PL41070B1 - - Google Patents
Download PDFInfo
- Publication number
- PL41070B1 PL41070B1 PL41070A PL4107056A PL41070B1 PL 41070 B1 PL41070 B1 PL 41070B1 PL 41070 A PL41070 A PL 41070A PL 4107056 A PL4107056 A PL 4107056A PL 41070 B1 PL41070 B1 PL 41070B1
- Authority
- PL
- Poland
- Prior art keywords
- halosilanes
- haloalkyl
- silicon
- alkenyl
- preparation
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 3
- 239000012433 hydrogen halide Substances 0.000 claims description 3
- -1 hydrogen halides Chemical class 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 2
- 238000003776 cleavage reaction Methods 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 230000007017 scission Effects 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims 3
- 239000011261 inert gas Substances 0.000 claims 1
- 210000004916 vomit Anatomy 0.000 claims 1
- 230000008673 vomiting Effects 0.000 claims 1
- GQIUQDDJKHLHTB-UHFFFAOYSA-N trichloro(ethenyl)silane Chemical compound Cl[Si](Cl)(Cl)C=C GQIUQDDJKHLHTB-UHFFFAOYSA-N 0.000 description 5
- 239000005050 vinyl trichlorosilane Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 239000010703 silicon Substances 0.000 description 4
- 238000000197 pyrolysis Methods 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229910000676 Si alloy Inorganic materials 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- UZBDLHYCYNXFRF-UHFFFAOYSA-N chloro(prop-1-enyl)silane Chemical compound C(=CC)[SiH2]Cl UZBDLHYCYNXFRF-UHFFFAOYSA-N 0.000 description 1
- RTCGUJFWSLMVSH-UHFFFAOYSA-N chloroform;silicon Chemical compound [Si].ClC(Cl)Cl RTCGUJFWSLMVSH-UHFFFAOYSA-N 0.000 description 1
- SLLGVCUQYRMELA-UHFFFAOYSA-N chlorosilicon Chemical compound Cl[Si] SLLGVCUQYRMELA-UHFFFAOYSA-N 0.000 description 1
- DBWSTBGNSJEPFT-UHFFFAOYSA-N dichloro-(2-chloroethyl)-methylsilane Chemical compound C[Si](Cl)(Cl)CCCl DBWSTBGNSJEPFT-UHFFFAOYSA-N 0.000 description 1
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical compound Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 1
- BUMGIEFFCMBQDG-UHFFFAOYSA-N dichlorosilicon Chemical compound Cl[Si]Cl BUMGIEFFCMBQDG-UHFFFAOYSA-N 0.000 description 1
- 210000001061 forehead Anatomy 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XWHPIFXRKKHEKR-UHFFFAOYSA-N iron silicon Chemical compound [Si].[Fe] XWHPIFXRKKHEKR-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- CAPIMQICDAJXSB-UHFFFAOYSA-N trichloro(1-chloroethyl)silane Chemical compound CC(Cl)[Si](Cl)(Cl)Cl CAPIMQICDAJXSB-UHFFFAOYSA-N 0.000 description 1
- FLPXNJHYVOVLSD-UHFFFAOYSA-N trichloro(2-chloroethyl)silane Chemical compound ClCC[Si](Cl)(Cl)Cl FLPXNJHYVOVLSD-UHFFFAOYSA-N 0.000 description 1
- 239000005052 trichlorosilane Substances 0.000 description 1
- PPDADIYYMSXQJK-UHFFFAOYSA-N trichlorosilicon Chemical compound Cl[Si](Cl)Cl PPDADIYYMSXQJK-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 210000001364 upper extremity Anatomy 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL41070B1 true PL41070B1 (OSRAM) | 1958-04-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH01163187A (ja) | 高沸点残渣中のポリシラン類の再分配法 | |
| US4297500A (en) | Conversion of low-boiling constituents from alkyl-chlorosilane synthesis | |
| US2647912A (en) | Production of dimethyl silicon dichloride | |
| US6344578B1 (en) | Process for working up residues from the direct synthesis of organochlorosilanes | |
| US3322511A (en) | Rearrangement of chlorosilanes | |
| US6013235A (en) | Conversion of direct process high-boiling residue to monosilanes | |
| US2888476A (en) | Preparation of long-chain alkylhalosilanes | |
| KR100253897B1 (ko) | 알킬클로로실란의 직접합성의 잔류물로부터 알킬클로로실란의제조방법 | |
| WO2011051133A1 (de) | Verfahren zur herstellung von organosilanen | |
| KR101435926B1 (ko) | 클로로실란의 하이드로젠 실란으로의 탈염소수소화를 위한 촉매 및 그 촉매를 사용한 하이드로젠실란의 제조 방법 | |
| US2553845A (en) | Preparation of alkoxysilanes | |
| PL41070B1 (OSRAM) | ||
| KR102807398B1 (ko) | 트리메틸클로로실란의 제조 방법 | |
| JPS54124898A (en) | Preparation of silicon nitride | |
| US2447873A (en) | Preparation of organohalogenosilanes | |
| JPS6337117B2 (OSRAM) | ||
| US2775606A (en) | Reaction of benzene and dichlorosilane trichlorosilane mix | |
| US4405590A (en) | Dismutation/redistribution of halogenosilanes into silane | |
| US3454616A (en) | Method for preparing monomethyldichlorosilane | |
| US3980686A (en) | Process for the preparation of chlorosilane | |
| US3704260A (en) | Purification of dimethylhydrogenchlorosilane | |
| GB2012787A (en) | Process for obtaining dimethyl hydrogen chlorosilane | |
| US3465019A (en) | Method for making organofunctional-alkylsiliconhydrides | |
| KR100469945B1 (ko) | 비닐클로로실란의제조방법 | |
| KR20150027905A (ko) | 메틸클로로실란의 직접합성법에서 부산물로 생성되는 고비점 잔류물의 연속적 재분배 방법 |