OA13350A - Elemental sulfur as an oral or parentral medical product. - Google Patents
Elemental sulfur as an oral or parentral medical product. Download PDFInfo
- Publication number
- OA13350A OA13350A OA1200600213A OA1200600213A OA13350A OA 13350 A OA13350 A OA 13350A OA 1200600213 A OA1200600213 A OA 1200600213A OA 1200600213 A OA1200600213 A OA 1200600213A OA 13350 A OA13350 A OA 13350A
- Authority
- OA
- OAPI
- Prior art keywords
- ail
- éléments
- formula
- salts
- compounds
- Prior art date
Links
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 title description 28
- 229940127554 medical product Drugs 0.000 title description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 29
- 239000002253 acid Substances 0.000 claims abstract description 23
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 20
- 239000003814 drug Substances 0.000 claims abstract description 19
- 239000000203 mixture Substances 0.000 claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 15
- 201000010099 disease Diseases 0.000 claims abstract description 5
- -1 polyethylene Polymers 0.000 claims description 47
- 239000000463 material Substances 0.000 claims description 29
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 17
- 229940127557 pharmaceutical product Drugs 0.000 claims description 17
- 239000002585 base Substances 0.000 claims description 14
- 239000004033 plastic Substances 0.000 claims description 14
- 229920003023 plastic Polymers 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 13
- 230000000737 periodic effect Effects 0.000 claims description 12
- 239000000843 powder Substances 0.000 claims description 11
- 210000000988 bone and bone Anatomy 0.000 claims description 10
- 239000003086 colorant Substances 0.000 claims description 10
- 239000000314 lubricant Substances 0.000 claims description 10
- 150000002894 organic compounds Chemical class 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 230000007547 defect Effects 0.000 claims description 9
- 239000007943 implant Substances 0.000 claims description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 238000013270 controlled release Methods 0.000 claims description 8
- 239000000499 gel Substances 0.000 claims description 8
- 239000008187 granular material Substances 0.000 claims description 8
- 239000008172 hydrogenated vegetable oil Substances 0.000 claims description 8
- 241000894007 species Species 0.000 claims description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 7
- 210000000481 breast Anatomy 0.000 claims description 7
- 239000002775 capsule Substances 0.000 claims description 7
- 150000002484 inorganic compounds Chemical class 0.000 claims description 7
- 229910010272 inorganic material Inorganic materials 0.000 claims description 7
- 235000013336 milk Nutrition 0.000 claims description 7
- 239000008267 milk Substances 0.000 claims description 7
- 210000004080 milk Anatomy 0.000 claims description 7
- 239000003826 tablet Substances 0.000 claims description 7
- 230000007704 transition Effects 0.000 claims description 7
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 239000004067 bulking agent Substances 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 150000002739 metals Chemical class 0.000 claims description 6
- 239000003921 oil Substances 0.000 claims description 6
- 235000019198 oils Nutrition 0.000 claims description 6
- 229920001223 polyethylene glycol Polymers 0.000 claims description 6
- 108090000623 proteins and genes Proteins 0.000 claims description 6
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 5
- 229910052768 actinide Inorganic materials 0.000 claims description 5
- 150000001255 actinides Chemical class 0.000 claims description 5
- 150000001323 aldoses Chemical class 0.000 claims description 5
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 5
- 238000000576 coating method Methods 0.000 claims description 5
- 229940079593 drug Drugs 0.000 claims description 5
- 230000002500 effect on skin Effects 0.000 claims description 5
- 230000002496 gastric effect Effects 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 235000012907 honey Nutrition 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 5
- 229910052747 lanthanoid Inorganic materials 0.000 claims description 5
- 150000002602 lanthanoids Chemical class 0.000 claims description 5
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical class [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 claims description 5
- 239000000243 solution Substances 0.000 claims description 5
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 4
- 244000303040 Glycyrrhiza glabra Species 0.000 claims description 4
- 235000006200 Glycyrrhiza glabra Nutrition 0.000 claims description 4
- 240000009023 Myrrhis odorata Species 0.000 claims description 4
- 235000007265 Myrrhis odorata Nutrition 0.000 claims description 4
- 235000012550 Pimpinella anisum Nutrition 0.000 claims description 4
- 229920002125 Sokalan® Polymers 0.000 claims description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims description 4
- 229930006000 Sucrose Natural products 0.000 claims description 4
- GJEAMHAFPYZYDE-UHFFFAOYSA-N [C].[S] Chemical class [C].[S] GJEAMHAFPYZYDE-UHFFFAOYSA-N 0.000 claims description 4
- 150000001298 alcohols Chemical class 0.000 claims description 4
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 claims description 4
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 claims description 4
- 235000013361 beverage Nutrition 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000011248 coating agent Substances 0.000 claims description 4
- 239000000084 colloidal system Substances 0.000 claims description 4
- 235000009508 confectionery Nutrition 0.000 claims description 4
- 239000006071 cream Substances 0.000 claims description 4
- 239000002552 dosage form Substances 0.000 claims description 4
- 235000013399 edible fruits Nutrition 0.000 claims description 4
- 239000000284 extract Substances 0.000 claims description 4
- 239000003889 eye drop Substances 0.000 claims description 4
- 229940012356 eye drops Drugs 0.000 claims description 4
- 238000009501 film coating Methods 0.000 claims description 4
- 239000000796 flavoring agent Substances 0.000 claims description 4
- 239000006260 foam Substances 0.000 claims description 4
- LPLVUJXQOOQHMX-QWBHMCJMSA-N glycyrrhizinic acid Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@H](O[C@@H]1O[C@@H]1C([C@H]2[C@]([C@@H]3[C@@]([C@@]4(CC[C@@]5(C)CC[C@@](C)(C[C@H]5C4=CC3=O)C(O)=O)C)(C)CC2)(C)CC1)(C)C)C(O)=O)[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O LPLVUJXQOOQHMX-QWBHMCJMSA-N 0.000 claims description 4
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 claims description 4
- 229910021432 inorganic complex Inorganic materials 0.000 claims description 4
- 235000011477 liquorice Nutrition 0.000 claims description 4
- 239000006210 lotion Substances 0.000 claims description 4
- 239000011159 matrix material Substances 0.000 claims description 4
- 239000003607 modifier Substances 0.000 claims description 4
- 239000002674 ointment Substances 0.000 claims description 4
- 229920000136 polysorbate Polymers 0.000 claims description 4
- 229940068965 polysorbates Drugs 0.000 claims description 4
- 102000004169 proteins and genes Human genes 0.000 claims description 4
- 239000000377 silicon dioxide Substances 0.000 claims description 4
- 229960001866 silicon dioxide Drugs 0.000 claims description 4
- 235000012239 silicon dioxide Nutrition 0.000 claims description 4
- 235000015096 spirit Nutrition 0.000 claims description 4
- 239000005720 sucrose Substances 0.000 claims description 4
- 238000009495 sugar coating Methods 0.000 claims description 4
- 239000004094 surface-active agent Substances 0.000 claims description 4
- 210000002700 urine Anatomy 0.000 claims description 4
- 235000013311 vegetables Nutrition 0.000 claims description 4
- 239000000230 xanthan gum Substances 0.000 claims description 4
- 229920001285 xanthan gum Polymers 0.000 claims description 4
- 235000010493 xanthan gum Nutrition 0.000 claims description 4
- 229940082509 xanthan gum Drugs 0.000 claims description 4
- RLLPVAHGXHCWKJ-IEBWSBKVSA-N (3-phenoxyphenyl)methyl (1s,3s)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(Cl)Cl)[C@@H]1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-IEBWSBKVSA-N 0.000 claims description 3
- 206010003178 Arterial thrombosis Diseases 0.000 claims description 3
- 206010019909 Hernia Diseases 0.000 claims description 3
- 206010021639 Incontinence Diseases 0.000 claims description 3
- VKCLPVFDVVKEKU-UHFFFAOYSA-N S=[P] Chemical class S=[P] VKCLPVFDVVKEKU-UHFFFAOYSA-N 0.000 claims description 3
- 206010046996 Varicose vein Diseases 0.000 claims description 3
- 239000008280 blood Substances 0.000 claims description 3
- 210000004369 blood Anatomy 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 210000000038 chest Anatomy 0.000 claims description 3
- 230000000916 dilatatory effect Effects 0.000 claims description 3
- 238000001839 endoscopy Methods 0.000 claims description 3
- 238000013265 extended release Methods 0.000 claims description 3
- 239000007888 film coating Substances 0.000 claims description 3
- 210000003709 heart valve Anatomy 0.000 claims description 3
- 230000002440 hepatic effect Effects 0.000 claims description 3
- 150000002632 lipids Chemical class 0.000 claims description 3
- 210000005036 nerve Anatomy 0.000 claims description 3
- 210000000056 organ Anatomy 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- 210000004872 soft tissue Anatomy 0.000 claims description 3
- 125000006850 spacer group Chemical group 0.000 claims description 3
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical class ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- 239000003356 suture material Substances 0.000 claims description 3
- 238000012360 testing method Methods 0.000 claims description 3
- 230000000472 traumatic effect Effects 0.000 claims description 3
- 230000002620 ureteric effect Effects 0.000 claims description 3
- 208000027185 varicose disease Diseases 0.000 claims description 3
- 230000002792 vascular Effects 0.000 claims description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 2
- MIDXCONKKJTLDX-UHFFFAOYSA-N 3,5-dimethylcyclopentane-1,2-dione Chemical compound CC1CC(C)C(=O)C1=O MIDXCONKKJTLDX-UHFFFAOYSA-N 0.000 claims description 2
- HZWWPUTXBJEENE-UHFFFAOYSA-N 5-amino-2-[[1-[5-amino-2-[[1-[2-amino-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid Chemical compound C1CCC(C(=O)NC(CCC(N)=O)C(=O)N2C(CCC2)C(=O)NC(CCC(N)=O)C(O)=O)N1C(=O)C(N)CC1=CC=C(O)C=C1 HZWWPUTXBJEENE-UHFFFAOYSA-N 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical group OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- 244000144730 Amygdalus persica Species 0.000 claims description 2
- 235000021537 Beetroot Nutrition 0.000 claims description 2
- 239000004322 Butylated hydroxytoluene Substances 0.000 claims description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 claims description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000001856 Ethyl cellulose Substances 0.000 claims description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims description 2
- 239000001293 FEMA 3089 Substances 0.000 claims description 2
- 108010061711 Gliadin Proteins 0.000 claims description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 2
- 206010053317 Hydrophobia Diseases 0.000 claims description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 2
- 229920000161 Locust bean gum Polymers 0.000 claims description 2
- 235000006679 Mentha X verticillata Nutrition 0.000 claims description 2
- 244000246386 Mentha pulegium Species 0.000 claims description 2
- 235000016257 Mentha pulegium Nutrition 0.000 claims description 2
- 235000002899 Mentha suaveolens Nutrition 0.000 claims description 2
- 235000004357 Mentha x piperita Nutrition 0.000 claims description 2
- 235000001636 Mentha x rotundifolia Nutrition 0.000 claims description 2
- 244000288157 Passiflora edulis Species 0.000 claims description 2
- 235000000370 Passiflora edulis Nutrition 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 239000004698 Polyethylene Substances 0.000 claims description 2
- 244000018633 Prunus armeniaca Species 0.000 claims description 2
- 235000009827 Prunus armeniaca Nutrition 0.000 claims description 2
- 235000010401 Prunus avium Nutrition 0.000 claims description 2
- 235000006040 Prunus persica var persica Nutrition 0.000 claims description 2
- 240000008296 Prunus serotina Species 0.000 claims description 2
- 235000014441 Prunus serotina Nutrition 0.000 claims description 2
- 244000235659 Rubus idaeus Species 0.000 claims description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims description 2
- 235000021355 Stearic acid Nutrition 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 2
- 235000009499 Vanilla fragrans Nutrition 0.000 claims description 2
- 244000263375 Vanilla tahitensis Species 0.000 claims description 2
- 235000012036 Vanilla tahitensis Nutrition 0.000 claims description 2
- 206010047249 Venous thrombosis Diseases 0.000 claims description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N acrylic acid methyl ester Natural products COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 230000001476 alcoholic effect Effects 0.000 claims description 2
- 235000010443 alginic acid Nutrition 0.000 claims description 2
- 229920000615 alginic acid Polymers 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- 239000010775 animal oil Substances 0.000 claims description 2
- 239000003945 anionic surfactant Substances 0.000 claims description 2
- 235000010208 anthocyanin Nutrition 0.000 claims description 2
- 230000000181 anti-adherent effect Effects 0.000 claims description 2
- 239000003911 antiadherent Substances 0.000 claims description 2
- 239000003963 antioxidant agent Substances 0.000 claims description 2
- 235000006708 antioxidants Nutrition 0.000 claims description 2
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- 239000003212 astringent agent Substances 0.000 claims description 2
- 235000008452 baby food Nutrition 0.000 claims description 2
- 229960002903 benzyl benzoate Drugs 0.000 claims description 2
- 235000021028 berry Nutrition 0.000 claims description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 235000015895 biscuits Nutrition 0.000 claims description 2
- 239000006189 buccal tablet Substances 0.000 claims description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 claims description 2
- 229940095259 butylated hydroxytoluene Drugs 0.000 claims description 2
- 235000012970 cakes Nutrition 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 claims description 2
- 235000013736 caramel Nutrition 0.000 claims description 2
- 229940096529 carboxypolymethylene Drugs 0.000 claims description 2
- 239000004203 carnauba wax Substances 0.000 claims description 2
- 235000013869 carnauba wax Nutrition 0.000 claims description 2
- 239000003093 cationic surfactant Chemical class 0.000 claims description 2
- 229960002798 cetrimide Drugs 0.000 claims description 2
- 229960000541 cetyl alcohol Drugs 0.000 claims description 2
- 229930002875 chlorophyll Natural products 0.000 claims description 2
- 235000019804 chlorophyll Nutrition 0.000 claims description 2
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical compound C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 claims description 2
- 235000020971 citrus fruits Nutrition 0.000 claims description 2
- 230000009918 complex formation Effects 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- 235000012343 cottonseed oil Nutrition 0.000 claims description 2
- 239000002385 cottonseed oil Substances 0.000 claims description 2
- 239000013078 crystal Substances 0.000 claims description 2
- 230000003111 delayed effect Effects 0.000 claims description 2
- 239000008121 dextrose Substances 0.000 claims description 2
- 235000019700 dicalcium phosphate Nutrition 0.000 claims description 2
- 229940095079 dicalcium phosphate anhydrous Drugs 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000007884 disintegrant Substances 0.000 claims description 2
- 238000004090 dissolution Methods 0.000 claims description 2
- 235000011869 dried fruits Nutrition 0.000 claims description 2
- 238000010410 dusting Methods 0.000 claims description 2
- 239000000839 emulsion Substances 0.000 claims description 2
- 230000002708 enhancing effect Effects 0.000 claims description 2
- 230000003628 erosive effect Effects 0.000 claims description 2
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 2
- 229920001249 ethyl cellulose Polymers 0.000 claims description 2
- 229940013317 fish oils Drugs 0.000 claims description 2
- 235000019634 flavors Nutrition 0.000 claims description 2
- 235000013305 food Nutrition 0.000 claims description 2
- 235000013355 food flavoring agent Nutrition 0.000 claims description 2
- 235000021022 fresh fruits Nutrition 0.000 claims description 2
- 235000011389 fruit/vegetable juice Nutrition 0.000 claims description 2
- 150000004676 glycans Chemical class 0.000 claims description 2
- 150000002314 glycerols Chemical class 0.000 claims description 2
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 claims description 2
- FETSQPAGYOVAQU-UHFFFAOYSA-N glyceryl palmitostearate Chemical compound OCC(O)CO.CCCCCCCCCCCCCCCC(O)=O.CCCCCCCCCCCCCCCCCC(O)=O FETSQPAGYOVAQU-UHFFFAOYSA-N 0.000 claims description 2
- 229940046813 glyceryl palmitostearate Drugs 0.000 claims description 2
- 235000001050 hortel pimenta Nutrition 0.000 claims description 2
- 239000003906 humectant Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 2
- 239000003456 ion exchange resin Substances 0.000 claims description 2
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 2
- 235000021374 legumes Nutrition 0.000 claims description 2
- 235000021388 linseed oil Nutrition 0.000 claims description 2
- 239000000944 linseed oil Substances 0.000 claims description 2
- 239000000711 locust bean gum Substances 0.000 claims description 2
- 235000010420 locust bean gum Nutrition 0.000 claims description 2
- 239000007937 lozenge Substances 0.000 claims description 2
- 239000004200 microcrystalline wax Substances 0.000 claims description 2
- 235000019808 microcrystalline wax Nutrition 0.000 claims description 2
- 239000011812 mixed powder Substances 0.000 claims description 2
- 235000013379 molasses Nutrition 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims description 2
- 235000014571 nuts Nutrition 0.000 claims description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 claims description 2
- 239000012188 paraffin wax Substances 0.000 claims description 2
- 239000006072 paste Substances 0.000 claims description 2
- 235000014594 pastries Nutrition 0.000 claims description 2
- 239000002304 perfume Substances 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 229920000573 polyethylene Polymers 0.000 claims description 2
- 229920005862 polyol Polymers 0.000 claims description 2
- 150000003077 polyols Chemical class 0.000 claims description 2
- 229920001282 polysaccharide Polymers 0.000 claims description 2
- 239000005017 polysaccharide Substances 0.000 claims description 2
- 230000002035 prolonged effect Effects 0.000 claims description 2
- 239000003380 propellant Substances 0.000 claims description 2
- 230000002685 pulmonary effect Effects 0.000 claims description 2
- 235000021013 raspberries Nutrition 0.000 claims description 2
- 150000004760 silicates Chemical class 0.000 claims description 2
- 239000000344 soap Substances 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims description 2
- 239000000600 sorbitol Substances 0.000 claims description 2
- 235000012424 soybean oil Nutrition 0.000 claims description 2
- 238000005507 spraying Methods 0.000 claims description 2
- 239000008117 stearic acid Substances 0.000 claims description 2
- 239000006190 sub-lingual tablet Substances 0.000 claims description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 2
- 239000000829 suppository Substances 0.000 claims description 2
- 235000020357 syrup Nutrition 0.000 claims description 2
- 239000006188 syrup Substances 0.000 claims description 2
- 230000009885 systemic effect Effects 0.000 claims description 2
- 239000000454 talc Substances 0.000 claims description 2
- 229910052623 talc Inorganic materials 0.000 claims description 2
- 230000001225 therapeutic effect Effects 0.000 claims description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 2
- 239000008158 vegetable oil Substances 0.000 claims description 2
- 239000003643 water by type Substances 0.000 claims description 2
- 102000004190 Enzymes Human genes 0.000 claims 1
- 108090000790 Enzymes Proteins 0.000 claims 1
- 101800004937 Protein C Proteins 0.000 claims 1
- 235000019485 Safflower oil Nutrition 0.000 claims 1
- 102100036546 Salivary acidic proline-rich phosphoprotein 1/2 Human genes 0.000 claims 1
- 101800001700 Saposin-D Proteins 0.000 claims 1
- 239000011149 active material Substances 0.000 claims 1
- 239000000853 adhesive Substances 0.000 claims 1
- 230000001070 adhesive effect Effects 0.000 claims 1
- 239000003242 anti bacterial agent Substances 0.000 claims 1
- 229940088710 antibiotic agent Drugs 0.000 claims 1
- 235000021311 artificial sweeteners Nutrition 0.000 claims 1
- 239000010836 blood and blood product Substances 0.000 claims 1
- 239000000872 buffer Substances 0.000 claims 1
- 235000014171 carbonated beverage Nutrition 0.000 claims 1
- 229940112822 chewing gum Drugs 0.000 claims 1
- 235000015218 chewing gum Nutrition 0.000 claims 1
- 210000000349 chromosome Anatomy 0.000 claims 1
- 229940088598 enzyme Drugs 0.000 claims 1
- 238000002641 enzyme replacement therapy Methods 0.000 claims 1
- 235000019249 food preservative Nutrition 0.000 claims 1
- 239000005452 food preservative Substances 0.000 claims 1
- 235000021096 natural sweeteners Nutrition 0.000 claims 1
- 235000014593 oils and fats Nutrition 0.000 claims 1
- 229920000642 polymer Polymers 0.000 claims 1
- 229960000856 protein c Drugs 0.000 claims 1
- 239000012857 radioactive material Substances 0.000 claims 1
- 235000005713 safflower oil Nutrition 0.000 claims 1
- 239000003813 safflower oil Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
- 239000003381 stabilizer Substances 0.000 claims 1
- 230000002459 sustained effect Effects 0.000 claims 1
- DSNBHJFQCNUKMA-SCKDECHMSA-N thromboxane A2 Chemical compound OC(=O)CCC\C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H]2O[C@H]1C2 DSNBHJFQCNUKMA-SCKDECHMSA-N 0.000 claims 1
- 229960005486 vaccine Drugs 0.000 claims 1
- 239000013598 vector Substances 0.000 claims 1
- 230000003519 ventilatory effect Effects 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 24
- 108010070675 Glutathione transferase Proteins 0.000 abstract description 9
- 102000005720 Glutathione transferase Human genes 0.000 abstract description 9
- 102000005486 Epoxide hydrolase Human genes 0.000 abstract description 7
- 108020002908 Epoxide hydrolase Proteins 0.000 abstract description 7
- 210000004185 liver Anatomy 0.000 abstract description 2
- 210000004072 lung Anatomy 0.000 abstract description 2
- 241001465754 Metazoa Species 0.000 abstract 1
- 238000001784 detoxification Methods 0.000 abstract 1
- 239000002207 metabolite Substances 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 description 27
- 239000011593 sulfur Substances 0.000 description 20
- JZRWCGZRTZMZEH-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 description 18
- 150000003568 thioethers Chemical class 0.000 description 15
- 150000003573 thiols Chemical class 0.000 description 15
- 208000035475 disorder Diseases 0.000 description 14
- 238000004519 manufacturing process Methods 0.000 description 14
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 11
- 150000007513 acids Chemical class 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 150000002576 ketones Chemical class 0.000 description 9
- 235000019157 thiamine Nutrition 0.000 description 9
- 239000011721 thiamine Substances 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 8
- BHQCQFFYRZLCQQ-UHFFFAOYSA-N (3alpha,5alpha,7alpha,12alpha)-3,7,12-trihydroxy-cholan-24-oic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 BHQCQFFYRZLCQQ-UHFFFAOYSA-N 0.000 description 6
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 6
- 239000004380 Cholic acid Substances 0.000 description 6
- 108010024636 Glutathione Proteins 0.000 description 6
- 229920002683 Glycosaminoglycan Polymers 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 6
- 150000001345 alkine derivatives Chemical class 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- 150000004982 aromatic amines Chemical class 0.000 description 6
- BHQCQFFYRZLCQQ-OELDTZBJSA-N cholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 BHQCQFFYRZLCQQ-OELDTZBJSA-N 0.000 description 6
- 235000019416 cholic acid Nutrition 0.000 description 6
- 229960002471 cholic acid Drugs 0.000 description 6
- KXGVEGMKQFWNSR-UHFFFAOYSA-N deoxycholic acid Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 KXGVEGMKQFWNSR-UHFFFAOYSA-N 0.000 description 6
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 6
- 229940065278 sulfur compound Drugs 0.000 description 6
- 150000003464 sulfur compounds Chemical class 0.000 description 6
- 235000013343 vitamin Nutrition 0.000 description 6
- 239000011782 vitamin Substances 0.000 description 6
- 229930003231 vitamin Natural products 0.000 description 6
- 229940088594 vitamin Drugs 0.000 description 6
- 229910052727 yttrium Inorganic materials 0.000 description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 5
- 229960003180 glutathione Drugs 0.000 description 5
- LTPQFVPQTZSJGS-UHFFFAOYSA-N 1$l^{4},3,5$l^{4},7-tetrathia-2,4,6,8-tetrazacycloocta-1,4,5,8-tetraene Chemical compound [N]1S[N]S[N]S[N]S1 LTPQFVPQTZSJGS-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 239000003925 fat Substances 0.000 description 4
- 238000005469 granulation Methods 0.000 description 4
- 230000003179 granulation Effects 0.000 description 4
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 4
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 3
- RUDATBOHQWOJDD-UHFFFAOYSA-N (3beta,5beta,7alpha)-3,7-Dihydroxycholan-24-oic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)CC2 RUDATBOHQWOJDD-UHFFFAOYSA-N 0.000 description 3
- CUKWUWBLQQDQAC-VEQWQPCFSA-N (3s)-3-amino-4-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s,3s)-1-[[(2s)-1-[(2s)-2-[[(1s)-1-carboxyethyl]carbamoyl]pyrrolidin-1-yl]-3-(1h-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-methyl-1-ox Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 CUKWUWBLQQDQAC-VEQWQPCFSA-N 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 3
- MSWZFWKMSRAUBD-GASJEMHNSA-N 2-amino-2-deoxy-D-galactopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O MSWZFWKMSRAUBD-GASJEMHNSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical class O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 3
- UCTWMZQNUQWSLP-UHFFFAOYSA-N Adrenaline Natural products CNCC(O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-UHFFFAOYSA-N 0.000 description 3
- 102400000345 Angiotensin-2 Human genes 0.000 description 3
- 101800000733 Angiotensin-2 Proteins 0.000 description 3
- 102000007592 Apolipoproteins Human genes 0.000 description 3
- 108010071619 Apolipoproteins Proteins 0.000 description 3
- 101800004538 Bradykinin Proteins 0.000 description 3
- 102400000967 Bradykinin Human genes 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 3
- 102000002045 Endothelin Human genes 0.000 description 3
- 108050009340 Endothelin Proteins 0.000 description 3
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 3
- 102400000921 Gastrin Human genes 0.000 description 3
- 108010052343 Gastrins Proteins 0.000 description 3
- 108010007979 Glycocholic Acid Proteins 0.000 description 3
- 229930186217 Glycolipid Natural products 0.000 description 3
- 102000003886 Glycoproteins Human genes 0.000 description 3
- 108090000288 Glycoproteins Proteins 0.000 description 3
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 3
- 102000004895 Lipoproteins Human genes 0.000 description 3
- 108090001030 Lipoproteins Proteins 0.000 description 3
- SMEROWZSTRWXGI-UHFFFAOYSA-N Lithocholsaeure Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)CC2 SMEROWZSTRWXGI-UHFFFAOYSA-N 0.000 description 3
- 102000015728 Mucins Human genes 0.000 description 3
- 108010063954 Mucins Proteins 0.000 description 3
- RFDAIACWWDREDC-UHFFFAOYSA-N Na salt-Glycocholic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(=O)NCC(O)=O)C)C1(C)C(O)C2 RFDAIACWWDREDC-UHFFFAOYSA-N 0.000 description 3
- 102400000050 Oxytocin Human genes 0.000 description 3
- 101800000989 Oxytocin Proteins 0.000 description 3
- XNOPRXBHLZRZKH-UHFFFAOYSA-N Oxytocin Natural products N1C(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CC(C)C)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C(C(C)CC)NC(=O)C1CC1=CC=C(O)C=C1 XNOPRXBHLZRZKH-UHFFFAOYSA-N 0.000 description 3
- 102000016611 Proteoglycans Human genes 0.000 description 3
- 108010067787 Proteoglycans Proteins 0.000 description 3
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- WBWWGRHZICKQGZ-UHFFFAOYSA-N Taurocholic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(=O)NCCS(O)(=O)=O)C)C1(C)C(O)C2 WBWWGRHZICKQGZ-UHFFFAOYSA-N 0.000 description 3
- GXBMIBRIOWHPDT-UHFFFAOYSA-N Vasopressin Natural products N1C(=O)C(CC=2C=C(O)C=CC=2)NC(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CC1=CC=CC=C1 GXBMIBRIOWHPDT-UHFFFAOYSA-N 0.000 description 3
- 108010004977 Vasopressins Proteins 0.000 description 3
- 102000002852 Vasopressins Human genes 0.000 description 3
- SGULYPGILJHFHK-JGWLITMVSA-N [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]-sulfidooxidanium Chemical compound [O+](=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[S-] SGULYPGILJHFHK-JGWLITMVSA-N 0.000 description 3
- MHRUUPNBNBHUKY-UHFFFAOYSA-N [S].[V].[Fe] Chemical class [S].[V].[Fe] MHRUUPNBNBHUKY-UHFFFAOYSA-N 0.000 description 3
- 150000000475 acetylene derivatives Chemical class 0.000 description 3
- 229940102884 adrenalin Drugs 0.000 description 3
- 150000001335 aliphatic alkanes Chemical class 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 150000003868 ammonium compounds Chemical class 0.000 description 3
- 229950006323 angiotensin ii Drugs 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- PYMYPHUHKUWMLA-WDCZJNDASA-N arabinose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)C=O PYMYPHUHKUWMLA-WDCZJNDASA-N 0.000 description 3
- PYMYPHUHKUWMLA-UHFFFAOYSA-N arabinose Natural products OCC(O)C(O)C(O)C=O PYMYPHUHKUWMLA-UHFFFAOYSA-N 0.000 description 3
- KBZOIRJILGZLEJ-LGYYRGKSSA-N argipressin Chemical compound C([C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@@H](C(N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N1)=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(N)=O)C1=CC=CC=C1 KBZOIRJILGZLEJ-LGYYRGKSSA-N 0.000 description 3
- SRBFZHDQGSBBOR-UHFFFAOYSA-N beta-D-Pyranose-Lyxose Natural products OC1COC(O)C(O)C1O SRBFZHDQGSBBOR-UHFFFAOYSA-N 0.000 description 3
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 3
- 239000003613 bile acid Substances 0.000 description 3
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 3
- 150000001720 carbohydrates Chemical class 0.000 description 3
- 235000014633 carbohydrates Nutrition 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000005018 casein Substances 0.000 description 3
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 3
- 235000021240 caseins Nutrition 0.000 description 3
- 229940106189 ceramide Drugs 0.000 description 3
- 150000001783 ceramides Chemical class 0.000 description 3
- 229930183167 cerebroside Natural products 0.000 description 3
- 150000001784 cerebrosides Chemical class 0.000 description 3
- AOXOCDRNSPFDPE-UKEONUMOSA-N chembl413654 Chemical compound C([C@H](C(=O)NCC(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](C)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@@H](N)CCC(O)=O)C1=CC=C(O)C=C1 AOXOCDRNSPFDPE-UKEONUMOSA-N 0.000 description 3
- RUDATBOHQWOJDD-BSWAIDMHSA-N chenodeoxycholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)CC1 RUDATBOHQWOJDD-BSWAIDMHSA-N 0.000 description 3
- 229960001091 chenodeoxycholic acid Drugs 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- 230000021615 conjugation Effects 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 125000006159 dianhydride group Chemical group 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 150000002016 disaccharides Chemical class 0.000 description 3
- 239000012990 dithiocarbamate Substances 0.000 description 3
- 229940075933 dithionate Drugs 0.000 description 3
- 229960003638 dopamine Drugs 0.000 description 3
- 150000002066 eicosanoids Chemical class 0.000 description 3
- ZUBDGKVDJUIMQQ-UBFCDGJISA-N endothelin-1 Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(O)=O)NC(=O)[C@H]1NC(=O)[C@H](CC=2C=CC=CC=2)NC(=O)[C@@H](CC=2C=CC(O)=CC=2)NC(=O)[C@H](C(C)C)NC(=O)[C@H]2CSSC[C@@H](C(N[C@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N2)=O)NC(=O)[C@@H](CO)NC(=O)[C@H](N)CSSC1)C1=CNC=N1 ZUBDGKVDJUIMQQ-UBFCDGJISA-N 0.000 description 3
- 150000002118 epoxides Chemical class 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 150000002270 gangliosides Chemical class 0.000 description 3
- RFDAIACWWDREDC-FRVQLJSFSA-N glycocholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(=O)NCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 RFDAIACWWDREDC-FRVQLJSFSA-N 0.000 description 3
- 229940099347 glycocholic acid Drugs 0.000 description 3
- 229930182470 glycoside Natural products 0.000 description 3
- 150000002338 glycosides Chemical class 0.000 description 3
- 150000002402 hexoses Chemical class 0.000 description 3
- 229940088597 hormone Drugs 0.000 description 3
- 239000005556 hormone Substances 0.000 description 3
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 3
- 150000004679 hydroxides Chemical class 0.000 description 3
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical class O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 3
- 150000002466 imines Chemical class 0.000 description 3
- 239000004310 lactic acid Substances 0.000 description 3
- 235000014655 lactic acid Nutrition 0.000 description 3
- 229910052745 lead Inorganic materials 0.000 description 3
- SMEROWZSTRWXGI-HVATVPOCSA-N lithocholic acid Chemical compound C([C@H]1CC2)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)CC1 SMEROWZSTRWXGI-HVATVPOCSA-N 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- CWWARWOPSKGELM-SARDKLJWSA-N methyl (2s)-2-[[(2s)-2-[[2-[[(2s)-2-[[(2s)-2-[[(2s)-5-amino-2-[[(2s)-5-amino-2-[[(2s)-1-[(2s)-6-amino-2-[[(2s)-1-[(2s)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5 Chemical compound C([C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)OC)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CCCN=C(N)N)C1=CC=CC=C1 CWWARWOPSKGELM-SARDKLJWSA-N 0.000 description 3
- 229910052750 molybdenum Inorganic materials 0.000 description 3
- 239000011733 molybdenum Substances 0.000 description 3
- 150000002772 monosaccharides Chemical class 0.000 description 3
- 229940051875 mucins Drugs 0.000 description 3
- 239000002858 neurotransmitter agent Substances 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- XNOPRXBHLZRZKH-DSZYJQQASA-N oxytocin Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@H](N)C(=O)N1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O)=O)[C@@H](C)CC)C1=CC=C(O)C=C1 XNOPRXBHLZRZKH-DSZYJQQASA-N 0.000 description 3
- 229960001723 oxytocin Drugs 0.000 description 3
- 229940014662 pantothenate Drugs 0.000 description 3
- 235000019161 pantothenic acid Nutrition 0.000 description 3
- 239000011713 pantothenic acid Substances 0.000 description 3
- 150000002972 pentoses Chemical class 0.000 description 3
- 150000008103 phosphatidic acids Chemical class 0.000 description 3
- 150000008105 phosphatidylcholines Chemical class 0.000 description 3
- 229940067605 phosphatidylethanolamines Drugs 0.000 description 3
- 150000008104 phosphatidylethanolamines Chemical class 0.000 description 3
- 150000003905 phosphatidylinositols Chemical class 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 235000018102 proteins Nutrition 0.000 description 3
- 150000003212 purines Chemical class 0.000 description 3
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 3
- 150000003230 pyrimidines Chemical class 0.000 description 3
- 239000003229 sclerosing agent Substances 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- 229940076279 serotonin Drugs 0.000 description 3
- 150000003410 sphingosines Chemical class 0.000 description 3
- 150000003431 steroids Chemical class 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 150000008163 sugars Chemical class 0.000 description 3
- 229940065721 systemic for obstructive airway disease xanthines Drugs 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- WBWWGRHZICKQGZ-GIHLXUJPSA-N taurocholic acid Chemical compound C([C@@H]1C[C@H]2O)[C@@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@@H]([C@@H](CCC(=O)NCCS(O)(=O)=O)C)[C@@]2(C)[C@H](O)C1 WBWWGRHZICKQGZ-GIHLXUJPSA-N 0.000 description 3
- 150000003505 terpenes Chemical class 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- 150000003538 tetroses Chemical class 0.000 description 3
- 229910052718 tin Inorganic materials 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 150000003641 trioses Chemical class 0.000 description 3
- 239000012989 trithiocarbonate Substances 0.000 description 3
- 210000002229 urogenital system Anatomy 0.000 description 3
- 229960003726 vasopressin Drugs 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000005864 Sulphur Substances 0.000 description 2
- 102000004357 Transferases Human genes 0.000 description 2
- 108090000992 Transferases Proteins 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 210000000941 bile Anatomy 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 229960001231 choline Drugs 0.000 description 2
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 2
- 238000005056 compaction Methods 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical class OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000003344 environmental pollutant Substances 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 150000002505 iron Chemical class 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 238000007726 management method Methods 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 229940067626 phosphatidylinositols Drugs 0.000 description 2
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical class OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 2
- 229960003080 taurine Drugs 0.000 description 2
- 229940011671 vitamin b6 Drugs 0.000 description 2
- UPYPTOCXMIWHSG-UHFFFAOYSA-N 1-dodecylsulfanyldodecane Chemical compound CCCCCCCCCCCCSCCCCCCCCCCCC UPYPTOCXMIWHSG-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- WDFZWSZNOFELJY-UHFFFAOYSA-N Arene oxide Chemical compound C1=CC=CC2OC21 WDFZWSZNOFELJY-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- MBMLMWLHJBBADN-UHFFFAOYSA-N Ferrous sulfide Chemical class [Fe]=S MBMLMWLHJBBADN-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 102000004157 Hydrolases Human genes 0.000 description 1
- 108090000604 Hydrolases Proteins 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 239000004614 Process Aid Substances 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000003416 augmentation Effects 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- 239000012620 biological material Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 238000004581 coalescence Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 210000000172 cytosol Anatomy 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- RMGVZKRVHHSUIM-UHFFFAOYSA-N dithionic acid Chemical class OS(=O)(=O)S(O)(=O)=O RMGVZKRVHHSUIM-UHFFFAOYSA-N 0.000 description 1
- 238000007908 dry granulation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- MVPICKVDHDWCJQ-UHFFFAOYSA-N ethyl 3-pyrrolidin-1-ylpropanoate Chemical compound CCOC(=O)CCN1CCCC1 MVPICKVDHDWCJQ-UHFFFAOYSA-N 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 210000005229 liver cell Anatomy 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000012567 medical material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 210000001589 microsome Anatomy 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 210000003101 oviduct Anatomy 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 231100000719 pollutant Toxicity 0.000 description 1
- 238000003908 quality control method Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229940100618 rectal suppository Drugs 0.000 description 1
- 239000006215 rectal suppository Substances 0.000 description 1
- 238000007632 sclerotherapy Methods 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 229940045902 sodium stearyl fumarate Drugs 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000005563 spheronization Methods 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 210000003454 tympanic membrane Anatomy 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 229940120293 vaginal suppository Drugs 0.000 description 1
- 239000006216 vaginal suppository Substances 0.000 description 1
- 238000005550 wet granulation Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/095—Sulfur, selenium, or tellurium compounds, e.g. thiols
- A61K31/10—Sulfides; Sulfoxides; Sulfones
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/66—Phosphorus compounds
- A61K31/661—Phosphorus acids or esters thereof not having P—C bonds, e.g. fosfosal, dichlorvos, malathion or mevinphos
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K33/00—Medicinal preparations containing inorganic active ingredients
- A61K33/04—Sulfur, selenium or tellurium; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B30—PRESSES
- B30B—PRESSES IN GENERAL
- B30B5/00—Presses characterised by the use of pressing means other than those mentioned in the preceding groups
- B30B5/02—Presses characterised by the use of pressing means other than those mentioned in the preceding groups wherein the pressing means is in the form of a flexible element, e.g. diaphragm, urged by fluid pressure
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Mechanical Engineering (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EG2003121103A EG26569A (en) | 2003-12-23 | 2003-12-23 | The element sulfur and its acid formations and derivatives of the enzyme deficiency of the enzyme glutase S transferfrez and epoxide hydrolys for all types of disease associated with this deficiency |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| OA13350A true OA13350A (en) | 2007-04-13 |
Family
ID=34707229
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| OA1200600213A OA13350A (en) | 2003-12-23 | 2004-02-16 | Elemental sulfur as an oral or parentral medical product. |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US20070141176A1 (lt) |
| EP (1) | EP1696938A1 (lt) |
| JP (1) | JP2007515437A (lt) |
| CN (1) | CN1905888A (lt) |
| AP (1) | AP2006003663A0 (lt) |
| AU (1) | AU2004305184A1 (lt) |
| BR (1) | BRPI0418124A (lt) |
| CA (1) | CA2551186A1 (lt) |
| EA (1) | EA200601208A1 (lt) |
| EG (1) | EG26569A (lt) |
| IL (1) | IL175617A0 (lt) |
| LT (1) | LT5486B (lt) |
| LV (1) | LV13492B (lt) |
| MX (1) | MXPA06007337A (lt) |
| NO (1) | NO20063416L (lt) |
| OA (1) | OA13350A (lt) |
| TN (1) | TNSN06259A1 (lt) |
| WO (1) | WO2005060979A1 (lt) |
| ZA (1) | ZA200604886B (lt) |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4596706A (en) * | 1985-04-12 | 1986-06-24 | Elena Avram | Method for eliminating or reducing the desire for smoking |
| AU3367589A (en) * | 1988-04-05 | 1989-11-03 | Dale Driver | Dietary mineral sulfur supplement |
| US5716606A (en) * | 1995-08-24 | 1998-02-10 | Boyce; Reginald D. | Lotion-based sulfur preparation for skin treatment |
| US6531506B1 (en) * | 1996-08-13 | 2003-03-11 | Regents Of The University Of California | Inhibitors of epoxide hydrolases for the treatment of hypertension |
| US6203820B1 (en) * | 1998-05-28 | 2001-03-20 | Brice E. Vickery | Compositions and methods for enhancing protein anabolism and detoxification |
| WO2000061154A1 (en) * | 1999-04-08 | 2000-10-19 | Khan Airudin S | Composition, containing sublimed sulphur, for altering plasma homodyst(e) levels in humans |
| CA2433070A1 (en) | 2001-01-13 | 2002-07-18 | The University Of North Carolina At Chapel Hill | Compounds, methods and compositions useful for the treatment of bovine viral diarrhea virus (bvdv) infection and hepatitis c virus (hcv) infection |
| AU2002342190A1 (en) * | 2001-10-29 | 2003-05-12 | Brian Penick | Sunspot skin cream |
-
2003
- 2003-12-23 EG EG2003121103A patent/EG26569A/en active
-
2004
- 2004-02-16 AP AP2006003663A patent/AP2006003663A0/xx unknown
- 2004-02-16 WO PCT/EG2004/000004 patent/WO2005060979A1/en not_active Ceased
- 2004-02-16 US US10/584,697 patent/US20070141176A1/en not_active Abandoned
- 2004-02-16 EP EP04757701A patent/EP1696938A1/en not_active Withdrawn
- 2004-02-16 AU AU2004305184A patent/AU2004305184A1/en not_active Abandoned
- 2004-02-16 CA CA002551186A patent/CA2551186A1/en not_active Abandoned
- 2004-02-16 MX MXPA06007337A patent/MXPA06007337A/es not_active Application Discontinuation
- 2004-02-16 BR BRPI0418124-7A patent/BRPI0418124A/pt not_active IP Right Cessation
- 2004-02-16 OA OA1200600213A patent/OA13350A/en unknown
- 2004-02-16 JP JP2006545927A patent/JP2007515437A/ja active Pending
- 2004-02-16 CN CNA2004800388420A patent/CN1905888A/zh active Pending
- 2004-02-16 EA EA200601208A patent/EA200601208A1/ru unknown
-
2006
- 2006-05-14 IL IL175617A patent/IL175617A0/en unknown
- 2006-06-13 ZA ZA200604886A patent/ZA200604886B/xx unknown
- 2006-07-20 LT LT2006062A patent/LT5486B/lt not_active IP Right Cessation
- 2006-07-24 NO NO20063416A patent/NO20063416L/no not_active Application Discontinuation
- 2006-07-24 LV LVP-06-95A patent/LV13492B/lv unknown
- 2006-08-15 TN TNP2006000259A patent/TNSN06259A1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| KR20070000441A (ko) | 2007-01-02 |
| IL175617A0 (en) | 2006-09-05 |
| BRPI0418124A (pt) | 2007-04-17 |
| MXPA06007337A (es) | 2007-03-01 |
| EP1696938A1 (en) | 2006-09-06 |
| ZA200604886B (en) | 2007-05-30 |
| EG26569A (en) | 2014-02-23 |
| LT5486B (lt) | 2008-04-25 |
| WO2005060979A8 (en) | 2007-01-04 |
| CN1905888A (zh) | 2007-01-31 |
| TNSN06259A1 (en) | 2007-12-03 |
| NO20063416L (no) | 2006-09-25 |
| WO2005060979A1 (en) | 2005-07-07 |
| JP2007515437A (ja) | 2007-06-14 |
| EA200601208A1 (ru) | 2006-12-29 |
| AU2004305184A1 (en) | 2005-07-07 |
| LT2006062A (lt) | 2007-10-25 |
| US20070141176A1 (en) | 2007-06-21 |
| LV13492B (en) | 2008-04-20 |
| AP2006003663A0 (en) | 2006-06-30 |
| CA2551186A1 (en) | 2005-07-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4334620B2 (ja) | ヒアルロン酸の局所麻酔剤との塩からなる医薬品 | |
| US4160827A (en) | Metronidazole phosphate and salts | |
| EP1105123B1 (en) | Pharmaceutical compositions containing lipase inhibitors and chitosan | |
| RU2706239C2 (ru) | Целастрол и его производные для лечения ожирения | |
| EP0147741B1 (de) | Pharmazeutische Zubereitung mit speziellen 1,2-Diacyl-Glycero-3-Phosphocholinen zur Behandlung von Erkrankungen im Magen-Darmbereich | |
| EP3434268A1 (en) | Compounds for the treatment of obesity and methods of use thereof | |
| CN120078763B (zh) | 一种治疗幽门螺旋杆菌感染的药物 | |
| CN118284615A (zh) | 化合物、其外消旋体、它们的盐、组合物、抗炎剂、痴呆症治疗剂及雷特综合征治疗剂 | |
| JP2024178417A (ja) | カンナビノイド由来組成物の吸収変動を低減するｎ－アシル化脂肪アミノ酸 | |
| JP2002501015A (ja) | リーシュマニア症の治療における経口投与のためのミルテフォシンを含有する固形医薬品 | |
| SK9492000A3 (en) | Pharmaceutical composition containing sibutramine and orlistat | |
| CN1130863A (zh) | 含磷酸酯或盐衍生物的组合物 | |
| CN108697663A (zh) | 在肝病治疗中使用胱天蛋白酶抑制剂的方法 | |
| JPH07507288A (ja) | デスフェリオキサミン−ｂ塩及び経口的に有効な鉄キレート剤としてのそれらの使用 | |
| JPS60120995A (ja) | 新規アミノ酸誘導体の製法 | |
| US20240009208A1 (en) | Stabilization of cannabinoids within solid dosage forms | |
| PL111746B1 (en) | Method of preparing of novel derivatives of amino acids | |
| OA13350A (en) | Elemental sulfur as an oral or parentral medical product. | |
| US6713513B2 (en) | Method for treating cartilage related diseases | |
| KR20060136411A (ko) | 경구 또는 비경구 약제로서의 원소 황 | |
| JPH06279432A (ja) | 新規な化合物および該化合物を有効成分とする抗癌剤 | |
| WO1996017616A1 (fr) | Trousse pour cycle de traitement de l'osteoporose | |
| WO1988007867A1 (fr) | Nootropique | |
| WO2013017977A1 (en) | Compositions and methods for the treatment of cancer | |
| CS209861B2 (cs) | Způsob výroby nových derivátů aminokyselin |