NO744296L - - Google Patents
Info
- Publication number
- NO744296L NO744296L NO744296A NO744296A NO744296L NO 744296 L NO744296 L NO 744296L NO 744296 A NO744296 A NO 744296A NO 744296 A NO744296 A NO 744296A NO 744296 L NO744296 L NO 744296L
- Authority
- NO
- Norway
- Prior art keywords
- cephem
- carboxylic acid
- thiomethyl
- methyl
- thiadiazol
- Prior art date
Links
- -1 4-methyl-thiazol-2-yl Chemical group 0.000 claims description 241
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 claims description 148
- 150000003839 salts Chemical class 0.000 claims description 25
- 150000002148 esters Chemical class 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 150000001735 carboxylic acids Chemical class 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- 125000004122 cyclic group Chemical group 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 208000035143 Bacterial infection Diseases 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 208000022362 bacterial infectious disease Diseases 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 4
- RJCCVRUTJIZWBE-FYZOBXCZSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CCS[C@@H]2CC(=O)N12 RJCCVRUTJIZWBE-FYZOBXCZSA-N 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000005556 thienylene group Chemical group 0.000 claims 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 238000006467 substitution reaction Methods 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 156
- 238000002844 melting Methods 0.000 description 131
- 230000008018 melting Effects 0.000 description 131
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 45
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 42
- 239000000243 solution Substances 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 37
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 28
- 239000000047 product Substances 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 22
- 238000001816 cooling Methods 0.000 description 21
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 21
- 235000017557 sodium bicarbonate Nutrition 0.000 description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 17
- 239000000706 filtrate Substances 0.000 description 16
- 229910052757 nitrogen Chemical group 0.000 description 14
- OCVLSHAVSIYKLI-UHFFFAOYSA-N 3h-1,3-thiazole-2-thione Chemical compound SC1=NC=CS1 OCVLSHAVSIYKLI-UHFFFAOYSA-N 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- SXKAOFCKWNAYJV-UHFFFAOYSA-N 2-(4-carbamimidoylphenoxy)acetyl chloride;hydrochloride Chemical compound Cl.NC(=N)C1=CC=C(OCC(Cl)=O)C=C1 SXKAOFCKWNAYJV-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- NAKQCFRTJSBUPT-UHFFFAOYSA-N 3-phenyl-2h-1,2,4-thiadiazole-5-thione Chemical compound S1C(S)=NC(C=2C=CC=CC=2)=N1 NAKQCFRTJSBUPT-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- YNFFJMSEXROLQH-UHFFFAOYSA-N 2-(4-carbamimidoylphenyl)acetyl chloride;hydrochloride Chemical compound Cl.NC(=N)C1=CC=C(CC(Cl)=O)C=C1 YNFFJMSEXROLQH-UHFFFAOYSA-N 0.000 description 7
- WTWUBAYBORQHCK-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenyl]acetyl chloride;hydrochloride Chemical compound Cl.C1=CC(CC(=O)Cl)=CC=C1N1C=NCC1 WTWUBAYBORQHCK-UHFFFAOYSA-N 0.000 description 7
- JLAMDELLBBZOOX-UHFFFAOYSA-N 3h-1,3,4-thiadiazole-2-thione Chemical compound SC1=NN=CS1 JLAMDELLBBZOOX-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- LDBWVTIHZMGKJM-UHFFFAOYSA-N 2-[4-(n'-hexylcarbamimidoyl)phenoxy]acetyl chloride;hydrochloride Chemical compound Cl.CCCCCCNC(=N)C1=CC=C(OCC(Cl)=O)C=C1 LDBWVTIHZMGKJM-UHFFFAOYSA-N 0.000 description 6
- FPVUWZFFEGYCGB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CC1=NN=C(S)S1 FPVUWZFFEGYCGB-UHFFFAOYSA-N 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 5
- NLHAIPFBNQZTMY-UHFFFAOYSA-N 4-methyl-3h-1,3-thiazole-2-thione Chemical compound CC1=CSC(S)=N1 NLHAIPFBNQZTMY-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000004283 imidazolin-2-yl group Chemical group [H]N1C(*)=NC([H])([H])C1([H])[H] 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 229960003424 phenylacetic acid Drugs 0.000 description 5
- 239000003279 phenylacetic acid Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 4
- ZLEDENDEVATHJB-UHFFFAOYSA-N 2-[4-(diaminomethylideneamino)phenyl]acetyl chloride;hydrochloride Chemical compound Cl.NC(=N)NC1=CC=C(CC(Cl)=O)C=C1 ZLEDENDEVATHJB-UHFFFAOYSA-N 0.000 description 4
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- ZVGKPQCCKGLQPB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-oxadiazole-2-thione Chemical compound CC1=NN=C(S)O1 ZVGKPQCCKGLQPB-UHFFFAOYSA-N 0.000 description 4
- FOHWXVBZGSVUGO-UHFFFAOYSA-N 5-phenyl-3h-1,3,4-oxadiazole-2-thione Chemical compound O1C(S)=NN=C1C1=CC=CC=C1 FOHWXVBZGSVUGO-UHFFFAOYSA-N 0.000 description 4
- PYVUFGZVZNBZRY-UHFFFAOYSA-N 5-propyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CCCC1=NNC(=S)S1 PYVUFGZVZNBZRY-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 125000001544 thienyl group Chemical group 0.000 description 4
- TVCRPVALIUAPDA-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenoxy]acetyl chloride;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)Cl)=CC=C1N1C=NCC1 TVCRPVALIUAPDA-UHFFFAOYSA-N 0.000 description 3
- CYCKHTAVNBPQDB-UHFFFAOYSA-N 4-phenyl-3H-thiazole-2-thione Chemical compound S1C(S)=NC(C=2C=CC=CC=2)=C1 CYCKHTAVNBPQDB-UHFFFAOYSA-N 0.000 description 3
- HPDKGOQMXJNIDB-UHFFFAOYSA-N 5-butyl-3h-1,3,4-oxadiazole-2-thione Chemical compound CCCCC1=NNC(=S)O1 HPDKGOQMXJNIDB-UHFFFAOYSA-N 0.000 description 3
- YCSKCFNAZMHYAL-UHFFFAOYSA-N 5-butyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CCCCC1=NNC(=S)S1 YCSKCFNAZMHYAL-UHFFFAOYSA-N 0.000 description 3
- ZTLMHGOWADYAHM-UHFFFAOYSA-N 5-phenyl-3h-1,3,4-thiadiazole-2-thione Chemical compound S1C(S)=NN=C1C1=CC=CC=C1 ZTLMHGOWADYAHM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 125000002098 pyridazinyl group Chemical group 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- SCJDIMRKEQKZAW-FOUAAFFMSA-N (6r)-4-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylic acid Chemical compound C1=CC(N)(C(O)=O)S[C@@H]2CC(=O)N21 SCJDIMRKEQKZAW-FOUAAFFMSA-N 0.000 description 2
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 2
- UDTVQXNZIKQKOI-BAFYGKSASA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylic acid Chemical compound C1=CC(C(=O)O)S[C@@H]2CC(=O)N21 UDTVQXNZIKQKOI-BAFYGKSASA-N 0.000 description 2
- 125000001305 1,2,4-triazol-3-yl group Chemical group [H]N1N=C([*])N=C1[H] 0.000 description 2
- WGJCBBASTRWVJL-UHFFFAOYSA-N 1,3-thiazolidine-2-thione Chemical compound SC1=NCCS1 WGJCBBASTRWVJL-UHFFFAOYSA-N 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 2
- XOHZHMUQBFJTNH-UHFFFAOYSA-N 1-methyl-2h-tetrazole-5-thione Chemical compound CN1N=NN=C1S XOHZHMUQBFJTNH-UHFFFAOYSA-N 0.000 description 2
- WMWWJPMQQUPEKK-UHFFFAOYSA-N 2-(4-carbamimidoyl-2-methoxyphenoxy)acetyl chloride;hydrochloride Chemical compound Cl.COC1=CC(C(N)=N)=CC=C1OCC(Cl)=O WMWWJPMQQUPEKK-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- QPTBEQAOQPKNCT-UHFFFAOYSA-N 2-[4-(4,5-dihydro-1h-imidazol-2-yl)-2-methoxyphenoxy]acetyl chloride;hydrochloride Chemical compound Cl.C1=C(OCC(Cl)=O)C(OC)=CC(C=2NCCN=2)=C1 QPTBEQAOQPKNCT-UHFFFAOYSA-N 0.000 description 2
- OWNQOPFMLVOZCP-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1N1C=NCC1 OWNQOPFMLVOZCP-UHFFFAOYSA-N 0.000 description 2
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 2
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- RUBRCWOFANAOTP-UHFFFAOYSA-N 3h-1,3,4-oxadiazole-2-thione Chemical compound S=C1NN=CO1 RUBRCWOFANAOTP-UHFFFAOYSA-N 0.000 description 2
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 2
- GDGIVSREGUOIJZ-UHFFFAOYSA-N 5-amino-3h-1,3,4-thiadiazole-2-thione Chemical compound NC1=NN=C(S)S1 GDGIVSREGUOIJZ-UHFFFAOYSA-N 0.000 description 2
- JEBLNEZCHGZGNM-UHFFFAOYSA-N 5-propyl-3h-1,3,4-oxadiazole-2-thione Chemical compound CCCC1=NN=C(S)O1 JEBLNEZCHGZGNM-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 229930186147 Cephalosporin Natural products 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 125000006196 aroyl alkyl group Chemical group 0.000 description 2
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229940124587 cephalosporin Drugs 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 230000020176 deacylation Effects 0.000 description 2
- 238000005947 deacylation reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000002636 imidazolinyl group Chemical group 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000001226 reprecipitation Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 125000004525 thiadiazinyl group Chemical group S1NN=C(C=C1)* 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- RJFPBECTFIUTHB-BAFYGKSASA-N (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class S1CC=C(C(O)=O)N2C(=O)C(N)[C@H]21 RJFPBECTFIUTHB-BAFYGKSASA-N 0.000 description 1
- 125000001506 1,2,3-triazol-5-yl group Chemical group [H]N1N=NC([H])=C1[*] 0.000 description 1
- 125000004505 1,2,4-oxadiazol-5-yl group Chemical group O1N=CN=C1* 0.000 description 1
- 125000004515 1,2,4-thiadiazol-3-yl group Chemical group S1N=C(N=C1)* 0.000 description 1
- 125000004516 1,2,4-thiadiazol-5-yl group Chemical group S1N=CN=C1* 0.000 description 1
- 125000004522 1,3,4-thiadiazol-5-yl group Chemical group S1C=NN=C1* 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- FHTDDANQIMVWKZ-UHFFFAOYSA-N 1h-pyridine-4-thione Chemical compound SC1=CC=NC=C1 FHTDDANQIMVWKZ-UHFFFAOYSA-N 0.000 description 1
- KXZSVYHFYHTNBI-UHFFFAOYSA-N 1h-quinoline-2-thione Chemical compound C1=CC=CC2=NC(S)=CC=C21 KXZSVYHFYHTNBI-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- UDOLXJQRYLXDPA-UHFFFAOYSA-N 2-(2-butoxy-4-carbamimidoylphenyl)acetic acid Chemical compound CCCCOC1=CC(C(N)=N)=CC=C1CC(O)=O UDOLXJQRYLXDPA-UHFFFAOYSA-N 0.000 description 1
- NOZKXRAMTCYCHH-UHFFFAOYSA-N 2-(3-carbamimidoylphenyl)acetic acid Chemical compound NC(=N)C1=CC=CC(CC(O)=O)=C1 NOZKXRAMTCYCHH-UHFFFAOYSA-N 0.000 description 1
- FMNLETOPHQKCSM-UHFFFAOYSA-N 2-(4-aminophenoxy)acetyl chloride;hydrochloride Chemical compound Cl.NC1=CC=C(OCC(Cl)=O)C=C1 FMNLETOPHQKCSM-UHFFFAOYSA-N 0.000 description 1
- JXWHHDBFBAUYBV-UHFFFAOYSA-N 2-(4-aminophenyl)acetyl chloride;hydrochloride Chemical compound Cl.NC1=CC=C(CC(Cl)=O)C=C1 JXWHHDBFBAUYBV-UHFFFAOYSA-N 0.000 description 1
- GVXWRFQRKQDHHZ-UHFFFAOYSA-N 2-(4-carbamimidoyl-2-chlorophenyl)acetic acid Chemical compound NC(=N)C1=CC=C(CC(O)=O)C(Cl)=C1 GVXWRFQRKQDHHZ-UHFFFAOYSA-N 0.000 description 1
- MWIPDJHYYHFSNJ-UHFFFAOYSA-N 2-(4-carbamimidoyl-2-methoxyphenoxy)acetic acid Chemical compound COC1=CC(C(N)=N)=CC=C1OCC(O)=O MWIPDJHYYHFSNJ-UHFFFAOYSA-N 0.000 description 1
- DJHMMUZYXQYFHN-UHFFFAOYSA-N 2-(4-carbamimidoyl-2-methoxyphenyl)acetic acid Chemical compound COC1=CC(C(N)=N)=CC=C1CC(O)=O DJHMMUZYXQYFHN-UHFFFAOYSA-N 0.000 description 1
- SICOJPBKXVBOAQ-UHFFFAOYSA-N 2-(4-carbamimidoyl-2-methylphenyl)acetic acid Chemical compound CC1=CC(C(N)=N)=CC=C1CC(O)=O SICOJPBKXVBOAQ-UHFFFAOYSA-N 0.000 description 1
- QBZZTMUDXDARTD-UHFFFAOYSA-N 2-(4-carbamimidoylphenoxy)acetic acid Chemical compound NC(=N)C1=CC=C(OCC(O)=O)C=C1 QBZZTMUDXDARTD-UHFFFAOYSA-N 0.000 description 1
- SSGFEOFDJDCDCI-UHFFFAOYSA-N 2-(4-carbamimidoylphenyl)acetic acid Chemical compound NC(=N)C1=CC=C(CC(O)=O)C=C1 SSGFEOFDJDCDCI-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- UQPCUSRVQFTXPI-UHFFFAOYSA-N 2-[4-(1,5-dimethyl-4,5-dihydroimidazol-2-yl)phenyl]acetic acid Chemical compound CN1C(C)CN=C1C1=CC=C(CC(O)=O)C=C1 UQPCUSRVQFTXPI-UHFFFAOYSA-N 0.000 description 1
- FMCLZRREMGCZNC-UHFFFAOYSA-N 2-[4-(4,5-dihydro-1h-imidazol-2-yl)phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1C1=NCCN1 FMCLZRREMGCZNC-UHFFFAOYSA-N 0.000 description 1
- MSGJFROSWKWZLL-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1N1C=NCC1 MSGJFROSWKWZLL-UHFFFAOYSA-N 0.000 description 1
- NFLQEVLKWGQNIA-UHFFFAOYSA-N 2-[4-(5,5-dimethyl-4,6-dihydro-1h-pyrimidin-2-yl)phenyl]acetic acid Chemical compound C1C(C)(C)CNC(C=2C=CC(CC(O)=O)=CC=2)=N1 NFLQEVLKWGQNIA-UHFFFAOYSA-N 0.000 description 1
- FFVKVNYSPFQISL-UHFFFAOYSA-N 2-[4-(5-butyl-1-methyl-4,5-dihydroimidazol-2-yl)phenyl]acetic acid Chemical compound CN1C(CCCC)CN=C1C1=CC=C(CC(O)=O)C=C1 FFVKVNYSPFQISL-UHFFFAOYSA-N 0.000 description 1
- IEBDXMAFJPPSGK-UHFFFAOYSA-N 2-[4-(diaminomethylideneamino)phenyl]acetic acid Chemical compound NC(=N)NC1=CC=C(CC(O)=O)C=C1 IEBDXMAFJPPSGK-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 229940054266 2-mercaptobenzothiazole Drugs 0.000 description 1
- RQSCFNPNNLWQBJ-UHFFFAOYSA-N 2-methyl-1,3,4-thiadiazole Chemical compound CC1=NN=CS1 RQSCFNPNNLWQBJ-UHFFFAOYSA-N 0.000 description 1
- LSTUQAHDYDFHFY-UHFFFAOYSA-N 2-phenyl-4H-1,3,4-thiadiazine Chemical compound C1(=CC=CC=C1)C=1SC=CNN1 LSTUQAHDYDFHFY-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NRENOZNSHMLGOF-UHFFFAOYSA-N 2-sulfanyltriazole Chemical compound SN1N=CC=N1 NRENOZNSHMLGOF-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- QPHZWABVAIGWHI-UHFFFAOYSA-N 3-methyl-2h-1,2,4-thiadiazole-5-thione Chemical compound CC1=NSC(S)=N1 QPHZWABVAIGWHI-UHFFFAOYSA-N 0.000 description 1
- UWSONZCNXUSTKW-UHFFFAOYSA-N 4,5-Dimethylthiazole Chemical compound CC=1N=CSC=1C UWSONZCNXUSTKW-UHFFFAOYSA-N 0.000 description 1
- 125000000972 4,5-dimethylthiazol-2-yl group Chemical group [H]C([H])([H])C1=C(N=C(*)S1)C([H])([H])[H] 0.000 description 1
- RAFAYWADRVMWFA-UHFFFAOYSA-N 4,6-dimethyl-1h-pyrimidine-2-thione Chemical compound CC1=CC(C)=NC(S)=N1 RAFAYWADRVMWFA-UHFFFAOYSA-N 0.000 description 1
- DLLBXBCKFUPBJE-UHFFFAOYSA-N 4-amino-1h-1,2,4-triazole-5-thione Chemical compound NN1C=NNC1=S DLLBXBCKFUPBJE-UHFFFAOYSA-N 0.000 description 1
- NHJQUZUFQOQBNE-UHFFFAOYSA-N 4-amino-3-ethyl-1h-1,2,4-triazole-5-thione Chemical compound CCC1=NNC(=S)N1N NHJQUZUFQOQBNE-UHFFFAOYSA-N 0.000 description 1
- KBKNKJFPVHUXCW-UHFFFAOYSA-N 4-amino-3-methyl-1h-1,2,4-triazole-5-thione Chemical compound CC1=NNC(=S)N1N KBKNKJFPVHUXCW-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- PRKZLIDQCQVIJT-UHFFFAOYSA-N 4-butyl-3h-1,3-thiazole-2-thione Chemical compound CCCCC1=CSC(=S)N1 PRKZLIDQCQVIJT-UHFFFAOYSA-N 0.000 description 1
- NFWIPQBJLBDGPT-UHFFFAOYSA-N 4-ethyl-2-sulfanyltriazole Chemical compound CCC=1C=NN(S)N=1 NFWIPQBJLBDGPT-UHFFFAOYSA-N 0.000 description 1
- FORKADXOPFAOHL-UHFFFAOYSA-N 4-ethyl-3h-1,3-thiazole-2-thione Chemical compound CCC1=CSC(S)=N1 FORKADXOPFAOHL-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- QRBREYLQUHFGNB-UHFFFAOYSA-N 4-methyl-1,3-thiazole-5-thiol Chemical compound CC=1N=CSC=1S QRBREYLQUHFGNB-UHFFFAOYSA-N 0.000 description 1
- FGLAFVWISSMEEI-UHFFFAOYSA-N 4-methylsulfanyl-6-phenyl-1h-1,3,5-triazine-2-thione Chemical compound CSC1=NC(S)=NC(C=2C=CC=CC=2)=N1 FGLAFVWISSMEEI-UHFFFAOYSA-N 0.000 description 1
- YGYKJHCECBCELB-UHFFFAOYSA-N 4-phenyl-1,3,4-thiadiazolidine-2-thione Chemical compound C1SC(S)=NN1C1=CC=CC=C1 YGYKJHCECBCELB-UHFFFAOYSA-N 0.000 description 1
- BACKYMNXXFPCRL-UHFFFAOYSA-N 4-propan-2-yl-3h-1,3-thiazole-2-thione Chemical compound CC(C)C1=CSC(S)=N1 BACKYMNXXFPCRL-UHFFFAOYSA-N 0.000 description 1
- PCAJJXCUIDYJFQ-UHFFFAOYSA-N 4-propyl-3h-1,3-thiazole-2-thione Chemical compound CCCC1=CSC(S)=N1 PCAJJXCUIDYJFQ-UHFFFAOYSA-N 0.000 description 1
- LORVDQSPQDOFQN-UHFFFAOYSA-N 4-tert-butyl-3h-1,3-thiazole-2-thione Chemical compound CC(C)(C)C1=CSC(=S)N1 LORVDQSPQDOFQN-UHFFFAOYSA-N 0.000 description 1
- UFSCJPPXRHCNLK-UHFFFAOYSA-N 5-ethyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CCC1=NN=C(S)S1 UFSCJPPXRHCNLK-UHFFFAOYSA-N 0.000 description 1
- OUZCWDMJTKYHCA-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound CC1=NNC(S)=N1 OUZCWDMJTKYHCA-UHFFFAOYSA-N 0.000 description 1
- BHQUBONFIYNJDA-UHFFFAOYSA-N 5-nitro-1h-pyridine-2-thione Chemical compound [O-][N+](=O)C1=CC=C(S)N=C1 BHQUBONFIYNJDA-UHFFFAOYSA-N 0.000 description 1
- BVPHXTUEZOQIBS-UHFFFAOYSA-N 6-methyl-1h-pyrimidine-2-thione Chemical compound CC1=CC=NC(S)=N1 BVPHXTUEZOQIBS-UHFFFAOYSA-N 0.000 description 1
- NKOPQOSBROLOFP-UHFFFAOYSA-N 6-methyl-3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical compound CC1=NNC(=S)NC1=O NKOPQOSBROLOFP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 108010087702 Penicillinase Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000001912 cyanamides Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- PMRYVIKBURPHAH-UHFFFAOYSA-N methimazole Chemical compound CN1C=CNC1=S PMRYVIKBURPHAH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000006384 methylpyridyl group Chemical group 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 125000004287 oxazol-2-yl group Chemical group [H]C1=C([H])N=C(*)O1 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229950009506 penicillinase Drugs 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- YBBJKCMMCRQZMA-UHFFFAOYSA-N pyrithione Chemical compound ON1C=CC=CC1=S YBBJKCMMCRQZMA-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 1
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- ZEMGGZBWXRYJHK-UHFFFAOYSA-N thiouracil Chemical compound O=C1C=CNC(=S)N1 ZEMGGZBWXRYJHK-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE2359544A DE2359544A1 (de) | 1973-11-29 | 1973-11-29 | Cephemderivate und verfahren zu ihrer herstellung |
Publications (1)
Publication Number | Publication Date |
---|---|
NO744296L true NO744296L (it) | 1975-06-23 |
Family
ID=5899440
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO744296A NO744296L (it) | 1973-11-29 | 1974-11-28 |
Country Status (23)
Country | Link |
---|---|
US (1) | US4016159A (it) |
JP (1) | JPS5088088A (it) |
AT (1) | AT341087B (it) |
AU (1) | AU7581274A (it) |
BE (1) | BE822780A (it) |
CA (1) | CA1040621A (it) |
CH (2) | CH611305A5 (it) |
DD (1) | DD117076A5 (it) |
DE (1) | DE2359544A1 (it) |
DK (1) | DK619574A (it) |
EG (1) | EG11596A (it) |
ES (1) | ES432221A1 (it) |
FI (1) | FI343374A (it) |
FR (1) | FR2252850B1 (it) |
GB (1) | GB1469448A (it) |
HU (1) | HU169852B (it) |
IE (1) | IE40424B1 (it) |
IL (1) | IL46084A0 (it) |
LU (1) | LU71381A1 (it) |
NL (1) | NL7415285A (it) |
NO (1) | NO744296L (it) |
SE (1) | SE7414994L (it) |
ZA (1) | ZA747594B (it) |
Families Citing this family (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4049806A (en) * | 1975-08-15 | 1977-09-20 | Syntex (U.S.A.) Inc. | Cephalosporin type antibacterials |
GB1579532A (en) * | 1976-05-21 | 1980-11-19 | Farmaceutici Italia | Cephalosporins |
DE3165912D1 (en) * | 1980-03-13 | 1984-10-18 | Ciba Geigy Ag | Metal complexes of isoindoline azines, processes for their preparation and their use |
JPS58212791A (ja) * | 1982-06-07 | 1983-12-10 | Microbial Chem Res Found | 新生理活性物質アルフアメニン及びその製造法 |
JPS59193889A (ja) * | 1983-04-18 | 1984-11-02 | Asahi Chem Ind Co Ltd | セフアロスポリン系化合物 |
JPS6233185A (ja) * | 1985-08-06 | 1987-02-13 | Otsuka Chem Co Ltd | セフアロスポリン化合物の新規誘導体、その製造方法及び該誘導体を含有する医薬組成物 |
US6291514B1 (en) | 1998-02-09 | 2001-09-18 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines, preparation thereof, and use thereof as protease inhibitors |
CA2750047A1 (en) | 2009-01-21 | 2010-07-29 | Basilea Pharmaceutica Ag | Novel bicyclic antibiotics |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3855213A (en) * | 1971-02-18 | 1974-12-17 | Smith Kline French Lab | 3-heterocyclic thiomethyl-cephalosporins |
DE2118635A1 (de) * | 1971-04-17 | 1972-11-02 | Farbwerke Hoechst AG, vormals Meister Lucius & Brüning, 6000 Frankfurt | Acylaminocephalosporansäuren und Verfahren zu ihrer Herstellung |
-
1973
- 1973-11-29 DE DE2359544A patent/DE2359544A1/de active Pending
-
1974
- 1974-10-28 CA CA212,430A patent/CA1040621A/en not_active Expired
- 1974-11-19 IL IL46084A patent/IL46084A0/xx unknown
- 1974-11-22 NL NL7415285A patent/NL7415285A/xx not_active Application Discontinuation
- 1974-11-23 ES ES432221A patent/ES432221A1/es not_active Expired
- 1974-11-27 FI FI3433/74A patent/FI343374A/fi unknown
- 1974-11-27 LU LU71381A patent/LU71381A1/xx unknown
- 1974-11-27 AU AU75812/74A patent/AU7581274A/en not_active Expired
- 1974-11-27 DD DD182617A patent/DD117076A5/xx unknown
- 1974-11-27 US US05/527,704 patent/US4016159A/en not_active Expired - Lifetime
- 1974-11-28 CH CH1581474A patent/CH611305A5/xx not_active IP Right Cessation
- 1974-11-28 IE IE2451/74A patent/IE40424B1/xx unknown
- 1974-11-28 ZA ZA00747594A patent/ZA747594B/xx unknown
- 1974-11-28 CH CH246478A patent/CH611307A5/xx not_active IP Right Cessation
- 1974-11-28 GB GB5164474A patent/GB1469448A/en not_active Expired
- 1974-11-28 NO NO744296A patent/NO744296L/no unknown
- 1974-11-28 DK DK619574A patent/DK619574A/da unknown
- 1974-11-28 AT AT953474A patent/AT341087B/de active
- 1974-11-28 JP JP49135961A patent/JPS5088088A/ja active Pending
- 1974-11-29 SE SE7414994A patent/SE7414994L/xx unknown
- 1974-11-29 HU HUHO1747A patent/HU169852B/hu unknown
- 1974-11-29 FR FR7439302A patent/FR2252850B1/fr not_active Expired
- 1974-11-29 BE BE151010A patent/BE822780A/xx unknown
- 1974-11-30 EG EG524/74A patent/EG11596A/xx active
Also Published As
Publication number | Publication date |
---|---|
CA1040621A (en) | 1978-10-17 |
GB1469448A (en) | 1977-04-06 |
ZA747594B (en) | 1975-12-31 |
ES432221A1 (es) | 1976-11-01 |
DK619574A (it) | 1975-07-28 |
LU71381A1 (it) | 1976-09-06 |
BE822780A (fr) | 1975-05-29 |
AU7581274A (en) | 1976-05-27 |
EG11596A (en) | 1979-03-31 |
JPS5088088A (it) | 1975-07-15 |
FI343374A (it) | 1975-05-30 |
CH611305A5 (it) | 1979-05-31 |
IE40424B1 (en) | 1979-05-23 |
US4016159A (en) | 1977-04-05 |
IL46084A0 (en) | 1975-02-10 |
FR2252850A1 (it) | 1975-06-27 |
SE7414994L (it) | 1975-05-30 |
AT341087B (de) | 1978-01-25 |
FR2252850B1 (it) | 1978-07-21 |
CH611307A5 (it) | 1979-05-31 |
DE2359544A1 (de) | 1975-10-30 |
IE40424L (en) | 1975-05-29 |
ATA953474A (de) | 1977-05-15 |
NL7415285A (nl) | 1975-06-02 |
HU169852B (it) | 1977-02-28 |
DD117076A5 (it) | 1975-12-20 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4470983A (en) | Cephalosporin derivatives | |
US4421912A (en) | Cephalosporin derivatives | |
JPS6228153B2 (it) | ||
US4201779A (en) | 7[(2-Amino-thiazol-4-yl)glyoxylamido]-cephem derivatives and processes for their preparation | |
SE447384B (sv) | Forfarande for framstellning av cefalosporinderivat | |
HU177441B (en) | Process for preparing syn isomers of 3,7-disubstituted 3-cephem-4-carboxylic acid derivatives | |
FR2534922A1 (fr) | Procede de preparation de composes de cephem et nouveaux produits ainsi que les compositions pharmaceutiques les renfermant | |
CA1225390A (en) | 3-bicyclicpyridinium-methyl cephalosporins | |
KR910000035B1 (ko) | 세팔로스포린 화합물, 이의 제법 및 이를 함유하는 약학적 조성물 | |
HU187575B (en) | Process for the preparation of cephem-carboxylic acid derivatives substituted by thienopyridinium-methyl and furopyridinium-methyl group | |
NO744296L (it) | ||
US4971961A (en) | Cephalosporin compounds and antibacterial agents | |
US4758557A (en) | Cephalosporin derivatives and bactericides containing the same | |
SE452324B (sv) | 7-beta-/alfa-syn-metoxiimino-alfa(2-aminotiazol-4-yl)-acetamido/-3-/(1,2,3-tiadiazol-5-yltio) metyl/-3-cefem-4-karboxylsyra samt derivat derav och farmaceutiska kompositioner derav | |
KR960015033B1 (ko) | 새로운 세팔로스포린 화합물 및 항균제 | |
US4358448A (en) | N-substituted thiazolyl derivatives of oxy-imino-substituted cephalosporins useful as anti-bacterial agents | |
HU184680B (en) | Process for producing ceph-3-eme-4-carboxylic acid derivatives containing amino-thiazolyl group in the side chain | |
CA1146947A (en) | Cephem derivatives and processes for their preparation | |
US4379924A (en) | Cephalosporin derivatives | |
KR860002184B1 (ko) | 세펨 유도체의 제조방법 | |
CA1209577A (en) | 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for preparation thereof | |
HU195966B (en) | Process for preparing antibacterial compounds and pharmaceutical compositions containing such compounds | |
IE44888B1 (en) | 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation theroef | |
JPH06298770A (ja) | 新規なセフェム化合物、その製造方法及び抗菌剤 | |
PT95843A (pt) | Processo para a preparacao de compostos de cefalosporina e de composicoes farmaceuticas que os contem |