NO831361L - Fremgangsmaate ved fremstilling av terapeutisk aktive oxazolderivater. - Google Patents
Fremgangsmaate ved fremstilling av terapeutisk aktive oxazolderivater.Info
- Publication number
- NO831361L NO831361L NO831361A NO831361A NO831361L NO 831361 L NO831361 L NO 831361L NO 831361 A NO831361 A NO 831361A NO 831361 A NO831361 A NO 831361A NO 831361 L NO831361 L NO 831361L
- Authority
- NO
- Norway
- Prior art keywords
- compound
- formula
- pharmaceutically acceptable
- acceptable salt
- propionic acid
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 4
- 238000000034 method Methods 0.000 title claims description 32
- 230000001225 therapeutic effect Effects 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 125
- 150000003839 salts Chemical class 0.000 claims abstract description 29
- 150000002148 esters Chemical class 0.000 claims abstract description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 8
- 150000002367 halogens Chemical class 0.000 claims abstract description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 150000007978 oxazole derivatives Chemical class 0.000 claims abstract description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- -1 4-(2-trifluoromethylphenyl)-oxazole-5-propionic acid Chemical compound 0.000 claims description 11
- 238000006460 hydrolysis reaction Methods 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- ALVAZNQNOCUYIF-UHFFFAOYSA-N 3-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C=CC(Cl)=CC=2)=C1CCC(O)=O ALVAZNQNOCUYIF-UHFFFAOYSA-N 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 7
- 238000006114 decarboxylation reaction Methods 0.000 claims description 6
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 claims description 5
- 238000003381 deacetylation reaction Methods 0.000 claims description 4
- RHPCJIOKZZBQTJ-UHFFFAOYSA-N methyl 3-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propanoate Chemical compound O1C(C)=NC(C=2C=CC(Cl)=CC=2)=C1CCC(=O)OC RHPCJIOKZZBQTJ-UHFFFAOYSA-N 0.000 claims description 4
- DFPFEEAAQNAJCB-UHFFFAOYSA-N 3-(2-methyl-4-phenyl-1,3-oxazol-5-yl)propanoic acid Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CCC(O)=O DFPFEEAAQNAJCB-UHFFFAOYSA-N 0.000 claims description 3
- AFROAEDZUOVNQN-UHFFFAOYSA-N 3-[2-methyl-4-(4-methylsulfanylphenyl)-1,3-oxazol-5-yl]propanoic acid Chemical compound C1=CC(SC)=CC=C1C1=C(CCC(O)=O)OC(C)=N1 AFROAEDZUOVNQN-UHFFFAOYSA-N 0.000 claims description 3
- 125000006165 cyclic alkyl group Chemical group 0.000 claims description 3
- 238000005695 dehalogenation reaction Methods 0.000 claims description 3
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 claims description 3
- IMQLMNKPVZWZDI-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]acetic acid Chemical compound O1C(C)=NC(C=2C=CC(Cl)=CC=2)=C1CC(O)=O IMQLMNKPVZWZDI-UHFFFAOYSA-N 0.000 claims description 2
- GNBSIPXHYGSMOG-UHFFFAOYSA-N 3-(2-pentyl-4-phenyl-1,3-oxazol-5-yl)propanoic acid Chemical compound O1C(CCCCC)=NC(C=2C=CC=CC=2)=C1CCC(O)=O GNBSIPXHYGSMOG-UHFFFAOYSA-N 0.000 claims description 2
- CPRBZLXFXDHVBG-UHFFFAOYSA-N 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C=C(C=CC=2)C(F)(F)F)=C1CCC(O)=O CPRBZLXFXDHVBG-UHFFFAOYSA-N 0.000 claims description 2
- COYRLTVESNXWPU-UHFFFAOYSA-N 3-[2-methyl-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C=CC(=CC=2)C(F)(F)F)=C1CCC(O)=O COYRLTVESNXWPU-UHFFFAOYSA-N 0.000 claims description 2
- JWNJYAZPDMZHJN-UHFFFAOYSA-N 3-[4-(2-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C(=CC=CC=2)Cl)=C1CCC(O)=O JWNJYAZPDMZHJN-UHFFFAOYSA-N 0.000 claims description 2
- BDGADINMMVHXDJ-UHFFFAOYSA-N 3-[4-(4-chlorophenyl)-2-ethyl-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(CC)=NC(C=2C=CC(Cl)=CC=2)=C1CCC(O)=O BDGADINMMVHXDJ-UHFFFAOYSA-N 0.000 claims description 2
- CAAMUUFJGWXRLO-UHFFFAOYSA-N 3-[5-(4-fluorophenyl)-2-methyl-2h-1,3-oxazol-5-yl]propanoic acid Chemical compound C1=NC(C)OC1(CCC(O)=O)C1=CC=C(F)C=C1 CAAMUUFJGWXRLO-UHFFFAOYSA-N 0.000 claims description 2
- MQKACGXBCCZRHJ-UHFFFAOYSA-N methyl 2-(2-methyl-4-phenyl-1,3-oxazol-5-yl)acetate Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CC(=O)OC MQKACGXBCCZRHJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- OVMBZZKKMVGKKT-UHFFFAOYSA-N 2-(2-methyl-4-phenyl-3h-1,3-oxazol-2-yl)acetic acid Chemical compound O1C(C)(CC(O)=O)NC(C=2C=CC=CC=2)=C1 OVMBZZKKMVGKKT-UHFFFAOYSA-N 0.000 claims 1
- MXDYWVBMZPSMPV-UHFFFAOYSA-N 3-(4-phenyl-1,3-oxazol-5-yl)propanoic acid Chemical compound O1C=NC(C=2C=CC=CC=2)=C1CCC(=O)O MXDYWVBMZPSMPV-UHFFFAOYSA-N 0.000 claims 1
- BTTBUYBJOVKRSL-UHFFFAOYSA-N 3-[4-(3-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C=C(Cl)C=CC=2)=C1CCC(O)=O BTTBUYBJOVKRSL-UHFFFAOYSA-N 0.000 claims 1
- 238000006297 dehydration reaction Methods 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 110
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 108
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 77
- 239000002904 solvent Substances 0.000 description 69
- 239000000203 mixture Substances 0.000 description 56
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 48
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 239000000243 solution Substances 0.000 description 39
- 235000019441 ethanol Nutrition 0.000 description 38
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 35
- 238000006243 chemical reaction Methods 0.000 description 31
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 238000003756 stirring Methods 0.000 description 21
- 238000000921 elemental analysis Methods 0.000 description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- 238000001816 cooling Methods 0.000 description 18
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 16
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 16
- 239000008103 glucose Substances 0.000 description 16
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 15
- 239000013078 crystal Substances 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 239000008280 blood Substances 0.000 description 12
- 210000004369 blood Anatomy 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- 235000017557 sodium bicarbonate Nutrition 0.000 description 12
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 12
- 239000003513 alkali Substances 0.000 description 11
- 230000000694 effects Effects 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 239000003480 eluent Substances 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 4
- 244000215068 Acacia senegal Species 0.000 description 4
- 229920000084 Gum arabic Polymers 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000000205 acacia gum Substances 0.000 description 4
- 235000010489 acacia gum Nutrition 0.000 description 4
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 230000002218 hypoglycaemic effect Effects 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- OBPIBYXSSAQSKY-UHFFFAOYSA-N 2,5-dimethyl-4-(4-methylsulfanylphenyl)-1,3-oxazole Chemical compound C1=CC(SC)=CC=C1C1=C(C)OC(C)=N1 OBPIBYXSSAQSKY-UHFFFAOYSA-N 0.000 description 3
- HUBNWLCTGNYTAJ-UHFFFAOYSA-N 2-(4-phenyl-1,3-oxazol-5-yl)ethanol Chemical compound O1C=NC(C=2C=CC=CC=2)=C1CCO HUBNWLCTGNYTAJ-UHFFFAOYSA-N 0.000 description 3
- IVWJHBBSIIBJOE-UHFFFAOYSA-N 5-(bromomethyl)-4-(4-chlorophenyl)-2-methyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC(Cl)=CC=2)=C1CBr IVWJHBBSIIBJOE-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- 102000004877 Insulin Human genes 0.000 description 3
- 108090001061 Insulin Proteins 0.000 description 3
- 206010022489 Insulin Resistance Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003472 antidiabetic agent Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 239000012024 dehydrating agents Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 3
- 229940125396 insulin Drugs 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- ADCYRBXQAJXJTD-UHFFFAOYSA-N 1-(4-chlorophenyl)propan-1-one Chemical compound CCC(=O)C1=CC=C(Cl)C=C1 ADCYRBXQAJXJTD-UHFFFAOYSA-N 0.000 description 2
- YMHOBZXQZVXHBM-UHFFFAOYSA-N 2,5-dimethoxy-4-bromophenethylamine Chemical compound COC1=CC(CCN)=C(OC)C=C1Br YMHOBZXQZVXHBM-UHFFFAOYSA-N 0.000 description 2
- QENAMZROPYWQIP-UHFFFAOYSA-N 2,5-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,3-oxazole Chemical compound O1C(C)=NC(C=2C(=CC=CC=2)C(F)(F)F)=C1C QENAMZROPYWQIP-UHFFFAOYSA-N 0.000 description 2
- IZYMNAPMPOVXPP-UHFFFAOYSA-N 2,5-dimethyl-4-phenyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1C IZYMNAPMPOVXPP-UHFFFAOYSA-N 0.000 description 2
- QPKXWZMCORUMPZ-UHFFFAOYSA-N 2-(2-methyl-4-phenyl-1,3-oxazol-5-yl)ethanol Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CCO QPKXWZMCORUMPZ-UHFFFAOYSA-N 0.000 description 2
- MGRAASWXOBPOPG-UHFFFAOYSA-N 2-(2-methyl-5-phenyl-2h-1,3-oxazol-5-yl)ethyl acetate Chemical compound C1=NC(C)OC1(CCOC(C)=O)C1=CC=CC=C1 MGRAASWXOBPOPG-UHFFFAOYSA-N 0.000 description 2
- PXOMLWDUHVRBNZ-UHFFFAOYSA-N 2-(4-phenyl-1,3-oxazol-5-yl)ethyl formate Chemical compound O1C=NC(C=2C=CC=CC=2)=C1CCOC=O PXOMLWDUHVRBNZ-UHFFFAOYSA-N 0.000 description 2
- JVTBKYPFCIQZAR-UHFFFAOYSA-N 2-chloro-3-[2-methyl-4-[2-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C(=CC=CC=2)C(F)(F)F)=C1CC(Cl)C(O)=O JVTBKYPFCIQZAR-UHFFFAOYSA-N 0.000 description 2
- MYKBTZOZOCIVRK-UHFFFAOYSA-N 2-chloro-3-[4-(4-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C=CC(Cl)=CC=2)=C1CC(Cl)C(O)=O MYKBTZOZOCIVRK-UHFFFAOYSA-N 0.000 description 2
- XCWDBIUGBNRURK-UHFFFAOYSA-N 3-(2-methyl-4-phenyl-1,3-oxazol-5-yl)propanenitrile Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CCC#N XCWDBIUGBNRURK-UHFFFAOYSA-N 0.000 description 2
- RXQHJPSGAKFUJN-UHFFFAOYSA-N 4-(4-chlorophenyl)-2,5-dimethyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC(Cl)=CC=2)=C1C RXQHJPSGAKFUJN-UHFFFAOYSA-N 0.000 description 2
- JQFNKZOMRMAVFN-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-ethyl-5-methyl-1,3-oxazole Chemical compound O1C(CC)=NC(C=2C=CC(Cl)=CC=2)=C1C JQFNKZOMRMAVFN-UHFFFAOYSA-N 0.000 description 2
- FZUIUKOOUSSDJU-UHFFFAOYSA-N 5-(2-chloroethyl)-2-methyl-4-phenyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CCCl FZUIUKOOUSSDJU-UHFFFAOYSA-N 0.000 description 2
- JQDMXFLQILCGIP-UHFFFAOYSA-N 5-(2-iodoethyl)-2-methyl-4-phenyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CCI JQDMXFLQILCGIP-UHFFFAOYSA-N 0.000 description 2
- XBXDTYJCVWGVIR-UHFFFAOYSA-N 5-(2-iodoethyl)-4-phenyl-1,3-oxazole Chemical compound O1C=NC(C=2C=CC=CC=2)=C1CCI XBXDTYJCVWGVIR-UHFFFAOYSA-N 0.000 description 2
- RHVJGNWRGVKTLQ-UHFFFAOYSA-N 5-(bromomethyl)-2-methyl-4-[2-(trifluoromethyl)phenyl]-1,3-oxazole Chemical compound O1C(C)=NC(C=2C(=CC=CC=2)C(F)(F)F)=C1CBr RHVJGNWRGVKTLQ-UHFFFAOYSA-N 0.000 description 2
- LVGYIPQRAINTMA-UHFFFAOYSA-N 5-(bromomethyl)-2-methyl-4-phenyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CBr LVGYIPQRAINTMA-UHFFFAOYSA-N 0.000 description 2
- WDQAAOVOWDOSMD-UHFFFAOYSA-N 5-(bromomethyl)-2-pentyl-4-phenyl-1,3-oxazole Chemical compound O1C(CCCCC)=NC(C=2C=CC=CC=2)=C1CBr WDQAAOVOWDOSMD-UHFFFAOYSA-N 0.000 description 2
- QOGKVRZABLIABN-UHFFFAOYSA-N 5-(bromomethyl)-4-(3-chlorophenyl)-2-methyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=C(Cl)C=CC=2)=C1CBr QOGKVRZABLIABN-UHFFFAOYSA-N 0.000 description 2
- HFFXIWBQNJOUBY-UHFFFAOYSA-N 5-(bromomethyl)-4-(4-chlorophenyl)-2-ethyl-1,3-oxazole Chemical compound O1C(CC)=NC(C=2C=CC(Cl)=CC=2)=C1CBr HFFXIWBQNJOUBY-UHFFFAOYSA-N 0.000 description 2
- PCMKMYKILWQNCV-UHFFFAOYSA-N 5-methyl-2-pentyl-4-phenyl-1,3-oxazole Chemical compound O1C(CCCCC)=NC(C=2C=CC=CC=2)=C1C PCMKMYKILWQNCV-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 239000004366 Glucose oxidase Substances 0.000 description 2
- 108010015776 Glucose oxidase Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 241000545067 Venus Species 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229940127003 anti-diabetic drug Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 229910001863 barium hydroxide Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- ZFNFNRCUMGVNOY-UHFFFAOYSA-N diethyl 2-[(2-methyl-4-phenyl-1,3-oxazol-5-yl)methyl]propanedioate Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CC(C(=O)OCC)C(=O)OCC ZFNFNRCUMGVNOY-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- RDULEYWUGKOCMR-UHFFFAOYSA-N ethyl 2-chloro-3-oxobutanoate Chemical compound CCOC(=O)C(Cl)C(C)=O RDULEYWUGKOCMR-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229940116332 glucose oxidase Drugs 0.000 description 2
- 235000019420 glucose oxidase Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- HAKIIEZGTCJPMV-UHFFFAOYSA-N n-(2-oxo-1-phenylpropyl)hexanamide Chemical compound CCCCCC(=O)NC(C(C)=O)C1=CC=CC=C1 HAKIIEZGTCJPMV-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- PRXHANOJNVGVGC-UHFFFAOYSA-N 1,3-bis(4-ethoxyphenyl)thiourea Chemical compound C1=CC(OCC)=CC=C1NC(=S)NC1=CC=C(OCC)C=C1 PRXHANOJNVGVGC-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QIJNVLLXIIPXQT-UHFFFAOYSA-N 1-(4-fluorophenyl)propan-1-one Chemical compound CCC(=O)C1=CC=C(F)C=C1 QIJNVLLXIIPXQT-UHFFFAOYSA-N 0.000 description 1
- QFKOWENRSZZLPK-UHFFFAOYSA-N 1-[4-(trifluoromethyl)phenyl]propan-1-one Chemical compound CCC(=O)C1=CC=C(C(F)(F)F)C=C1 QFKOWENRSZZLPK-UHFFFAOYSA-N 0.000 description 1
- PLWANCOYVAFWCA-UHFFFAOYSA-N 1-amino-1-phenylpropan-2-one;hydrochloride Chemical compound Cl.CC(=O)C(N)C1=CC=CC=C1 PLWANCOYVAFWCA-UHFFFAOYSA-N 0.000 description 1
- XNZADSWHPZKBBY-UHFFFAOYSA-N 2,5-dimethyl-4-[3-(trifluoromethyl)phenyl]-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=C(C=CC=2)C(F)(F)F)=C1C XNZADSWHPZKBBY-UHFFFAOYSA-N 0.000 description 1
- YTEVYKQFTPDAHY-UHFFFAOYSA-N 2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC(=CC=2)C(F)(F)F)=C1C YTEVYKQFTPDAHY-UHFFFAOYSA-N 0.000 description 1
- RCLCQAAILJMTDQ-UHFFFAOYSA-N 2-(2-methyl-4-phenyl-1,3-oxazol-5-yl)acetic acid Chemical compound O1C(C)=NC(C=2C=CC=CC=2)=C1CC(O)=O RCLCQAAILJMTDQ-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- WPDWOCRJBPXJFM-UHFFFAOYSA-N 2-bromo-1-phenylpropan-1-one Chemical compound CC(Br)C(=O)C1=CC=CC=C1 WPDWOCRJBPXJFM-UHFFFAOYSA-N 0.000 description 1
- AXCPQHPNAZONTH-UHFFFAOYSA-N 2-chloro-1-phenylpropan-1-one Chemical compound CC(Cl)C(=O)C1=CC=CC=C1 AXCPQHPNAZONTH-UHFFFAOYSA-N 0.000 description 1
- FFSQUPZKCFPFEM-UHFFFAOYSA-N 3,3,3-trifluoro-2-methyl-1-phenylpropan-1-one Chemical compound FC(F)(F)C(C)C(=O)C1=CC=CC=C1 FFSQUPZKCFPFEM-UHFFFAOYSA-N 0.000 description 1
- FEULTNHBSPJOSP-UHFFFAOYSA-N 3-(4-phenyl-1,3-oxazol-5-yl)propanenitrile Chemical compound O1C=NC(C=2C=CC=CC=2)=C1CCC#N FEULTNHBSPJOSP-UHFFFAOYSA-N 0.000 description 1
- MWDLWLLNJPOVNY-UHFFFAOYSA-N 3-[2-methyl-4-[2-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid Chemical compound O1C(C)=NC(C=2C(=CC=CC=2)C(F)(F)F)=C1CCC(O)=O MWDLWLLNJPOVNY-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- IGOYRYSKKLREIH-UHFFFAOYSA-N 3-bromo-4-(4-chlorophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CC(Br)C(=O)C1=CC=C(Cl)C=C1 IGOYRYSKKLREIH-UHFFFAOYSA-N 0.000 description 1
- KTJRGPZVSKWRTJ-UHFFFAOYSA-N 3-chloro-1-phenylpropan-1-one Chemical compound ClCCC(=O)C1=CC=CC=C1 KTJRGPZVSKWRTJ-UHFFFAOYSA-N 0.000 description 1
- IRWRIGHYGSXWOL-UHFFFAOYSA-N 4,4,4-trifluoro-1-phenylbutan-1-one Chemical compound FC(F)(F)CCC(=O)C1=CC=CC=C1 IRWRIGHYGSXWOL-UHFFFAOYSA-N 0.000 description 1
- VOUIEQMKSQLUSM-UHFFFAOYSA-N 4-(3-chlorophenyl)-2,5-dimethyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=C(Cl)C=CC=2)=C1C VOUIEQMKSQLUSM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- AHVASTJJVAYFPY-UHFFFAOYSA-N 4-(4-chlorophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(Cl)C=C1 AHVASTJJVAYFPY-UHFFFAOYSA-N 0.000 description 1
- DALSJTSGNDYXSS-UHFFFAOYSA-N 4-(4-fluorophenyl)-2,5-dimethyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC(F)=CC=2)=C1C DALSJTSGNDYXSS-UHFFFAOYSA-N 0.000 description 1
- KMQLIDDEQAJAGJ-UHFFFAOYSA-N 4-oxo-4-phenylbutyric acid Chemical compound OC(=O)CCC(=O)C1=CC=CC=C1 KMQLIDDEQAJAGJ-UHFFFAOYSA-N 0.000 description 1
- BVLILROMUFYKGH-UHFFFAOYSA-N 5-(4-chlorophenyl)-5-oxopentanoic acid Chemical compound OC(=O)CCCC(=O)C1=CC=C(Cl)C=C1 BVLILROMUFYKGH-UHFFFAOYSA-N 0.000 description 1
- FWPSUHJHPZGRDT-UHFFFAOYSA-N 5-(bromomethyl)-2-methyl-4-[3-(trifluoromethyl)phenyl]-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=C(C=CC=2)C(F)(F)F)=C1CBr FWPSUHJHPZGRDT-UHFFFAOYSA-N 0.000 description 1
- MCMQWVVNMANULN-UHFFFAOYSA-N 5-(bromomethyl)-2-methyl-4-[4-(trifluoromethyl)phenyl]-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC(=CC=2)C(F)(F)F)=C1CBr MCMQWVVNMANULN-UHFFFAOYSA-N 0.000 description 1
- LAGFKUAVBGVMRH-UHFFFAOYSA-N 5-(bromomethyl)-4-(2-chlorophenyl)-2-methyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C(=CC=CC=2)Cl)=C1CBr LAGFKUAVBGVMRH-UHFFFAOYSA-N 0.000 description 1
- NNCBPHBXNPYCEA-UHFFFAOYSA-N 5-(bromomethyl)-4-(4-fluorophenyl)-2-methyl-1,3-oxazole Chemical compound O1C(C)=NC(C=2C=CC(F)=CC=2)=C1CBr NNCBPHBXNPYCEA-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241000725101 Clea Species 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000008589 Obesity Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000006196 deacetylation Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- LDJUDHMVLPUVRM-UHFFFAOYSA-N ethyl 3-[4-(3-chlorophenyl)-2-methyl-1,3-oxazol-5-yl]propanoate Chemical compound O1C(C)=NC(C=2C=C(Cl)C=CC=2)=C1CCC(=O)OCC LDJUDHMVLPUVRM-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- KPEOTPDZWBPHIV-UHFFFAOYSA-N methyl 3-[2-methyl-4-(4-methylsulfanylphenyl)-1,3-oxazol-5-yl]propanoate Chemical compound O1C(C)=NC(C=2C=CC(SC)=CC=2)=C1CCC(=O)OC KPEOTPDZWBPHIV-UHFFFAOYSA-N 0.000 description 1
- HOHUCDGNYVWANV-UHFFFAOYSA-N methyl 3-bromo-4-oxo-4-phenylbutanoate Chemical compound COC(=O)CC(Br)C(=O)C1=CC=CC=C1 HOHUCDGNYVWANV-UHFFFAOYSA-N 0.000 description 1
- AAMXATHDCLQRAR-UHFFFAOYSA-N methyl 4-bromo-5-(4-chlorophenyl)-5-oxopentanoate Chemical compound COC(=O)CCC(Br)C(=O)C1=CC=C(Cl)C=C1 AAMXATHDCLQRAR-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 235000020824 obesity Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D263/14—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Diabetes (AREA)
- General Chemical & Material Sciences (AREA)
- Emergency Medicine (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Endocrinology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP57066124A JPS58183676A (ja) | 1982-04-19 | 1982-04-19 | オキサゾ−ル誘導体 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO831361L true NO831361L (no) | 1983-10-20 |
Family
ID=13306807
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO831361A NO831361L (no) | 1982-04-19 | 1983-04-18 | Fremgangsmaate ved fremstilling av terapeutisk aktive oxazolderivater. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4596816A (pt) |
| EP (1) | EP0092239A3 (pt) |
| JP (1) | JPS58183676A (pt) |
| KR (1) | KR840004415A (pt) |
| AU (1) | AU1355283A (pt) |
| CA (1) | CA1195985A (pt) |
| DK (1) | DK172183A (pt) |
| ES (1) | ES8603174A1 (pt) |
| FI (1) | FI831253L (pt) |
| GR (1) | GR79251B (pt) |
| HU (1) | HU187002B (pt) |
| NO (1) | NO831361L (pt) |
| PT (1) | PT76563B (pt) |
| ZA (1) | ZA832657B (pt) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4632930A (en) * | 1984-11-30 | 1986-12-30 | E. I. Du Pont De Nemours And Company | Antihypertensive alkyl-arylimidazole, thiazole and oxazole derivatives |
| ZW19786A1 (en) * | 1985-10-17 | 1988-05-18 | Hoffmann La Roche | Heterocyclic compounds |
| GB8531608D0 (en) * | 1985-12-23 | 1986-02-05 | Beecham Group Plc | Treatment |
| US4968707A (en) * | 1987-06-10 | 1990-11-06 | Pfizer Inc. | Oxazolidin-2-one derivatives as hypoglycemic agents |
| US5239080A (en) * | 1989-02-08 | 1993-08-24 | Takeda Chemical Industries, Ltd. | Oxazole compounds and their use as antidiabetic and bone-reduction inhibitory agents |
| EP0440183A1 (en) * | 1990-02-01 | 1991-08-07 | Takeda Chemical Industries, Ltd. | Oxazole compounds, their production and use |
| FR2699172B1 (fr) * | 1992-12-11 | 1995-01-20 | Adir | Nouveaux dérivés de 4-méthyl-1,3-oxazole, leur procédé de préparation et les compositions pharmaceutiques qui les contiennent. |
| US6177452B1 (en) | 1996-04-03 | 2001-01-23 | Takeda Chemical Industries, Ltd. | Oxazole derivatives, their production and use |
| EP1077966B1 (en) * | 1998-05-12 | 2002-11-20 | Wyeth | Biphenyl sulfonyl aryl carboxylic acids useful in the treatment of insulin resistance and hyperglycemia |
| CA2331118A1 (en) * | 1998-05-12 | 1999-11-18 | Wyeth | Oxazole-aryl-carboxylic acids useful in the treatment of insulin resistance and hyperglycemia |
| US6699896B1 (en) | 1998-05-12 | 2004-03-02 | Wyeth | Oxazole-aryl-carboxylic acids useful in the treatment of insulin resistance and hyperglycemia |
| CN101519386A (zh) | 2001-04-16 | 2009-09-02 | 田边三菱制药株式会社 | 高传导率钙-活化k通道开启剂 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1226548A (pt) * | 1967-06-14 | 1971-03-31 | Wyeth John & Brother Ltd | |
| GB1245087A (en) * | 1967-10-26 | 1971-09-02 | Wyeth John & Brother Ltd | Heterocyclic compounds |
| US3578671A (en) * | 1967-11-06 | 1971-05-11 | Wyeth John & Brother Ltd | Oxazoles |
-
1982
- 1982-04-19 JP JP57066124A patent/JPS58183676A/ja active Pending
-
1983
- 1983-04-12 CA CA000425700A patent/CA1195985A/en not_active Expired
- 1983-04-14 FI FI831253A patent/FI831253L/fi not_active Application Discontinuation
- 1983-04-15 ZA ZA832657A patent/ZA832657B/xx unknown
- 1983-04-15 US US06/485,433 patent/US4596816A/en not_active Expired - Fee Related
- 1983-04-15 AU AU13552/83A patent/AU1355283A/en not_active Abandoned
- 1983-04-18 PT PT76563A patent/PT76563B/pt unknown
- 1983-04-18 NO NO831361A patent/NO831361L/no unknown
- 1983-04-18 GR GR71110A patent/GR79251B/el unknown
- 1983-04-19 ES ES521865A patent/ES8603174A1/es not_active Expired
- 1983-04-19 HU HU831358A patent/HU187002B/hu unknown
- 1983-04-19 DK DK172183A patent/DK172183A/da not_active IP Right Cessation
- 1983-04-19 EP EP83103787A patent/EP0092239A3/en not_active Withdrawn
- 1983-11-16 KR KR1019830001606A patent/KR840004415A/ko not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CA1195985A (en) | 1985-10-29 |
| AU1355283A (en) | 1983-10-27 |
| HU187002B (en) | 1985-10-28 |
| ES521865A0 (es) | 1985-05-16 |
| JPS58183676A (ja) | 1983-10-26 |
| FI831253A0 (fi) | 1983-04-14 |
| KR840004415A (ko) | 1984-10-15 |
| ES8603174A1 (es) | 1985-05-16 |
| PT76563B (en) | 1986-05-07 |
| US4596816A (en) | 1986-06-24 |
| DK172183A (da) | 1983-10-20 |
| GR79251B (pt) | 1984-10-22 |
| ZA832657B (en) | 1984-01-25 |
| PT76563A (en) | 1983-05-01 |
| DK172183D0 (da) | 1983-04-19 |
| FI831253L (fi) | 1983-10-20 |
| EP0092239A2 (en) | 1983-10-26 |
| EP0092239A3 (en) | 1985-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP5299810B2 (ja) | 代謝疾患の治療に使用するための、化合物、薬学的組成物及び方法 | |
| NO831361L (no) | Fremgangsmaate ved fremstilling av terapeutisk aktive oxazolderivater. | |
| JP5474769B2 (ja) | ペルオキシソーム増殖剤活性化受容体の活性化剤 | |
| EP2061760A1 (en) | Benzo-fused compounds for use in treating metabolic disorders | |
| WO2007033002A1 (en) | Conformationally constrained 3- (4-hydroxy-phenyl) - substituted-propanoic acids useful for treating metabolic disorders | |
| IE890738L (en) | Hypoglycemic thiazolidinedione derivatives | |
| KR20090118958A (ko) | Ｐｐａｒ 활성 화합물 | |
| WO2001079197A1 (en) | ACTIVATORS FOR PEROXISOME PROLIFERATOR ACTIVATED RECEPTOR δ (PPARδ) | |
| NO812558L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive oksazolidin-derivater. | |
| FR2787789A1 (fr) | Benzopyranes et benzoxepines utilisables dans le traitement de dyslipidemies, de l'atherosclerose et du diabete, compositions pharmaceutiques les contenant et procedes de preparations | |
| KR101942752B1 (ko) | Ｇｐｒ120 효능제로서의 티오아릴 유도체 | |
| EP2694465A1 (en) | Ortho-fluoro substituted compounds for the treatment of metabolic diseases | |
| EP1742927A1 (en) | Butanoic acid derivatives, processes for the preparation thereof, pharmaceutical compositions comprising them, and therapeutic applications threreof | |
| US5116855A (en) | Rhodanine derivatives and pharmaceutical compositions | |
| AU2013252205B2 (en) | 4-((substituted phenyl) difluoromethyl) phenoxy carboxylic acid derivative, and preparation method and uses thereof | |
| EP0096890B1 (en) | Oxazoleacetic acid derivatives, process for their production and compositions containing said derivatives | |
| JPWO2006090920A1 (ja) | ペルオキシソーム増殖剤活性化受容体δの活性化剤 | |
| KR20200008127A (ko) | 치환된 페닐아세트산 유도체의 제조방법 | |
| JP2000327603A (ja) | プロピオン酸誘導体の製造方法 | |
| US5489592A (en) | 3,4-dihydro-4-oxo-3-(2-propenyl)-1-phthalazineacetic acids and derivatives, their preparations and medicines containing them | |
| IE882015L (en) | PRIDYL-PYRROLO £1,2-c| THIAZOLES | |
| NO831094L (no) | Pyridon-2-derivater, fremgangsmaate til deres fremstilling, og legemidler inneholdende dem | |
| WO2022002117A1 (zh) | 一种制备含异恶唑啉脲嘧啶类化合物中间体的方法 | |
| EP0313202A2 (en) | Process for preparing halomethyl thiazoles | |
| JPS59190979A (ja) | オキサゾ−ル誘導体の製造法 |