PL36566B1 - - Google Patents
Download PDFInfo
- Publication number
- PL36566B1 PL36566B1 PL36566A PL3656653A PL36566B1 PL 36566 B1 PL36566 B1 PL 36566B1 PL 36566 A PL36566 A PL 36566A PL 3656653 A PL3656653 A PL 3656653A PL 36566 B1 PL36566 B1 PL 36566B1
- Authority
- PL
- Poland
- Prior art keywords
- weight
- parts
- addition
- slime
- borax
- Prior art date
Links
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- 239000003973 paint Substances 0.000 claims description 6
- ODINCKMPIJJUCX-UHFFFAOYSA-N Calcium oxide Chemical compound [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 3
- 229940037003 alum Drugs 0.000 claims description 3
- 229910021529 ammonia Inorganic materials 0.000 claims description 3
- 229910021538 borax Inorganic materials 0.000 claims description 3
- 235000012255 calcium oxide Nutrition 0.000 claims description 3
- 239000000292 calcium oxide Substances 0.000 claims description 3
- 239000005018 casein Substances 0.000 claims description 3
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 claims description 3
- 235000021240 caseins Nutrition 0.000 claims description 3
- 238000000576 coating method Methods 0.000 claims description 3
- 239000004328 sodium tetraborate Substances 0.000 claims description 3
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002966 varnish Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 235000014692 zinc oxide Nutrition 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- -1 alum Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL36566B1 true PL36566B1 (cs) | 1953-10-31 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI881986A7 (fi) | Kuiva sementtikoostumus ja ferrosulfaatin käyttö kromaattia neutraloivana sementin lisäaineena | |
| PL36566B1 (cs) | ||
| RU2084481C1 (ru) | Состав для огнезащитного покрытия | |
| US2588438A (en) | Cement paint composition | |
| US1994438A (en) | Paint composition | |
| GB583388A (en) | Improvements in and relating to the treatment of chemical substances or compositionscontaining them to increase their water resistance | |
| GB357119A (en) | Improvements in or relating to water paints | |
| DE423637C (de) | Verfahren zur Herstellung eines wetterfesten UEberzuges fuer Gegenstaende aus Ton und aehnlichen Stoffen auf kaltem Wege | |
| GB191307907A (en) | Improved Composition for Flooring and like purposes. | |
| US1808865A (en) | Interior wall finish | |
| US1625815A (en) | Paint composition | |
| GB920446A (en) | Improvements in or relating to cementitious compositions | |
| DE382509C (de) | Verfahren zur Herstellung von Anstrichmassen und Farbanstrichen | |
| US18338A (en) | Improvement in bronzing-liquids | |
| SU421655A1 (ru) | Фибролитовая смесь | |
| US2663651A (en) | Method of concealing defects in a surface | |
| SU108881A1 (ru) | Способ изготовлени бактерицидных лакокрасочных материалов | |
| US1257488A (en) | Plastic composition for building purposes. | |
| DE846883C (de) | Verfahren zur Herstellung von Anstrichmassen, insbesondere fuer Flammschutz und Tarnung | |
| GB688198A (en) | Improvements in or relating to the treating and finishing of wood surfaces | |
| GB259636A (en) | Improvements in processes of mineralising fibrous materials, and in the making of blocks or the like therefrom | |
| SU771055A1 (ru) | Шпаклевка | |
| RU2311396C1 (ru) | Композиция для окраски силикатных изделий | |
| US409012A (en) | Ornamentation of walls | |
| US22878A (en) | Improvement in methods of varnishing and protecting surfaces |