NO843307L - Cykloheksankarbonksylsyrer og derivater derav - Google Patents
Cykloheksankarbonksylsyrer og derivater deravInfo
- Publication number
- NO843307L NO843307L NO843307A NO843307A NO843307L NO 843307 L NO843307 L NO 843307L NO 843307 A NO843307 A NO 843307A NO 843307 A NO843307 A NO 843307A NO 843307 L NO843307 L NO 843307L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- compounds
- preparation
- starting materials
- substituted starting
- Prior art date
Links
- 239000002253 acid Substances 0.000 title description 5
- 150000007513 acids Chemical class 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 24
- 150000002825 nitriles Chemical class 0.000 claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims description 29
- 238000002360 preparation method Methods 0.000 claims description 17
- -1 cyano, carboxyl Chemical group 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 claims description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000005599 alkyl carboxylate group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910000085 borane Inorganic materials 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- ZLHGGXBDLPPRTK-UHFFFAOYSA-N ethyl 1-(1-cyanoethyl)-2-oxocyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(C(C)C#N)CCCCC1=O ZLHGGXBDLPPRTK-UHFFFAOYSA-N 0.000 claims description 3
- FGSGHBPKHFDJOP-UHFFFAOYSA-N ethyl 2-oxocyclohexane-1-carboxylate Chemical compound CCOC(=O)C1CCCCC1=O FGSGHBPKHFDJOP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 150000004792 aryl magnesium halides Chemical class 0.000 claims description 2
- 125000005518 carboxamido group Chemical group 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims 2
- 150000003973 alkyl amines Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 150000001408 amides Chemical class 0.000 abstract description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 28
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 20
- 238000004821 distillation Methods 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 206010003119 arrhythmia Diseases 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- LPMXVESGRSUGHW-UHFFFAOYSA-N Acolongiflorosid K Natural products OC1C(O)C(O)C(C)OC1OC1CC2(O)CCC3C4(O)CCC(C=5COC(=O)C=5)C4(C)CC(O)C3C2(CO)C(O)C1 LPMXVESGRSUGHW-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- LPMXVESGRSUGHW-GHYGWZAOSA-N Ouabain Natural products O([C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O1)[C@H]1C[C@@H](O)[C@@]2(CO)[C@@](O)(C1)CC[C@H]1[C@]3(O)[C@@](C)([C@H](C4=CC(=O)OC4)CC3)C[C@@H](O)[C@H]21 LPMXVESGRSUGHW-GHYGWZAOSA-N 0.000 description 8
- 244000166550 Strophanthus gratus Species 0.000 description 8
- 230000006793 arrhythmia Effects 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- LPMXVESGRSUGHW-HBYQJFLCSA-N ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 8
- 229960003343 ouabain Drugs 0.000 description 8
- 239000008346 aqueous phase Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- ZWHXIFNNXXKYQV-UHFFFAOYSA-N ethyl 1-(3-bromopropyl)-2-phenylcyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(CCCBr)CCCCC1C1=CC=CC=C1 ZWHXIFNNXXKYQV-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- AYKOYYPHXSQPOU-UHFFFAOYSA-N ethyl 2-phenylcyclohexane-1-carboxylate Chemical compound CCOC(=O)C1CCCCC1C1=CC=CC=C1 AYKOYYPHXSQPOU-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 3
- 239000011368 organic material Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- OANXCEQREFYAIQ-UHFFFAOYSA-N 2-phenylcyclohexane-1-carbonitrile Chemical compound N#CC1CCCCC1C1=CC=CC=C1 OANXCEQREFYAIQ-UHFFFAOYSA-N 0.000 description 2
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000003531 anti-dysrhythmic effect Effects 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001934 cyclohexanes Chemical class 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 2
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- OZXAZKNWBIADLD-UHFFFAOYSA-N ethyl 1-(3-aminopropyl)-2-phenylcyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(CCCN)CCCCC1C1=CC=CC=C1 OZXAZKNWBIADLD-UHFFFAOYSA-N 0.000 description 2
- FXMLNPDQVDJPHS-UHFFFAOYSA-N ethyl 2-phenyl-1-prop-2-enylcyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(CC=C)CCCCC1C1=CC=CC=C1 FXMLNPDQVDJPHS-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- XPXMKIXDFWLRAA-UHFFFAOYSA-N hydrazinide Chemical compound [NH-]N XPXMKIXDFWLRAA-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- RYCSAYKPHHASEB-UHFFFAOYSA-N 1-[1-(dimethylamino)ethyl]-2-phenylcyclohexane-1-carbonitrile Chemical compound CN(C(C)C1(C(CCCC1)C1=CC=CC=C1)C#N)C RYCSAYKPHHASEB-UHFFFAOYSA-N 0.000 description 1
- SJLLLEBFOOEFCU-UHFFFAOYSA-N 1-[1-(dimethylamino)ethyl]-n-methyl-2-phenylcyclohexane-1-carboxamide Chemical compound CNC(=O)C1(C(C)N(C)C)CCCCC1C1=CC=CC=C1 SJLLLEBFOOEFCU-UHFFFAOYSA-N 0.000 description 1
- NTVOKYSQWFXKDO-UHFFFAOYSA-N 1-[1-(dimethylamino)propyl]-2-phenylcyclohexane-1-carbonitrile Chemical compound CN(C(CC)C1(C(CCCC1)C1=CC=CC=C1)C#N)C NTVOKYSQWFXKDO-UHFFFAOYSA-N 0.000 description 1
- OTSNVGGFDPWQOH-UHFFFAOYSA-N 1-[3-(dimethylamino)propyl]-2-hydroxy-2-phenylcyclohexane-1-carboxylic acid Chemical compound CN(C)CCCC1(C(O)=O)CCCCC1(O)C1=CC=CC=C1 OTSNVGGFDPWQOH-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- ILYSAKHOYBPSPC-UHFFFAOYSA-N 2-phenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1 ILYSAKHOYBPSPC-UHFFFAOYSA-N 0.000 description 1
- KNEOMRJGGYPQDR-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1-carboxylic acid Chemical compound OC(=O)C1C=CCC=C1C1=CC=CC=C1 KNEOMRJGGYPQDR-UHFFFAOYSA-N 0.000 description 1
- DRLVMOAWNVOSPE-UHFFFAOYSA-N 2-phenylcyclohexan-1-one Chemical compound O=C1CCCCC1C1=CC=CC=C1 DRLVMOAWNVOSPE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 238000006824 Eschweiler-Clarke methylation reaction Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 125000005219 aminonitrile group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 206010061592 cardiac fibrillation Diseases 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 150000001916 cyano esters Chemical class 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- HPTSVSJDUUFKIF-UHFFFAOYSA-N ethyl 1-(3-aminopropyl)-2-hydroxy-2-phenylcyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(CCCN)CCCCC1(O)C1=CC=CC=C1 HPTSVSJDUUFKIF-UHFFFAOYSA-N 0.000 description 1
- WDERVJUSDFNKGW-UHFFFAOYSA-N ethyl 1-(3-azidopropyl)-2-phenylcyclohexane-1-carboxylate Chemical compound [N-]=[N+]=NCCCC1(C(=O)OCC)CCCCC1C1=CC=CC=C1 WDERVJUSDFNKGW-UHFFFAOYSA-N 0.000 description 1
- OBKFRDIAWHAWPD-UHFFFAOYSA-N ethyl 1-[1-(dimethylamino)ethyl]-2-phenylcyclohexane-1-carboxylate Chemical compound CCOC(=O)C1(C(C)N(C)C)CCCCC1C1=CC=CC=C1 OBKFRDIAWHAWPD-UHFFFAOYSA-N 0.000 description 1
- XRLBLNLJGUHNKJ-UHFFFAOYSA-N ethyl 1-[3-(cyclohexylamino)propyl]-2-phenylcyclohexane-1-carboxylate Chemical compound C1CCCC(C=2C=CC=CC=2)C1(C(=O)OCC)CCCNC1CCCCC1 XRLBLNLJGUHNKJ-UHFFFAOYSA-N 0.000 description 1
- VMLKTGWPNMUGIM-UHFFFAOYSA-N ethyl 1-[3-(dimethylamino)propyl]-2-hydroxy-2-phenylcyclohexane-1-carboxylate Chemical compound CN(C)CCCC1(C(=O)OCC)CCCCC1(O)C1=CC=CC=C1 VMLKTGWPNMUGIM-UHFFFAOYSA-N 0.000 description 1
- JJOYCHKVKWDMEA-UHFFFAOYSA-N ethyl cyclohexanecarboxylate Chemical compound CCOC(=O)C1CCCCC1 JJOYCHKVKWDMEA-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002600 fibrillogenic effect Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011981 lindlar catalyst Substances 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- MAGVJLLHDZWQFM-UHFFFAOYSA-N n-chloro-n-methylmethanamine Chemical compound CN(C)Cl MAGVJLLHDZWQFM-UHFFFAOYSA-N 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical class CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000005147 toluenesulfonyl group Chemical group C=1(C(=CC=CC1)S(=O)(=O)*)C 0.000 description 1
- 230000002861 ventricular Effects 0.000 description 1
- 206010047302 ventricular tachycardia Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52470183A | 1983-08-19 | 1983-08-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO843307L true NO843307L (no) | 1985-02-20 |
Family
ID=24090317
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO843307A NO843307L (no) | 1983-08-19 | 1984-08-17 | Cykloheksankarbonksylsyrer og derivater derav |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0134889B1 (ja) |
| JP (1) | JPS6058951A (ja) |
| AT (1) | ATE30715T1 (ja) |
| AU (1) | AU563091B2 (ja) |
| DE (1) | DE3467341D1 (ja) |
| DK (1) | DK395784A (ja) |
| FI (1) | FI843241A (ja) |
| IL (1) | IL71763A0 (ja) |
| NO (1) | NO843307L (ja) |
| PH (1) | PH19434A (ja) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8729179B1 (en) * | 2012-08-20 | 2014-05-20 | Henkel US IP LLC | Moisture curable polyacrylates |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT230351B (de) * | 1960-05-18 | 1963-12-10 | Merck Ag E | Verfahren zur Herstellung von neuen Cyclohexanderivaten und deren Säureadditionssalzen bzw. quaternären Ammoniumverbindungen |
| DE1793383C3 (de) * | 1968-09-10 | 1979-03-01 | Knoll Ag, 6700 Ludwigshafen | 4-Cyan-4-phenyl-aminocyclohexane und deren wasserlösliche Salze, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| US3974157A (en) * | 1974-03-04 | 1976-08-10 | Pennwalt Corporation | 1-(Amino-alkyl)-2-aryl-cyclohexane alcohols and esters |
-
1984
- 1984-05-02 DE DE8484104894T patent/DE3467341D1/de not_active Expired
- 1984-05-02 EP EP84104894A patent/EP0134889B1/en not_active Expired
- 1984-05-02 AT AT84104894T patent/ATE30715T1/de not_active IP Right Cessation
- 1984-05-04 AU AU27695/84A patent/AU563091B2/en not_active Ceased
- 1984-05-04 IL IL71763A patent/IL71763A0/xx unknown
- 1984-05-16 PH PH30679A patent/PH19434A/en unknown
- 1984-07-30 JP JP59157720A patent/JPS6058951A/ja active Pending
- 1984-08-16 FI FI843241A patent/FI843241A/fi not_active Application Discontinuation
- 1984-08-17 DK DK395784A patent/DK395784A/da not_active Application Discontinuation
- 1984-08-17 NO NO843307A patent/NO843307L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3467341D1 (en) | 1987-12-17 |
| EP0134889B1 (en) | 1987-11-11 |
| FI843241A (fi) | 1985-02-20 |
| JPS6058951A (ja) | 1985-04-05 |
| AU2769584A (en) | 1985-02-21 |
| ATE30715T1 (de) | 1987-11-15 |
| FI843241A0 (fi) | 1984-08-16 |
| AU563091B2 (en) | 1987-06-25 |
| EP0134889A2 (en) | 1985-03-27 |
| DK395784D0 (da) | 1984-08-17 |
| EP0134889A3 (en) | 1985-07-31 |
| IL71763A0 (en) | 1984-09-30 |
| DK395784A (da) | 1985-02-20 |
| PH19434A (en) | 1986-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0158775B1 (en) | Substituted sulfonamidobenzamides, antiarrythmic agents and compositions thereof | |
| DE69615025T2 (de) | Benzamid-derivate und deren verwendung als vasopressin-antagonisten | |
| CA2727932A1 (en) | A process for the preparation of the apoptosis promoter abt-263 | |
| US5648540A (en) | Amine preparation | |
| EP0889874B1 (en) | 7-amino-2-heptenoates and their use in the preparation of methylphenidate | |
| KR950006891B1 (ko) | 아미노 알코올의 제조방법 | |
| FI72508B (fi) | Foerfarande foer framstaellning av n-propylacetonitrilderivat. | |
| NO843307L (no) | Cykloheksankarbonksylsyrer og derivater derav | |
| NO124430B (ja) | ||
| EP0664799B1 (en) | Amide derivatives | |
| EP0389425B1 (de) | Neue Benzothiopyranylamine | |
| US4474783A (en) | Cyclopropylmethyl piperazines, the process for preparing the same and their use in therapeutics | |
| US4595759A (en) | Cyclohexane carboxylic acids and derivatives thereof as antidysrhythmic agents | |
| JPH05239005A (ja) | Ｎ−（２−アミノエチル）ベンズアミド類およびその新規中間体 | |
| US3555093A (en) | 2,alpha-dimenthyl-beta-ethyl-beta-(p-fluorophenyl)-ethylamines and the salts thereof | |
| US4013641A (en) | Indolobenzoxazepines | |
| DK168741B1 (da) | Phenyleddikesyrederivater, lægemiddel indeholdende et sådant derivat, anvendelse af et sådant derivat til fremstilling af et lægemiddel, fremgangsmåde til fremstilling af lægemidlet samt analogifremgangsmåde til fremstilling af phenyleddikesyrederivaterne | |
| US3153093A (en) | Amino derivatives of nu-cyclopropylbenzylamines | |
| US3631107A (en) | N n'-bis(acenaphthenylmethyl)-cyclohexanebis(methylamines) and the salts thereof | |
| JPH02104577A (ja) | テトラヒドロピリミジン化合物の製造法 | |
| US2789122A (en) | Aminoalkyl trimethylsilylbenzoates | |
| JP2601661B2 (ja) | 新規なアルキレンジアミン誘導体およびグルタミン酸遮断剤 | |
| US3211736A (en) | N-[(1-piperidyl)-lower-alkyl]-(3-, 2-, and 1-indolyl)-lower-alkanoylamides | |
| JP2003507463A (ja) | 置換ピペラジン誘導体、その調製及びその薬物としての使用 | |
| KR820002047B1 (ko) | 피페리딘 유도체의 제조방법 |