NO137826C - Analogifremgangsmaate for fremstilling av terapeutisk virksomme derivater av 6-amino-penicillansyre - Google Patents
Analogifremgangsmaate for fremstilling av terapeutisk virksomme derivater av 6-amino-penicillansyreInfo
- Publication number
- NO137826C NO137826C NO4290/70A NO429070A NO137826C NO 137826 C NO137826 C NO 137826C NO 4290/70 A NO4290/70 A NO 4290/70A NO 429070 A NO429070 A NO 429070A NO 137826 C NO137826 C NO 137826C
- Authority
- NO
- Norway
- Prior art keywords
- amino
- preparation
- therapeutically effective
- penicillanic acid
- analogy procedure
- Prior art date
Links
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5520969 | 1969-11-11 | ||
| GB33211/70A GB1293590A (en) | 1969-11-11 | 1969-11-11 | New penicillanic acid derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO137826B NO137826B (no) | 1978-01-23 |
| NO137826C true NO137826C (no) | 1982-02-16 |
Family
ID=26261769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO4290/70A NO137826C (no) | 1969-11-11 | 1970-11-10 | Analogifremgangsmaate for fremstilling av terapeutisk virksomme derivater av 6-amino-penicillansyre |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS518955B1 (cs) |
| AT (1) | AT301026B (cs) |
| BE (1) | BE758782A (cs) |
| BG (1) | BG18619A3 (cs) |
| CH (2) | CH559752A5 (cs) |
| CS (1) | CS166020B2 (cs) |
| DE (1) | DE2055531C3 (cs) |
| DK (1) | DK135127B (cs) |
| ES (1) | ES385437A1 (cs) |
| FI (1) | FI54601C (cs) |
| FR (1) | FR2073338A1 (cs) |
| HU (1) | HU162440B (cs) |
| IE (1) | IE34620B1 (cs) |
| IL (1) | IL35490A (cs) |
| IT (1) | IT1044209B (cs) |
| LU (1) | LU62031A1 (cs) |
| NL (1) | NL168227C (cs) |
| NO (1) | NO137826C (cs) |
| PL (1) | PL90581B1 (cs) |
| RO (2) | RO56878A (cs) |
| SE (1) | SE397355B (cs) |
| SU (1) | SU406362A3 (cs) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL79157B1 (cs) * | 1970-12-22 | 1975-06-30 | ||
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| GB1427139A (en) * | 1972-03-13 | 1976-03-10 | Astra Laekemedel Ab | Penicillins |
| GB1417099A (en) * | 1973-02-02 | 1975-12-10 | Leo Pharm Prod Ltd | Method for the production of derivatives of 6-aminopenicillanic acid |
| SU566843A1 (ru) * | 1975-01-06 | 1977-07-30 | Ордена Трудового Красного Знамени Институт Органической Синтеза Ан Латвийской Сср | Способ получени производных 6- -амидинопенициллановой кислоты |
| GB1579931A (en) * | 1976-04-15 | 1980-11-26 | Leo Pharm Prod Ltd | Bis-penicillanoyl-oxy-alkanes |
| TWI375678B (en) | 2005-06-09 | 2012-11-01 | Yakult Honsha Kk | A method of preparation of a tricyclic ketone |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3135755A (en) * | 1961-11-20 | 1964-06-02 | Hoffmann La Roche | Pyrimidine formamidines of primary amines |
| US3322781A (en) * | 1963-10-18 | 1967-05-30 | Bristol Myers Co | 6-(substituted-hydroxyamidino)-penicillanic acids |
| CH480792A (de) * | 1967-01-26 | 1969-11-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
-
0
- BE BE758782D patent/BE758782A/xx not_active IP Right Cessation
-
1970
- 1970-10-20 IL IL35490A patent/IL35490A/xx unknown
- 1970-10-22 IE IE1359/70A patent/IE34620B1/xx unknown
- 1970-11-05 CH CH1644070A patent/CH559752A5/xx not_active IP Right Cessation
- 1970-11-05 CH CH1113074A patent/CH559753A5/xx not_active IP Right Cessation
- 1970-11-05 AT AT995970A patent/AT301026B/de not_active IP Right Cessation
- 1970-11-06 DK DK565070AA patent/DK135127B/da not_active IP Right Cessation
- 1970-11-09 SU SU1489793A patent/SU406362A3/ru active
- 1970-11-10 SE SE7015181A patent/SE397355B/xx unknown
- 1970-11-10 RO RO64921A patent/RO56878A/ro unknown
- 1970-11-10 IT IT70739/70A patent/IT1044209B/it active
- 1970-11-10 FR FR7040428A patent/FR2073338A1/fr active Granted
- 1970-11-10 LU LU62031D patent/LU62031A1/xx unknown
- 1970-11-10 NL NLAANVRAGE7016435,A patent/NL168227C/xx not_active IP Right Cessation
- 1970-11-10 PL PL1970144350A patent/PL90581B1/pl unknown
- 1970-11-10 NO NO4290/70A patent/NO137826C/no unknown
- 1970-11-10 CS CS7560A patent/CS166020B2/cs unknown
- 1970-11-10 RO RO72470A patent/RO60563A/ro unknown
- 1970-11-11 ES ES385437A patent/ES385437A1/es not_active Expired
- 1970-11-11 FI FI3032/70A patent/FI54601C/fi active
- 1970-11-11 BG BG016025A patent/BG18619A3/xx unknown
- 1970-11-11 DE DE2055531A patent/DE2055531C3/de not_active Expired
- 1970-11-11 JP JP45099009A patent/JPS518955B1/ja active Pending
- 1970-11-11 HU HULO372A patent/HU162440B/hu not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI54601B (fi) | 1978-09-29 |
| CH559753A5 (cs) | 1975-03-14 |
| BG18619A3 (bg) | 1975-02-25 |
| RO60563A (cs) | 1977-01-15 |
| NL7016435A (cs) | 1971-05-13 |
| IT1044209B (it) | 1980-03-20 |
| HU162440B (cs) | 1973-02-28 |
| IL35490A0 (en) | 1970-12-24 |
| FI54601C (fi) | 1979-01-10 |
| SU406362A3 (cs) | 1973-11-05 |
| RO56878A (cs) | 1975-02-15 |
| CH559752A5 (cs) | 1975-03-14 |
| NL168227C (nl) | 1982-03-16 |
| IE34620L (en) | 1971-05-11 |
| SE397355B (sv) | 1977-10-31 |
| DE2055531B2 (de) | 1980-01-10 |
| IE34620B1 (en) | 1975-06-25 |
| NL168227B (nl) | 1981-10-16 |
| IL35490A (en) | 1974-11-29 |
| ES385437A1 (es) | 1973-11-01 |
| JPS518955B1 (cs) | 1976-03-22 |
| CS166020B2 (cs) | 1976-01-29 |
| FR2073338A1 (en) | 1971-10-01 |
| LU62031A1 (cs) | 1971-05-10 |
| FR2073338B1 (cs) | 1974-02-15 |
| NO137826B (no) | 1978-01-23 |
| BE758782A (fr) | 1971-05-10 |
| AT301026B (de) | 1972-08-25 |
| DK135127C (cs) | 1977-08-15 |
| PL90581B1 (en) | 1977-01-31 |
| DE2055531A1 (de) | 1971-05-27 |
| DE2055531C3 (de) | 1982-02-25 |
| DK135127B (da) | 1977-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE393800B (sv) | Forfarande for framstellning av bensoylamino-alkyl-fenoxi-alkylkarbonsyraderivat med lipidsenkande effekt | |
| NO145883C (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 7-methoxy-7-acylamino-cefalosporansyrederivater | |
| SE385872B (sv) | Forfarande for framstellning av vissa angivna p-karbonyl - fenoxi - iso - smorsyraestrar | |
| SE398229B (sv) | Forfarande for framstellning av 4-fenoxi-fenoxialkankarbonsyraderivat | |
| SE398877B (sv) | Forfarande for framstellning av 14-hydroxi-morfinanderivat | |
| SE385885B (sv) | Foerfarande foer framstaellning av 4-amino-6-arylpyrimidinderivat | |
| SE7700442L (sv) | Forfarande for framstellning av 6-aminopenicillansyra | |
| SE397677B (sv) | Forfarande for framstellning av en alfa-dipeptidlagalkylester av l-asparaginsyra | |
| SE385698B (sv) | Forfarande for framstellning av kinolinettiksyraderivat | |
| NO147917C (no) | Fremgangsmaate for fremstilling av 3-metyl-delta3-cefem-4-karboksylsyre-forbindelser | |
| SE402451B (sv) | Forfarande for framstellning av 14-desoxi-14-acetoximutilin | |
| SE397973B (sv) | Forfarande for framstellning av bensoylfenylsmorsyraderivat | |
| FI50418C (fi) | Menetelmä terapeuttisesti käytettävien tiokarbamidihappojohdannaisten valmistamiseksi | |
| SE400551B (sv) | Forfarande for framstellning av terapeutiskt aktiva 3-amino-5-karbamylbensoesyraderivat | |
| SE7511680L (sv) | Forfarande for framstellning av furanderivat | |
| SE399708B (sv) | Forfarande for framstellning av tioxanton-2-karboxylsyraderivat | |
| NO137826C (no) | Analogifremgangsmaate for fremstilling av terapeutisk virksomme derivater av 6-amino-penicillansyre | |
| SE380273B (sv) | Forfarande for framstellning av tiopyrimidinderivat | |
| SE392615B (sv) | Forfarande for framstellning av 2-nitro-5-imidazolaldehydderivat | |
| SE384685B (sv) | Forfarande for framstellning av linkomycinderivat | |
| SE417318B (sv) | Forfarande for framstellning av oxofurylesterderivat av penicillin | |
| SE408177B (sv) | Forfarande for framstellning av 4-hydroximetyl-1-ftalazonderivat | |
| SE394668B (sv) | Forfarande for framstellning av 2-etylhexan-1-al | |
| SE397350B (sv) | Forfarande for framstellning av tieno-diazepinderivat | |
| NO137050C (no) | Fremgangsm}te til fremstilling av butyrofenonderivater |