GR63596B - 4-n-acylfortimicin b derivatives and the chemical corversion of fortimicin b to fortimicin 4 - Google Patents
4-n-acylfortimicin b derivatives and the chemical corversion of fortimicin b to fortimicin 4Info
- Publication number
- GR63596B GR63596B GR54390A GR770154390A GR63596B GR 63596 B GR63596 B GR 63596B GR 54390 A GR54390 A GR 54390A GR 770154390 A GR770154390 A GR 770154390A GR 63596 B GR63596 B GR 63596B
- Authority
- GR
- Greece
- Prior art keywords
- fortimicin
- corversion
- acylfortimicin
- derivatives
- chemical
- Prior art date
Links
- 229930195503 Fortimicin Natural products 0.000 title 2
- BIDUPMYXGFNAEJ-APGVDKLISA-N astromicin Chemical compound O[C@@H]1[C@H](N(C)C(=O)CN)[C@@H](OC)[C@@H](O)[C@H](N)[C@H]1O[C@@H]1[C@H](N)CC[C@@H]([C@H](C)N)O1 BIDUPMYXGFNAEJ-APGVDKLISA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/20—Carbocyclic rings
- C07H15/22—Cyclohexane rings, substituted by nitrogen atoms
- C07H15/222—Cyclohexane rings substituted by at least two nitrogen atoms
- C07H15/224—Cyclohexane rings substituted by at least two nitrogen atoms with only one saccharide radical directly attached to the cyclohexyl radical, e.g. destomycin, fortimicin, neamine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Communicable Diseases (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/725,829 US4091032A (en) | 1976-09-23 | 1976-09-23 | 4-N-acylfortimicin B derivatives and the chemical conversion of fortimicin B to fortimicin A |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GR63596B true GR63596B (en) | 1979-11-26 |
Family
ID=24916124
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GR54390A GR63596B (en) | 1976-09-23 | 1977-09-20 | 4-n-acylfortimicin b derivatives and the chemical corversion of fortimicin b to fortimicin 4 |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4091032A (enExample) |
| JP (1) | JPS5368752A (enExample) |
| AR (1) | AR224722A1 (enExample) |
| AU (1) | AU519064B2 (enExample) |
| BE (1) | BE859012A (enExample) |
| CA (1) | CA1114809A (enExample) |
| DE (1) | DE2742949C2 (enExample) |
| DK (1) | DK419877A (enExample) |
| ES (2) | ES462566A1 (enExample) |
| FR (1) | FR2365586A1 (enExample) |
| GB (2) | GB1591606A (enExample) |
| GR (1) | GR63596B (enExample) |
| NO (1) | NO773256L (enExample) |
| NZ (1) | NZ185239A (enExample) |
| PH (1) | PH16052A (enExample) |
| SE (1) | SE7710683L (enExample) |
| ZA (2) | ZA775651B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR66054B (enExample) * | 1976-10-28 | 1981-01-14 | Abbott Lab | |
| JPS5466679A (en) * | 1977-11-07 | 1979-05-29 | Kyowa Hakko Kogyo Co Ltd | Novel antibiotic substance fortimicin kf and fortimicin kg, and their preparation |
| US4214075A (en) * | 1977-12-21 | 1980-07-22 | Abbott Laboratories | 6'-Epi-fortimicin A and B derivatives |
| JPS6041679B2 (ja) * | 1978-03-03 | 1985-09-18 | 協和醗酵工業株式会社 | 新抗生物質ホ−テイマイシンkg↓1,kg↓2およびkg↓3ならびにそれらの製造法 |
| US4234717A (en) * | 1978-03-30 | 1980-11-18 | American Cyanamid Company | Antibacterial antibiotic BM782 |
| US4208407A (en) * | 1979-02-05 | 1980-06-17 | Abbott Laboratories | 5-Deoxyfortimicin A, 2,5-dideoxyfortimicin A and the corresponding 4-N-acyl and alkyl fortimicin B derivatives thereof and intermediates therefor |
| US4207415A (en) * | 1979-02-05 | 1980-06-10 | Abbott Laboratories | Method of producing 2-deoxyfortimicin A |
| US4214079A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N, 2'-N and 4,2'-Di-N-fortimicin AL derivatives |
| US4293689A (en) * | 1979-03-29 | 1981-10-06 | Abbott Laboratories | Method of producing 3-O-demethylfortimicin B from fortimicin AN |
| US4219644A (en) * | 1979-03-29 | 1980-08-26 | Abbott Laboratories | Fortimicins AH and AI |
| US4216210A (en) * | 1979-03-29 | 1980-08-05 | Abbott Laboratories | Fortimicins AM and AP derivatives |
| US4213971A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N, 2'-N and 4,2'-Di-N-fortimicin AD derivatives |
| US4213972A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N, 2'-N and 4,2'Di-N-fortimicins AH and AI |
| US4331804A (en) * | 1979-03-29 | 1982-05-25 | Abbott Laboratories | 2-Epi-fortimicin A and derivatives |
| JPS55130969A (en) * | 1979-03-29 | 1980-10-11 | Abbott Lab | 11epiifortimicin a and derivative |
| US4219643A (en) * | 1979-03-29 | 1980-08-26 | Abbott Laboratories | Fortimicin AN |
| US4219642A (en) * | 1979-03-29 | 1980-08-26 | Abbott Laboratories | Fortimicin AO |
| US4226979A (en) * | 1979-03-29 | 1980-10-07 | Abbott Laboratories | Fortimicin AK |
| US4213974A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | 4-N,2'-N and 4,2'-Di-N-fortimicin AO derivatives |
| US4214078A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | Fortimicin AL |
| US4214080A (en) * | 1979-03-29 | 1980-07-22 | Abbott Laboratories | Fortimicins AM and AP |
| US4218442A (en) * | 1979-03-29 | 1980-08-19 | Abbott Laboratories | 1-Epi-fortimicin A and derivatives |
| US4275193A (en) * | 1979-09-26 | 1981-06-23 | Abbott Laboratories | 4,5-Carbamates of fortimicin B |
| US4263429A (en) * | 1979-09-26 | 1981-04-21 | Abbott Laboratories | 1,2,6-Tri-N-benzyloxycarbonylfortimicin B-4,5-carbamate and 1,2,6-tri-N-acetylfortimicin B-4,5-carbamate |
| US4431799A (en) * | 1979-09-26 | 1984-02-14 | Abbott Laboratories | 6'-Modified fortimicin compounds |
| US4232147A (en) * | 1979-09-26 | 1980-11-04 | Abbott Laboratories | 4-N-Acylfortimicin B-1,5-carbamates |
| US4340727A (en) * | 1979-09-26 | 1982-07-20 | Abbott Laboratories | 1,2-Modified fortimicins A and B, intermediates therefor and method for their manufacture |
| US4269970A (en) * | 1979-09-26 | 1981-05-26 | Abbott Laboratories | 1,2-Carbamates of fortimicin B and derivatives |
| US4252972A (en) * | 1979-09-26 | 1981-02-24 | Abbott Laboratories | Fortimicin B-1,2:4,5-bis-carbamates |
| US4273925A (en) * | 1979-09-26 | 1981-06-16 | Abbott Laboratories | 1,2-Modified fortimicins A and B, intermediates therefor and method for their manufacture |
| US4230846A (en) * | 1979-09-26 | 1980-10-28 | Abbott Laboratories | 1,5-Carbamates of fortimicin B and derivatives |
| US4382926A (en) * | 1980-04-01 | 1983-05-10 | Zaidan Hojin Biseibutsu Kagaku Kenkyu Kai | Formimidoyl A and B useful as semi-synthetic aminoglycosidic antibiotics |
| US4338307A (en) * | 1980-11-10 | 1982-07-06 | Abbott Laboratories | 2'-N-Des-β-lysyl antibiotic AX-127B-1 and 4-N-acyl and alkyl derivatives thereof |
| US4338308A (en) * | 1980-11-10 | 1982-07-06 | Abbott Laboratories | 4-N-β-Lysyl-2'-N-des-β-lysyl antibiotic AX-127B-1 and the pharmaceutically acceptable salts thereof |
| US4338309A (en) * | 1980-11-10 | 1982-07-06 | Abbott Laboratories | 4',5'-Dihydro-antibiotic AX-127B-1; 2'-N-des-β-lysyl-4',5'-dihydro-antibiotic AX-127B-1; and 4-N-derivatives thereof |
| IE54288B1 (en) * | 1982-03-05 | 1989-08-16 | Fujisawa Pharmaceutical Co | New 1,4-diaminocyclitol derivatives, processes for their preparation and pharmaceutical compositions containing them |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5246311B2 (enExample) * | 1973-04-17 | 1977-11-24 | ||
| US3931400A (en) * | 1973-04-17 | 1976-01-06 | Abbott Laboratories | Fortimicin B and process for production thereof |
| JPS5145675B2 (enExample) * | 1973-07-23 | 1976-12-04 | ||
| JPS50145588A (enExample) * | 1974-05-16 | 1975-11-21 |
-
1976
- 1976-09-23 US US05/725,829 patent/US4091032A/en not_active Expired - Lifetime
-
1977
- 1977-09-20 CA CA287,098A patent/CA1114809A/en not_active Expired
- 1977-09-20 GR GR54390A patent/GR63596B/el unknown
- 1977-09-21 ZA ZA00775651A patent/ZA775651B/xx unknown
- 1977-09-21 ZA ZA00775652A patent/ZA775652B/xx unknown
- 1977-09-22 ES ES462566A patent/ES462566A1/es not_active Expired
- 1977-09-22 NZ NZ185239A patent/NZ185239A/xx unknown
- 1977-09-22 JP JP11453277A patent/JPS5368752A/ja active Pending
- 1977-09-22 DK DK419877A patent/DK419877A/da not_active Application Discontinuation
- 1977-09-22 AU AU29025/77A patent/AU519064B2/en not_active Expired
- 1977-09-22 GB GB4211/79A patent/GB1591606A/en not_active Expired
- 1977-09-22 NO NO773256A patent/NO773256L/no unknown
- 1977-09-22 GB GB39568/77A patent/GB1591320A/en not_active Expired
- 1977-09-22 FR FR7728633A patent/FR2365586A1/fr active Granted
- 1977-09-23 AR AR269316A patent/AR224722A1/es active
- 1977-09-23 SE SE7710683A patent/SE7710683L/xx not_active Application Discontinuation
- 1977-09-23 DE DE2742949A patent/DE2742949C2/de not_active Expired
- 1977-09-23 BE BE181169A patent/BE859012A/xx unknown
-
1978
- 1978-03-20 US US05/888,085 patent/US4155902A/en not_active Expired - Lifetime
- 1978-08-16 ES ES472608A patent/ES472608A1/es not_active Expired
-
1980
- 1980-09-25 PH PH24630A patent/PH16052A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5368752A (en) | 1978-06-19 |
| NZ185239A (en) | 1980-08-26 |
| GB1591320A (en) | 1981-06-17 |
| DE2742949C2 (de) | 1983-08-04 |
| NO773256L (no) | 1978-03-29 |
| AR224722A1 (es) | 1982-01-15 |
| BE859012A (fr) | 1978-03-23 |
| GB1591606A (en) | 1981-06-24 |
| ES462566A1 (es) | 1978-11-16 |
| SE7710683L (sv) | 1978-03-24 |
| AU519064B2 (en) | 1981-11-05 |
| FR2365586A1 (fr) | 1978-04-21 |
| US4091032A (en) | 1978-05-23 |
| PH16052A (en) | 1983-06-02 |
| ES472608A1 (es) | 1979-02-16 |
| ZA775651B (en) | 1979-07-25 |
| DE2742949A1 (de) | 1978-03-30 |
| US4155902A (en) | 1979-05-22 |
| FR2365586B1 (enExample) | 1982-12-17 |
| CA1114809A (en) | 1981-12-22 |
| DK419877A (da) | 1978-03-24 |
| AU2902577A (en) | 1979-03-29 |
| ZA775652B (en) | 1979-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GR63596B (en) | 4-n-acylfortimicin b derivatives and the chemical corversion of fortimicin b to fortimicin 4 | |
| IL51227A (en) | Chlorodeoxysucroses and their use as sweeteners | |
| JPS5321168A (en) | 11*22aryll22rrethyl**1hh1*2*44triazoles* its preparation and their use | |
| JPS5569598A (en) | Manufacture of 4*66dii00*aminoglycosyl**1*33 diaminocyclitols | |
| JPS52153964A (en) | Preparation of benzimidazolonee*2* | |
| JPS51131880A (en) | 11*3*3*33triarylpropyl**44 phenyll44piperidinemethanol and analogous compounds | |
| JPS5344539A (en) | 22*33phenyll22 aminopropionyloxy* derivatives | |
| JPS52139040A (en) | 22 and 33substituted enekephlin | |
| JPS52133974A (en) | 1*33dihydrooheteroarylspiro*isobenzolane* | |
| JPS5323974A (en) | Preparation of 55aminoo1*2*33thiadiazole | |
| JPS5223081A (en) | 1*44dihydropyridines and application to remedy | |
| JPS537677A (en) | 2*66methanoo2hh11 benzooxosines | |
| JPS5365892A (en) | 33*22aminoethylthio**66*11hydroxyethyl* 77oxoo11azabicyclo*3*2*0*heptt22 enee22carboxylate | |
| JPS5321159A (en) | 1*55disubstitutedd22pyrrolidones | |
| JPS5337669A (en) | Production and use of 1*44dihydropyridine derivatives | |
| JPS52156897A (en) | 77*alphaa*2*33dihydroo22oxoo1hh benzimidazolee11ylcarbonylamino** arylacetoamide*cephalospolines | |
| JPS52133995A (en) | 1*2*44thiadiazinone and its preparation and application thereof | |
| JPS5291851A (en) | 4* alphaa and 4* betaa aminoo4**deoxyyoreandrine and preparation thereof | |
| JPS5555127A (en) | Substituted 1*111diaminoundecane*its manufacture and its use | |
| JPS5427576A (en) | 2*2*55trimethyll55phenyll 1*33doxane * production thereof and ferfume containing same | |
| ZA772232B (en) | Improvements relating to the use of fluoroacylresorcins | |
| JPS5293777A (en) | Preparation of 1*22benzothiadinee33carboxyamide | |
| JPS5346974A (en) | Preparation of thiazolinee*3* | |
| JPS5365853A (en) | 15 * 166dihydroxyprostaglandin and like | |
| JPS54117480A (en) | 2**nnsubstituted fortimicin b and derivatives |