NO852078L - Nye sulfonylureaforbindelser, deres anvendelse for ugress-bekjempelse og herbicide preparater inneholdende samme. - Google Patents
Nye sulfonylureaforbindelser, deres anvendelse for ugress-bekjempelse og herbicide preparater inneholdende samme.Info
- Publication number
- NO852078L NO852078L NO852078A NO852078A NO852078L NO 852078 L NO852078 L NO 852078L NO 852078 A NO852078 A NO 852078A NO 852078 A NO852078 A NO 852078A NO 852078 L NO852078 L NO 852078L
- Authority
- NO
- Norway
- Prior art keywords
- och2
- connection according
- alkyl
- alkoxy
- alkylthio
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 54
- 238000002360 preparation method Methods 0.000 title claims description 25
- 230000002363 herbicidal effect Effects 0.000 title description 13
- 239000004009 herbicide Substances 0.000 title description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 42
- 239000007787 solid Substances 0.000 claims description 39
- -1 Sulfonylurea compound Chemical class 0.000 claims description 37
- 125000004414 alkyl thio group Chemical group 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 22
- 229910052731 fluorine Inorganic materials 0.000 claims description 15
- 229910052794 bromium Inorganic materials 0.000 claims description 14
- 125000004429 atom Chemical group 0.000 claims description 13
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 claims description 12
- 108010081348 HRT1 protein Hairy Proteins 0.000 claims description 12
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims description 12
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 12
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 11
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 claims description 9
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 6
- 125000005336 allyloxy group Chemical group 0.000 claims description 6
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- 125000005136 alkenylsulfinyl group Chemical group 0.000 claims description 5
- 125000005137 alkenylsulfonyl group Chemical group 0.000 claims description 5
- 125000005108 alkenylthio group Chemical group 0.000 claims description 5
- 229940100389 Sulfonylurea Drugs 0.000 claims description 4
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims description 3
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 3
- 125000005139 alkynylsulfonyl group Chemical group 0.000 claims description 3
- 125000005109 alkynylthio group Chemical group 0.000 claims description 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 101100073357 Streptomyces halstedii sch2 gene Proteins 0.000 claims 3
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims 2
- 125000005134 alkynylsulfinyl group Chemical group 0.000 claims 2
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- RNHXTCZZACTEMK-UHFFFAOYSA-N methyl 4-ethoxybenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C=C1 RNHXTCZZACTEMK-UHFFFAOYSA-N 0.000 claims 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 claims 1
- 125000004001 thioalkyl group Chemical group 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 186
- 239000000243 solution Substances 0.000 description 87
- 239000002904 solvent Substances 0.000 description 69
- 239000000203 mixture Substances 0.000 description 58
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- 150000003456 sulfonamides Chemical class 0.000 description 46
- 238000000034 method Methods 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- 238000001704 evaporation Methods 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 31
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 28
- 229940124530 sulfonamide Drugs 0.000 description 28
- 229910052736 halogen Inorganic materials 0.000 description 26
- 150000002367 halogens Chemical class 0.000 description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 26
- 239000000047 product Substances 0.000 description 25
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 24
- 241000196324 Embryophyta Species 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000000460 chlorine Substances 0.000 description 20
- 230000008020 evaporation Effects 0.000 description 20
- 239000001257 hydrogen Substances 0.000 description 20
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 20
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 17
- 239000004615 ingredient Substances 0.000 description 17
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 239000008187 granular material Substances 0.000 description 16
- 239000002002 slurry Substances 0.000 description 16
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 239000011734 sodium Substances 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 235000019204 saccharin Nutrition 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- 238000007429 general method Methods 0.000 description 12
- 230000035784 germination Effects 0.000 description 12
- 239000002245 particle Substances 0.000 description 12
- 229940081974 saccharin Drugs 0.000 description 12
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical class O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 239000000463 material Substances 0.000 description 11
- 239000003921 oil Substances 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- DUVJEMBTGGPDNX-UHFFFAOYSA-N 6-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound OC1=CC=C2C(=O)NS(=O)(=O)C2=C1 DUVJEMBTGGPDNX-UHFFFAOYSA-N 0.000 description 10
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 10
- 239000012948 isocyanate Substances 0.000 description 10
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 239000004563 wettable powder Substances 0.000 description 8
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- VUWZPRWSIVNGKG-UHFFFAOYSA-N fluoromethane Chemical compound F[CH2] VUWZPRWSIVNGKG-UHFFFAOYSA-N 0.000 description 7
- 150000002391 heterocyclic compounds Chemical class 0.000 description 7
- 239000005457 ice water Substances 0.000 description 7
- 230000008635 plant growth Effects 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910052717 sulfur Inorganic materials 0.000 description 7
- 238000012546 transfer Methods 0.000 description 7
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 241000209140 Triticum Species 0.000 description 6
- 235000021307 Triticum Nutrition 0.000 description 6
- 125000000304 alkynyl group Chemical group 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000012986 modification Methods 0.000 description 6
- 230000004048 modification Effects 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 6
- 150000003573 thiols Chemical class 0.000 description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 5
- 101150041968 CDC13 gene Proteins 0.000 description 5
- 229920000742 Cotton Polymers 0.000 description 5
- 244000299507 Gossypium hirsutum Species 0.000 description 5
- NNKPETMULXPJDF-UHFFFAOYSA-N O=S=NS(=O)=O Chemical class O=S=NS(=O)=O NNKPETMULXPJDF-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000012010 growth Effects 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 4
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- NHUNLDQEFDSCBB-UHFFFAOYSA-N 1-chlorobutane;hexane Chemical class CCCCCl.CCCCCC NHUNLDQEFDSCBB-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 4
- ZTVJJAASXFPCHR-UHFFFAOYSA-N O=S(=O)N=S(=O)=O Chemical class O=S(=O)N=S(=O)=O ZTVJJAASXFPCHR-UHFFFAOYSA-N 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 244000062793 Sorghum vulgare Species 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 4
- 229960001413 acetanilide Drugs 0.000 description 4
- 239000000010 aprotic solvent Substances 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 239000007810 chemical reaction solvent Substances 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000002027 dichloromethane extract Substances 0.000 description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- UHCBBWUQDAVSMS-UHFFFAOYSA-N fluoroethane Chemical group CCF UHCBBWUQDAVSMS-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 231100001184 nonphytotoxic Toxicity 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 description 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 3
- JFPJVTNYCURRAB-UHFFFAOYSA-N 2-nitro-n-phenylacetamide Chemical compound [O-][N+](=O)CC(=O)NC1=CC=CC=C1 JFPJVTNYCURRAB-UHFFFAOYSA-N 0.000 description 3
- VDIKJTUGYIOQTP-UHFFFAOYSA-N 4-methylsulfanyl-2-nitrobenzoic acid Chemical compound CSC1=CC=C(C(O)=O)C([N+]([O-])=O)=C1 VDIKJTUGYIOQTP-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 241001621841 Alopecurus myosuroides Species 0.000 description 3
- 235000009051 Ambrosia paniculata var. peruviana Nutrition 0.000 description 3
- 235000003097 Artemisia absinthium Nutrition 0.000 description 3
- 240000001851 Artemisia dracunculus Species 0.000 description 3
- 235000017731 Artemisia dracunculus ssp. dracunculus Nutrition 0.000 description 3
- 235000003261 Artemisia vulgaris Nutrition 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 3
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 3
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 description 3
- 244000277285 Cassia obtusifolia Species 0.000 description 3
- 235000006719 Cassia obtusifolia Nutrition 0.000 description 3
- 235000016854 Cyperus rotundus Nutrition 0.000 description 3
- 244000075634 Cyperus rotundus Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000220317 Rosa Species 0.000 description 3
- 235000021536 Sugar beet Nutrition 0.000 description 3
- 240000007313 Tilia cordata Species 0.000 description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 230000002152 alkylating effect Effects 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000001138 artemisia absinthium Substances 0.000 description 3
- 229960000892 attapulgite Drugs 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 238000010410 dusting Methods 0.000 description 3
- 230000008029 eradication Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 235000009973 maize Nutrition 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- IKZNVXZVFKLFQX-UHFFFAOYSA-N methyl 2-amino-4-methylsulfanylbenzoate Chemical compound COC(=O)C1=CC=C(SC)C=C1N IKZNVXZVFKLFQX-UHFFFAOYSA-N 0.000 description 3
- QEHJRVXYYAJULL-UHFFFAOYSA-N methyl 4-ethoxy-2-hydroxybenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C(O)=C1 QEHJRVXYYAJULL-UHFFFAOYSA-N 0.000 description 3
- NDVANAVZMGSJFF-UHFFFAOYSA-N methyl 4-ethoxy-2-sulfamoylbenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C(S(N)(=O)=O)=C1 NDVANAVZMGSJFF-UHFFFAOYSA-N 0.000 description 3
- HUZSUNNMNIAFFN-UHFFFAOYSA-N methyl 4-ethoxy-2-sulfanylbenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C(S)=C1 HUZSUNNMNIAFFN-UHFFFAOYSA-N 0.000 description 3
- KNKOPFYVQBTAOD-UHFFFAOYSA-N methyl 4-methylsulfanyl-2-sulfamoylbenzoate Chemical compound COC(=O)C1=CC=C(SC)C=C1S(N)(=O)=O KNKOPFYVQBTAOD-UHFFFAOYSA-N 0.000 description 3
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 3
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 229910052625 palygorskite Inorganic materials 0.000 description 3
- 150000004965 peroxy acids Chemical class 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical class NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000004576 sand Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000010265 sodium sulphite Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 3
- JOKPITBUODAHEN-UHFFFAOYSA-N sulfanylideneplatinum Chemical compound [Pt]=S JOKPITBUODAHEN-UHFFFAOYSA-N 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- XRHIEEKYMUTDBT-UHFFFAOYSA-N 1,1-dioxo-6-phenylmethoxy-1,2-benzothiazol-3-one Chemical compound C=1C=C2C(=O)NS(=O)(=O)C2=CC=1OCC1=CC=CC=C1 XRHIEEKYMUTDBT-UHFFFAOYSA-N 0.000 description 2
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 240000006995 Abutilon theophrasti Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 240000008853 Datura stramonium Species 0.000 description 2
- 244000152970 Digitaria sanguinalis Species 0.000 description 2
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 235000006386 Polygonum aviculare Nutrition 0.000 description 2
- 244000292697 Polygonum aviculare Species 0.000 description 2
- 241001355178 Setaria faberi Species 0.000 description 2
- 240000006410 Sida spinosa Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000004280 Sodium formate Substances 0.000 description 2
- 240000002439 Sorghum halepense Species 0.000 description 2
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 239000006184 cosolvent Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical group C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000005243 fluidization Methods 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- MKXGJDRLEOZEGM-UHFFFAOYSA-N methyl 2-chlorosulfonyl-4-ethoxybenzoate Chemical compound CCOC1=CC=C(C(=O)OC)C(S(Cl)(=O)=O)=C1 MKXGJDRLEOZEGM-UHFFFAOYSA-N 0.000 description 2
- YPHQYPVQKMVDAI-UHFFFAOYSA-N methyl 2-chlorosulfonyl-4-methylsulfanylbenzoate Chemical compound COC(=O)C1=CC=C(SC)C=C1S(Cl)(=O)=O YPHQYPVQKMVDAI-UHFFFAOYSA-N 0.000 description 2
- XHPMTRIZNFHESE-UHFFFAOYSA-N methyl 4-methylsulfanyl-2-nitrobenzoate Chemical compound COC(=O)C1=CC=C(SC)C=C1[N+]([O-])=O XHPMTRIZNFHESE-UHFFFAOYSA-N 0.000 description 2
- 235000019713 millet Nutrition 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- 235000019254 sodium formate Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 150000003738 xylenes Chemical class 0.000 description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 description 1
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 description 1
- 125000006727 (C1-C6) alkenyl group Chemical group 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000006728 (C1-C6) alkynyl group Chemical group 0.000 description 1
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- QXCIQSNKZUAHQI-UHFFFAOYSA-N 1,3-bis(4-nitrophenyl)propan-2-one Chemical class C1=CC([N+](=O)[O-])=CC=C1CC(=O)CC1=CC=C([N+]([O-])=O)C=C1 QXCIQSNKZUAHQI-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- XDZMPRGFOOFSBL-UHFFFAOYSA-M 2-ethoxybenzoate Chemical compound CCOC1=CC=CC=C1C([O-])=O XDZMPRGFOOFSBL-UHFFFAOYSA-M 0.000 description 1
- QUWBGQXYZZQGGY-UHFFFAOYSA-N 2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(O)C(=O)C2=C1 QUWBGQXYZZQGGY-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- HXIQYSLFEXIOAV-UHFFFAOYSA-N 2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenol Chemical compound CC1=CC(O)=C(C(C)(C)C)C=C1SC1=CC(C(C)(C)C)=C(O)C=C1C HXIQYSLFEXIOAV-UHFFFAOYSA-N 0.000 description 1
- SAJYSJVBNGUWJK-UHFFFAOYSA-N 4-amino-2-nitrobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C([N+]([O-])=O)=C1 SAJYSJVBNGUWJK-UHFFFAOYSA-N 0.000 description 1
- DVZPQHRWOUXUPU-UHFFFAOYSA-N 4-ethoxy-2-hydroxybenzoic acid Chemical compound CCOC1=CC=C(C(O)=O)C(O)=C1 DVZPQHRWOUXUPU-UHFFFAOYSA-N 0.000 description 1
- SHSGDXCJYVZFTP-UHFFFAOYSA-M 4-ethoxybenzoate Chemical compound CCOC1=CC=C(C([O-])=O)C=C1 SHSGDXCJYVZFTP-UHFFFAOYSA-M 0.000 description 1
- FNDZIIJCKXGZJA-UHFFFAOYSA-N 4-hydroxy-2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1[N+]([O-])=O FNDZIIJCKXGZJA-UHFFFAOYSA-N 0.000 description 1
- 206010001557 Albinism Diseases 0.000 description 1
- 241000209761 Avena Species 0.000 description 1
- 235000011293 Brassica napus Nutrition 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 241000209202 Bromus secalinus Species 0.000 description 1
- 235000011305 Capsella bursa pastoris Nutrition 0.000 description 1
- 240000008867 Capsella bursa-pastoris Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 241001289540 Fallopia convolvulus Species 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 235000014820 Galium aparine Nutrition 0.000 description 1
- 240000005702 Galium aparine Species 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 244000158996 Hedysarum boreale Species 0.000 description 1
- 235000017443 Hedysarum boreale Nutrition 0.000 description 1
- 235000007858 Hedysarum occidentale Nutrition 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 240000007218 Ipomoea hederacea Species 0.000 description 1
- 241000110847 Kochia Species 0.000 description 1
- 244000100545 Lolium multiflorum Species 0.000 description 1
- 238000007192 Meerwein reaction reaction Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000012641 Pigmentation disease Diseases 0.000 description 1
- 244000292693 Poa annua Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 244000124765 Salsola kali Species 0.000 description 1
- 235000007658 Salsola kali Nutrition 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000002594 Solanum nigrum Nutrition 0.000 description 1
- 244000061457 Solanum nigrum Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 241000404538 Tripleurospermum maritimum subsp. inodorum Species 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241000208041 Veronica Species 0.000 description 1
- 241000990144 Veronica persica Species 0.000 description 1
- 241001506773 Xanthium sp. Species 0.000 description 1
- 244000067505 Xanthium strumarium Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 241000044474 Zuloagaea bulbosa Species 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000008331 benzenesulfonamides Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000002828 fuel tank Substances 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- VXMGBSXIKBWFBU-UHFFFAOYSA-N n-methyl-1,3,5-triazin-2-amine Chemical class CNC1=NC=NC=N1 VXMGBSXIKBWFBU-UHFFFAOYSA-N 0.000 description 1
- BQNXHDSGGRTFNX-UHFFFAOYSA-N n-methylpyrimidin-2-amine Chemical class CNC1=NC=CC=N1 BQNXHDSGGRTFNX-UHFFFAOYSA-N 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 238000012958 reprocessing Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 229940035893 uracil Drugs 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/78—Halides of sulfonic acids
- C07C309/86—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/89—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing carboxyl groups bound to the carbon skeleton
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/36—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< directly attached to at least one heterocyclic ring; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/65—N-sulfonylisocyanates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D521/00—Heterocyclic compounds containing unspecified hetero rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US61341284A | 1984-05-24 | 1984-05-24 | |
| US06/699,869 US4632693A (en) | 1984-05-24 | 1985-02-14 | Herbicidal sulfonamides |
| US71551185A | 1985-03-27 | 1985-03-27 | |
| US72070285A | 1985-04-10 | 1985-04-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO852078L true NO852078L (no) | 1985-11-25 |
Family
ID=27505114
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO852078A NO852078L (no) | 1984-05-24 | 1985-05-23 | Nye sulfonylureaforbindelser, deres anvendelse for ugress-bekjempelse og herbicide preparater inneholdende samme. |
Country Status (13)
| Country | Link |
|---|---|
| EP (1) | EP0162723B1 (enFirst) |
| AU (1) | AU593527B2 (enFirst) |
| BR (1) | BR8502461A (enFirst) |
| CA (1) | CA1233182A (enFirst) |
| DE (1) | DE3582955D1 (enFirst) |
| DK (1) | DK232085A (enFirst) |
| ES (2) | ES8609276A1 (enFirst) |
| GR (1) | GR851279B (enFirst) |
| HU (1) | HUT37868A (enFirst) |
| IL (1) | IL75290A (enFirst) |
| NO (1) | NO852078L (enFirst) |
| NZ (1) | NZ212172A (enFirst) |
| TR (1) | TR22272A (enFirst) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4661147A (en) * | 1984-06-05 | 1987-04-28 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| CA1230119A (en) * | 1985-11-22 | 1987-12-08 | Craig L. Hillemann | N-2-carboxylphenylsulfonyl-n'-pyrimidin-2-yl or triazin-2-yl-urea compounds |
| US4759792A (en) * | 1986-06-05 | 1988-07-26 | Ciba-Geigy Corporation | Phenylsulfonylureas |
| EP0327251A1 (en) * | 1988-02-01 | 1989-08-09 | E.I. Du Pont De Nemours And Company | Herbicides for control of blackgrass |
| US5160363A (en) * | 1988-05-12 | 1992-11-03 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| DE3842177A1 (de) * | 1988-12-15 | 1990-06-21 | Basf Ag | Substituierte sulfonylharnstoffe |
| DE3900472A1 (de) * | 1989-01-10 | 1990-07-12 | Basf Ag | Herbizide sulfonylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung |
| JPH0753718B2 (ja) * | 1989-02-08 | 1995-06-07 | 呉羽化学工業株式会社 | N‐置換‐3‐(置換ヒドラジノ)ベンゼンスルホンアミド誘導体、その製造方法及び除草剤 |
| US5151114A (en) * | 1989-02-08 | 1992-09-29 | Hideo Arahori | N-substituted-3-(substituted hydrazino)benzenesulfonamide derivatives, and herbicidal compositions |
| JP2598317B2 (ja) * | 1989-02-08 | 1997-04-09 | 呉羽化学工業株式会社 | N‐置換‐3‐(含窒素5員環)ベンゼンスルホンアミド誘導体、その製造方法及び除草剤 |
| US5242894A (en) * | 1989-02-08 | 1993-09-07 | Kureha Kagaku Kogyo K.K. | N-substituted-3-(nitrogen-containing 5-membered ring)-benzenesulfonamide derivatives, and herbicidal compositions |
| US5198566A (en) * | 1989-02-08 | 1993-03-30 | Kureha Kagaku Kogyo K.K. | N-substituted-3-(substituted hydrazino)-benzenesulfonamides |
| JPH0720959B2 (ja) * | 1989-02-20 | 1995-03-08 | 呉羽化学工業株式会社 | N―置換―3―〔(2,3―ジメチルマレイミド)アミノ〕ベンゼンスルホンアミド誘導体、その製造方法及び除草剤 |
| DE4029484A1 (de) * | 1990-09-18 | 1992-03-19 | Basf Ag | Herbizide (((1,3,5-triazin-2-yl)aminocarbonyl)aminosulfonyl)benzoesaeureester, verfahren zu ihrer herstellung und ihre verwendung |
| WO2011039276A1 (de) | 2009-10-01 | 2011-04-07 | Bayer Cropscience Ag | Oxathiazinyl-(het)arylsulfonylharnstoffe, verfahren und zwischenprodukte zu ihrer herstellung und ihre verwendung als planzenschutzmittel und pflaznenwachstumsregulatoren |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK163123C (da) * | 1978-05-30 | 1992-06-09 | Du Pont | Benzensulfonylurinstoffer til anvendelse som herbicider eller plantevaekstregulatorer, praeparat indeholdende dem samt deres anvendelse |
| US4545811A (en) * | 1981-08-06 | 1985-10-08 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N'-triazinyl-ureas |
| MA19680A1 (fr) * | 1982-01-11 | 1983-10-01 | Novartis Ag | N- arylsulfonyl - n' - pyrimidinylurees. |
| CA1229086A (en) * | 1984-05-09 | 1987-11-10 | Hugh M. Brown | Herbicidal halopyrimidines |
-
1985
- 1985-05-23 DK DK232085A patent/DK232085A/da unknown
- 1985-05-23 NZ NZ212172A patent/NZ212172A/xx unknown
- 1985-05-23 TR TR22272A patent/TR22272A/xx unknown
- 1985-05-23 IL IL75290A patent/IL75290A/xx unknown
- 1985-05-23 ES ES543419A patent/ES8609276A1/es not_active Expired
- 1985-05-23 NO NO852078A patent/NO852078L/no unknown
- 1985-05-24 GR GR851279A patent/GR851279B/el unknown
- 1985-05-24 HU HU851992A patent/HUT37868A/hu unknown
- 1985-05-24 CA CA000482308A patent/CA1233182A/en not_active Expired
- 1985-05-24 EP EP85303674A patent/EP0162723B1/en not_active Expired - Lifetime
- 1985-05-24 AU AU42835/85A patent/AU593527B2/en not_active Ceased
- 1985-05-24 BR BR8502461A patent/BR8502461A/pt unknown
- 1985-05-24 DE DE8585303674T patent/DE3582955D1/de not_active Expired - Lifetime
-
1986
- 1986-01-31 ES ES551552A patent/ES8706638A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| TR22272A (tr) | 1986-12-04 |
| GR851279B (enFirst) | 1985-11-25 |
| BR8502461A (pt) | 1986-01-28 |
| DK232085D0 (da) | 1985-05-23 |
| AU4283585A (en) | 1985-11-28 |
| ES551552A0 (es) | 1987-07-01 |
| DK232085A (da) | 1985-11-25 |
| IL75290A (en) | 1988-11-15 |
| ES543419A0 (es) | 1986-08-16 |
| EP0162723A3 (en) | 1986-10-08 |
| NZ212172A (en) | 1989-03-29 |
| ES8706638A1 (es) | 1987-07-01 |
| DE3582955D1 (de) | 1991-07-04 |
| EP0162723B1 (en) | 1991-05-29 |
| CA1233182A (en) | 1988-02-23 |
| IL75290A0 (en) | 1985-09-29 |
| AU593527B2 (en) | 1990-02-15 |
| HUT37868A (en) | 1986-03-28 |
| ES8609276A1 (es) | 1986-08-16 |
| EP0162723A2 (en) | 1985-11-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100379594B1 (ko) | 아실화된아미노페닐설포닐우레아,이의제법,및이의제초제및식물성장조절제로서의용도 | |
| KR920004189B1 (ko) | 신규의 페닐설폰류 화합물의 제조방법 | |
| KR100467128B1 (ko) | N-(5,7-디메톡시[1,2,4]트리아졸로[1,5-a]피리미딘-2-일)아릴설폰아미드 화합물 및 제초제로서의 이의 용도 | |
| AU645389B2 (en) | Novel sulfonylureas | |
| CA1341034C (en) | Heterocyclic 2-alkoxyphenoxysulfonylureas and the use thereof as herbicides or plant growth regulators | |
| EP0035893A2 (en) | Herbicidal benzene- and pyridine-sulfonamide derivatives | |
| AU697495B2 (en) | Acylated aminophenylsulfonylureas; preparation and use as herbicides and plant growth regulators | |
| CZ108396A3 (en) | Phenylsulfonyl ureas, process of their preparatio phenylsulfonyl ureas, process of their preparation, their use as herbicides and growth regulators an, their use as herbicides and growth regulators as well as intermediates for their preparation s well as intermediates for their preparation | |
| EP0041404A2 (en) | Herbicidal thiophenesulfonamides | |
| NO852078L (no) | Nye sulfonylureaforbindelser, deres anvendelse for ugress-bekjempelse og herbicide preparater inneholdende samme. | |
| CA2073135A1 (en) | Salts of pyridylsulfonylureas as herbicides and plant growth regulators, their preparation and their use | |
| PT96445A (pt) | Processo para a preparacao de piridil-sulfonil-ureias e de composicoes herbicidas e de regulacao do desenvolvimento de plantas que as contem | |
| BG62051B1 (bg) | Хербициден пиридинсулфонамид | |
| CA2144769A1 (en) | Hydroxylaminophenylsulfonylureas, their synthesis, and their use as herbicides and plant growth regulators | |
| RU2041628C1 (ru) | Гербицидное средство с синергитическим действием и способ борьбы с нежелательной растительностью в полезных растительных культурах | |
| JP3464237B2 (ja) | N−ヘテロアリール−n’−(ピリド−2−イル−スルホニル)尿素類、それらの製造方法およびそれらの除草剤および植物生長調整剤としての用途 | |
| CZ349596A3 (en) | Phenylsulfonyl ureas with substituent on nitrogen, process of their preparation and application as herbicidal agents and plant growth regulators | |
| EP0235449B1 (en) | Herbicidal sulfonamides | |
| CS251791A3 (en) | Novel sulfoureas | |
| CZ349696A3 (en) | Formylaminophenyl sulfonyl ureas, process of their preparation and application as herbicidal agents and plant growth regulators | |
| US4710221A (en) | Herbicidal sulfonamides | |
| US5714436A (en) | N-heteroaryl-N'-(pyrid-2-ylsulfonyl)ureas, processes for their preparation, and their use as herbicides and plant growth regulators | |
| US4724039A (en) | Herbicidal sulfonamides | |
| JP2997287B2 (ja) | 3―置換アルキルサリチレートを基礎としたフエノキシスルホニル尿素、それらの製造方法およびそれらの除草剤および植物生長調整剤としての使用方法 | |
| US6017852A (en) | Method of controlling undesired plant growth in rice |