PL174412B1 - Sposób zintegrowanego wytwarzania liniowych alkilobenzenów - Google Patents
Sposób zintegrowanego wytwarzania liniowych alkilobenzenówInfo
- Publication number
- PL174412B1 PL174412B1 PL93300466A PL30046693A PL174412B1 PL 174412 B1 PL174412 B1 PL 174412B1 PL 93300466 A PL93300466 A PL 93300466A PL 30046693 A PL30046693 A PL 30046693A PL 174412 B1 PL174412 B1 PL 174412B1
- Authority
- PL
- Poland
- Prior art keywords
- alkylation
- benzene
- reactor
- mixture
- paraffins
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 29
- 150000004996 alkyl benzenes Chemical class 0.000 title claims abstract description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims abstract description 84
- 239000000203 mixture Substances 0.000 claims abstract description 49
- 238000005804 alkylation reaction Methods 0.000 claims abstract description 47
- 230000029936 alkylation Effects 0.000 claims abstract description 37
- 239000003054 catalyst Substances 0.000 claims abstract description 30
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 23
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 22
- 150000001336 alkenes Chemical class 0.000 claims abstract description 21
- 238000006297 dehydration reaction Methods 0.000 claims abstract description 19
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 17
- 230000018044 dehydration Effects 0.000 claims abstract description 17
- 150000001993 dienes Chemical class 0.000 claims abstract description 13
- 230000003197 catalytic effect Effects 0.000 claims abstract description 11
- 238000005984 hydrogenation reaction Methods 0.000 claims abstract description 7
- 238000004519 manufacturing process Methods 0.000 claims abstract description 7
- 150000005673 monoalkenes Chemical class 0.000 claims abstract description 6
- 239000011541 reaction mixture Substances 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 3
- 150000001555 benzenes Chemical class 0.000 claims abstract 5
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 33
- -1 AlCl3 hydrocarbon Chemical class 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 3
- 239000000654 additive Substances 0.000 claims 1
- 230000000996 additive effect Effects 0.000 claims 1
- 230000036571 hydration Effects 0.000 claims 1
- 238000006703 hydration reaction Methods 0.000 claims 1
- 238000006356 dehydrogenation reaction Methods 0.000 abstract description 12
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical class CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 abstract 1
- 239000000047 product Substances 0.000 description 23
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 10
- 238000009835 boiling Methods 0.000 description 10
- 238000004821 distillation Methods 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 10
- 229910052739 hydrogen Inorganic materials 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000004817 gas chromatography Methods 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 238000000926 separation method Methods 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 238000005336 cracking Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000012188 paraffin wax Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000002468 indanes Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 229910000510 noble metal Inorganic materials 0.000 description 3
- 238000010555 transalkylation reaction Methods 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 150000001239 acenaphthenes Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 229910052716 thallium Inorganic materials 0.000 description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 2
- SXVRSCIZJBGJGB-UHFFFAOYSA-N 1-chloropropan-2-ylbenzene Chemical compound ClCC(C)C1=CC=CC=C1 SXVRSCIZJBGJGB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- SYKNUAWMBRIEKB-UHFFFAOYSA-N [Cl].[Br] Chemical compound [Cl].[Br] SYKNUAWMBRIEKB-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 238000006065 biodegradation reaction Methods 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003426 co-catalyst Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003203 everyday effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000010808 liquid waste Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 150000004045 organic chlorine compounds Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C15/00—Cyclic hydrocarbons containing only six-membered aromatic rings as cyclic parts
- C07C15/02—Monocyclic hydrocarbons
- C07C15/107—Monocyclic hydrocarbons having saturated side-chain containing at least six carbon atoms, e.g. detergent alkylates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/54—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition of unsaturated hydrocarbons to saturated hydrocarbons or to hydrocarbons containing a six-membered aromatic ring with no unsaturation outside the aromatic ring
- C07C2/64—Addition to a carbon atom of a six-membered aromatic ring
- C07C2/66—Catalytic processes
- C07C2/68—Catalytic processes with halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2527/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- C07C2527/06—Halogens; Compounds thereof
- C07C2527/125—Compounds comprising a halogen and scandium, yttrium, aluminium, gallium, indium or thallium
- C07C2527/126—Aluminium chloride
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Detergent Compositions (AREA)
- Crystals, And After-Treatments Of Crystals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ITMI922177A IT1255512B (it) | 1992-09-24 | 1992-09-24 | Processo migliorato per la produzione di alchilbenzeni lineari |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL300466A1 PL300466A1 (en) | 1994-04-18 |
| PL174412B1 true PL174412B1 (pl) | 1998-07-31 |
Family
ID=11363982
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL93300466A PL174412B1 (pl) | 1992-09-24 | 1993-09-23 | Sposób zintegrowanego wytwarzania liniowych alkilobenzenów |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US5574198A (Direct) |
| EP (1) | EP0589511B1 (Direct) |
| AT (1) | ATE160560T1 (Direct) |
| BG (1) | BG61806B1 (Direct) |
| CA (1) | CA2106621C (Direct) |
| DE (1) | DE69315403T2 (Direct) |
| DK (1) | DK0589511T3 (Direct) |
| ES (1) | ES2109424T3 (Direct) |
| GR (1) | GR3025535T3 (Direct) |
| IT (1) | IT1255512B (Direct) |
| PL (1) | PL174412B1 (Direct) |
| RO (2) | RO111360B1 (Direct) |
| YU (1) | YU48598B (Direct) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6995127B1 (en) | 1996-02-08 | 2006-02-07 | Huntsman Petrochemical Corporation | Alkyl toluene sulfonate detergent |
| US6133492A (en) * | 1996-02-08 | 2000-10-17 | Huntsman Petrochemical Corporation | Alkylation of benzene to form linear alkylbenzenes using fluorine-containing mordenites |
| US6562776B1 (en) | 1996-02-08 | 2003-05-13 | Huntsman Petrochemical Corporation | Solid alkylbenzene sulfonates and cleaning compositions having enhanced water hardness tolerance |
| US6849588B2 (en) * | 1996-02-08 | 2005-02-01 | Huntsman Petrochemical Corporation | Structured liquids made using LAB sulfonates of varied 2-isomer content |
| US6166281A (en) * | 1996-02-08 | 2000-12-26 | Huntsman Petrochemical Corporation | Alkylation of benzene to form linear alkylbenzenes using fluorine-containing mordenites |
| US6630430B1 (en) | 1996-02-08 | 2003-10-07 | Huntsman Petrochemical Corporation | Fuel and oil detergents |
| CN100475785C (zh) * | 1997-08-08 | 2009-04-08 | 宝洁公司 | 经吸附分离用于制备表面活性剂的改进方法及其产物 |
| IT1295934B1 (it) * | 1997-10-30 | 1999-05-28 | Condea Augusta Spa | Procedimento migliorato per la sintesi di alchilpoliglucosidi |
| ITMI981631A1 (it) * | 1998-07-16 | 2000-01-16 | Condea Augusta Spa | Procedimento per la produzione di idrocarburi alchilaromatici lineari |
| ES2181533B1 (es) * | 2000-05-29 | 2004-06-16 | Uop Llc | Procedimiento para fabricar compuestos alquilaromaticos usando un catalizador de alquilacion solido. |
| US7692055B2 (en) * | 2007-02-12 | 2010-04-06 | Uop Llc | Transalkylation of dialkylbenzene |
| US7642389B2 (en) * | 2007-02-12 | 2010-01-05 | Uop Llc | Energy integrated processes including alkylation and transalkylation for making detergent range alkylbenzenes |
| US7576247B2 (en) * | 2007-02-12 | 2009-08-18 | Uop Llc | Processes for making detergent range alkylbenzenes |
| US7652182B2 (en) * | 2007-02-12 | 2010-01-26 | Uop Llc | Energy integrated processes including alkylation and transalkylation for making detergent range alkylbenzenes |
| US9192916B2 (en) * | 2009-09-21 | 2015-11-24 | Uop Llc | Selective hydrogenation of dienes in the manufacture of MLAB |
| US20110071020A1 (en) * | 2009-09-21 | 2011-03-24 | Uop Llc | Selective Hydrogenation of Dienes in the Manufacture of MLAB |
| CA2909562C (en) | 2013-04-19 | 2019-07-30 | Reliance Industries Limited | Ionic liquid compound for catalysis of chemical reactions |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3875253A (en) * | 1969-09-23 | 1975-04-01 | Shuan K Huang | Dehydrogenating normal paraffins |
| US4520214A (en) * | 1984-04-04 | 1985-05-28 | Uop Inc. | High selectivity process for dehydrogenation of paraffinic hydrocarbons |
-
1992
- 1992-09-24 IT ITMI922177A patent/IT1255512B/it active IP Right Grant
-
1993
- 1993-02-02 RO RO93-00109A patent/RO111360B1/ro unknown
- 1993-09-15 ES ES93202662T patent/ES2109424T3/es not_active Expired - Lifetime
- 1993-09-15 DK DK93202662.8T patent/DK0589511T3/da active
- 1993-09-15 EP EP93202662A patent/EP0589511B1/en not_active Expired - Lifetime
- 1993-09-15 AT AT93202662T patent/ATE160560T1/de not_active IP Right Cessation
- 1993-09-15 DE DE69315403T patent/DE69315403T2/de not_active Expired - Fee Related
- 1993-09-21 CA CA002106621A patent/CA2106621C/en not_active Expired - Fee Related
- 1993-09-22 YU YU60693A patent/YU48598B/sh unknown
- 1993-09-23 BG BG98121A patent/BG61806B1/bg unknown
- 1993-09-23 PL PL93300466A patent/PL174412B1/pl not_active IP Right Cessation
- 1993-09-24 RO RO93-01270A patent/RO111455B1/ro unknown
-
1995
- 1995-04-10 US US08/419,959 patent/US5574198A/en not_active Expired - Lifetime
-
1997
- 1997-11-28 GR GR970403184T patent/GR3025535T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU60693A (sh) | 1996-02-19 |
| IT1255512B (it) | 1995-11-09 |
| EP0589511B1 (en) | 1997-11-26 |
| PL300466A1 (en) | 1994-04-18 |
| ITMI922177A0 (it) | 1992-09-24 |
| ATE160560T1 (de) | 1997-12-15 |
| BG61806B1 (bg) | 1998-06-30 |
| BG98121A (bg) | 1994-12-02 |
| CA2106621A1 (en) | 1994-03-25 |
| DE69315403T2 (de) | 1998-04-09 |
| RO111455B1 (ro) | 1996-10-31 |
| GR3025535T3 (Direct) | 1998-02-27 |
| RO111360B1 (ro) | 1996-09-30 |
| US5574198A (en) | 1996-11-12 |
| YU48598B (sh) | 1998-12-23 |
| CA2106621C (en) | 2004-02-17 |
| EP0589511A1 (en) | 1994-03-30 |
| ES2109424T3 (es) | 1998-01-16 |
| DE69315403D1 (de) | 1998-01-08 |
| DK0589511T3 (da) | 1998-05-04 |
| ITMI922177A1 (it) | 1994-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL174412B1 (pl) | Sposób zintegrowanego wytwarzania liniowych alkilobenzenów | |
| US4783567A (en) | HF alkylation process | |
| RU2169134C2 (ru) | Способ получения линейных алкилбензолов | |
| US3681442A (en) | Alkylaromatic sulfonate detergent process of preparation | |
| EP0046678B2 (en) | Process for continuous production of cumene and/or diisopropylbenzene | |
| US3341614A (en) | Production of detergent alkylate | |
| EP0160145A2 (en) | Alkylation of aromatic molecules using wide pore, amorphous silica-alumina catalyst | |
| US3910994A (en) | Alkylaromatic sulfonate detergent process | |
| US5386072A (en) | Process for the preparation of linear alkylbenzenes | |
| KR0146023B1 (ko) | 에틸벤젠의 제조방법 | |
| US4691068A (en) | Process for production of alkyl aromatics | |
| US20040030211A1 (en) | Maximizing meta-isomers in the production of dialkylbenzene compounds | |
| US4431854A (en) | Continuous preparation of ethylbenzene in a heterogeneous-phase reaction | |
| EP0729446B1 (en) | Production of para-xylene by selective methylation of toluene with methyl halides | |
| KR100284466B1 (ko) | 선형 파라핀 탈수소화 공정으로부터 유도된 선형 올레핀을 사용한 방향족의 개선된 알킬화 방법 | |
| US5079386A (en) | Process for the preparation of alkyl substituted tetralins and indanes | |
| KR100290720B1 (ko) | 1,1-다이아릴에탄의 제조방법 | |
| US3184517A (en) | Alkylation process for preparing propylbenzenes | |
| JP2526637B2 (ja) | p−体を高含量とするジアルキルベンゼンの製造法 | |
| US4520218A (en) | Production of dialkylated aromatics | |
| US5689030A (en) | Method for prolonging the life of alkylation product stream defluorinator beds | |
| KR960002589B1 (ko) | m-에틸디페닐류의 제조방법 | |
| US5171917A (en) | Selective production of a p-alkylethylbenzene or 4,4'-alkylethylbiphenyl | |
| JP2883893B2 (ja) | アラルキルベンゼン類の製造方法 | |
| KR890003780B1 (ko) | 파라핀성 탄화수소의 탈수소화 공정 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Decisions on the lapse of the protection rights |
Effective date: 20090923 |