NO742737L - - Google Patents
Info
- Publication number
- NO742737L NO742737L NO742737A NO742737A NO742737L NO 742737 L NO742737 L NO 742737L NO 742737 A NO742737 A NO 742737A NO 742737 A NO742737 A NO 742737A NO 742737 L NO742737 L NO 742737L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- general formula
- benzodiazepine
- halogen
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 238000007254 oxidation reaction Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical class N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- -1 methoxy, ethoxy, propoxy Chemical group 0.000 description 3
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- QQUIWIVTEWQHKA-UHFFFAOYSA-N 3h-1,4-benzodiazepine Chemical class C1=NCC=NC2=CC=CC=C21 QQUIWIVTEWQHKA-UHFFFAOYSA-N 0.000 description 2
- YERSFONNQQBBRN-UHFFFAOYSA-N 7-chloro-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepine-2-carbonitrile Chemical compound ClC=1C=CC2=C(C(=NCC(N2)C#N)C2=CC=CC=C2)C1 YERSFONNQQBBRN-UHFFFAOYSA-N 0.000 description 2
- JVQJIOGELLYIIQ-UHFFFAOYSA-N 7-chloro-5-phenyl-3H-1,4-benzodiazepine-2-carbonitrile Chemical compound C(#N)C1=NC2=C(C(=NC1)C1=CC=CC=C1)C=C(C=C2)Cl JVQJIOGELLYIIQ-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 229940049706 benzodiazepine Drugs 0.000 description 2
- 238000007333 cyanation reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- WPHGSKGZRAQSGP-UHFFFAOYSA-N methylenecyclohexane Natural products C1CCCC2CC21 WPHGSKGZRAQSGP-UHFFFAOYSA-N 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- CZWUXUPLWLGPBZ-UHFFFAOYSA-N 1,3-dihydro-1,2-benzodiazepine-2-carbonitrile Chemical class C(#N)N1NC2=C(C=CC1)C=CC=C2 CZWUXUPLWLGPBZ-UHFFFAOYSA-N 0.000 description 1
- NTLDJOUQLMVTMD-UHFFFAOYSA-N 1-phenyl-1,4-benzodiazepine Chemical compound C1=CC=CC=C1N1C2=CC=CC=C2C=NC=C1 NTLDJOUQLMVTMD-UHFFFAOYSA-N 0.000 description 1
- GSIGZZKHXAAYOA-UHFFFAOYSA-N 6-phenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical class C12=CC=CC=C2N2C=NN=C2CN=C1C1=CC=CC=C1 GSIGZZKHXAAYOA-UHFFFAOYSA-N 0.000 description 1
- ZXBHWLWXRCXTSO-UHFFFAOYSA-N 7-chloro-5-(2-fluorophenyl)-2,3-dihydro-1H-1,4-benzodiazepine-2-carbonitrile Chemical compound ClC=1C=CC2=C(C(=NCC(N2)C#N)C2=C(C=CC=C2)F)C1 ZXBHWLWXRCXTSO-UHFFFAOYSA-N 0.000 description 1
- VIYATZUINQZUAA-UHFFFAOYSA-N 7-chloro-5-(2-fluorophenyl)-2,3-dihydro-1h-1,4-benzodiazepine Chemical compound FC1=CC=CC=C1C1=NCCNC2=CC=C(Cl)C=C12 VIYATZUINQZUAA-UHFFFAOYSA-N 0.000 description 1
- GIVYEEPCHMGCEK-UHFFFAOYSA-N 7-chloro-5-phenyl-3h-1,4-benzodiazepine Chemical compound C12=CC(Cl)=CC=C2N=CCN=C1C1=CC=CC=C1 GIVYEEPCHMGCEK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- MPZVLJCMGPYWQQ-UHFFFAOYSA-N 8-chloro-6-(2-fluorophenyl)-1-methyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1F MPZVLJCMGPYWQQ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- XZBIXDPGRMLSTC-UHFFFAOYSA-N formohydrazide Chemical compound NNC=O XZBIXDPGRMLSTC-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- DXGIRFAFSFKYCF-UHFFFAOYSA-N propanehydrazide Chemical compound CCC(=O)NN DXGIRFAFSFKYCF-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00383363A US3849434A (en) | 1973-07-27 | 1973-07-27 | Process for preparing triazolobenzodiazepines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO742737L true NO742737L (enExample) | 1975-02-24 |
Family
ID=23512776
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO742737A NO742737L (enExample) | 1973-07-27 | 1974-07-26 |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3849434A (enExample) |
| JP (1) | JPS5041891A (enExample) |
| AR (1) | AR204535A1 (enExample) |
| AU (1) | AU7169674A (enExample) |
| BE (1) | BE818133A (enExample) |
| DD (1) | DD114608A5 (enExample) |
| DE (1) | DE2436148A1 (enExample) |
| DK (1) | DK402874A (enExample) |
| ES (1) | ES428640A1 (enExample) |
| FI (1) | FI226074A7 (enExample) |
| FR (1) | FR2270255B1 (enExample) |
| GB (1) | GB1445789A (enExample) |
| IL (1) | IL45343A0 (enExample) |
| LU (1) | LU70604A1 (enExample) |
| NL (1) | NL7410111A (enExample) |
| NO (1) | NO742737L (enExample) |
| PL (1) | PL89891B1 (enExample) |
| SE (1) | SE7409735L (enExample) |
| ZA (1) | ZA744605B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4075408A (en) * | 1975-09-08 | 1978-02-21 | Parke, Davis & Company | Imidazopyrazolodiazepine compounds |
| US8277840B2 (en) * | 2005-07-22 | 2012-10-02 | Emcure Pharmaceuticals Limited | Sustained release formulation of alprazolam |
-
1973
- 1973-07-27 US US00383363A patent/US3849434A/en not_active Expired - Lifetime
-
1974
- 1974-01-01 AR AR254905A patent/AR204535A1/es active
- 1974-07-18 ZA ZA00744605A patent/ZA744605B/xx unknown
- 1974-07-25 FR FR7425867A patent/FR2270255B1/fr not_active Expired
- 1974-07-25 IL IL45343A patent/IL45343A0/xx unknown
- 1974-07-25 DD DD180122A patent/DD114608A5/xx unknown
- 1974-07-25 JP JP49084703A patent/JPS5041891A/ja active Pending
- 1974-07-25 LU LU70604*A patent/LU70604A1/xx unknown
- 1974-07-26 ES ES428640A patent/ES428640A1/es not_active Expired
- 1974-07-26 BE BE146982A patent/BE818133A/xx unknown
- 1974-07-26 FI FI2260/74A patent/FI226074A7/fi unknown
- 1974-07-26 SE SE7409735A patent/SE7409735L/xx unknown
- 1974-07-26 DK DK402874A patent/DK402874A/da unknown
- 1974-07-26 AU AU71696/74A patent/AU7169674A/en not_active Expired
- 1974-07-26 PL PL1974173038A patent/PL89891B1/pl unknown
- 1974-07-26 GB GB3316774A patent/GB1445789A/en not_active Expired
- 1974-07-26 NO NO742737A patent/NO742737L/no unknown
- 1974-07-26 NL NL7410111A patent/NL7410111A/xx unknown
- 1974-07-26 DE DE2436148A patent/DE2436148A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| LU70604A1 (enExample) | 1976-05-31 |
| FI226074A7 (enExample) | 1975-01-28 |
| DD114608A5 (enExample) | 1975-08-12 |
| GB1445789A (en) | 1976-08-11 |
| ZA744605B (en) | 1975-08-27 |
| PL89891B1 (enExample) | 1976-12-31 |
| AR204535A1 (es) | 1976-02-12 |
| FR2270255B1 (enExample) | 1976-10-22 |
| AU7169674A (en) | 1976-01-29 |
| NL7410111A (nl) | 1975-01-29 |
| DE2436148A1 (de) | 1975-02-13 |
| IL45343A0 (en) | 1974-10-22 |
| FR2270255A1 (enExample) | 1975-12-05 |
| BE818133A (fr) | 1975-01-27 |
| ES428640A1 (es) | 1976-08-16 |
| SE7409735L (enExample) | 1975-01-28 |
| DK402874A (enExample) | 1975-04-01 |
| US3849434A (en) | 1974-11-19 |
| JPS5041891A (enExample) | 1975-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3100770A (en) | 5-pyridyl-1,4-benzodiazepine compounds | |
| Elliott et al. | Hydrazides and thiohydrazides as sources of condensed oxadiazines and thiadiazines, including novel azo derivatives based on dithizone | |
| EP0004024A2 (de) | Verfahren zur Herstellung von 3-Hydroxy-6-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazocinen | |
| DE2156472A1 (de) | Verfahren zur Herstellung von neuen Diazepinderivaten | |
| NO170987B (no) | Fremgangsmaate for avsvovling av jern | |
| NO742737L (enExample) | ||
| US3235555A (en) | 7-amino-3-cyanoethyl-1-methyl-2, 4-dioxo-1, 2, 3, 4, 5, 6-hexahydropyrido[2, 3-d] pyrimidine and related compounds | |
| US3546212A (en) | Oxidation of benzodiazepines with ruthenium tetroxide | |
| Finch et al. | Rearrangement of 3-amino-1-benzylindazole to 4-amino-2-phenylquinazoline | |
| NO153263B (no) | Lavtirriterende fast eller flytende saapepreparat | |
| NO120370B (enExample) | ||
| Ogata et al. | 5-Aryl-1, 5-dihydro-2H-1, 4-benzodiazepin-2-one derivatives as antianxiety agents | |
| DE1695161A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| Peet et al. | Synthesis of 5H‐Tetrazolo [1, 5‐d][1, 4] benzodiazepin‐6 (7H) ones | |
| DE1965980A1 (de) | 2-(Dioxopiperazino)-benzophenone und Verfahren zu ihrer Herstellung | |
| KR840002269B1 (ko) | 이미다조 벤조디아제핀 유도체의 제조방법 | |
| NO132800B (enExample) | ||
| US3153082A (en) | 2-amino-benzophenones | |
| NO128328B (enExample) | ||
| US3321520A (en) | Iminocycloheptatrienes and a process for preparing the same | |
| US3413346A (en) | 2-(2-haloethylamino)-5-halo-benzophenones | |
| US3904603A (en) | 2,3,4,5-tetrahydro-4,4-dialkyl-1h-1,4-benzodiazepine halides | |
| US3838116A (en) | Process for preparing 1,4-benzodiazepines | |
| US3671517A (en) | Preparation of 2,3,4,5-tetrahydro-5-phen-yl-1h-1,4-benzodiazepines and intermediates | |
| US3418315A (en) | Preparation of 7-chloro-1,3-dihydro-3-diethylamino - 3 - methyl - 5 - phenyl - 2h - 1,4-benzodiazepin-2-one |