NO753530L - - Google Patents
Info
- Publication number
- NO753530L NO753530L NO753530A NO753530A NO753530L NO 753530 L NO753530 L NO 753530L NO 753530 A NO753530 A NO 753530A NO 753530 A NO753530 A NO 753530A NO 753530 L NO753530 L NO 753530L
- Authority
- NO
- Norway
- Prior art keywords
- hydrogen
- carbon atoms
- stands
- alkyl
- formula
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 68
- 150000001875 compounds Chemical class 0.000 claims description 67
- 229910052739 hydrogen Inorganic materials 0.000 claims description 66
- 239000001257 hydrogen Substances 0.000 claims description 66
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 43
- 125000000217 alkyl group Chemical group 0.000 claims description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 24
- 150000002431 hydrogen Chemical class 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 19
- 125000002947 alkylene group Chemical group 0.000 claims description 18
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 17
- 229910052760 oxygen Inorganic materials 0.000 claims description 17
- 239000001301 oxygen Substances 0.000 claims description 17
- 229910052799 carbon Inorganic materials 0.000 claims description 16
- 125000001424 substituent group Chemical group 0.000 claims description 12
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 9
- 150000002894 organic compounds Chemical class 0.000 claims description 3
- 125000005837 1,2-cyclopentylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:1])C([H])([*:2])C1([H])[H] 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 238000006722 reduction reaction Methods 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 6
- 239000012259 ether extract Substances 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 4
- -1 alkali metal amides Chemical class 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- 230000001741 anti-phlogistic effect Effects 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000000468 ketone group Chemical group 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920000137 polyphosphoric acid Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- PCPVAZKLFNGRKQ-UHFFFAOYSA-N 2-(5-hydroxy-7-methyl-6,7,8,9-tetrahydro-5h-benzo[7]annulen-3-yl)acetic acid Chemical compound OC1CC(C)CCC2=CC=C(CC(O)=O)C=C21 PCPVAZKLFNGRKQ-UHFFFAOYSA-N 0.000 description 2
- XZKVFSAIJUPOJI-UHFFFAOYSA-N 2-(7-methyl-5-oxo-6,7,8,9-tetrahydrobenzo[7]annulen-3-yl)acetic acid Chemical compound O=C1CC(C)CCC2=CC=C(CC(O)=O)C=C21 XZKVFSAIJUPOJI-UHFFFAOYSA-N 0.000 description 2
- TXJZBYXGNHMNML-UHFFFAOYSA-N COC(=O)CCC1=CC(CC(C)C)=CC=C1 Chemical compound COC(=O)CCC1=CC(CC(C)C)=CC=C1 TXJZBYXGNHMNML-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- UUIQMZJEGPQKFD-UHFFFAOYSA-N Methyl butyrate Chemical compound CCCC(=O)OC UUIQMZJEGPQKFD-UHFFFAOYSA-N 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- AKGGYBADQZYZPD-UHFFFAOYSA-N benzylacetone Chemical compound CC(=O)CCC1=CC=CC=C1 AKGGYBADQZYZPD-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 125000002993 cycloalkylene group Chemical group 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical class NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VKXPPTUOVXPZGW-UHFFFAOYSA-N methyl 2-methyl-4-(4-propanoylphenyl)butanoate Chemical compound CCC(=O)C1=CC=C(CCC(C)C(=O)OC)C=C1 VKXPPTUOVXPZGW-UHFFFAOYSA-N 0.000 description 2
- XQKIYIXSHDBCSR-UHFFFAOYSA-N methyl 3-methyl-5-phenylpentanoate Chemical compound COC(=O)CC(C)CCC1=CC=CC=C1 XQKIYIXSHDBCSR-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- HFIOTNXMNPDTLO-UHFFFAOYSA-N 1-(3-methylphenyl)butan-1-one Chemical compound CCCC(=O)C1=CC=CC(C)=C1 HFIOTNXMNPDTLO-UHFFFAOYSA-N 0.000 description 1
- AWIPPSDKPFJPNC-UHFFFAOYSA-N 2-(6-ethyl-8-oxo-6,7-dihydro-5h-naphthalen-2-yl)acetic acid Chemical compound OC(=O)CC1=CC=C2CC(CC)CC(=O)C2=C1 AWIPPSDKPFJPNC-UHFFFAOYSA-N 0.000 description 1
- CTDNKAVGZOIRMI-UHFFFAOYSA-N 2-(cyclohepten-1-yl)acetic acid Chemical compound OC(=O)CC1=CCCCCC1 CTDNKAVGZOIRMI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- HMKABHUHCNGOGZ-UHFFFAOYSA-N 4-[4-(1-carboxyethyl)phenyl]-2-methylbutanoic acid Chemical compound OC(=O)C(C)CCC1=CC=C(C(C)C(O)=O)C=C1 HMKABHUHCNGOGZ-UHFFFAOYSA-N 0.000 description 1
- HAFWJHVQECPLAL-UHFFFAOYSA-N 5-[4-(carboxymethyl)phenyl]-3-methylpentanoic acid Chemical compound OC(=O)CC(C)CCC1=CC=C(CC(O)=O)C=C1 HAFWJHVQECPLAL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010031149 Osteitis Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 238000006856 Wolf-Kishner-Huang Minlon reduction reaction Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000003946 cyclohexylamines Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- CTSAXXHOGZNKJR-UHFFFAOYSA-N methyl 2-diethoxyphosphorylacetate Chemical compound CCOP(=O)(OCC)CC(=O)OC CTSAXXHOGZNKJR-UHFFFAOYSA-N 0.000 description 1
- KEIGTQPTFNQBMC-UHFFFAOYSA-N methyl 2-methyl-4-phenylbutanoate Chemical compound COC(=O)C(C)CCC1=CC=CC=C1 KEIGTQPTFNQBMC-UHFFFAOYSA-N 0.000 description 1
- FHASOOYJUZKVFW-UHFFFAOYSA-N methyl 3-methylpentanoate Chemical compound CCC(C)CC(=O)OC FHASOOYJUZKVFW-UHFFFAOYSA-N 0.000 description 1
- BQCZBPWYGSLNJG-UHFFFAOYSA-N methyl 5-(4-acetylphenyl)-3-methylpentanoate Chemical compound COC(=O)CC(C)CCC1=CC=C(C(C)=O)C=C1 BQCZBPWYGSLNJG-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- HNBDRPTVWVGKBR-UHFFFAOYSA-N methyl pentanoate Chemical compound CCCCC(=O)OC HNBDRPTVWVGKBR-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- KLBIUKJOZFWCLW-UHFFFAOYSA-N thallium(iii) nitrate Chemical compound [Tl+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O KLBIUKJOZFWCLW-UHFFFAOYSA-N 0.000 description 1
- UAXOELSVPTZZQG-UHFFFAOYSA-N tiglic acid Natural products CC(C)=C(C)C(O)=O UAXOELSVPTZZQG-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/46—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid
- C07C57/50—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid containing condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/09—Preparation of carboxylic acids or their salts, halides or anhydrides from carboxylic acid esters or lactones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1447274 | 1974-10-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO753530L true NO753530L (show.php) | 1976-04-30 |
Family
ID=4401133
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO753530A NO753530L (show.php) | 1974-10-29 | 1975-10-21 |
Country Status (15)
| Country | Link |
|---|---|
| JP (1) | JPS5176251A (show.php) |
| AU (1) | AU8607875A (show.php) |
| BE (1) | BE834916A (show.php) |
| DD (1) | DD121778A5 (show.php) |
| DE (1) | DE2546906A1 (show.php) |
| DK (1) | DK470875A (show.php) |
| ES (1) | ES442133A1 (show.php) |
| FI (1) | FI752917A7 (show.php) |
| FR (1) | FR2289176A1 (show.php) |
| GB (1) | GB1530153A (show.php) |
| IL (1) | IL48366A0 (show.php) |
| NL (1) | NL7512467A (show.php) |
| NO (1) | NO753530L (show.php) |
| SE (1) | SE7511811L (show.php) |
| ZA (1) | ZA756804B (show.php) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH592598A5 (show.php) * | 1973-10-30 | 1977-10-31 | Hexachimie | |
| AR206619A1 (es) * | 1974-02-07 | 1976-08-06 | Hexachimie | Procedimiento para peparar acidos 5-indanilaceticos |
| JPS50111057A (show.php) * | 1974-02-14 | 1975-09-01 |
-
1975
- 1975-10-20 FI FI752917A patent/FI752917A7/fi not_active Application Discontinuation
- 1975-10-20 DE DE19752546906 patent/DE2546906A1/de active Pending
- 1975-10-20 DK DK470875A patent/DK470875A/da not_active Application Discontinuation
- 1975-10-21 NO NO753530A patent/NO753530L/no unknown
- 1975-10-21 SE SE7511811A patent/SE7511811L/xx unknown
- 1975-10-23 GB GB43680/75A patent/GB1530153A/en not_active Expired
- 1975-10-24 NL NL7512467A patent/NL7512467A/xx unknown
- 1975-10-27 BE BE161293A patent/BE834916A/xx unknown
- 1975-10-27 IL IL48366A patent/IL48366A0/xx unknown
- 1975-10-28 DD DD189089A patent/DD121778A5/xx unknown
- 1975-10-28 AU AU86078/75A patent/AU8607875A/en not_active Expired
- 1975-10-28 JP JP50128971A patent/JPS5176251A/ja active Pending
- 1975-10-28 ES ES442133A patent/ES442133A1/es not_active Expired
- 1975-10-29 FR FR7533005A patent/FR2289176A1/fr active Granted
- 1975-10-29 ZA ZA756804A patent/ZA756804B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7512467A (nl) | 1976-05-04 |
| DD121778A5 (show.php) | 1976-08-20 |
| FR2289176B1 (show.php) | 1978-07-28 |
| IL48366A0 (en) | 1975-12-31 |
| FR2289176A1 (fr) | 1976-05-28 |
| BE834916A (fr) | 1976-04-27 |
| GB1530153A (en) | 1978-10-25 |
| SE7511811L (sv) | 1976-04-30 |
| DK470875A (da) | 1976-04-30 |
| ZA756804B (en) | 1977-06-29 |
| AU8607875A (en) | 1977-05-05 |
| ES442133A1 (es) | 1977-06-16 |
| DE2546906A1 (de) | 1976-09-30 |
| FI752917A7 (show.php) | 1976-04-30 |
| JPS5176251A (show.php) | 1976-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU599029B2 (en) | Ascorbic acid derivatives, production and use thereof | |
| JPH10504836A (ja) | オルト置換芳香族エーテル化合物及び鎮痛のための薬剤組成物中へのこれらの使用 | |
| EP0974583B1 (en) | Phenylpiperidine derivatives | |
| US4003908A (en) | Derivatives of imidazo(4,5-b)pyridines | |
| US4112236A (en) | Interphenylene 8-aza-9-dioxothia-11,12-secoprostaglandins | |
| US4247706A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| NZ202298A (en) | Benzofuranone derivatives and pharmaceutical compositions | |
| US4829081A (en) | Analogs of mevalonolactone and derivatives thereof | |
| US4205170A (en) | Propionic acid derivatives | |
| EP0074170B1 (en) | Chroman compounds, process for producing them and pharmaceutical compositions containing them | |
| US4539326A (en) | 5-Oxo-5H-(1)benzopyrano(2,3-b)pyridine derivatives, their production and use as anti-inflammatory agents | |
| EP0068386B1 (de) | Substituierte Imidazo(1,5-a)pyridine, Verfahren zu ihrer Herstellung und pharmazeutische Präparate die diese Verbindungen enthalten | |
| GB1586655A (en) | Pyrido-indole transquilising agents | |
| NO753530L (show.php) | ||
| US4154743A (en) | 3-Oxobenzofuranyl-2-idenyl, haloacetic acids | |
| US3929833A (en) | Organic compounds | |
| JPH07119188B2 (ja) | カルコン誘導体 | |
| FR2849849A1 (fr) | Nouveaux acides carboxyliques et derives pour le traitement et la prevention du diabete et des dyslipemies | |
| SU982544A3 (ru) | Способ получени 5,8-дигидро-5-этил-8-оксофуро (3,2в)-1,8-нафтиридин-7-карбоновой кислоты или ее соли | |
| US4716172A (en) | 4-substituted octahydroquinolizine analgesic compounds and octahydroquinolizinium intermediates | |
| US3420841A (en) | 1,3-di-(4-pyridyl)propane derivatives | |
| US4076838A (en) | Benzocycloheptene-2-acetic acids | |
| US3828053A (en) | Lower-alkyl-beta-oxo-4-piperidine-n-benzoylpropionates | |
| US4088654A (en) | Derivatives of imidazo(4,5-b)pyridines | |
| NO800230L (no) | Fremgangsmaate ved fremstilling av kinazolinderivater |