NO845172L - Fremgangsmaate for fremstilling av imidazolinonderivater - Google Patents
Fremgangsmaate for fremstilling av imidazolinonderivaterInfo
- Publication number
- NO845172L NO845172L NO845172A NO845172A NO845172L NO 845172 L NO845172 L NO 845172L NO 845172 A NO845172 A NO 845172A NO 845172 A NO845172 A NO 845172A NO 845172 L NO845172 L NO 845172L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- compound
- imidazolin
- pharmaceutically acceptable
- propylamino
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 19
- 238000002360 preparation method Methods 0.000 title abstract description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 139
- 150000003839 salts Chemical class 0.000 claims abstract description 41
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 28
- 239000001257 hydrogen Substances 0.000 claims abstract description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 14
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 7
- 239000001301 oxygen Substances 0.000 claims abstract description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 7
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims abstract description 6
- 239000005864 Sulphur Chemical group 0.000 claims abstract description 6
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims abstract description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 38
- 239000000126 substance Substances 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- VQSXCZMVUMSITD-UHFFFAOYSA-N 3-[3-(piperidin-1-ylmethyl)phenoxy]propan-1-amine Chemical compound NCCCOC1=CC=CC(CN2CCCCC2)=C1 VQSXCZMVUMSITD-UHFFFAOYSA-N 0.000 claims description 9
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 239000003153 chemical reaction reagent Substances 0.000 claims description 5
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 5
- XZAKYJBLDUAUSD-UHFFFAOYSA-N 2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,4-dihydroimidazol-5-one Chemical compound O=C1CNC(NCCCOC=2C=C(CN3CCCCC3)C=CC=2)=N1 XZAKYJBLDUAUSD-UHFFFAOYSA-N 0.000 claims description 4
- 150000001721 carbon Chemical group 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 4
- 125000006308 propyl amino group Chemical group 0.000 claims description 4
- QTPROSYLXAPWHM-UHFFFAOYSA-N 3-benzyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-4h-imidazol-5-one Chemical compound C=1C=CC(CN2CCCCC2)=CC=1OCCCNC1=NC(=O)CN1CC1=CC=CC=C1 QTPROSYLXAPWHM-UHFFFAOYSA-N 0.000 claims description 3
- JSHJYBBDHIWCIX-UHFFFAOYSA-N 3-methyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-4h-imidazol-5-one Chemical compound CN1CC(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 JSHJYBBDHIWCIX-UHFFFAOYSA-N 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000001072 heteroaryl group Chemical group 0.000 claims description 3
- XKXZAVLRYZDNHM-UHFFFAOYSA-N 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-1,4-dihydroimidazol-5-one Chemical compound O1C(CN(C)C)=CC=C1CSCCNC1=NC(=O)CN1 XKXZAVLRYZDNHM-UHFFFAOYSA-N 0.000 claims description 2
- MYSHQAHXATZEFM-UHFFFAOYSA-N 2-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropyl]-1,4-dihydroimidazol-5-one Chemical compound O=C1CNC(CCCOC=2N=CC=C(CN3CCCCC3)C=2)=N1 MYSHQAHXATZEFM-UHFFFAOYSA-N 0.000 claims description 2
- LKSXHDOPFVYBTJ-UHFFFAOYSA-N 3-ethyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-4h-imidazol-5-one Chemical compound CCN1CC(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 LKSXHDOPFVYBTJ-UHFFFAOYSA-N 0.000 claims description 2
- RKZIJNDMXFLZFP-UHFFFAOYSA-N 3-methyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-4h-imidazol-5-one;dihydrochloride Chemical compound Cl.Cl.CN1CC(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 RKZIJNDMXFLZFP-UHFFFAOYSA-N 0.000 claims description 2
- ADASGSGBPNAOJS-UHFFFAOYSA-N 3-methyl-2-[3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropylamino]-4h-imidazol-5-one Chemical compound CN1CC(=O)N=C1NCCCOC1=CC(CN2CCCCC2)=CC=N1 ADASGSGBPNAOJS-UHFFFAOYSA-N 0.000 claims description 2
- PQPFFTPGHQLIAS-UHFFFAOYSA-N 4,4-dimethyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1h-imidazol-5-one Chemical compound O=C1C(C)(C)NC(NCCCOC=2C=C(CN3CCCCC3)C=CC=2)=N1 PQPFFTPGHQLIAS-UHFFFAOYSA-N 0.000 claims description 2
- YXFZWWXCNIRWHK-UHFFFAOYSA-N 4-benzyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,4-dihydroimidazol-5-one Chemical compound N1C(CC=2C=CC=CC=2)C(=O)N=C1NCCCOC(C=1)=CC=CC=1CN1CCCCC1 YXFZWWXCNIRWHK-UHFFFAOYSA-N 0.000 claims description 2
- CIBCDBBVDRYLSY-UHFFFAOYSA-N 4-methyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-1,4-dihydroimidazol-5-one Chemical compound O=C1C(C)NC(NCCCOC=2C=C(CN3CCCCC3)C=CC=2)=N1 CIBCDBBVDRYLSY-UHFFFAOYSA-N 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 150000003573 thiols Chemical class 0.000 claims 2
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims 1
- AZZPAAYLMUOGNP-UHFFFAOYSA-N 2-methylsulfanyl-1,4-dihydroimidazol-5-one Chemical compound CSC1=NC(=O)CN1 AZZPAAYLMUOGNP-UHFFFAOYSA-N 0.000 claims 1
- XBIZLNNDBBZBAS-UHFFFAOYSA-N 3-methyl-2-methylsulfanyl-4h-imidazol-5-one Chemical compound CSC1=NC(=O)CN1C XBIZLNNDBBZBAS-UHFFFAOYSA-N 0.000 claims 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 abstract description 3
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 3
- 239000000543 intermediate Substances 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 106
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 52
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 48
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 37
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 28
- 239000007787 solid Substances 0.000 description 27
- 229960001340 histamine Drugs 0.000 description 26
- -1 skin inflammation Chemical compound 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 239000003921 oil Substances 0.000 description 23
- 235000019198 oils Nutrition 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 102000005962 receptors Human genes 0.000 description 10
- 108020003175 receptors Proteins 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 230000001404 mediated effect Effects 0.000 description 7
- CLIVSWVSPTXDDB-UHFFFAOYSA-N 3-methyl-2-methylsulfanyl-4h-imidazol-5-one;hydroiodide Chemical compound I.CSC1=NC(=O)CN1C CLIVSWVSPTXDDB-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 239000002026 chloroform extract Substances 0.000 description 6
- 230000005764 inhibitory process Effects 0.000 description 6
- HVTPYQIIUYERPM-UHFFFAOYSA-N 2-methylsulfanyl-1,4-dihydroimidazol-5-one;hydroiodide Chemical compound I.CSC1=NC(=O)CN1 HVTPYQIIUYERPM-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000005557 antagonist Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 4
- 239000011976 maleic acid Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 210000002784 stomach Anatomy 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 102000003710 Histamine H2 Receptors Human genes 0.000 description 3
- 108090000050 Histamine H2 Receptors Proteins 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000003396 thiol group Chemical class [H]S* 0.000 description 3
- SALZXYUJJZVVFD-UHFFFAOYSA-N 1-benzyl-2-sulfanylideneimidazolidin-4-one Chemical compound S=C1NC(=O)CN1CC1=CC=CC=C1 SALZXYUJJZVVFD-UHFFFAOYSA-N 0.000 description 2
- FLDCYXOIVORVJI-UHFFFAOYSA-N 2-[[4-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=NC(CSCCN)=C1 FLDCYXOIVORVJI-UHFFFAOYSA-N 0.000 description 2
- JFGCGQJHMUYGLU-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=C(CSCCN)O1 JFGCGQJHMUYGLU-UHFFFAOYSA-N 0.000 description 2
- AAEOEVRPMYKMKS-UHFFFAOYSA-N 3-[4-(piperidin-1-ylmethyl)pyridin-2-yl]oxypropan-1-amine Chemical compound C1=NC(OCCCN)=CC(CN2CCCCC2)=C1 AAEOEVRPMYKMKS-UHFFFAOYSA-N 0.000 description 2
- QRVRKDXHWFIKLQ-UHFFFAOYSA-N 3-benzyl-2-methylsulfanyl-4h-imidazol-5-one;hydroiodide Chemical compound I.CSC1=NC(=O)CN1CC1=CC=CC=C1 QRVRKDXHWFIKLQ-UHFFFAOYSA-N 0.000 description 2
- MSFPWHYRFULRPV-UHFFFAOYSA-N 3-ethyl-2-methylsulfanyl-4h-imidazol-5-one;hydroiodide Chemical compound I.CCN1CC(=O)N=C1SC MSFPWHYRFULRPV-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000001871 Tachycardia Diseases 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002876 beta blocker Substances 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229960001380 cimetidine Drugs 0.000 description 2
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 230000027119 gastric acid secretion Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000622 liquid--liquid extraction Methods 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 2
- 229960000582 mepyramine Drugs 0.000 description 2
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 230000006794 tachycardia Effects 0.000 description 2
- RDJUHLUBPADHNP-UHFFFAOYSA-N 1,2,3,5-tetrahydroxybenzene Chemical compound OC1=CC(O)=C(O)C(O)=C1 RDJUHLUBPADHNP-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- JGPCGIROINQNDS-UHFFFAOYSA-N 2-[2-[[4-[(dimethylamino)methyl]pyridin-2-yl]methylsulfanyl]ethylamino]-3-methyl-4h-imidazol-5-one Chemical compound CN(C)CC1=CC=NC(CSCCNC=2N(CC(=O)N=2)C)=C1 JGPCGIROINQNDS-UHFFFAOYSA-N 0.000 description 1
- OTPSRFGPMLQFKW-UHFFFAOYSA-N 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-3-methyl-4h-imidazol-5-one Chemical compound O1C(CN(C)C)=CC=C1CSCCNC1=NC(=O)CN1C OTPSRFGPMLQFKW-UHFFFAOYSA-N 0.000 description 1
- YBWDTYQGBJTJBO-UHFFFAOYSA-N 2-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-3-methyl-4h-imidazol-5-one;dihydrochloride Chemical compound Cl.Cl.O1C(CN(C)C)=CC=C1CSCCNC1=NC(=O)CN1C YBWDTYQGBJTJBO-UHFFFAOYSA-N 0.000 description 1
- BJRXZMCJFCAZDL-UHFFFAOYSA-N 2-bromopropanal Chemical compound CC(Br)C=O BJRXZMCJFCAZDL-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical class O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- UXEWJXOIXZTIOM-UHFFFAOYSA-N 3-benzyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-4h-imidazol-5-one;dihydrochloride Chemical compound Cl.Cl.C=1C=CC(CN2CCCCC2)=CC=1OCCCNC1=NC(=O)CN1CC1=CC=CC=C1 UXEWJXOIXZTIOM-UHFFFAOYSA-N 0.000 description 1
- LYTJNMIOITYENU-UHFFFAOYSA-N 3-ethyl-2-[3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino]-4h-imidazol-5-one;dihydrochloride Chemical compound Cl.Cl.CCN1CC(=O)N=C1NCCCOC1=CC=CC(CN2CCCCC2)=C1 LYTJNMIOITYENU-UHFFFAOYSA-N 0.000 description 1
- WAVYYIGPCYPIBP-UHFFFAOYSA-N 3-ethyl-2-methylsulfanyl-4h-imidazol-5-one Chemical compound CCN1CC(=O)N=C1SC WAVYYIGPCYPIBP-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- LYXDEZWUGARRFT-UHFFFAOYSA-N 4,4-dimethyl-2-methylsulfanyl-1h-imidazol-5-one;hydroiodide Chemical compound I.CSC1=NC(=O)C(C)(C)N1 LYXDEZWUGARRFT-UHFFFAOYSA-N 0.000 description 1
- ACSANIRJSRJFPL-UHFFFAOYSA-N 4-benzyl-2-methylsulfanyl-1,4-dihydroimidazol-5-one;hydroiodide Chemical compound I.N1C(SC)=NC(=O)C1CC1=CC=CC=C1 ACSANIRJSRJFPL-UHFFFAOYSA-N 0.000 description 1
- PILMZQWQYGDQIR-UHFFFAOYSA-N 4-methyl-2-methylsulfanyl-1,4-dihydroimidazol-5-one Chemical compound CSC1=NC(=O)C(C)N1 PILMZQWQYGDQIR-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- LTADUKVTOPJJJF-SPIKMXEPSA-N C(\C=C/C(=O)O)(=O)O.C(\C=C/C(=O)O)(=O)O.CN(C)CC1=CC=C(O1)CSCCNC=1NCC(N1)=O Chemical compound C(\C=C/C(=O)O)(=O)O.C(\C=C/C(=O)O)(=O)O.CN(C)CC1=CC=C(O1)CSCCNC=1NCC(N1)=O LTADUKVTOPJJJF-SPIKMXEPSA-N 0.000 description 1
- UDCGFSYQAMFVAE-SPIKMXEPSA-N C(\C=C/C(=O)O)(=O)O.C(\C=C/C(=O)O)(=O)O.N1(CCCCC1)CC1=CC(=NC=C1)OCCCNC=1N(CC(N1)=O)C Chemical compound C(\C=C/C(=O)O)(=O)O.C(\C=C/C(=O)O)(=O)O.N1(CCCCC1)CC1=CC(=NC=C1)OCCCNC=1N(CC(N1)=O)C UDCGFSYQAMFVAE-SPIKMXEPSA-N 0.000 description 1
- 125000005947 C1-C6 alkylsulfonyloxy group Chemical group 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- 102000000543 Histamine Receptors Human genes 0.000 description 1
- 108010002059 Histamine Receptors Proteins 0.000 description 1
- 101150056637 Hrh2 gene Proteins 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 206010067171 Regurgitation Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000009858 acid secretion Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 230000001746 atrial effect Effects 0.000 description 1
- IIQFIDKGTDXLBU-UHFFFAOYSA-N benzyl thiohypochlorite Chemical compound ClSCC1=CC=CC=C1 IIQFIDKGTDXLBU-UHFFFAOYSA-N 0.000 description 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 208000034158 bleeding Diseases 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- RIMGDBZXWSGBQN-UHFFFAOYSA-N burimamide Chemical class CNC(=S)NCCCCC1=CN=C[N]1 RIMGDBZXWSGBQN-UHFFFAOYSA-N 0.000 description 1
- XAAHAAMILDNBPS-UHFFFAOYSA-L calcium hydrogenphosphate dihydrate Chemical compound O.O.[Ca+2].OP([O-])([O-])=O XAAHAAMILDNBPS-UHFFFAOYSA-L 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 210000003238 esophagus Anatomy 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- ZYBWTEQKHIADDQ-UHFFFAOYSA-N ethanol;methanol Chemical compound OC.CCO ZYBWTEQKHIADDQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000000763 evoking effect Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- VGIVLIHKENZQHQ-UHFFFAOYSA-N n,n,n',n'-tetramethylmethanediamine Chemical compound CN(C)CN(C)C VGIVLIHKENZQHQ-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- FEQAUBVIUZJXKN-UHFFFAOYSA-N propan-2-imine;hydrochloride Chemical compound [Cl-].CC(C)=[NH2+] FEQAUBVIUZJXKN-UHFFFAOYSA-N 0.000 description 1
- HHAVHBDPWSUKHZ-UHFFFAOYSA-N propan-2-ol;propan-2-one Chemical compound CC(C)O.CC(C)=O HHAVHBDPWSUKHZ-UHFFFAOYSA-N 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000000306 recurrent effect Effects 0.000 description 1
- 210000005245 right atrium Anatomy 0.000 description 1
- 210000005241 right ventricle Anatomy 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 231100000161 signs of toxicity Toxicity 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 230000036269 ulceration Effects 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 239000012178 vegetable wax Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/86—Oxygen and sulfur atoms, e.g. thiohydantoin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/88—Nitrogen atoms, e.g. allantoin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838311443A GB8311443D0 (en) | 1983-04-27 | 1983-04-27 | Chemical compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO845172L true NO845172L (no) | 1984-12-21 |
Family
ID=10541762
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO845172A NO845172L (no) | 1983-04-27 | 1984-12-21 | Fremgangsmaate for fremstilling av imidazolinonderivater |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4567176A (de) |
| EP (1) | EP0132914B1 (de) |
| JP (1) | JPS60501207A (de) |
| KR (1) | KR840008330A (de) |
| AT (1) | ATE34978T1 (de) |
| DE (1) | DE3471929D1 (de) |
| ES (1) | ES531933A0 (de) |
| FI (1) | FI845095A0 (de) |
| GB (1) | GB8311443D0 (de) |
| GR (1) | GR81941B (de) |
| HU (1) | HUT34744A (de) |
| IL (1) | IL71639A0 (de) |
| NO (1) | NO845172L (de) |
| PT (1) | PT78498B (de) |
| WO (1) | WO1984004304A1 (de) |
| ZA (1) | ZA843088B (de) |
| ZW (1) | ZW6784A1 (de) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8417194D0 (en) * | 1984-07-05 | 1984-08-08 | Boots Co Plc | Therapeutic agents |
| TW221689B (de) * | 1991-08-27 | 1994-03-11 | Otsuka Pharma Co Ltd | |
| GB9611046D0 (en) * | 1996-05-25 | 1996-07-31 | Wivenhoe Techn Ltd | Pharmacological compounds |
| US7423147B2 (en) | 2004-03-31 | 2008-09-09 | Janssen Pharmaceutical, N.V. | Pyridine compounds as histamine H3 modulators |
| CA2653940C (en) | 2006-05-30 | 2015-07-14 | Janssen Pharmaceutica N.V. | Substituted pyridyl amide compounds as modulators of the histamine h3 receptor |
| CA2706328C (en) | 2007-11-20 | 2016-04-19 | Janssen Pharmaceutica N.V. | Cycloalkyloxy- and heterocycloalkyloxypyridine compounds as modulators of the histamine h3 receptor |
| EP4196793A1 (de) | 2020-08-11 | 2023-06-21 | Université de Strasbourg | Auf lebermakrophagen abzielende h2-blocker zur prävention und behandlung von lebererkrankungen und krebs |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3968216A (en) * | 1969-10-29 | 1976-07-06 | Smith Kline & French Laboratories Limited | Method of inhibiting histamine activity with guanidine compounds |
| GB1419994A (en) * | 1973-05-03 | 1976-01-07 | Smith Kline French Lab | Heterocyclicalkylaminotheterocyclic compounds methods for their preparation and compositions comprising them |
| IN151188B (de) * | 1978-02-13 | 1983-03-05 | Smith Kline French Lab | |
| ZA793443B (en) * | 1978-07-26 | 1980-12-31 | Glaxo Group Ltd | Heterocyclic derivatives |
| ZW21281A1 (en) * | 1980-10-01 | 1981-11-18 | Smith Kline French Lab | Amine derivatives |
| GR79384B (de) * | 1982-08-20 | 1984-10-22 | Hoechst Uk Ltd |
-
1983
- 1983-04-27 GB GB838311443A patent/GB8311443D0/en active Pending
-
1984
- 1984-04-13 JP JP59501699A patent/JPS60501207A/ja active Pending
- 1984-04-13 EP EP84302550A patent/EP0132914B1/de not_active Expired
- 1984-04-13 HU HU842253A patent/HUT34744A/hu unknown
- 1984-04-13 AT AT84302550T patent/ATE34978T1/de active
- 1984-04-13 WO PCT/GB1984/000127 patent/WO1984004304A1/en active Application Filing
- 1984-04-13 DE DE8484302550T patent/DE3471929D1/de not_active Expired
- 1984-04-18 US US06/601,527 patent/US4567176A/en not_active Expired - Fee Related
- 1984-04-24 GR GR74486A patent/GR81941B/el unknown
- 1984-04-25 IL IL71639A patent/IL71639A0/xx unknown
- 1984-04-26 KR KR1019840002229A patent/KR840008330A/ko not_active Application Discontinuation
- 1984-04-26 ZA ZA843088A patent/ZA843088B/xx unknown
- 1984-04-26 ES ES531933A patent/ES531933A0/es active Granted
- 1984-04-26 PT PT78498A patent/PT78498B/pt unknown
- 1984-04-26 ZW ZW67/84A patent/ZW6784A1/xx unknown
- 1984-12-21 NO NO845172A patent/NO845172L/no unknown
- 1984-12-21 FI FI845095A patent/FI845095A0/fi not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| ES8505668A1 (es) | 1985-06-01 |
| WO1984004304A1 (en) | 1984-11-08 |
| EP0132914B1 (de) | 1988-06-08 |
| PT78498B (en) | 1986-06-02 |
| PT78498A (en) | 1984-05-01 |
| IL71639A0 (en) | 1984-07-31 |
| FI845095L (fi) | 1984-12-21 |
| DE3471929D1 (de) | 1988-07-14 |
| HUT34744A (en) | 1985-04-28 |
| ATE34978T1 (de) | 1988-06-15 |
| GR81941B (de) | 1984-12-12 |
| ZW6784A1 (en) | 1985-04-17 |
| US4567176A (en) | 1986-01-28 |
| KR840008330A (ko) | 1984-12-14 |
| EP0132914A2 (de) | 1985-02-13 |
| FI845095A0 (fi) | 1984-12-21 |
| ZA843088B (en) | 1985-02-27 |
| EP0132914A3 (en) | 1985-12-27 |
| ES531933A0 (es) | 1985-06-01 |
| GB8311443D0 (en) | 1983-06-02 |
| JPS60501207A (ja) | 1985-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66000C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 2-amino-4-pyrimidonderivat | |
| SK25199A3 (en) | Heterocyclic metalloprotease inhibitors | |
| KR20230012597A (ko) | Ampk 활성화제 | |
| EA015249B1 (ru) | Соединения с сочетанием антагонистической активности в отношении каннабиноидных рецепторов сви ингибирующей активности в отношении ацетилхолинэстеразы | |
| JP2650869B2 (ja) | 新規の５−ピロリル−６−ハロゲノ−２−ピリジルメチルスルフィニルベンゾイミダゾール誘導体およびその製造方法 | |
| NO874194L (no) | Fremgangsmaate ved fremstilling av dihydro-pyridinderivater | |
| NO845172L (no) | Fremgangsmaate for fremstilling av imidazolinonderivater | |
| DK168763B1 (da) | Heterocykliske derivater, farmaceutiske præparater indeholdende disse, deres anvendelse ved behandlingen af histaminformidlede tilstande i hjernen samt fremgangsmåder til deres fremstilling | |
| EP0180298B1 (de) | Pyrimidinverbindungen | |
| EP0004561A2 (de) | Harnstoff- und Amidoverbindungen, deren Herstellung, pharmazeutische Präparate enthaltend diese Verbindungen und deren Verwendung zur Zubereitung von pharmazeutischen Präparaten | |
| US4540699A (en) | N-Substituted pyridinones having histamine H2 -antagonist activity | |
| US4388317A (en) | Pyrimidones having histamine H2 -antagonist activity | |
| US4608380A (en) | Substituted aminopyridones having histamine H2 -receptor blocking activity | |
| DE60107852T2 (de) | Thienopyrrolidinone | |
| US5364860A (en) | Naphthyridine compounds which inhibit tyrosine kinase and their pharmaceutical compositions | |
| NO843043L (no) | Fremgangsmaate for fremstilling av forbindelser med histamin h2-antagonistvirkning | |
| EP0028117B1 (de) | Guanidinverbindungen, Verfahren zu deren Herstellung und diese enthaltende Zusammensetzungen | |
| US4571398A (en) | Cytosine derivatives having histamine H2 -antagonist activity | |
| US4307104A (en) | Guanidine compounds | |
| US4359466A (en) | Guanidine compounds | |
| CS264298B2 (cs) | Způsob výroby dusíkatých arylmethoxythiofenových derivátů | |
| US4542140A (en) | Pyridinyl substituted ketenemercaptal derivatives | |
| NZ206853A (en) | Pyridine-pyrimidinone derivatives and pharmaceutical compositions thereof | |
| JPH03148262A (ja) | イミダゾール誘導体およびその製造法ならびにこれを含有する抗潰瘍剤 |