NO791567L - Vaske- og rensemiddel. - Google Patents
Vaske- og rensemiddel.Info
- Publication number
- NO791567L NO791567L NO791567A NO791567A NO791567L NO 791567 L NO791567 L NO 791567L NO 791567 A NO791567 A NO 791567A NO 791567 A NO791567 A NO 791567A NO 791567 L NO791567 L NO 791567L
- Authority
- NO
- Norway
- Prior art keywords
- weight
- agent according
- phosphate
- ortho
- washing
- Prior art date
Links
- 239000003599 detergent Substances 0.000 title claims description 38
- 238000005406 washing Methods 0.000 claims description 55
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 43
- 229910019142 PO4 Inorganic materials 0.000 claims description 35
- 239000010452 phosphate Substances 0.000 claims description 28
- 239000000203 mixture Substances 0.000 claims description 22
- 239000003513 alkali Substances 0.000 claims description 21
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 16
- 239000004566 building material Substances 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 13
- 239000004094 surface-active agent Substances 0.000 claims description 13
- 239000012459 cleaning agent Substances 0.000 claims description 12
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims description 12
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 239000000654 additive Substances 0.000 claims description 10
- 235000011180 diphosphates Nutrition 0.000 claims description 8
- 229940048084 pyrophosphate Drugs 0.000 claims description 8
- -1 peroxide compounds Chemical class 0.000 claims description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- 150000001447 alkali salts Chemical class 0.000 claims description 6
- 239000000344 soap Substances 0.000 claims description 5
- 238000001694 spray drying Methods 0.000 claims description 5
- 239000003760 tallow Substances 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000000129 anionic group Chemical group 0.000 claims description 4
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 4
- 239000002736 nonionic surfactant Substances 0.000 claims description 4
- 229910021536 Zeolite Inorganic materials 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 150000002191 fatty alcohols Chemical class 0.000 claims description 3
- 239000010457 zeolite Substances 0.000 claims description 3
- 125000002947 alkylene group Chemical class 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- 239000007844 bleaching agent Substances 0.000 claims description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical class OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 2
- 239000004327 boric acid Chemical class 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- 239000008139 complexing agent Substances 0.000 claims description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 claims description 2
- 239000002563 ionic surfactant Substances 0.000 claims description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical class O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 claims 1
- 239000007921 spray Substances 0.000 claims 1
- 239000000047 product Substances 0.000 description 40
- 235000021317 phosphate Nutrition 0.000 description 29
- 239000004744 fabric Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 8
- 239000011574 phosphorus Substances 0.000 description 8
- 229910052698 phosphorus Inorganic materials 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 229920000388 Polyphosphate Polymers 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000001205 polyphosphate Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- 239000007832 Na2SO4 Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 238000012851 eutrophication Methods 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 235000011176 polyphosphates Nutrition 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 229910052919 magnesium silicate Inorganic materials 0.000 description 2
- 235000019792 magnesium silicate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- FEWFXBUNENSNBQ-UHFFFAOYSA-N 2-hydroxyacrylic acid Chemical compound OC(=C)C(O)=O FEWFXBUNENSNBQ-UHFFFAOYSA-N 0.000 description 1
- LIFHMKCDDVTICL-UHFFFAOYSA-N 6-(chloromethyl)phenanthridine Chemical compound C1=CC=C2C(CCl)=NC3=CC=CC=C3C2=C1 LIFHMKCDDVTICL-UHFFFAOYSA-N 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 101001096355 Homo sapiens Replication factor C subunit 3 Proteins 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 102100037855 Replication factor C subunit 3 Human genes 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000013066 combination product Substances 0.000 description 1
- 229940127555 combination product Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 238000004851 dishwashing Methods 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- NBZBKCUXIYYUSX-UHFFFAOYSA-N iminodiacetic acid Chemical class OC(=O)CNCC(O)=O NBZBKCUXIYYUSX-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical class OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- 239000008239 natural water Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920001444 polymaleic acid Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000011347 resin Chemical class 0.000 description 1
- 229920005989 resin Chemical class 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 230000009919 sequestration Effects 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- HYHAWELIVMOSBT-UHFFFAOYSA-M sodium;2-aminopentadecanoate Chemical compound [Na+].CCCCCCCCCCCCCC(N)C([O-])=O HYHAWELIVMOSBT-UHFFFAOYSA-M 0.000 description 1
- IWMMSZLFZZPTJY-UHFFFAOYSA-M sodium;3-(dodecylamino)propane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCNCCCS([O-])(=O)=O IWMMSZLFZZPTJY-UHFFFAOYSA-M 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000002352 surface water Substances 0.000 description 1
- 238000005320 surfactant adsorption Methods 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 235000012976 tarts Nutrition 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/06—Phosphates, including polyphosphates
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782820554 DE2820554A1 (de) | 1978-05-11 | 1978-05-11 | Wasch- und reinigungsmittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO791567L true NO791567L (no) | 1979-11-13 |
Family
ID=6039100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO791567A NO791567L (no) | 1978-05-11 | 1979-05-10 | Vaske- og rensemiddel. |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4308158A (ja) |
| JP (1) | JPS54148803A (ja) |
| AT (1) | AT375389B (ja) |
| BE (1) | BE876146A (ja) |
| CA (1) | CA1113826A (ja) |
| CH (1) | CH641834A5 (ja) |
| DE (1) | DE2820554A1 (ja) |
| DK (1) | DK195479A (ja) |
| ES (1) | ES8101115A1 (ja) |
| FI (1) | FI66901C (ja) |
| FR (1) | FR2425473A1 (ja) |
| GB (1) | GB2023164B (ja) |
| IT (1) | IT7948983A0 (ja) |
| LU (1) | LU81239A1 (ja) |
| NL (1) | NL7903403A (ja) |
| NO (1) | NO791567L (ja) |
| SE (1) | SE7904128L (ja) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3066338D1 (en) * | 1979-03-06 | 1984-03-08 | Unilever Nv | Detergent compositions |
| AU6418880A (en) * | 1979-11-12 | 1981-05-21 | Unilever Ltd. | Detergent compositions |
| US4428749A (en) * | 1981-01-14 | 1984-01-31 | Lever Brothers Company | Fabric washing process and detergent composition for use therein |
| DE3424299A1 (de) * | 1984-07-02 | 1986-01-09 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung eines spruehgetrockneten nichtionischen waschhilfsmittels |
| US4915862A (en) * | 1988-08-11 | 1990-04-10 | The Procter & Gamble Company | Granular detergent compositions containing crutched and admixed phosphate builder system |
| US5180515A (en) * | 1989-07-27 | 1993-01-19 | The Procter & Gamble Company | Granular detergent compositions having low levels of potassium salt to provide improved solubility |
| ZA9458B (en) * | 1993-01-11 | 1995-08-07 | Colgate Palmolive Co | Soap composition containing sodium pyrophosphate |
| NL1012895C2 (nl) * | 1999-07-22 | 2001-01-23 | Innocleaning Concepts Holding | Werkwijze en inrichting voor het verwijderen van vuil met behulp van stoom en reinigingsmiddel. |
| US7125833B2 (en) * | 2003-03-24 | 2006-10-24 | Wacker Chemie Ag | Cyclodextrin laundry detergent additive complexes and compositions containing same |
| DE102010023790A1 (de) | 2010-06-15 | 2011-12-15 | Heinrich-Heine-Universität Düsseldorf | Waschaktive Zusammensetzung |
| JP2015091992A (ja) * | 2015-01-27 | 2015-05-14 | 三浦工業株式会社 | 殺菌性洗浄剤 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2568110A (en) * | 1951-09-18 | Method of making glassy phosphate | ||
| US2594431A (en) * | 1950-04-01 | 1952-04-29 | Monsanto Chemicals | Detergent compositions |
| BE551479A (ja) * | 1955-10-03 | |||
| DE1080722B (de) * | 1957-07-18 | 1960-04-28 | Kurt Lindner Dr | Lagerbestaendiges, selbsttaetiges Waschmittelkonzentrat |
| US3015540A (en) * | 1960-11-23 | 1962-01-02 | Tennessce Valley Authority | Manufacture of superphosphoric acid |
| BE621716A (ja) * | 1961-08-25 | |||
| NL302725A (ja) | 1963-01-14 | |||
| US3361523A (en) * | 1963-03-19 | 1968-01-02 | Monsanto Co | Method for producing phosphates |
| US3403974A (en) * | 1964-03-25 | 1968-10-01 | Armour Agricult Chem | Method and apparatus for concentrating phosphoric acids containing impurities |
| US3507614A (en) * | 1966-03-14 | 1970-04-21 | Tennessee Valley Authority | Process for production of phosphoric acid |
| CA941705A (en) * | 1971-04-21 | 1974-02-12 | Walter J. Evett | Sequestrant composition and method of use |
| US4115307A (en) * | 1974-12-13 | 1978-09-19 | Erco Industries Limited | Phosphate composition |
| US4116852A (en) * | 1975-02-14 | 1978-09-26 | The Procter & Gamble Company | Builders and built detergent compositions |
| US4101455A (en) * | 1975-06-16 | 1978-07-18 | The Procter & Gamble Company | Low phosphate content glassy phosphate detergent compositions having optimum detergency |
| DE2751354A1 (de) * | 1977-11-17 | 1979-05-23 | Hoechst Ag | Verfahren zur herstellung von gemischen aus kristallinem zeolith und natriumtriphosphat |
-
1978
- 1978-05-11 DE DE19782820554 patent/DE2820554A1/de not_active Withdrawn
-
1979
- 1979-04-24 CA CA326,229A patent/CA1113826A/en not_active Expired
- 1979-05-01 NL NL7903403A patent/NL7903403A/xx not_active Application Discontinuation
- 1979-05-01 GB GB7915068A patent/GB2023164B/en not_active Expired
- 1979-05-07 US US06/036,403 patent/US4308158A/en not_active Expired - Lifetime
- 1979-05-08 CH CH432679A patent/CH641834A5/de not_active IP Right Cessation
- 1979-05-09 IT IT7948983A patent/IT7948983A0/it unknown
- 1979-05-09 AT AT0345379A patent/AT375389B/de not_active IP Right Cessation
- 1979-05-09 LU LU81239A patent/LU81239A1/de unknown
- 1979-05-09 BE BE0/195076A patent/BE876146A/xx not_active IP Right Cessation
- 1979-05-09 FI FI791480A patent/FI66901C/fi not_active IP Right Cessation
- 1979-05-10 DK DK195479A patent/DK195479A/da not_active Application Discontinuation
- 1979-05-10 NO NO791567A patent/NO791567L/no unknown
- 1979-05-10 SE SE7904128A patent/SE7904128L/ not_active Application Discontinuation
- 1979-05-10 ES ES480443A patent/ES8101115A1/es not_active Expired
- 1979-05-10 JP JP5637879A patent/JPS54148803A/ja active Pending
- 1979-05-11 FR FR7912103A patent/FR2425473A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FI66901B (fi) | 1984-08-31 |
| IT7948983A0 (it) | 1979-05-09 |
| FI66901C (fi) | 1984-12-10 |
| SE7904128L (sv) | 1979-11-12 |
| GB2023164A (en) | 1979-12-28 |
| FI791480A (fi) | 1979-11-12 |
| FR2425473B1 (ja) | 1983-09-02 |
| ES8101115A1 (es) | 1981-03-01 |
| CH641834A5 (de) | 1984-03-15 |
| CA1113826A (en) | 1981-12-08 |
| DK195479A (da) | 1979-11-12 |
| FR2425473A1 (fr) | 1979-12-07 |
| ATA345379A (de) | 1983-12-15 |
| JPS54148803A (en) | 1979-11-21 |
| BE876146A (fr) | 1979-11-09 |
| DE2820554A1 (de) | 1979-11-22 |
| ES480443A0 (es) | 1980-12-16 |
| GB2023164B (en) | 1982-10-13 |
| NL7903403A (nl) | 1979-11-13 |
| US4308158A (en) | 1981-12-29 |
| AT375389B (de) | 1984-07-25 |
| LU81239A1 (de) | 1979-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4102799A (en) | Automatic dishwasher detergent with improved effects on overglaze | |
| US3852209A (en) | Non-phosphate automatic dishwasher detergent | |
| US4428749A (en) | Fabric washing process and detergent composition for use therein | |
| CA1127495A (en) | Production of detergent compositions | |
| JPH0377238B2 (ja) | ||
| JPH06502199A (ja) | 洗剤用ビルダー | |
| NO791567L (no) | Vaske- og rensemiddel. | |
| US5205954A (en) | Automatic dishwasher powder detergent composition | |
| CH673033A5 (en) | Powder dishwashing agents for dishwashing machines - contg. combination of sodium citrate and sodium salt(s) of hydroxy-ethane di:phosphonic acid with sodium silicate | |
| CA1140830A (en) | Detergent compositions | |
| DE2043086A1 (de) | Schwachschaumendes Wasch , Reimgungs und Enthartungsmittel | |
| DE1965643A1 (de) | Schwachschaeumendes Wasch-,Reinigungs- und Enthaertungsmittel | |
| JPS601918B2 (ja) | 再汚染の少ない無燐洗剤組成物 | |
| EP0028143B1 (en) | Fabric washing process and detergent composition for use therein | |
| CA1121246A (en) | Detergent and cleansing compositions | |
| DE2043088A1 (de) | Schwachschaumendes Wasch , Reimgungs und Enthartungsmittel | |
| CA1314189C (en) | Detergent compositions | |
| CA1137384A (en) | Fabric washing process and detergent composition for use therein | |
| GB1039966A (en) | Production of compositions having chlorine-releasing and ion-sequestering properties | |
| JPH05132696A (ja) | 織物付着防止のための組成物及び方法 | |
| EP0029299B1 (en) | Detergent composition and process for its production | |
| US4257906A (en) | Method of protecting nitrilotriacetate salts | |
| CA2031289A1 (en) | Automatic dishwasher powder detergent composition | |
| GB2060677A (en) | Detergent compositions containing bicarbonate | |
| DE2043087A1 (de) | Schwachschaumendes Wasch , Reimgungs und Enthartungsmittel |