NO743912L - - Google Patents
Info
- Publication number
- NO743912L NO743912L NO743912A NO743912A NO743912L NO 743912 L NO743912 L NO 743912L NO 743912 A NO743912 A NO 743912A NO 743912 A NO743912 A NO 743912A NO 743912 L NO743912 L NO 743912L
- Authority
- NO
- Norway
- Prior art keywords
- compartment
- compartments
- cells
- cell
- hydroxide
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 87
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 84
- 239000012528 membrane Substances 0.000 claims description 83
- 239000000243 solution Substances 0.000 claims description 78
- 239000000872 buffer Substances 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 44
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 31
- 229920001577 copolymer Polymers 0.000 claims description 29
- 238000004519 manufacturing process Methods 0.000 claims description 29
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 26
- 229910052801 chlorine Inorganic materials 0.000 claims description 26
- 239000000460 chlorine Substances 0.000 claims description 26
- -1 halide ions Chemical class 0.000 claims description 24
- 239000000463 material Substances 0.000 claims description 22
- 230000008569 process Effects 0.000 claims description 22
- 238000005868 electrolysis reaction Methods 0.000 claims description 21
- 239000011780 sodium chloride Substances 0.000 claims description 16
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 14
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 13
- 229920001155 polypropylene Polymers 0.000 claims description 13
- 239000010936 titanium Substances 0.000 claims description 13
- 229910052719 titanium Inorganic materials 0.000 claims description 13
- 239000003792 electrolyte Substances 0.000 claims description 11
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 claims description 10
- 239000007864 aqueous solution Substances 0.000 claims description 10
- 150000002430 hydrocarbons Chemical class 0.000 claims description 10
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 10
- 239000004215 Carbon black (E152) Substances 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 229920000642 polymer Polymers 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- 229910000510 noble metal Inorganic materials 0.000 claims description 8
- 239000004743 Polypropylene Substances 0.000 claims description 7
- 229910000831 Steel Inorganic materials 0.000 claims description 7
- 229910052697 platinum Inorganic materials 0.000 claims description 7
- 239000010959 steel Substances 0.000 claims description 7
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 6
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 claims description 5
- 150000004706 metal oxides Chemical class 0.000 claims description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 5
- 229910052707 ruthenium Inorganic materials 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 239000010425 asbestos Substances 0.000 claims description 4
- 229910002804 graphite Inorganic materials 0.000 claims description 4
- 239000010439 graphite Substances 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 239000010970 precious metal Substances 0.000 claims description 4
- 229910052895 riebeckite Inorganic materials 0.000 claims description 4
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 4
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 3
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 claims description 2
- 229910045601 alloy Inorganic materials 0.000 claims description 2
- 239000000956 alloy Substances 0.000 claims description 2
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 239000010955 niobium Substances 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 239000002699 waste material Substances 0.000 claims 3
- JMGNVALALWCTLC-UHFFFAOYSA-N 1-fluoro-2-(2-fluoroethenoxy)ethene Chemical class FC=COC=CF JMGNVALALWCTLC-UHFFFAOYSA-N 0.000 claims 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 1
- 241000102542 Kara Species 0.000 claims 1
- 238000004090 dissolution Methods 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 210000004027 cell Anatomy 0.000 description 105
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 27
- 235000002639 sodium chloride Nutrition 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 12
- 238000011282 treatment Methods 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 239000004020 conductor Substances 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 229920002678 cellulose Polymers 0.000 description 6
- 239000001913 cellulose Substances 0.000 description 6
- 239000010408 film Substances 0.000 description 6
- 239000004753 textile Substances 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical class [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 230000004048 modification Effects 0.000 description 5
- 238000012986 modification Methods 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 238000004061 bleaching Methods 0.000 description 4
- 238000010276 construction Methods 0.000 description 4
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 230000003134 recirculating effect Effects 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 3
- 230000006835 compression Effects 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 239000004800 polyvinyl chloride Substances 0.000 description 3
- 229920000915 polyvinyl chloride Polymers 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- 239000004155 Chlorine dioxide Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- 229920001131 Pulp (paper) Polymers 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910001508 alkali metal halide Inorganic materials 0.000 description 2
- 150000008045 alkali metal halides Chemical class 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 210000002421 cell wall Anatomy 0.000 description 2
- 235000019398 chlorine dioxide Nutrition 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000004035 construction material Substances 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000004064 recycling Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- 229920004546 Hetron™ Polymers 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920001774 Perfluoroether Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 210000005056 cell body Anatomy 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 235000021438 curry Nutrition 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012527 feed solution Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 239000013521 mastic Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000010309 melting process Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- UJMWVICAENGCRF-UHFFFAOYSA-N oxygen difluoride Chemical compound FOF UJMWVICAENGCRF-UHFFFAOYSA-N 0.000 description 1
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011513 prestressed concrete Substances 0.000 description 1
- 230000000135 prohibitive effect Effects 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000007665 sagging Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B13/00—Diaphragms; Spacing elements
- C25B13/02—Diaphragms; Spacing elements characterised by shape or form
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
- C25B1/26—Chlorine; Compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US411619A US3899403A (en) | 1973-11-01 | 1973-11-01 | Electrolytic method of making concentrated hydroxide solutions by sequential use of 3-compartment and 2-compartment electrolytic cells having separating compartment walls of particular cation-active permselective membranes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO743912L true NO743912L (pm) | 1975-05-26 |
Family
ID=23629662
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO743912A NO743912L (pm) | 1973-11-01 | 1974-10-30 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3899403A (pm) |
| JP (1) | JPS5075195A (pm) |
| AR (1) | AR209270A1 (pm) |
| AU (1) | AU7452974A (pm) |
| BR (1) | BR7409139D0 (pm) |
| DE (1) | DE2451847A1 (pm) |
| FI (1) | FI319374A7 (pm) |
| FR (1) | FR2249972A1 (pm) |
| IT (1) | IT1025403B (pm) |
| NL (1) | NL7414203A (pm) |
| NO (1) | NO743912L (pm) |
| SE (1) | SE7413728L (pm) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4147599A (en) * | 1977-07-19 | 1979-04-03 | Diamond Shamrock Corporation | Production of alkali metal carbonates in a cell having a carboxyl membrane |
| AR205953A1 (es) * | 1975-01-22 | 1976-06-15 | Diamond Shamrock Corp | Produccion de carbonatos de metales a calinos en una celula de membrana |
| JPS597795B2 (ja) * | 1975-04-17 | 1984-02-21 | 株式会社トクヤマ | 電解用陰極鑵 |
| US4212712A (en) * | 1975-11-19 | 1980-07-15 | Kureha Kagaku Kogyo Kabushiki Kaisha | Process for the electrolytic treatment of alkali metal halide solution using ion exchange membranes |
| FR2355926A1 (fr) * | 1975-11-21 | 1978-01-20 | Rhone Poulenc Ind | Diaphragme selectif d'electrolyse |
| US4036717A (en) * | 1975-12-29 | 1977-07-19 | Diamond Shamrock Corporation | Method for concentration and purification of a cell liquor in an electrolytic cell |
| US4057474A (en) * | 1976-06-25 | 1977-11-08 | Allied Chemical Corporation | Electrolytic production of alkali metal hydroxide |
| US4076603A (en) * | 1977-04-07 | 1978-02-28 | Kaiser Aluminum & Chemical Corporation | Caustic and chlorine production process |
| US4147600A (en) * | 1978-01-06 | 1979-04-03 | Hooker Chemicals & Plastics Corp. | Electrolytic method of producing concentrated hydroxide solutions |
| FR2618165B1 (fr) * | 1987-07-17 | 1991-05-10 | Rhone Poulenc Chimie | Procede de reduction par electrolyse et de separation de l'europium et cellule d'electrolyse pour la mise en oeuvre de ce procede. |
| US20020179435A1 (en) * | 2001-06-04 | 2002-12-05 | Maddan Orville Lee | Apparatus and method for producing magnesium from seawater |
| KR101118795B1 (ko) * | 2011-12-14 | 2012-03-21 | (주) 테크윈 | 소독부산물 저감형 고효율 차아염소산나트륨 발생장치 |
| EP3824991B1 (en) | 2012-04-23 | 2022-07-27 | Nemaska Lithium Inc. | Process for preparing lithium sulphate |
| CA2927020C (en) | 2012-05-30 | 2021-03-23 | Nemaska Lithium Inc. | Processes for preparing lithium carbonate |
| US20160032471A1 (en) | 2013-03-15 | 2016-02-04 | Nemaska Lithium Inc. | Processes for preparing lithium hydroxide |
| CA3185410A1 (en) | 2013-10-23 | 2015-04-30 | Nemaska Lithium Inc. | Process for preparing lithium hydroxide via two electrochemical cells |
| US10036094B2 (en) * | 2013-10-23 | 2018-07-31 | Nemaska Lithium Inc. | Processes and systems for preparing lithium hydroxide |
| CN103628085B (zh) * | 2013-11-22 | 2016-10-05 | 新汶矿业集团有限责任公司泰山盐化工分公司 | 氯碱生产中水资源循环利用方法 |
| AU2015221373C1 (en) | 2014-02-24 | 2019-09-05 | Nemaska Lithium Inc. | Methods for treating lithium-containing materials |
| US9644278B2 (en) * | 2015-03-13 | 2017-05-09 | Barbara Jean Manojlovich | Recycling hydrogen generator |
| CN105063655B (zh) * | 2015-08-12 | 2017-06-06 | 江苏安凯特科技股份有限公司 | 生产亚氨基二乙酸的方法 |
| CA3024085A1 (en) | 2016-05-17 | 2017-11-23 | Diversey, Inc. | Alkaline and chlorine solutions produced using electro-chemical activation |
| CA2940509A1 (en) | 2016-08-26 | 2018-02-26 | Nemaska Lithium Inc. | Processes for treating aqueous compositions comprising lithium sulfate and sulfuric acid |
| JP6921209B2 (ja) | 2017-01-26 | 2021-08-18 | ディバーシー,インコーポレーテッド | 電気化学的活性化システムにおける中和 |
| KR102400367B1 (ko) | 2017-11-22 | 2022-05-23 | 네마스카 리튬 인코포레이션 | 다양한 금속의 하이드록사이드와 옥사이드 및 이들의 유도체를 제조하는 방법 |
| CA3141478A1 (en) | 2019-05-22 | 2020-11-26 | Nemaska Lithium Inc. | Processes for preparing hydroxides and oxides of various metals and derivatives thereof |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2967807A (en) * | 1952-01-23 | 1961-01-10 | Hooker Chemical Corp | Electrolytic decomposition of sodium chloride |
| NL278049A (pm) * | 1961-05-05 | |||
| US3282875A (en) * | 1964-07-22 | 1966-11-01 | Du Pont | Fluorocarbon vinyl ether polymers |
| US3341366A (en) * | 1964-08-19 | 1967-09-12 | Gen Electric | Sulfonated polymers of alpha, beta, beta-trifluorostyrene, with applications to structures and cells |
| US3496077A (en) * | 1967-12-18 | 1970-02-17 | Hal B H Cooper | Electrolyzing of salt solutions |
| US3562008A (en) * | 1968-10-14 | 1971-02-09 | Ppg Industries Inc | Method for producing a ruthenium coated titanium electrode |
| US3773634A (en) * | 1972-03-09 | 1973-11-20 | Diamond Shamrock Corp | Control of an olyte-catholyte concentrations in membrane cells |
-
1973
- 1973-11-01 US US411619A patent/US3899403A/en not_active Expired - Lifetime
-
1974
- 1974-10-21 AU AU74529/74A patent/AU7452974A/en not_active Expired
- 1974-10-30 AR AR256341A patent/AR209270A1/es active
- 1974-10-30 NO NO743912A patent/NO743912L/no unknown
- 1974-10-30 FR FR7436301A patent/FR2249972A1/fr not_active Withdrawn
- 1974-10-30 NL NL7414203A patent/NL7414203A/xx unknown
- 1974-10-31 BR BR9139/74A patent/BR7409139D0/pt unknown
- 1974-10-31 DE DE19742451847 patent/DE2451847A1/de active Pending
- 1974-10-31 SE SE7413728A patent/SE7413728L/ not_active Application Discontinuation
- 1974-10-31 IT IT29063/74A patent/IT1025403B/it active
- 1974-10-31 JP JP49126516A patent/JPS5075195A/ja active Pending
- 1974-10-31 FI FI3193/74A patent/FI319374A7/fi unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1025403B (it) | 1978-08-10 |
| US3899403A (en) | 1975-08-12 |
| FI319374A7 (pm) | 1975-05-02 |
| AR209270A1 (es) | 1977-04-15 |
| AU7452974A (en) | 1976-04-29 |
| DE2451847A1 (de) | 1975-05-07 |
| NL7414203A (nl) | 1975-05-06 |
| BR7409139D0 (pt) | 1975-08-26 |
| FR2249972A1 (pm) | 1975-05-30 |
| SE7413728L (pm) | 1975-05-02 |
| JPS5075195A (pm) | 1975-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO743912L (pm) | ||
| CA1073402A (en) | Electrolytic manufacture of chlorates using a plurality of electrolytic cells | |
| CA1056768A (en) | Coating metal anodes to decrease consumption rates | |
| CA1043736A (en) | Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen | |
| US4272338A (en) | Process for the treatment of anolyte brine | |
| US3976549A (en) | Electrolysis method | |
| US5064514A (en) | Apparatus for the production of chloric acid | |
| US4124477A (en) | Electrolytic cell utilizing pretreated semi-permeable membranes | |
| EP0514427A1 (en) | ELECTROCHEMICAL PROCESS FOR THE PRODUCTION OF MIXTURES OF CHLORIC ACID AND AN ALKALINE METAL CHLORATE. | |
| CS214871B2 (en) | Method of preparation of alcalic metal carbonate in the electrolyser | |
| US4040919A (en) | Voltage reduction of membrane cell for the electrolysis of brine | |
| US3878072A (en) | Electrolytic method for the manufacture of chlorates | |
| US4578159A (en) | Electrolysis of alkali metal chloride brine in catholyteless membrane cells employing an oxygen consuming cathode | |
| US3954579A (en) | Electrolytic method for the simultaneous manufacture of concentrated and dilute aqueous hydroxide solutions | |
| NO144245B (no) | Fremgangsmaate ved fremstilling av halogen og alkalimetallhydroxyd ved elektrolyse av en vandig alkalimetallhalogenidopploesning | |
| CA1076060A (en) | Electrolytic method for the manufacture of hypochlorites | |
| US3905879A (en) | Electrolytic manufacture of dithionites | |
| JPH0573834B2 (pm) | ||
| US3920551A (en) | Electrolytic method for the manufacture of dithionites | |
| US3948737A (en) | Process for electrolysis of brine | |
| US4062743A (en) | Electrolytic process for potassium hydroxide | |
| NO139610B (no) | Fremgangsmaate for fremstilling av alkalihydroksyd og klor eller hydrogen eller klor ved elektrolyse | |
| US4061550A (en) | Process for electrolysis | |
| US5425863A (en) | Electrolysis cell for the production of a gas | |
| US4285795A (en) | Electrolysis apparatus |