NZ198889A - Aminocarboxylic acid derivatives and pharmaceutical compositions - Google Patents
Aminocarboxylic acid derivatives and pharmaceutical compositionsInfo
- Publication number
- NZ198889A NZ198889A NZ198889A NZ19888981A NZ198889A NZ 198889 A NZ198889 A NZ 198889A NZ 198889 A NZ198889 A NZ 198889A NZ 19888981 A NZ19888981 A NZ 19888981A NZ 198889 A NZ198889 A NZ 198889A
- Authority
- NZ
- New Zealand
- Prior art keywords
- carbon atoms
- compound
- formula
- lower alkyl
- alkyl
- Prior art date
Links
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- 125000004432 carbon atom Chemical group C* 0.000 claims description 105
- 150000001875 compounds Chemical class 0.000 claims description 94
- 125000000217 alkyl group Chemical group 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 41
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 238000001802 infusion Methods 0.000 claims description 20
- 238000012360 testing method Methods 0.000 claims description 20
- -1 acetamido, amino Chemical group 0.000 claims description 17
- 125000003342 alkenyl group Chemical group 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 15
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 10
- 125000003107 substituted aryl group Chemical group 0.000 claims description 10
- 238000011282 treatment Methods 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000000304 alkynyl group Chemical group 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000003282 alkyl amino group Chemical group 0.000 claims description 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 241000124008 Mammalia Species 0.000 claims description 7
- 238000011321 prophylaxis Methods 0.000 claims description 7
- 208000020446 Cardiac disease Diseases 0.000 claims description 6
- 208000019622 heart disease Diseases 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 239000008280 blood Substances 0.000 claims description 4
- 210000004369 blood Anatomy 0.000 claims description 4
- 230000037396 body weight Effects 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000002950 monocyclic group Chemical group 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- 230000000903 blocking effect Effects 0.000 claims description 3
- 238000001990 intravenous administration Methods 0.000 claims description 3
- 210000004185 liver Anatomy 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- 125000003367 polycyclic group Chemical group 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 239000012467 final product Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 5
- 229910052799 carbon Inorganic materials 0.000 claims 4
- 229910052739 hydrogen Inorganic materials 0.000 claims 4
- 239000001257 hydrogen Substances 0.000 claims 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- 125000004429 atom Chemical group 0.000 claims 2
- 238000010438 heat treatment Methods 0.000 claims 2
- 240000005578 Rivina humilis Species 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 238000000921 elemental analysis Methods 0.000 description 16
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 238000010992 reflux Methods 0.000 description 14
- 238000002474 experimental method Methods 0.000 description 13
- 239000012429 reaction media Substances 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 9
- 229940039009 isoproterenol Drugs 0.000 description 9
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 9
- 238000001228 spectrum Methods 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 210000002837 heart atrium Anatomy 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 6
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 230000000747 cardiac effect Effects 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 5
- 238000011084 recovery Methods 0.000 description 5
- 210000003437 trachea Anatomy 0.000 description 5
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 4
- 239000002981 blocking agent Substances 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- GVMPCQYYYYFGMV-UHFFFAOYSA-N methyl 4-(oxiran-2-ylmethoxy)benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OCC1OC1 GVMPCQYYYYFGMV-UHFFFAOYSA-N 0.000 description 4
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- ANOUKFYBOAKOIR-UHFFFAOYSA-N DIMPEA Natural products COC1=CC=C(CCN)C=C1OC ANOUKFYBOAKOIR-UHFFFAOYSA-N 0.000 description 3
- 239000000674 adrenergic antagonist Substances 0.000 description 3
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 3
- 230000001186 cumulative effect Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 230000002503 metabolic effect Effects 0.000 description 3
- 239000002808 molecular sieve Substances 0.000 description 3
- 150000003891 oxalate salts Chemical class 0.000 description 3
- DURULFYMVIFBIR-UHFFFAOYSA-N practolol Chemical compound CC(C)NCC(O)COC1=CC=C(NC(C)=O)C=C1 DURULFYMVIFBIR-UHFFFAOYSA-N 0.000 description 3
- 229960001749 practolol Drugs 0.000 description 3
- 229960003712 propranolol Drugs 0.000 description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 3
- 238000010183 spectrum analysis Methods 0.000 description 3
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 3
- 238000005292 vacuum distillation Methods 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- CJBDUOMQLFKVQC-UHFFFAOYSA-N 3-(2-hydroxyphenyl)propanoic acid Chemical compound OC(=O)CCC1=CC=CC=C1O CJBDUOMQLFKVQC-UHFFFAOYSA-N 0.000 description 2
- IJFXRHURBJZNAO-UHFFFAOYSA-N 3-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(O)=C1 IJFXRHURBJZNAO-UHFFFAOYSA-N 0.000 description 2
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 2
- XQXPVVBIMDBYFF-UHFFFAOYSA-N 4-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=C(O)C=C1 XQXPVVBIMDBYFF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 206010003119 arrhythmia Diseases 0.000 description 2
- 230000006793 arrhythmia Effects 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000001746 atrial effect Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 2
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000008034 disappearance Effects 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- CDNNMNLILHWPMH-UHFFFAOYSA-N methyl 2-(oxiran-2-ylmethoxy)benzoate Chemical compound COC(=O)C1=CC=CC=C1OCC1OC1 CDNNMNLILHWPMH-UHFFFAOYSA-N 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- 229960001047 methyl salicylate Drugs 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- YYFIGOPUHPDIBO-UHFFFAOYSA-N propanoic acid;hydrochloride Chemical compound Cl.CCC(O)=O YYFIGOPUHPDIBO-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- MDYOLVRUBBJPFM-UHFFFAOYSA-N tropolone Chemical compound OC1=CC=CC=CC1=O MDYOLVRUBBJPFM-UHFFFAOYSA-N 0.000 description 2
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- 125000006031 2-methyl-3-butenyl group Chemical group 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 108060003345 Adrenergic Receptor Proteins 0.000 description 1
- 102000017910 Adrenergic receptor Human genes 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 101000780199 Bos taurus Acyl-coenzyme A synthetase ACSM1, mitochondrial Proteins 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- 101000654316 Centruroides limpidus Beta-toxin Cll2 Proteins 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 101000881330 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) Dynein heavy chain, cytoplasmic Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N aminomethyl benzene Natural products NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000007885 bronchoconstriction Effects 0.000 description 1
- 230000007883 bronchodilation Effects 0.000 description 1
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical compound [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 description 1
- 229960004484 carbachol Drugs 0.000 description 1
- 150000003943 catecholamines Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 229960003920 cocaine Drugs 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000007071 enzymatic hydrolysis Effects 0.000 description 1
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000013401 experimental design Methods 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- XGDZEDRBLVIUMX-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)acetate Chemical compound COC(=O)CC1=CC=C(O)C=C1 XGDZEDRBLVIUMX-UHFFFAOYSA-N 0.000 description 1
- UGCLEKVSHFQKOD-UHFFFAOYSA-N methyl 2-[4-(oxiran-2-ylmethoxy)phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1OCC1OC1 UGCLEKVSHFQKOD-UHFFFAOYSA-N 0.000 description 1
- TYCFNOCRTIAJQV-UHFFFAOYSA-N methyl 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=C(OCC(O)CNC(C)C)C=C1 TYCFNOCRTIAJQV-UHFFFAOYSA-N 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- MRBDMNSDAVCSSF-UHFFFAOYSA-N phentolamine Chemical compound C1=CC(C)=CC=C1N(C=1C=C(O)C=CC=1)CC1=NCCN1 MRBDMNSDAVCSSF-UHFFFAOYSA-N 0.000 description 1
- 229960001999 phentolamine Drugs 0.000 description 1
- IFXDDAVRUDKPBW-UHFFFAOYSA-N phenyl acetate;hydrochloride Chemical compound Cl.CC(=O)OC1=CC=CC=C1 IFXDDAVRUDKPBW-UHFFFAOYSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- QEOZPZMHUFEVEI-UHFFFAOYSA-N propyl 3-(4-hydroxyphenyl)propanoate Chemical compound CCCOC(=O)CCC1=CC=C(O)C=C1 QEOZPZMHUFEVEI-UHFFFAOYSA-N 0.000 description 1
- WFTWIXWXBYFUJY-UHFFFAOYSA-N propyl 3-[4-(oxiran-2-ylmethoxy)phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCCC)=CC=C1OCC1OC1 WFTWIXWXBYFUJY-UHFFFAOYSA-N 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000002889 sympathetic effect Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000000451 tissue damage Effects 0.000 description 1
- 231100000827 tissue damage Toxicity 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 210000001364 upper extremity Anatomy 0.000 description 1
- 210000001186 vagus nerve Anatomy 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/211,345 US4387103A (en) | 1980-11-28 | 1980-11-28 | Method for treatment or prophylaxis of cardiac disorders |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ198889A true NZ198889A (en) | 1985-08-16 |
Family
ID=22786543
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ198889A NZ198889A (en) | 1980-11-28 | 1981-11-06 | Aminocarboxylic acid derivatives and pharmaceutical compositions |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4387103A (enExample) |
| EP (2) | EP0053435B1 (enExample) |
| JP (1) | JPS57502123A (enExample) |
| KR (1) | KR880001539B1 (enExample) |
| AU (1) | AU546424B2 (enExample) |
| CA (1) | CA1258868A (enExample) |
| DK (1) | DK164660C (enExample) |
| EG (1) | EG16108A (enExample) |
| GR (1) | GR76921B (enExample) |
| IL (1) | IL64345A (enExample) |
| NZ (1) | NZ198889A (enExample) |
| PH (1) | PH18384A (enExample) |
| RO (1) | RO85311A (enExample) |
| WO (1) | WO1982001869A1 (enExample) |
| ZA (1) | ZA817737B (enExample) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8004088L (sv) * | 1980-06-02 | 1981-12-03 | Haessle Ab | Nya substituerade 3-fenoxi-l-alkoxikarbonylalkylamino-propanol-2-er med beta-receptorblockerande egenskaper samt forfarande for deras framstellning, farmaceutiska beredningar innehallande desamma och metod att ... |
| US4387103A (en) * | 1980-11-28 | 1983-06-07 | American Hospital Supply Corporation | Method for treatment or prophylaxis of cardiac disorders |
| DE3248835A1 (de) * | 1981-06-23 | 1983-06-30 | American Hospital Supply Corp | Zusammensetzungen fuer die behandlung von glaukom |
| US4454154A (en) * | 1981-06-23 | 1984-06-12 | American Hospital Supply Corporation | Method for treating glaucoma by the topical administration of selectively metabolized beta-blocking agents |
| US4582855A (en) * | 1981-11-12 | 1986-04-15 | American Hospital Supply Corporation | Aromatic and esters of hydroxypropylamines |
| US4508725A (en) * | 1982-12-22 | 1985-04-02 | American Hospital Supply Corporation | Esters of 3-(3-substituted-amino-2-hydroxypropoxy)-4-substituted-1,2,5-thiadiazole derivatives |
| US4556668A (en) * | 1983-07-15 | 1985-12-03 | American Hospital Supply Corporation | Ethylenediamine derivatives of aryloxypropanolamine aryl esters having various medicinal properties |
| US5334601A (en) * | 1984-03-14 | 1994-08-02 | Bodor Nicholas S | Soft β-adrenergic blocking agents |
| JPH08799B2 (ja) * | 1984-03-14 | 1996-01-10 | ボ−ダ−,ニコラス・エス | 緩和β−アドレナリン遮断薬 |
| US5202347A (en) * | 1984-03-14 | 1993-04-13 | Bodor Nicholas S | Soft β-adrenergic blocking agents |
| US5135926A (en) * | 1984-03-14 | 1992-08-04 | Bodor Nicholas S | Soft β-adrenergic blocking agents |
| JPH0720861B2 (ja) * | 1984-04-09 | 1995-03-08 | ザ デュポン マーク ファーマソウテイカル カンパニー | 心臓障害の処置または予防用の医薬組成物および方法 |
| US4579867A (en) * | 1984-04-09 | 1986-04-01 | American Hospital Supply Corporation | Stable pharmaceutical compositions of short-acting β-adrenergic receptor blocking agents |
| WO1988001614A1 (en) * | 1986-09-02 | 1988-03-10 | E.I. Du Pont De Nemours And Company | RESOLUTION OF dl-METHYL 3-[4-(2-HYDROXY-3-ISOPROPYLAMINO)PROPOXY]PHENYLPROPIONATE [(dl-ESMOLOL)] |
| ES2065291B1 (es) * | 1993-07-30 | 1995-10-01 | Prodesfarma Sa | "nitrato esteres de 1-ariloxi-3-alquilamino-2-propanoles, utilizacion y composicion farmaceutica correspondiente" |
| US5536749A (en) * | 1994-10-13 | 1996-07-16 | Sl Pharmaceuticals, Inc. | Method for attenuation of sympathetic nervous system activity or onset of migraine by selectively metabolized beta-blocking agents |
| US6197817B1 (en) * | 1999-01-22 | 2001-03-06 | Selectus Pharmaceuticals, Inc. | Phenylpropionic acids and esters: compounds and methods for inducing beta-blockade for the treatment of cardiac disorders |
| US7049326B2 (en) * | 2000-05-12 | 2006-05-23 | The University Of Toledo | Method and compositions for temporarily incapacitating subjects |
| US6756047B2 (en) | 2000-05-12 | 2004-06-29 | The University Of Toledo | Method and compositions for treating persistent pulmonary hypertension using aralkyl ester soft drugs |
| US6750238B1 (en) * | 2000-05-12 | 2004-06-15 | The University Of Toledo | Aralkyl ester soft drugs |
| ES2265437T3 (es) * | 2000-07-27 | 2007-02-16 | Pharmacia Corporation | Terapia de combinacion antagonista epoxi-esteroidal de aldosterona y antagonista beta-adrenergico para tratamiento de la insuficiencia cardiaca congestiva. |
| EP1417962A1 (de) | 2002-11-06 | 2004-05-12 | AOP Orphan Pharmaceuticals AG | Verfahren zur Herstellung eines Arzneimittels enthaltend Esmolol |
| ATE533509T1 (de) * | 2003-08-08 | 2011-12-15 | Ono Pharmaceutical Co | Herzverlangsamender arzneistoff mit beta-blockern mit kurzzeitwirkung als wirkstoff |
| US8426467B2 (en) * | 2007-05-22 | 2013-04-23 | Baxter International Inc. | Colored esmolol concentrate |
| US20080293814A1 (en) | 2007-05-22 | 2008-11-27 | Deepak Tiwari | Concentrate esmolol |
| US8722736B2 (en) * | 2007-05-22 | 2014-05-13 | Baxter International Inc. | Multi-dose concentrate esmolol with benzyl alcohol |
| US8440168B2 (en) * | 2008-03-24 | 2013-05-14 | The Board Of Regents Of The University Of Texas System | Image-guided therapy of myocardial disease: composition, manufacturing and applications |
| CN117126070A (zh) * | 2023-08-25 | 2023-11-28 | 海南灵康制药有限公司 | 一种盐酸艾司洛尔b晶型及其制备方法和应用 |
| CN119613359A (zh) * | 2024-11-21 | 2025-03-14 | 广东京豪生物制药有限公司 | 盐酸艾司洛尔关键中间体的制备 |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3459782A (en) * | 1963-08-26 | 1969-08-05 | Boehringer Sohn Ingelheim | 1-substituted phenoxy-2-hydroxy-3-isopropylamino-propanes |
| US3637852A (en) * | 1963-08-26 | 1972-01-25 | Boehringer Sohn Ingelheim | 1-phenoxy-2-hydroxy-3-isopropylamino-propanes and salts thereof |
| DE1643262C3 (de) * | 1967-12-13 | 1975-06-26 | C.H. Boehringer Sohn, 6507 Ingelheim | i-Phenoxy^-hydroxy-S-alklyaminopropane, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| ES361530A1 (es) * | 1967-12-18 | 1970-11-01 | Boehringer Sohn Ingelheim | Procedimiento para la preparacion de nuevos 1-fenoxi-2-hi- droxi 3-sec - alcohilamino propanos racemicos u opticamente activos. |
| US3740444A (en) * | 1968-01-25 | 1973-06-19 | Boehringer Sohn Ingelheim | Therapeutic compositions and method |
| GB1285038A (en) * | 1969-02-21 | 1972-08-09 | Ici Ltd | Alkanolamine derivatives |
| CA945172A (en) * | 1969-02-21 | 1974-04-09 | Imperial Chemical Industries Limited | Alkanolamine derivatives |
| DE1937477C3 (de) * | 1969-07-23 | 1980-04-10 | C.H. Boehringer Sohn, 6507 Ingelheim | I -Phenoxy-2-hydroxy-3-(l -methylcycloalkylamino)-propane, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| US3705907A (en) * | 1970-02-19 | 1972-12-12 | Sandoz Ltd | 4-(2-hydroxy)-3-aminopropoxy)-indole derivatives |
| DE2130393C3 (de) * | 1970-06-22 | 1981-02-26 | E.R. Squibb & Sons Inc., New York, N.Y. (V.St.A.) | 6,7-Dihydroxy -5,6,7,8-tetrahydronaphthyloxyaminopropanole und ihre Salze mit Säuren sowie ihre Verwendung bei der Bekämpfung von Herzerkrankungen |
| FR2192812A1 (en) * | 1972-07-20 | 1974-02-15 | Centre Etd Ind Pharma | 2-(3-Amino 2-hydroxy propoxy) thymotic acid cpds - with local anaesth-etic, anti arrhythmic and antitussive activity |
| AT330150B (de) * | 1973-02-28 | 1976-06-10 | Boehringer Sohn Ingelheim | Verfahren zur herstellung von neuen 1-phenoxy-2-hydroxy -3- propargylaminopropanen und von deren saureadditionssalzen |
| US3857873A (en) * | 1974-02-11 | 1974-12-31 | Warner Lambert Co | 3-hydroxy-5-(3-(substituted-amino)-2-hydroxypropoxy)-benzyl alcohols |
| US4165374A (en) * | 1976-02-09 | 1979-08-21 | Sandoz Ltd. | Thieno[3,2-c]pyridines |
| US4191765A (en) * | 1976-05-25 | 1980-03-04 | Hoechst Aktiengesellschaft | 1-Aryloxy-2-hydroxy-3-aminopropanes |
| US4119718A (en) * | 1977-05-02 | 1978-10-10 | Merck & Co., Inc. | 3-Amino-2-oxy-propoxy-substituted isothiazoles |
| FR2415622A1 (fr) * | 1978-01-25 | 1979-08-24 | Lipha | Amino alcools derives de l'ortho-hydroxy cinnamate de methyle applicables notamment comme medicaments |
| US4202978A (en) * | 1978-02-08 | 1980-05-13 | Hoffmann-La Roche Inc. | (S)-1-[2-(4-(2-Hydroxy-s-(1-alkylaminopropoxy)phenylalkyl]-4-phenylpiperazines |
| JPS55124742A (en) * | 1979-03-20 | 1980-09-26 | Kyowa Hakko Kogyo Co Ltd | Novel aminoalcohol derivative |
| SE8004087L (sv) * | 1980-06-02 | 1981-12-03 | Haessle Ab | Nya parasubstituerade 3-fenoxi-1-alkylaminopropanol-2-er med betareceptorblockerande egenskaper, samt forfarande for deras framstellning, farmaceutiska beredningar innehallande desamma, och metod att behandla akut ... |
| US4387103A (en) * | 1980-11-28 | 1983-06-07 | American Hospital Supply Corporation | Method for treatment or prophylaxis of cardiac disorders |
-
1980
- 1980-11-28 US US06/211,345 patent/US4387103A/en not_active Expired - Lifetime
-
1981
- 1981-07-27 RO RO81108290A patent/RO85311A/ro unknown
- 1981-10-29 EP EP81305129A patent/EP0053435B1/en not_active Expired
- 1981-11-06 NZ NZ198889A patent/NZ198889A/en unknown
- 1981-11-09 ZA ZA817737A patent/ZA817737B/xx unknown
- 1981-11-16 AU AU78938/81A patent/AU546424B2/en not_active Ceased
- 1981-11-16 JP JP56503716A patent/JPS57502123A/ja active Pending
- 1981-11-16 PH PH26497A patent/PH18384A/en unknown
- 1981-11-16 WO PCT/US1981/001514 patent/WO1982001869A1/en not_active Ceased
- 1981-11-16 EP EP81903188A patent/EP0065542B1/en not_active Expired
- 1981-11-24 IL IL64345A patent/IL64345A/xx not_active IP Right Cessation
- 1981-11-26 GR GR66622A patent/GR76921B/el unknown
- 1981-11-26 CA CA000390966A patent/CA1258868A/en not_active Expired
- 1981-11-28 EG EG694/81A patent/EG16108A/xx active
- 1981-11-28 KR KR1019810004622A patent/KR880001539B1/ko not_active Expired
-
1982
- 1982-07-27 DK DK335082A patent/DK164660C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| EP0053435B1 (en) | 1986-09-17 |
| PH18384A (en) | 1985-06-19 |
| DK164660C (da) | 1992-12-14 |
| GR76921B (enExample) | 1984-09-04 |
| WO1982001869A1 (en) | 1982-06-10 |
| CA1258868A (en) | 1989-08-29 |
| AU7893881A (en) | 1982-06-17 |
| EP0053435A1 (en) | 1982-06-09 |
| US4387103A (en) | 1983-06-07 |
| DK335082A (da) | 1982-07-27 |
| EP0065542A1 (en) | 1982-12-01 |
| DK164660B (da) | 1992-07-27 |
| EG16108A (en) | 1986-12-30 |
| KR830007487A (ko) | 1983-10-21 |
| RO85311A (ro) | 1984-09-29 |
| JPS57502123A (enExample) | 1982-12-02 |
| EP0065542B1 (en) | 1986-07-23 |
| ZA817737B (en) | 1983-07-27 |
| KR880001539B1 (ko) | 1988-08-20 |
| IL64345A (en) | 1986-02-28 |
| EP0065542A4 (en) | 1983-04-25 |
| AU546424B2 (en) | 1985-08-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ198889A (en) | Aminocarboxylic acid derivatives and pharmaceutical compositions | |
| US3712927A (en) | Alkanolamine derivatives | |
| US4081447A (en) | 5-[2-Hydroxy-3-(3,4-dimethoxy phenethylamino)]-propoxy-3,4-dihydro carbostyril and pharmaceutically acceptable salts thereof | |
| US4593119A (en) | Method for treatment or prophylaxis of cardiac disorders | |
| US4507498A (en) | Phenoxycarboxylic acids | |
| US3676493A (en) | Alkanolamine derivatives | |
| US4405642A (en) | Method for treatment or prophylaxis of cardiac disorders | |
| NZ202228A (en) | 2-hydroxypropylamine aryl ester derivatives and pharmaceutical compositions | |
| US4134991A (en) | Derivatives of 2-(3-phenyl-2-aminopropionyloxy)-acetic acid | |
| US4450173A (en) | Compounds and method for treatment or prophylaxis of cardiac disorders | |
| AU546152B2 (en) | Compounds and method for treatment or prophylaxis of cardiac disorders | |
| EP0034116A2 (en) | N-(3-phenoxy-2-hydroxypropyl)benzimidazole-1-alkanamines | |
| US4226875A (en) | Novel spiro-oxazolidinediones | |
| US4177280A (en) | Bicyclo[3.1.0]hexyl-substituted carbonylaminophenoxy cardiovascular agents | |
| CS239948B2 (en) | Processing of substitute n-carboxamidealkylfenoxypropanolamine | |
| US4604481A (en) | Compounds for treatment or prophylaxis of cardiac disorders | |
| US4029676A (en) | Esters of tetrahydronaphthyloxy-aminopropanols | |
| Baldwin et al. | Approaches to vasodilating/. beta.-adrenergic blocking agents: examples of the dihydrolutidine type | |
| US4782176A (en) | Phenoxycarboxylic acids | |
| HU190994B (en) | Process for producing 1-/-2,4-dichloro-phenoxy/-3-/-3,4-dimethoxy-beta-phenetyl-amino-/-2-propanol | |
| IE46590B1 (en) | Propanolamine derivatives | |
| NO161799B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive esterholdige fenoksypropanolaminer. | |
| EP0026289A1 (en) | Antihypertensive polyhalohydroxyisopropyl phenylalkanoic and phenylalkenoic acids, amides and esters, pharmaceutical compositions therefrom and intermediates thereto | |
| NO156126B (no) | Analogifremgangsmaate for fremstilling av beta-blokkere. |