NO773256L - 4-n-acylfortimycin-b-derivater og fremgangsmaate til kjemisk omdannelse av fortimycin-b til fortimycin-a og andre 4-n-acylfortimycin-b-derivater - Google Patents
4-n-acylfortimycin-b-derivater og fremgangsmaate til kjemisk omdannelse av fortimycin-b til fortimycin-a og andre 4-n-acylfortimycin-b-derivaterInfo
- Publication number
- NO773256L NO773256L NO773256A NO773256A NO773256L NO 773256 L NO773256 L NO 773256L NO 773256 A NO773256 A NO 773256A NO 773256 A NO773256 A NO 773256A NO 773256 L NO773256 L NO 773256L
- Authority
- NO
- Norway
- Prior art keywords
- compound according
- tri
- benzyloxycarbonyl
- fortimycin
- benzyloxycarbonylfortimycin
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 25
- 238000006243 chemical reaction Methods 0.000 title description 20
- 239000000126 substance Substances 0.000 title description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 118
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 96
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 86
- 150000001875 compounds Chemical class 0.000 claims description 48
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 48
- 150000003839 salts Chemical class 0.000 claims description 32
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 27
- 239000002904 solvent Substances 0.000 claims description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 24
- 125000002252 acyl group Chemical group 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 18
- -1 N-benzyloxycarbonyl-protected ammonium Chemical class 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 12
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 12
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 10
- 125000000266 alpha-aminoacyl group Chemical group 0.000 claims description 9
- 150000001413 amino acids Chemical class 0.000 claims description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- MJSHDCCLFGOEIK-UHFFFAOYSA-N benzyl (2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)OCC1=CC=CC=C1 MJSHDCCLFGOEIK-UHFFFAOYSA-N 0.000 claims description 4
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 230000003213 activating effect Effects 0.000 claims description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 3
- VRPJIFMKZZEXLR-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NCC(O)=O VRPJIFMKZZEXLR-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 230000001681 protective effect Effects 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims 2
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 claims 1
- QIXRWIVDBZJDGD-UHFFFAOYSA-N benzyl (4-nitrophenyl) carbonate Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC(=O)OCC1=CC=CC=C1 QIXRWIVDBZJDGD-UHFFFAOYSA-N 0.000 claims 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 claims 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 claims 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 claims 1
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 claims 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 63
- 239000000243 solution Substances 0.000 description 38
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 31
- 239000000047 product Substances 0.000 description 30
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 25
- 239000000741 silica gel Substances 0.000 description 25
- 229910002027 silica gel Inorganic materials 0.000 description 25
- 238000004458 analytical method Methods 0.000 description 22
- 229910052757 nitrogen Inorganic materials 0.000 description 22
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 20
- 239000000908 ammonium hydroxide Substances 0.000 description 20
- 238000003756 stirring Methods 0.000 description 17
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 15
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 15
- 239000003480 eluent Substances 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 12
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 10
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 10
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 101150041968 CDC13 gene Proteins 0.000 description 9
- 238000004587 chromatography analysis Methods 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000011521 glass Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 229940024606 amino acid Drugs 0.000 description 6
- 235000001014 amino acid Nutrition 0.000 description 6
- 244000309464 bull Species 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- ZUSSTQCWRDLYJA-UHFFFAOYSA-N n-hydroxy-5-norbornene-2,3-dicarboximide Chemical compound C1=CC2CC1C1C2C(=O)N(O)C1=O ZUSSTQCWRDLYJA-UHFFFAOYSA-N 0.000 description 6
- 239000003242 anti bacterial agent Substances 0.000 description 5
- 229940088710 antibiotic agent Drugs 0.000 description 5
- 230000003115 biocidal effect Effects 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 241000588724 Escherichia coli Species 0.000 description 4
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- DNKITKPTEJNJOU-UHFFFAOYSA-N benzyl 2-hydroxy-5-nitrobenzoate Chemical compound OC1=CC=C([N+]([O-])=O)C=C1C(=O)OCC1=CC=CC=C1 DNKITKPTEJNJOU-UHFFFAOYSA-N 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- GMWQKAHYINBSDJ-UHFFFAOYSA-N 2-hydroxy-3-(phenylmethoxycarbonylamino)propanoic acid Chemical compound OC(=O)C(O)CNC(=O)OCC1=CC=CC=C1 GMWQKAHYINBSDJ-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 239000000538 analytical sample Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000007327 hydrogenolysis reaction Methods 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- YJNQRRCNDSQTQO-ZDUSSCGKSA-N 2-[[(2s)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetic acid Chemical compound OC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)OCC1=CC=CC=C1 YJNQRRCNDSQTQO-ZDUSSCGKSA-N 0.000 description 2
- VFRCXEHNAFUTQC-UHFFFAOYSA-N 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetic acid Chemical compound OC(=O)CNC(=O)CNC(=O)OCC1=CC=CC=C1 VFRCXEHNAFUTQC-UHFFFAOYSA-N 0.000 description 2
- ULKOBRDRCYROKY-UHFFFAOYSA-N 2-hydroxy-4-(phenylmethoxycarbonylamino)butanoic acid Chemical compound OC(=O)C(O)CCNC(=O)OCC1=CC=CC=C1 ULKOBRDRCYROKY-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 241000588747 Klebsiella pneumoniae Species 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- CJUMAFVKTCBCJK-UHFFFAOYSA-N N-benzyloxycarbonylglycine Chemical compound OC(=O)CNC(=O)OCC1=CC=CC=C1 CJUMAFVKTCBCJK-UHFFFAOYSA-N 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000004599 antimicrobial Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- YMAWOPBAYDPSLA-UHFFFAOYSA-N glycylglycine Chemical compound [NH3+]CC(=O)NCC([O-])=O YMAWOPBAYDPSLA-UHFFFAOYSA-N 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000010647 peptide synthesis reaction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- TYRGLVWXHJRKMT-MRVPVSSYSA-N (2r)-2-(phenylmethoxycarbonylamino)propanoic acid Chemical compound OC(=O)[C@@H](C)NC(=O)OCC1=CC=CC=C1 TYRGLVWXHJRKMT-MRVPVSSYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 229930182566 Gentamicin Natural products 0.000 description 1
- CEAZRRDELHUEMR-URQXQFDESA-N Gentamicin Chemical compound O1[C@H](C(C)NC)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](NC)[C@@](C)(O)CO2)O)[C@H](N)C[C@@H]1N CEAZRRDELHUEMR-URQXQFDESA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 108010008488 Glycylglycine Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FFDGPVCHZBVARC-UHFFFAOYSA-N N,N-dimethylglycine Chemical compound CN(C)CC(O)=O FFDGPVCHZBVARC-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- 241000588777 Providencia rettgeri Species 0.000 description 1
- 241000293869 Salmonella enterica subsp. enterica serovar Typhimurium Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- 241000607760 Shigella sonnei Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 229960003767 alanine Drugs 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N azide group Chemical group [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000006355 carbonyl methylene group Chemical group [H]C([H])([*:2])C([*:1])=O 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 108700003601 dimethylglycine Proteins 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229940092559 enterobacter aerogenes Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
- 229940043257 glycylglycine Drugs 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229960000318 kanamycin Drugs 0.000 description 1
- 229930027917 kanamycin Natural products 0.000 description 1
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 1
- 229930182823 kanamycin A Natural products 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 238000009630 liquid culture Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- TYRGLVWXHJRKMT-QMMMGPOBSA-N n-benzyloxycarbonyl-l-serine-betalactone Chemical compound OC(=O)[C@H](C)NC(=O)OCC1=CC=CC=C1 TYRGLVWXHJRKMT-QMMMGPOBSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229940039748 oxalate Drugs 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229940043230 sarcosine Drugs 0.000 description 1
- 229940115939 shigella sonnei Drugs 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229960000707 tobramycin Drugs 0.000 description 1
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 229940070710 valerate Drugs 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/20—Carbocyclic rings
- C07H15/22—Cyclohexane rings, substituted by nitrogen atoms
- C07H15/222—Cyclohexane rings substituted by at least two nitrogen atoms
- C07H15/224—Cyclohexane rings substituted by at least two nitrogen atoms with only one saccharide radical directly attached to the cyclohexyl radical, e.g. destomycin, fortimicin, neamine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Communicable Diseases (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/725,829 US4091032A (en) | 1976-09-23 | 1976-09-23 | 4-N-acylfortimicin B derivatives and the chemical conversion of fortimicin B to fortimicin A |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO773256L true NO773256L (no) | 1978-03-29 |
Family
ID=24916124
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO773256A NO773256L (no) | 1976-09-23 | 1977-09-22 | 4-n-acylfortimycin-b-derivater og fremgangsmaate til kjemisk omdannelse av fortimycin-b til fortimycin-a og andre 4-n-acylfortimycin-b-derivater |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4091032A (enExample) |
| JP (1) | JPS5368752A (enExample) |
| AR (1) | AR224722A1 (enExample) |
| AU (1) | AU519064B2 (enExample) |
| BE (1) | BE859012A (enExample) |
| CA (1) | CA1114809A (enExample) |
| DE (1) | DE2742949C2 (enExample) |
| DK (1) | DK419877A (enExample) |
| ES (2) | ES462566A1 (enExample) |
| FR (1) | FR2365586A1 (enExample) |
| GB (2) | GB1591606A (enExample) |
| GR (1) | GR63596B (enExample) |
| NO (1) | NO773256L (enExample) |
| NZ (1) | NZ185239A (enExample) |
| PH (1) | PH16052A (enExample) |
| SE (1) | SE7710683L (enExample) |
| ZA (2) | ZA775651B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR66054B (enExample) * | 1976-10-28 | 1981-01-14 | Abbott Lab | |
| JPS5466679A (en) * | 1977-11-07 | 1979-05-29 | Kyowa Hakko Kogyo Co Ltd | Novel antibiotic substance fortimicin kf and fortimicin kg, and their preparation |
| US4214075A (en) * | 1977-12-21 | 1980-07-22 | Abbott Laboratories | 6'-Epi-fortimicin A and B derivatives |
| JPS6041679B2 (ja) * | 1978-03-03 | 1985-09-18 | 協和醗酵工業株式会社 | 新抗生物質ホ−テイマイシンkg↓1,kg↓2およびkg↓3ならびにそれらの製造法 |
| US4234717A (en) * | 1978-03-30 | 1980-11-18 | American Cyanamid Company | Antibacterial antibiotic BM782 |
| US4208407A (en) * | 1979-02-05 | 1980-06-17 | Abbott Laboratories | 5-Deoxyfortimicin A, 2,5-dideoxyfortimicin A and the corresponding 4-N-acyl and alkyl fortimicin B derivatives thereof and intermediates therefor |
| US4207415A (en) * | 1979-02-05 | 1980-06-10 | Abbott Laboratories | Method of producing 2-deoxyfortimicin A |
| US4214079A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N, 2'-N and 4,2'-Di-N-fortimicin AL derivatives |
| US4293689A (en) * | 1979-03-29 | 1981-10-06 | Abbott Laboratories | Method of producing 3-O-demethylfortimicin B from fortimicin AN |
| US4219644A (en) * | 1979-03-29 | 1980-08-26 | Abbott Laboratories | Fortimicins AH and AI |
| US4216210A (en) * | 1979-03-29 | 1980-08-05 | Abbott Laboratories | Fortimicins AM and AP derivatives |
| US4213971A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N, 2'-N and 4,2'-Di-N-fortimicin AD derivatives |
| US4213972A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N, 2'-N and 4,2'Di-N-fortimicins AH and AI |
| US4331804A (en) * | 1979-03-29 | 1982-05-25 | Abbott Laboratories | 2-Epi-fortimicin A and derivatives |
| JPS55130969A (en) * | 1979-03-29 | 1980-10-11 | Abbott Lab | 11epiifortimicin a and derivative |
| US4219643A (en) * | 1979-03-29 | 1980-08-26 | Abbott Laboratories | Fortimicin AN |
| US4219642A (en) * | 1979-03-29 | 1980-08-26 | Abbott Laboratories | Fortimicin AO |
| US4226979A (en) * | 1979-03-29 | 1980-10-07 | Abbott Laboratories | Fortimicin AK |
| US4213974A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N,2'-N and 4,2'-Di-N-fortimicin AO derivatives |
| US4214078A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | Fortimicin AL |
| US4214080A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | Fortimicins AM and AP |
| US4218442A (en) * | 1979-03-29 | 1980-08-19 | Abbott Laboratories | 1-Epi-fortimicin A and derivatives |
| US4275193A (en) * | 1979-09-26 | 1981-06-23 | Abbott Laboratories | 4,5-Carbamates of fortimicin B |
| US4263429A (en) * | 1979-09-26 | 1981-04-21 | Abbott Laboratories | 1,2,6-Tri-N-benzyloxycarbonylfortimicin B-4,5-carbamate and 1,2,6-tri-N-acetylfortimicin B-4,5-carbamate |
| US4431799A (en) * | 1979-09-26 | 1984-02-14 | Abbott Laboratories | 6'-Modified fortimicin compounds |
| US4232147A (en) * | 1979-09-26 | 1980-11-04 | Abbott Laboratories | 4-N-Acylfortimicin B-1,5-carbamates |
| US4340727A (en) * | 1979-09-26 | 1982-07-20 | Abbott Laboratories | 1,2-Modified fortimicins A and B, intermediates therefor and method for their manufacture |
| US4269970A (en) * | 1979-09-26 | 1981-05-26 | Abbott Laboratories | 1,2-Carbamates of fortimicin B and derivatives |
| US4252972A (en) * | 1979-09-26 | 1981-02-24 | Abbott Laboratories | Fortimicin B-1,2:4,5-bis-carbamates |
| US4273925A (en) * | 1979-09-26 | 1981-06-16 | Abbott Laboratories | 1,2-Modified fortimicins A and B, intermediates therefor and method for their manufacture |
| US4230846A (en) * | 1979-09-26 | 1980-10-28 | Abbott Laboratories | 1,5-Carbamates of fortimicin B and derivatives |
| US4382926A (en) * | 1980-04-01 | 1983-05-10 | Zaidan Hojin Biseibutsu Kagaku Kenkyu Kai | Formimidoyl A and B useful as semi-synthetic aminoglycosidic antibiotics |
| US4338307A (en) * | 1980-11-10 | 1982-07-06 | Abbott Laboratories | 2'-N-Des-β-lysyl antibiotic AX-127B-1 and 4-N-acyl and alkyl derivatives thereof |
| US4338308A (en) * | 1980-11-10 | 1982-07-06 | Abbott Laboratories | 4-N-β-Lysyl-2'-N-des-β-lysyl antibiotic AX-127B-1 and the pharmaceutically acceptable salts thereof |
| US4338309A (en) * | 1980-11-10 | 1982-07-06 | Abbott Laboratories | 4',5'-Dihydro-antibiotic AX-127B-1; 2'-N-des-β-lysyl-4',5'-dihydro-antibiotic AX-127B-1; and 4-N-derivatives thereof |
| IE54288B1 (en) * | 1982-03-05 | 1989-08-16 | Fujisawa Pharmaceutical Co | New 1,4-diaminocyclitol derivatives, processes for their preparation and pharmaceutical compositions containing them |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5246311B2 (enExample) * | 1973-04-17 | 1977-11-24 | ||
| US3931400A (en) * | 1973-04-17 | 1976-01-06 | Abbott Laboratories | Fortimicin B and process for production thereof |
| JPS5145675B2 (enExample) * | 1973-07-23 | 1976-12-04 | ||
| JPS50145588A (enExample) * | 1974-05-16 | 1975-11-21 |
-
1976
- 1976-09-23 US US05/725,829 patent/US4091032A/en not_active Expired - Lifetime
-
1977
- 1977-09-20 CA CA287,098A patent/CA1114809A/en not_active Expired
- 1977-09-20 GR GR54390A patent/GR63596B/el unknown
- 1977-09-21 ZA ZA00775651A patent/ZA775651B/xx unknown
- 1977-09-21 ZA ZA00775652A patent/ZA775652B/xx unknown
- 1977-09-22 ES ES462566A patent/ES462566A1/es not_active Expired
- 1977-09-22 NZ NZ185239A patent/NZ185239A/xx unknown
- 1977-09-22 JP JP11453277A patent/JPS5368752A/ja active Pending
- 1977-09-22 DK DK419877A patent/DK419877A/da not_active Application Discontinuation
- 1977-09-22 AU AU29025/77A patent/AU519064B2/en not_active Expired
- 1977-09-22 GB GB4211/79A patent/GB1591606A/en not_active Expired
- 1977-09-22 NO NO773256A patent/NO773256L/no unknown
- 1977-09-22 GB GB39568/77A patent/GB1591320A/en not_active Expired
- 1977-09-22 FR FR7728633A patent/FR2365586A1/fr active Granted
- 1977-09-23 AR AR269316A patent/AR224722A1/es active
- 1977-09-23 SE SE7710683A patent/SE7710683L/xx not_active Application Discontinuation
- 1977-09-23 DE DE2742949A patent/DE2742949C2/de not_active Expired
- 1977-09-23 BE BE181169A patent/BE859012A/xx unknown
-
1978
- 1978-03-20 US US05/888,085 patent/US4155902A/en not_active Expired - Lifetime
- 1978-08-16 ES ES472608A patent/ES472608A1/es not_active Expired
-
1980
- 1980-09-25 PH PH24630A patent/PH16052A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5368752A (en) | 1978-06-19 |
| NZ185239A (en) | 1980-08-26 |
| GB1591320A (en) | 1981-06-17 |
| DE2742949C2 (de) | 1983-08-04 |
| AR224722A1 (es) | 1982-01-15 |
| GR63596B (en) | 1979-11-26 |
| BE859012A (fr) | 1978-03-23 |
| GB1591606A (en) | 1981-06-24 |
| ES462566A1 (es) | 1978-11-16 |
| SE7710683L (sv) | 1978-03-24 |
| AU519064B2 (en) | 1981-11-05 |
| FR2365586A1 (fr) | 1978-04-21 |
| US4091032A (en) | 1978-05-23 |
| PH16052A (en) | 1983-06-02 |
| ES472608A1 (es) | 1979-02-16 |
| ZA775651B (en) | 1979-07-25 |
| DE2742949A1 (de) | 1978-03-30 |
| US4155902A (en) | 1979-05-22 |
| FR2365586B1 (enExample) | 1982-12-17 |
| CA1114809A (en) | 1981-12-22 |
| DK419877A (da) | 1978-03-24 |
| AU2902577A (en) | 1979-03-29 |
| ZA775652B (en) | 1979-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO773256L (no) | 4-n-acylfortimycin-b-derivater og fremgangsmaate til kjemisk omdannelse av fortimycin-b til fortimycin-a og andre 4-n-acylfortimycin-b-derivater | |
| US4117221A (en) | Aminoacyl derivatives of aminoglycoside antibiotics | |
| GB1598704A (en) | 3-de-o-methylfortimicins | |
| Zhang et al. | Design, synthesis and antibacterial activity of novel actinonin derivatives containing benzimidazole heterocycles | |
| Konishi et al. | BBM-928, a new antitumor antibiotic complex III. Structure determination of BBM-928 A, B and C | |
| US3792037A (en) | Process for preparing ambutyrosin | |
| US4169141A (en) | 1-Peptidyl derivatives of di-O-aminoglycosyl-1,3-diaminocyclitol antibacterial agents | |
| US4250304A (en) | 2-Deoxy-2-substituted fortimicin A and B and derivatives | |
| Haskell et al. | The preparation and biological activity of novel amino acid analogs of butirosin | |
| US4237272A (en) | Derivatives of fortimicin A | |
| Scheigetz et al. | A Synthesis of 4-α-Guanidino-2-Deoxy-2, 3-Didehydro N-Acetylneuraminic Acid | |
| RANE et al. | Selective N-acylation of gentamicin antibiotics-Synthesis of 1-N-acyl derivatives | |
| US4647656A (en) | Aminoglycoside compounds | |
| IE42785B1 (en) | L-3-(3,4-dihydroxyphenyl)-2-methyl-alanine peptides | |
| Shimizu et al. | Synthetic studies on leupeptins and their analogs | |
| EP0040764B1 (en) | Novel aminoglycosides, and antibiotic use thereof | |
| US4169942A (en) | Fortimicin derivatives and method for production thereof | |
| US4174312A (en) | 4-N-acylfortimicin B derivatives and the chemical conversion of fortimicin B to fortimicin A | |
| US4231924A (en) | 4-N-Acylfortimicin B derivatives and the chemical conversion of fortimicin B to fortimicin A | |
| FR2523583A1 (fr) | Procede de production de 6'-alkylspectinomycines et de leurs analogues et nouveaux composes intermediaires utilises dans ce procede | |
| IKEDA et al. | Synthesis of demethyl derivatives of istamycin A | |
| US4173564A (en) | 4-N-acylfortimicin B derivatives and the chemical conversion of fortimicin B to fortimicin A | |
| US4188319A (en) | 4-N-Acylfortimicin B derivatives and the chemical conversion of fortimicin B to fortimicin A | |
| US4132846A (en) | 1-N-(α-Hydroxy-β-aminopropionyl) XK-62-2 and method of production thereof | |
| Lackner et al. | A new actinomycin-type chromopeptide from Streptomyces sp. HKI-0155 |