NO842164L - Flytende vaskemiddel - Google Patents
Flytende vaskemiddelInfo
- Publication number
- NO842164L NO842164L NO842164A NO842164A NO842164L NO 842164 L NO842164 L NO 842164L NO 842164 A NO842164 A NO 842164A NO 842164 A NO842164 A NO 842164A NO 842164 L NO842164 L NO 842164L
- Authority
- NO
- Norway
- Prior art keywords
- weight
- surfactant
- detergent according
- enzyme
- detergents
- Prior art date
Links
- 239000003599 detergent Substances 0.000 title claims description 92
- 239000007788 liquid Substances 0.000 title claims description 36
- 108090000790 Enzymes Proteins 0.000 claims description 36
- 102000004190 Enzymes Human genes 0.000 claims description 36
- 229940088598 enzyme Drugs 0.000 claims description 36
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 33
- 239000002736 nonionic surfactant Substances 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 16
- 239000004094 surface-active agent Substances 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- 239000002280 amphoteric surfactant Substances 0.000 claims description 12
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 229910019142 PO4 Inorganic materials 0.000 claims description 8
- -1 alkali metal borates Chemical class 0.000 claims description 8
- 230000000087 stabilizing effect Effects 0.000 claims description 7
- 239000003945 anionic surfactant Substances 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 6
- 239000010452 phosphate Substances 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 229910021538 borax Inorganic materials 0.000 claims description 5
- 239000004328 sodium tetraborate Substances 0.000 claims description 5
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 4
- 239000004327 boric acid Substances 0.000 claims description 4
- 150000001639 boron compounds Chemical class 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 108090000637 alpha-Amylases Proteins 0.000 claims description 3
- 102000004139 alpha-Amylases Human genes 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 3
- 229910052810 boron oxide Inorganic materials 0.000 claims description 3
- 108091005658 Basic proteases Proteins 0.000 claims description 2
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000001509 sodium citrate Substances 0.000 claims description 2
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical group O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 description 20
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 13
- 125000000217 alkyl group Chemical group 0.000 description 11
- 239000000463 material Substances 0.000 description 11
- 230000000694 effects Effects 0.000 description 7
- 150000002191 fatty alcohols Chemical class 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000003860 storage Methods 0.000 description 6
- 239000007844 bleaching agent Substances 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 235000021317 phosphate Nutrition 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 229940079919 digestives enzyme preparation Drugs 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical class CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 239000006081 fluorescent whitening agent Substances 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 108010003855 mesentericopeptidase Proteins 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229920005646 polycarboxylate Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- YGUMVDWOQQJBGA-VAWYXSNFSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-VAWYXSNFSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 108010056079 Subtilisins Proteins 0.000 description 1
- 102000005158 Subtilisins Human genes 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229940024171 alpha-amylase Drugs 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000019219 chocolate Nutrition 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 description 1
- 229940043276 diisopropanolamine Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 229960004068 hexachlorophene Drugs 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- MOWNZPNSYMGTMD-UHFFFAOYSA-N oxidoboron Chemical class O=[B] MOWNZPNSYMGTMD-UHFFFAOYSA-N 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- ZAWGLAXBGYSUHN-UHFFFAOYSA-M sodium;2-[bis(carboxymethyl)amino]acetate Chemical compound [Na+].OC(=O)CN(CC(O)=O)CC([O-])=O ZAWGLAXBGYSUHN-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 108010075550 termamyl Proteins 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- KVSKGMLNBAPGKH-UHFFFAOYSA-N tribromosalicylanilide Chemical compound OC1=C(Br)C=C(Br)C=C1C(=O)NC1=CC=C(Br)C=C1 KVSKGMLNBAPGKH-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Cleaning Or Drying Semiconductors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US49964983A | 1983-05-31 | 1983-05-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO842164L true NO842164L (no) | 1984-12-03 |
Family
ID=23986110
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO842164A NO842164L (no) | 1983-05-31 | 1984-05-30 | Flytende vaskemiddel |
Country Status (24)
| Country | Link |
|---|---|
| AT (1) | AT394573B (el) |
| AU (1) | AU564917B2 (el) |
| BE (1) | BE899779A (el) |
| BR (1) | BR8402594A (el) |
| CA (1) | CA1220742A (el) |
| CH (1) | CH659478A5 (el) |
| DE (1) | DE3418295A1 (el) |
| DK (1) | DK165187C (el) |
| ES (1) | ES8706808A1 (el) |
| FR (1) | FR2546901B1 (el) |
| GB (1) | GB2140818B (el) |
| GR (1) | GR81585B (el) |
| HK (1) | HK18392A (el) |
| IT (1) | IT1177763B (el) |
| LU (1) | LU85391A1 (el) |
| MX (1) | MX161670A (el) |
| MY (1) | MY102606A (el) |
| NL (1) | NL8401741A (el) |
| NO (1) | NO842164L (el) |
| NZ (1) | NZ208157A (el) |
| PH (1) | PH20171A (el) |
| PT (1) | PT78654B (el) |
| SE (1) | SE8402870L (el) |
| ZA (1) | ZA843666B (el) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4537706A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid to stabilize enzymes |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| ZA856296B (en) * | 1984-08-31 | 1987-03-25 | Colgate Palmolive Co | Hot water wash cycle detergent-softener compositions |
| NZ216792A (en) * | 1985-07-26 | 1989-04-26 | Colgate Palmolive Co | Stabilised,fabric-softening built detergent compositions containing enzymes and swelling bentonite clay |
| US4842769A (en) * | 1985-07-26 | 1989-06-27 | Colgate-Palmolive Co. | Stabilized fabric softening built detergent composition containing enzymes |
| US4900475A (en) * | 1985-07-26 | 1990-02-13 | Colgate-Palmolive Co. | Stabilized built liquid detergent composition containing enzyme |
| SE467827B (sv) * | 1985-07-26 | 1992-09-21 | Colgate Palmolive Co | Stabiliserad enzyminnehaallande foerstaerkt flytande detergentkomposition och dess anvaendning vid tvaettning av textilier |
| US4959179A (en) * | 1989-01-30 | 1990-09-25 | Lever Brothers Company | Stabilized enzymes liquid detergent composition containing lipase and protease |
| US5089163A (en) * | 1989-01-30 | 1992-02-18 | Lever Brothers Company, Division Of Conopco, Inc. | Enzymatic liquid detergent composition |
| EP0476212A1 (en) * | 1990-09-17 | 1992-03-25 | The Procter & Gamble Company | Liquid detergent compositions |
| HU213044B (en) * | 1991-04-30 | 1997-01-28 | Procter & Gamble | Built liquid detergents with boric-polyol complex to inhibit proteolytic enzyme with additives improving detergent effect |
| US5358656A (en) * | 1991-12-31 | 1994-10-25 | Lever Brothers Company, Division Of Conopco, Inc. | Compositions comprising glyceroglycolipids having an amine linkage as a surfactant or cosurfactant |
| JP2540435B2 (ja) * | 1993-06-21 | 1996-10-02 | 花王株式会社 | 硬質表面用洗浄剤組成物 |
| US6624132B1 (en) * | 2000-06-29 | 2003-09-23 | Ecolab Inc. | Stable liquid enzyme compositions with enhanced activity |
| US7795199B2 (en) | 2000-06-29 | 2010-09-14 | Ecolab Inc. | Stable antimicrobial compositions including spore, bacteria, fungi, and/or enzyme |
| US7964548B2 (en) | 2009-01-20 | 2011-06-21 | Ecolab Usa Inc. | Stable aqueous antimicrobial enzyme compositions |
| US7723281B1 (en) | 2009-01-20 | 2010-05-25 | Ecolab Inc. | Stable aqueous antimicrobial enzyme compositions comprising a tertiary amine antimicrobial |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI61715C (fi) * | 1976-11-01 | 1982-09-10 | Unilever Nv | Enzymer innehaollande stabiliserad flytande detergentkomposition |
| US4261868A (en) * | 1979-08-08 | 1981-04-14 | Lever Brothers Company | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound |
| IT1129814B (it) * | 1980-07-02 | 1986-06-11 | Unilever Nv | Composizione detergente enzimatica liquida |
| DE3264685D1 (en) * | 1981-11-13 | 1985-08-14 | Unilever Nv | Enzymatic liquid cleaning composition |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
-
1984
- 1984-05-14 NZ NZ208157A patent/NZ208157A/en unknown
- 1984-05-15 ZA ZA843666A patent/ZA843666B/xx unknown
- 1984-05-17 AU AU28315/84A patent/AU564917B2/en not_active Ceased
- 1984-05-17 DE DE19843418295 patent/DE3418295A1/de not_active Ceased
- 1984-05-23 CH CH2563/84A patent/CH659478A5/de not_active IP Right Cessation
- 1984-05-24 FR FR8408169A patent/FR2546901B1/fr not_active Expired
- 1984-05-28 PT PT78654A patent/PT78654B/pt unknown
- 1984-05-28 SE SE8402870A patent/SE8402870L/ unknown
- 1984-05-29 IT IT48276/84A patent/IT1177763B/it active
- 1984-05-29 GB GB08413672A patent/GB2140818B/en not_active Expired
- 1984-05-29 BE BE0/213026A patent/BE899779A/fr not_active IP Right Cessation
- 1984-05-30 AT AT0178484A patent/AT394573B/de active
- 1984-05-30 LU LU85391A patent/LU85391A1/fr unknown
- 1984-05-30 BR BR8402594A patent/BR8402594A/pt not_active IP Right Cessation
- 1984-05-30 CA CA000455402A patent/CA1220742A/en not_active Expired
- 1984-05-30 GR GR74873A patent/GR81585B/el unknown
- 1984-05-30 PH PH30740A patent/PH20171A/en unknown
- 1984-05-30 NL NL8401741A patent/NL8401741A/nl not_active Application Discontinuation
- 1984-05-30 DK DK269184A patent/DK165187C/da active
- 1984-05-30 NO NO842164A patent/NO842164L/no unknown
- 1984-05-30 ES ES532929A patent/ES8706808A1/es not_active Expired
- 1984-05-31 MX MX201517A patent/MX161670A/es unknown
-
1987
- 1987-09-29 MY MYPI87002252A patent/MY102606A/en unknown
-
1992
- 1992-03-05 HK HK183/92A patent/HK18392A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU2831584A (en) | 1984-12-06 |
| PT78654A (en) | 1984-06-01 |
| LU85391A1 (fr) | 1985-03-21 |
| IT1177763B (it) | 1987-08-26 |
| BR8402594A (pt) | 1985-04-23 |
| ATA178484A (de) | 1991-10-15 |
| ES532929A0 (es) | 1987-06-16 |
| SE8402870D0 (sv) | 1984-05-28 |
| PH20171A (en) | 1986-10-14 |
| PT78654B (en) | 1986-08-05 |
| DE3418295A1 (de) | 1984-12-06 |
| AT394573B (de) | 1992-05-11 |
| FR2546901B1 (fr) | 1987-04-17 |
| CH659478A5 (de) | 1987-01-30 |
| ES8706808A1 (es) | 1987-06-16 |
| DK269184D0 (da) | 1984-05-30 |
| AU564917B2 (en) | 1987-09-03 |
| SE8402870L (sv) | 1984-12-01 |
| HK18392A (en) | 1992-03-13 |
| IT8448276A0 (it) | 1984-05-29 |
| FR2546901A1 (fr) | 1984-12-07 |
| NL8401741A (nl) | 1984-12-17 |
| DK269184A (da) | 1984-12-01 |
| MX161670A (es) | 1990-12-10 |
| GB2140818B (en) | 1987-01-21 |
| DK165187C (da) | 1993-03-15 |
| GR81585B (el) | 1984-12-11 |
| MY102606A (en) | 1992-08-17 |
| ZA843666B (en) | 1985-12-24 |
| GB8413672D0 (en) | 1984-07-04 |
| GB2140818A (en) | 1984-12-05 |
| DK165187B (da) | 1992-10-19 |
| NZ208157A (en) | 1986-11-12 |
| BE899779A (fr) | 1984-11-29 |
| CA1220742A (en) | 1987-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4670179A (en) | Stabilized built single phase liquid detergent composition containing enzymes | |
| NO160451B (no) | Flytende, enzymholdig vaskemiddel. | |
| NO842164L (no) | Flytende vaskemiddel | |
| US4842758A (en) | Stabilized enzyme system for use in aqueous liquid built detergent compositions | |
| USH1776H (en) | Enzyme-containing heavy duty liquid detergent | |
| EP0135227B1 (en) | Machine-dishwashing compositions | |
| US5437686A (en) | Peroxygen bleach composition activated by bi and tricyclic diketones | |
| US5698507A (en) | Nonaqueous gelled automatic dishwashing composition | |
| US4652394A (en) | Built single phase liquid anionic detergent compositions containing stabilized enzymes | |
| JPH0463920B2 (el) | ||
| JPH0241398A (ja) | 安定化酵素液体洗剤組成物 | |
| US4842767A (en) | Heavy duty built aqueous liquid detergent composition containing stabilized enzymes | |
| US5512206A (en) | Peroxygen bleach composition | |
| KR940010119B1 (ko) | 효소를 함유하는 안정화되고 증강된 액체 세제 조성물과 이를 이용한 세탁방법 | |
| CA1208578A (en) | Liquid detergent composition with mixed enzyme formulation | |
| US5785887A (en) | Peroxygen bleach composition | |
| WO2001002531A1 (en) | Transparent or translucent, liquid or gel type automatic dishwashing detergent product | |
| JP2020084141A (ja) | 繊維製品用の液体洗浄剤組成物 | |
| CA2325159A1 (en) | Enzyme-containing liquid detergent of relatively high viscosity | |
| EP0103926A1 (en) | Aqueous liquid detergent compositions | |
| WO2001029171A1 (en) | Liquid or gel detergent with increased specific gravity | |
| CS273853B1 (en) | Method of enzymatic components stabilization in liquid or pasty-like detergents |