PL110765B1 - Method of producing derivatives of p-nitroso-diphenylhydroxylamine - Google Patents
Method of producing derivatives of p-nitroso-diphenylhydroxylamine Download PDFInfo
- Publication number
- PL110765B1 PL110765B1 PL1978204212A PL20421278A PL110765B1 PL 110765 B1 PL110765 B1 PL 110765B1 PL 1978204212 A PL1978204212 A PL 1978204212A PL 20421278 A PL20421278 A PL 20421278A PL 110765 B1 PL110765 B1 PL 110765B1
- Authority
- PL
- Poland
- Prior art keywords
- nitrosobenzene
- acid
- nitroso
- diphenylhydroxylamine
- reaction
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 93
- NLRKCXQQSUWLCH-UHFFFAOYSA-N nitrosobenzene Chemical compound O=NC1=CC=CC=C1 NLRKCXQQSUWLCH-UHFFFAOYSA-N 0.000 claims description 47
- 238000006243 chemical reaction Methods 0.000 claims description 44
- 239000002253 acid Substances 0.000 claims description 40
- 239000003054 catalyst Substances 0.000 claims description 31
- 150000002832 nitroso derivatives Chemical class 0.000 claims description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 24
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 18
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 16
- 239000003960 organic solvent Substances 0.000 claims description 9
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 8
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- TWLBRQVYXPMCFK-UHFFFAOYSA-N 1-methyl-2-nitrosobenzene Chemical compound CC1=CC=CC=C1N=O TWLBRQVYXPMCFK-UHFFFAOYSA-N 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 238000009833 condensation Methods 0.000 claims description 6
- 230000005494 condensation Effects 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- -1 alkyl radical Chemical class 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- ICYPOGVRNGUWNP-UHFFFAOYSA-N 1,3-dichloro-2-nitrosobenzene Chemical compound ClC1=CC=CC(Cl)=C1N=O ICYPOGVRNGUWNP-UHFFFAOYSA-N 0.000 claims description 4
- AYGXDXVGROLVJK-UHFFFAOYSA-N 1-chloro-2-nitrosobenzene Chemical compound ClC1=CC=CC=C1N=O AYGXDXVGROLVJK-UHFFFAOYSA-N 0.000 claims description 4
- RBKIPVPBQBMGNJ-UHFFFAOYSA-N 1-methoxy-2-nitrosobenzene Chemical compound COC1=CC=CC=C1N=O RBKIPVPBQBMGNJ-UHFFFAOYSA-N 0.000 claims description 4
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- HDLCHVIFMRMBJP-UHFFFAOYSA-N 1,4-dichloro-2-nitrosobenzene Chemical compound ClC1=CC=C(Cl)C(N=O)=C1 HDLCHVIFMRMBJP-UHFFFAOYSA-N 0.000 claims description 3
- DEQKNNCVTAXLKX-UHFFFAOYSA-N 1-nitro-3-nitrosobenzene Chemical compound [O-][N+](=O)C1=CC=CC(N=O)=C1 DEQKNNCVTAXLKX-UHFFFAOYSA-N 0.000 claims description 3
- QMYICKNKPIKZIK-UHFFFAOYSA-N 1-nitroso-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(N=O)=C1 QMYICKNKPIKZIK-UHFFFAOYSA-N 0.000 claims description 3
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims description 2
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical compound FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 claims description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 50
- 239000000243 solution Substances 0.000 description 31
- 238000003756 stirring Methods 0.000 description 27
- 229940098779 methanesulfonic acid Drugs 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 14
- 239000000843 powder Substances 0.000 description 13
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 238000001035 drying Methods 0.000 description 10
- 239000005457 ice water Substances 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- 230000007935 neutral effect Effects 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 7
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 7
- 230000008707 rearrangement Effects 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 238000000605 extraction Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 235000002639 sodium chloride Nutrition 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- 238000006471 dimerization reaction Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 150000003460 sulfonic acids Chemical class 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 4
- 229940092714 benzenesulfonic acid Drugs 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 230000000447 dimerizing effect Effects 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000004448 titration Methods 0.000 description 3
- JAMGZOIOVGVZOI-UHFFFAOYSA-N (n-phenylanilino) nitrite Chemical class C=1C=CC=CC=1N(ON=O)C1=CC=CC=C1 JAMGZOIOVGVZOI-UHFFFAOYSA-N 0.000 description 2
- NSGVPXKWKUZSAY-UHFFFAOYSA-N 1-nitro-2-nitrosobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1N=O NSGVPXKWKUZSAY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- ZHGASCUQXLPSDT-UHFFFAOYSA-N cyclohexanesulfonic acid Chemical compound OS(=O)(=O)C1CCCCC1 ZHGASCUQXLPSDT-UHFFFAOYSA-N 0.000 description 2
- 239000000539 dimer Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- IBSXAAOLHMGYLZ-UHFFFAOYSA-N methyl 2-nitrosobenzoate Chemical compound COC(=O)C1=CC=CC=C1N=O IBSXAAOLHMGYLZ-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- NLRKCXQQSUWLCH-IDEBNGHGSA-N nitrosobenzene Chemical class O=N[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 NLRKCXQQSUWLCH-IDEBNGHGSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 2
- ORZMSMCZBZARKY-UHFFFAOYSA-N 1,3,2$l^{6}-benzodioxathiole 2,2-dioxide Chemical compound C1=CC=C2OS(=O)(=O)OC2=C1 ORZMSMCZBZARKY-UHFFFAOYSA-N 0.000 description 1
- ZNTJGNOQDHOIIX-UHFFFAOYSA-N 1-chloro-3-nitrosobenzene Chemical compound ClC1=CC=CC(N=O)=C1 ZNTJGNOQDHOIIX-UHFFFAOYSA-N 0.000 description 1
- UYTJAHDDQVFRBS-UHFFFAOYSA-N 1-fluoro-2-nitrosobenzene Chemical compound FC1=CC=CC=C1N=O UYTJAHDDQVFRBS-UHFFFAOYSA-N 0.000 description 1
- NYJYFSGMYHSTNZ-UHFFFAOYSA-N 1-methyl-4-nitrosobenzene Chemical compound CC1=CC=C(N=O)C=C1 NYJYFSGMYHSTNZ-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- BZOVBIIWPDQIHF-UHFFFAOYSA-N 3-hydroxy-2-methylbenzenesulfonic acid Chemical compound CC1=C(O)C=CC=C1S(O)(=O)=O BZOVBIIWPDQIHF-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- YOBAEOGBNPPUQV-UHFFFAOYSA-N iron;trihydrate Chemical compound O.O.O.[Fe].[Fe] YOBAEOGBNPPUQV-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- BBLDUGKYPWLKPO-UHFFFAOYSA-N methanesulfonic acid;(n-phenylanilino) nitrite Chemical compound CS(O)(=O)=O.C=1C=CC=CC=1N(ON=O)C1=CC=CC=C1 BBLDUGKYPWLKPO-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- FMMQDMHSGNXJSQ-UHFFFAOYSA-N n,n-diphenylhydroxylamine Chemical compound C=1C=CC=CC=1N(O)C1=CC=CC=C1 FMMQDMHSGNXJSQ-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- VLZLOWPYUQHHCG-UHFFFAOYSA-N nitromethylbenzene Chemical compound [O-][N+](=O)CC1=CC=CC=C1 VLZLOWPYUQHHCG-UHFFFAOYSA-N 0.000 description 1
- 150000002897 organic nitrogen compounds Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- LPXPTNMVRIOKMN-UHFFFAOYSA-N sodium;nitrous acid Chemical compound [Na+].ON=O LPXPTNMVRIOKMN-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000001131 transforming effect Effects 0.000 description 1
- 231100000925 very toxic Toxicity 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/46—Oxygen atoms attached in position 4 having a hydrogen atom as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2703919A DE2703919C2 (de) | 1977-01-31 | 1977-01-31 | Verfahren zur Herstellung von p-Nitroso-diphenylhydroxylaminen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL204212A1 PL204212A1 (pl) | 1979-04-09 |
| PL110765B1 true PL110765B1 (en) | 1980-07-31 |
Family
ID=5999983
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1978204212A PL110765B1 (en) | 1977-01-31 | 1978-01-25 | Method of producing derivatives of p-nitroso-diphenylhydroxylamine |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4129740A (OSRAM) |
| JP (1) | JPS5395927A (OSRAM) |
| BE (1) | BE863286A (OSRAM) |
| BR (1) | BR7800548A (OSRAM) |
| CA (1) | CA1106854A (OSRAM) |
| CH (1) | CH632231A5 (OSRAM) |
| CS (1) | CS204017B2 (OSRAM) |
| DD (1) | DD134517A5 (OSRAM) |
| DE (1) | DE2703919C2 (OSRAM) |
| ES (1) | ES465875A1 (OSRAM) |
| FR (1) | FR2378745B1 (OSRAM) |
| GB (1) | GB1560719A (OSRAM) |
| HU (1) | HU179106B (OSRAM) |
| IT (1) | IT1102812B (OSRAM) |
| NL (1) | NL7800276A (OSRAM) |
| PL (1) | PL110765B1 (OSRAM) |
| RO (1) | RO74630A (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2961447D1 (en) * | 1978-08-18 | 1982-01-28 | Akzo Nv | Process for the preparation of p-nitroso-diphenylhydroxylamines |
| JPH05321449A (ja) * | 1992-05-18 | 1993-12-07 | Kokuyo Co Ltd | 床部材 |
| DE19922405A1 (de) * | 1999-05-14 | 2000-11-16 | Bayer Ag | Verfahren zur Herstellung von (4-Nitrosophenyl)phenylhydroxylamin |
| DE10055221A1 (de) | 2000-11-08 | 2002-05-29 | Bayer Ag | Verfahren zur Herstellung von 4-Aminodiphenylamin |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1147237B (de) * | 1961-04-06 | 1963-04-18 | Bayer Ag | Verfahren zur Herstellung von N-Phenyl-N-(4-nitrosophenyl)-hydroxylamin |
| GB1257984A (OSRAM) * | 1969-04-24 | 1971-12-22 | ||
| US3933848A (en) * | 1971-07-28 | 1976-01-20 | Standard Oil Company | Process for the preparation of phenylamines and carbazoles |
-
1977
- 1977-01-31 DE DE2703919A patent/DE2703919C2/de not_active Expired
-
1978
- 1978-01-09 CS CS78167A patent/CS204017B2/cs unknown
- 1978-01-10 FR FR7800565A patent/FR2378745B1/fr not_active Expired
- 1978-01-10 NL NL7800276A patent/NL7800276A/xx not_active Application Discontinuation
- 1978-01-11 ES ES465875A patent/ES465875A1/es not_active Expired
- 1978-01-20 CH CH59778A patent/CH632231A5/de not_active IP Right Cessation
- 1978-01-23 IT IT47741/78A patent/IT1102812B/it active
- 1978-01-25 BE BE184609A patent/BE863286A/xx not_active IP Right Cessation
- 1978-01-25 PL PL1978204212A patent/PL110765B1/pl unknown
- 1978-01-27 DD DD78203454A patent/DD134517A5/xx unknown
- 1978-01-30 BR BR7800548A patent/BR7800548A/pt unknown
- 1978-01-30 HU HU78AO459A patent/HU179106B/hu unknown
- 1978-01-30 RO RO7893049A patent/RO74630A/ro unknown
- 1978-01-30 US US05/873,327 patent/US4129740A/en not_active Expired - Lifetime
- 1978-01-30 CA CA295,886A patent/CA1106854A/en not_active Expired
- 1978-01-31 JP JP980878A patent/JPS5395927A/ja active Granted
- 1978-01-31 GB GB3810/78A patent/GB1560719A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH632231A5 (de) | 1982-09-30 |
| US4129740A (en) | 1978-12-12 |
| JPS6238346B2 (OSRAM) | 1987-08-17 |
| DE2703919B1 (de) | 1978-07-27 |
| CS204017B2 (en) | 1981-03-31 |
| FR2378745A1 (fr) | 1978-08-25 |
| PL204212A1 (pl) | 1979-04-09 |
| CA1106854A (en) | 1981-08-11 |
| JPS5395927A (en) | 1978-08-22 |
| ES465875A1 (es) | 1978-09-16 |
| NL7800276A (nl) | 1978-08-02 |
| RO74630A (ro) | 1980-11-30 |
| BE863286A (fr) | 1978-05-16 |
| IT7847741A0 (it) | 1978-01-23 |
| HU179106B (en) | 1982-08-28 |
| GB1560719A (en) | 1980-02-06 |
| DE2703919C2 (de) | 1979-03-29 |
| DD134517A5 (de) | 1979-03-07 |
| FR2378745B1 (fr) | 1985-06-21 |
| IT1102812B (it) | 1985-10-07 |
| BR7800548A (pt) | 1978-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| LECHER et al. | Some new methods for preparing Bunte salts | |
| PL110765B1 (en) | Method of producing derivatives of p-nitroso-diphenylhydroxylamine | |
| US4467123A (en) | Process for the preparation of alkali metal diphenylates and free hydroxydiphenyls | |
| Johnson et al. | Researches on amines. IV. 1 the alkylation and hydrolysis of aliphatic sulfonamides. A new synthesis of sarcosine. 2 | |
| US4427600A (en) | Preparation of 1-alkyl-2-chloro-5-nitrobenzene-4-sulfonic acids | |
| US2064395A (en) | Organic disulphides | |
| EP1044964A2 (en) | Method for producing 1,2-naphthoquinone-2-diazide-4-sulphonyl chloride | |
| EP0009267B1 (en) | Process for the preparation of p-nitroso-diphenylhydroxylamines | |
| US2202212A (en) | Preparation of guanyl-urea-nu-sulphonic acid | |
| JPWO1992006935A1 (ja) | スルホン化剤及びスルホン化法 | |
| DE3305654C2 (OSRAM) | ||
| US1882335A (en) | Method of separating halo-benzoic acids | |
| US2969392A (en) | Amidomethylation of aromatic hydrocarbons | |
| CN1089756C (zh) | 吡啶-2,6-二胺的硝化 | |
| JPH09124530A (ja) | 9,9−ビス(ヒドロキシアリール)フルオレンの製造方法 | |
| EP0181743B1 (en) | Polymerization initiator | |
| EP0151835B1 (en) | Process for producing pentachloronitrobenzene from hexachlorobenzene | |
| Hilditch | CXLVIII.—Aromatic α-disulphones | |
| US2311282A (en) | Nitrated bornyl phenols and the method of preparing the same | |
| EP0218005B1 (de) | Eintopfverfahren zur Herstellung von 2-Acetaminonaphthalin-6-sulfonsäure hoher Reinheit | |
| US4150055A (en) | Reduction and desulfonation of 2,4- and 2,6- dinitrobenzenesulfonates, which may contain a methyl group in the 5-position, to primary amino compounds | |
| JPH0588700B2 (OSRAM) | ||
| PL126634B1 (en) | Method for producing para-substituted derivatives of n,n'-diphenylurea | |
| JPS6226265A (ja) | 3,3′−ジアミノジフエニルスルホンの製造法 | |
| PL146896B1 (en) | Method of obtaining surface-active perfluoroalkylbenzene sulfonates |