NO136712B - - Google Patents
Download PDFInfo
- Publication number
- NO136712B NO136712B NO3355/71A NO335571A NO136712B NO 136712 B NO136712 B NO 136712B NO 3355/71 A NO3355/71 A NO 3355/71A NO 335571 A NO335571 A NO 335571A NO 136712 B NO136712 B NO 136712B
- Authority
- NO
- Norway
- Prior art keywords
- acid
- benzoxazol
- benzoxazole
- hydrogen
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 28
- 150000001408 amides Chemical class 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 231100000252 nontoxic Toxicity 0.000 claims description 6
- 230000003000 nontoxic effect Effects 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 6
- FRFQGGRLXTVFBG-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1C1=NC2=CC=CC=C2O1 FRFQGGRLXTVFBG-UHFFFAOYSA-N 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 230000003287 optical effect Effects 0.000 claims 1
- 239000002253 acid Substances 0.000 description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- 239000000203 mixture Substances 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 22
- -1 ion salt Chemical class 0.000 description 20
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 14
- 238000003776 cleavage reaction Methods 0.000 description 13
- 230000007017 scission Effects 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 238000010828 elution Methods 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- AWCMNCDJXFWKTO-UHFFFAOYSA-N 2-(3-fluoro-4-methylphenyl)-1,3-benzoxazole Chemical compound C1=C(F)C(C)=CC=C1C1=NC2=CC=CC=C2O1 AWCMNCDJXFWKTO-UHFFFAOYSA-N 0.000 description 4
- ZAXLJGNKZIOEJN-UHFFFAOYSA-N 2-[4-(bromomethyl)-3-fluorophenyl]-1,3-benzoxazole Chemical compound C1=C(CBr)C(F)=CC(C=2OC3=CC=CC=C3N=2)=C1 ZAXLJGNKZIOEJN-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 230000000202 analgesic effect Effects 0.000 description 4
- 230000001754 anti-pyretic effect Effects 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 4
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 4
- 239000012467 final product Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 4
- 125000000355 1,3-benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- QEHVZLYSEMNBIJ-UHFFFAOYSA-N 2-(2-fluoro-4-methylphenyl)-1,3-benzoxazole Chemical compound FC1=CC(C)=CC=C1C1=NC2=CC=CC=C2O1 QEHVZLYSEMNBIJ-UHFFFAOYSA-N 0.000 description 3
- ADDCUSIRCGNNII-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)-2-fluorophenyl]acetic acid Chemical compound C1=C(F)C(CC(=O)O)=CC=C1C1=NC2=CC=CC=C2O1 ADDCUSIRCGNNII-UHFFFAOYSA-N 0.000 description 3
- GGCPYCRPEWHCQT-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)-2-fluorophenyl]acetonitrile Chemical compound C1=C(CC#N)C(F)=CC(C=2OC3=CC=CC=C3N=2)=C1 GGCPYCRPEWHCQT-UHFFFAOYSA-N 0.000 description 3
- RWXRIVQREANWBZ-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)-3-fluorophenyl]acetic acid Chemical compound FC1=CC(CC(=O)O)=CC=C1C1=NC2=CC=CC=C2O1 RWXRIVQREANWBZ-UHFFFAOYSA-N 0.000 description 3
- SVSVOPWCUHQFAM-UHFFFAOYSA-N 2-fluoro-4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C(F)=C1 SVSVOPWCUHQFAM-UHFFFAOYSA-N 0.000 description 3
- HGYACDWHRDFSTI-UHFFFAOYSA-N 3-fluoro-n-(2-hydroxyphenyl)-4-methylbenzamide Chemical compound C1=C(F)C(C)=CC=C1C(=O)NC1=CC=CC=C1O HGYACDWHRDFSTI-UHFFFAOYSA-N 0.000 description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000005903 acid hydrolysis reaction Methods 0.000 description 3
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- UJUJTJBCXVEAGQ-UHFFFAOYSA-N ethyl 2-amino-4-ethylbenzoate Chemical compound CCOC(=O)C1=CC=C(CC)C=C1N UJUJTJBCXVEAGQ-UHFFFAOYSA-N 0.000 description 3
- XOTHHWKTZXUUGF-UHFFFAOYSA-N ethyl 4-ethyl-2-fluorobenzoate Chemical compound CCOC(=O)C1=CC=C(CC)C=C1F XOTHHWKTZXUUGF-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- MLAJZRMDXUNKBQ-UHFFFAOYSA-N 1,3-benzoxazole;2-phenylacetic acid Chemical compound C1=CC=C2OC=NC2=C1.OC(=O)CC1=CC=CC=C1 MLAJZRMDXUNKBQ-UHFFFAOYSA-N 0.000 description 2
- 150000000183 1,3-benzoxazoles Chemical class 0.000 description 2
- ULLVHIYNHNLLTD-UHFFFAOYSA-N 2-(2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1,3-benzoxazole Chemical compound O1C(=NC2=C1C=CC=C2)C2=C1C(CC1)=CC=C2 ULLVHIYNHNLLTD-UHFFFAOYSA-N 0.000 description 2
- PWDRABLQVUHYAE-UHFFFAOYSA-N 2-(4-ethylphenyl)-1,3-benzoxazole Chemical compound C1=CC(CC)=CC=C1C1=NC2=CC=CC=C2O1 PWDRABLQVUHYAE-UHFFFAOYSA-N 0.000 description 2
- HGVAGPYGRASSIW-UHFFFAOYSA-N 2-(8-bromo-2-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-1,3-benzoxazole Chemical compound C1=CC=C2OC(C=3C=CC=C4CC(C=34)Br)=NC2=C1 HGVAGPYGRASSIW-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- FXLLPFZHBJEAAF-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)-3-fluorophenyl]acetonitrile Chemical compound FC1=CC(CC#N)=CC=C1C1=NC2=CC=CC=C2O1 FXLLPFZHBJEAAF-UHFFFAOYSA-N 0.000 description 2
- SSNLLVDAIDMADK-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)-3-fluorophenyl]propanenitrile Chemical compound FC1=CC(C(C#N)C)=CC=C1C1=NC2=CC=CC=C2O1 SSNLLVDAIDMADK-UHFFFAOYSA-N 0.000 description 2
- AOHYZOQLEUTIOK-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)-3-fluorophenyl]propanoic acid Chemical compound FC1=CC(C(C(O)=O)C)=CC=C1C1=NC2=CC=CC=C2O1 AOHYZOQLEUTIOK-UHFFFAOYSA-N 0.000 description 2
- NIJFGSNJAWEWNU-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)phenyl]acetic acid Chemical class C1=CC(CC(=O)O)=CC=C1C1=NC2=CC=CC=C2O1 NIJFGSNJAWEWNU-UHFFFAOYSA-N 0.000 description 2
- DIEPGNPDXOEPMF-UHFFFAOYSA-N 2-[4-(bromomethyl)phenyl]-5,7-dichloro-1,3-benzoxazole Chemical compound N=1C2=CC(Cl)=CC(Cl)=C2OC=1C1=CC=C(CBr)C=C1 DIEPGNPDXOEPMF-UHFFFAOYSA-N 0.000 description 2
- YPMOSFLHSWFWMO-UHFFFAOYSA-N 2-[4-(bromomethyl)phenyl]-7-chloro-1,3-benzoxazole Chemical compound O1C=2C(Cl)=CC=CC=2N=C1C1=CC=C(CBr)C=C1 YPMOSFLHSWFWMO-UHFFFAOYSA-N 0.000 description 2
- YNEXPZBQRZDROJ-UHFFFAOYSA-N 2-fluoro-n-(2-hydroxyphenyl)-4-methylbenzamide Chemical compound FC1=CC(C)=CC=C1C(=O)NC1=CC=CC=C1O YNEXPZBQRZDROJ-UHFFFAOYSA-N 0.000 description 2
- GGSNKPVLVSSJRR-UHFFFAOYSA-N 7-chloro-2-(4-methylphenyl)-1,3-benzoxazole Chemical compound C1=CC(C)=CC=C1C1=NC2=CC=CC(Cl)=C2O1 GGSNKPVLVSSJRR-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 238000011914 asymmetric synthesis Methods 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 2
- VPYIUNFTBVAXHC-UHFFFAOYSA-N methyl 2-[4-(1,3-benzoxazol-2-yl)phenyl]acetate Chemical compound C1=CC(CC(=O)OC)=CC=C1C1=NC2=CC=CC=C2O1 VPYIUNFTBVAXHC-UHFFFAOYSA-N 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- YFRMSGJWNBWYLR-UHFFFAOYSA-N n-(2-hydroxyphenyl)bicyclo[4.2.0]octa-1(6),2,4,7-tetraene-4-carboxamide Chemical compound OC1=CC=CC=C1NC(=O)C1=CC=C(C=C2)C2=C1 YFRMSGJWNBWYLR-UHFFFAOYSA-N 0.000 description 2
- SJWFXCIHNDVPSH-UHFFFAOYSA-N octan-2-ol Chemical compound CCCCCCC(C)O SJWFXCIHNDVPSH-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229960002317 succinimide Drugs 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- 229910000634 wood's metal Inorganic materials 0.000 description 2
- NOOLISFMXDJSKH-UTLUCORTSA-N (+)-Neomenthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1O NOOLISFMXDJSKH-UTLUCORTSA-N 0.000 description 1
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical compound C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- REPVLJRCJUVQFA-UHFFFAOYSA-N (-)-isopinocampheol Natural products C1C(O)C(C)C2C(C)(C)C1C2 REPVLJRCJUVQFA-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- LIUSHSVUMMYGRB-UHFFFAOYSA-N 1-naphthalen-1-yl-n-phenoxymethanamine Chemical compound C=1C=CC2=CC=CC=C2C=1CNOC1=CC=CC=C1 LIUSHSVUMMYGRB-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- DCTFLNVNPBQXCA-UHFFFAOYSA-N 2-(4-ethyl-2-fluorophenyl)-1,3-benzoxazole Chemical compound FC1=CC(CC)=CC=C1C1=NC2=CC=CC=C2O1 DCTFLNVNPBQXCA-UHFFFAOYSA-N 0.000 description 1
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- NOYRIHCKRFZVSR-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)phenyl]acetamide Chemical compound C1=CC(CC(=O)N)=CC=C1C1=NC2=CC=CC=C2O1 NOYRIHCKRFZVSR-UHFFFAOYSA-N 0.000 description 1
- LHCFDCJEODNBBM-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)phenyl]acetonitrile Chemical compound C1=CC(CC#N)=CC=C1C1=NC2=CC=CC=C2O1 LHCFDCJEODNBBM-UHFFFAOYSA-N 0.000 description 1
- QLUANHBGNWYQEQ-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)phenyl]propanenitrile Chemical compound C1=CC(C(C#N)C)=CC=C1C1=NC2=CC=CC=C2O1 QLUANHBGNWYQEQ-UHFFFAOYSA-N 0.000 description 1
- OPVVSPOJNYBBRW-UHFFFAOYSA-N 2-[4-(1-bromoethyl)-2-fluorophenyl]-1,3-benzoxazole Chemical compound FC1=CC(C(Br)C)=CC=C1C1=NC2=CC=CC=C2O1 OPVVSPOJNYBBRW-UHFFFAOYSA-N 0.000 description 1
- OVXSJARAAGARCQ-UHFFFAOYSA-N 2-[4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1C1=NC2=CC(Cl)=CC(Cl)=C2O1 OVXSJARAAGARCQ-UHFFFAOYSA-N 0.000 description 1
- AOWMELKLBAWBEX-UHFFFAOYSA-N 2-[4-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]acetonitrile Chemical compound N=1C2=CC(Cl)=CC(Cl)=C2OC=1C1=CC=C(CC#N)C=C1 AOWMELKLBAWBEX-UHFFFAOYSA-N 0.000 description 1
- MZTBNAOGIGNCES-UHFFFAOYSA-N 2-[4-(7-chloro-1,3-benzoxazol-2-yl)phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1C1=NC2=CC=CC(Cl)=C2O1 MZTBNAOGIGNCES-UHFFFAOYSA-N 0.000 description 1
- HMVZNCUMSPAUSW-UHFFFAOYSA-N 2-[4-(7-chloro-1,3-benzoxazol-2-yl)phenyl]acetonitrile Chemical compound O1C=2C(Cl)=CC=CC=2N=C1C1=CC=C(CC#N)C=C1 HMVZNCUMSPAUSW-UHFFFAOYSA-N 0.000 description 1
- NMVULQLWSAGZJY-UHFFFAOYSA-N 2-[4-(bromomethyl)-2-fluorophenyl]-1,3-benzoxazole Chemical compound FC1=CC(CBr)=CC=C1C1=NC2=CC=CC=C2O1 NMVULQLWSAGZJY-UHFFFAOYSA-N 0.000 description 1
- LFOXZOBJWYTCTG-UHFFFAOYSA-N 2-[4-(bromomethyl)phenyl]-1,3-benzoxazole Chemical compound C1=CC(CBr)=CC=C1C1=NC2=CC=CC=C2O1 LFOXZOBJWYTCTG-UHFFFAOYSA-N 0.000 description 1
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 description 1
- WNYFUEDXRZPXTQ-UHFFFAOYSA-N 2-amino-4-ethylbenzoic acid Chemical compound CCC1=CC=C(C(O)=O)C(N)=C1 WNYFUEDXRZPXTQ-UHFFFAOYSA-N 0.000 description 1
- QUIIUKFPLUUSGQ-UHFFFAOYSA-N 2-amino-6-chlorophenol Chemical compound NC1=CC=CC(Cl)=C1O QUIIUKFPLUUSGQ-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- ZQVKTHRQIXSMGY-UHFFFAOYSA-N 4-Ethylbenzoic acid Chemical compound CCC1=CC=C(C(O)=O)C=C1 ZQVKTHRQIXSMGY-UHFFFAOYSA-N 0.000 description 1
- MKFCYQTVSDCXAQ-UHFFFAOYSA-N 4-chloro-2-fluoro-1-methylbenzene Chemical compound CC1=CC=C(Cl)C=C1F MKFCYQTVSDCXAQ-UHFFFAOYSA-N 0.000 description 1
- BYWHFIBKBKBJGU-UHFFFAOYSA-N 4-ethyl-2-fluoro-n-(2-hydroxyphenyl)benzamide Chemical compound FC1=CC(CC)=CC=C1C(=O)NC1=CC=CC=C1O BYWHFIBKBKBJGU-UHFFFAOYSA-N 0.000 description 1
- GFQKDOWVJRRVEW-UHFFFAOYSA-N 4-ethyl-2-fluorobenzoic acid Chemical compound CCC1=CC=C(C(O)=O)C(F)=C1 GFQKDOWVJRRVEW-UHFFFAOYSA-N 0.000 description 1
- UCKQPZMVYSREGK-UHFFFAOYSA-N 4-ethyl-2-fluorobenzoyl chloride Chemical compound CCC1=CC=C(C(Cl)=O)C(F)=C1 UCKQPZMVYSREGK-UHFFFAOYSA-N 0.000 description 1
- LKALLKNMLASJLL-UHFFFAOYSA-N 4-ethyl-n-(2-hydroxyphenyl)benzamide Chemical compound C1=CC(CC)=CC=C1C(=O)NC1=CC=CC=C1O LKALLKNMLASJLL-UHFFFAOYSA-N 0.000 description 1
- AVTLLLZVYYPGFX-UHFFFAOYSA-N 4-ethylbenzoyl chloride Chemical compound CCC1=CC=C(C(Cl)=O)C=C1 AVTLLLZVYYPGFX-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- VHEXSBDHSXPGPU-UHFFFAOYSA-N 5,7-dichloro-2-(4-methylphenyl)-1,3-benzoxazole Chemical compound C1=CC(C)=CC=C1C1=NC2=CC(Cl)=CC(Cl)=C2O1 VHEXSBDHSXPGPU-UHFFFAOYSA-N 0.000 description 1
- CSDAZFISYIYVTQ-UHFFFAOYSA-N 5-(1,3-benzoxazol-2-yl)bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile Chemical compound C1=CC=C2OC(C=3C=CC=C4CC(C=34)C#N)=NC2=C1 CSDAZFISYIYVTQ-UHFFFAOYSA-N 0.000 description 1
- RBMUAGDCCJDQLE-UHFFFAOYSA-N 5-methyl-2-propan-2-ylcyclohexan-1-amine Chemical compound CC(C)C1CCC(C)CC1N RBMUAGDCCJDQLE-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- 206010010071 Coma Diseases 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 201000005569 Gout Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000004575 Infectious Arthritis Diseases 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- QMGVPVSNSZLJIA-UHFFFAOYSA-N Nux Vomica Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OCC=C2CN2C1C46CC2 QMGVPVSNSZLJIA-UHFFFAOYSA-N 0.000 description 1
- YZTLCAJKZKQRMA-UHFFFAOYSA-N O1C(=NC2=C1C=CC=C2)C(C(=O)O)(C)C2=CC(=CC=C2)F Chemical compound O1C(=NC2=C1C=CC=C2)C(C(=O)O)(C)C2=CC(=CC=C2)F YZTLCAJKZKQRMA-UHFFFAOYSA-N 0.000 description 1
- 102000004316 Oxidoreductases Human genes 0.000 description 1
- 108090000854 Oxidoreductases Proteins 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical class C(C)(=O)* 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000010945 base-catalyzed hydrolysis reactiony Methods 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- DBUPJTGSRSUMMZ-UHFFFAOYSA-N bicyclo[4.2.0]octa-1(6),2,4,7-tetraene-4-carbonyl chloride Chemical compound ClC(=O)C1=CC=C2C=CC2=C1 DBUPJTGSRSUMMZ-UHFFFAOYSA-N 0.000 description 1
- 238000002306 biochemical method Methods 0.000 description 1
- 229940116229 borneol Drugs 0.000 description 1
- CKDOCTFBFTVPSN-UHFFFAOYSA-N borneol Natural products C1CC2(C)C(C)CC1C2(C)C CKDOCTFBFTVPSN-UHFFFAOYSA-N 0.000 description 1
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 description 1
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- RCTFHBWTYQOVGJ-UHFFFAOYSA-N chloroform;dichloromethane Chemical compound ClCCl.ClC(Cl)Cl RCTFHBWTYQOVGJ-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- DTGKSKDOIYIVQL-UHFFFAOYSA-N dl-isoborneol Natural products C1CC2(C)C(O)CC1C2(C)C DTGKSKDOIYIVQL-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 239000012374 esterification agent Substances 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- YPGCWEMNNLXISK-UHFFFAOYSA-N hydratropic acid Chemical class OC(=O)C(C)C1=CC=CC=C1 YPGCWEMNNLXISK-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- CWHRCNWADHUTKJ-UHFFFAOYSA-N n-(3,5-dichloro-2-hydroxyphenyl)-4-methylbenzamide Chemical compound C1=CC(C)=CC=C1C(=O)NC1=CC(Cl)=CC(Cl)=C1O CWHRCNWADHUTKJ-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229960001404 quinidine Drugs 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 201000003068 rheumatic fever Diseases 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 201000001223 septic arthritis Diseases 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D263/57—Aryl or substituted aryl radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7122770A | 1970-09-10 | 1970-09-10 | |
| US16538971A | 1971-07-22 | 1971-07-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO136712B true NO136712B (forum.php) | 1977-07-18 |
| NO136712C NO136712C (no) | 1977-10-26 |
Family
ID=26751978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO3355/71A NO136712C (no) | 1970-09-10 | 1971-09-09 | Analogifremgangsm}te ved fremstilling av terapeutisk aktive benzoxazolforbindelser. |
Country Status (23)
| Country | Link |
|---|---|
| JP (2) | JPS544953B1 (forum.php) |
| AT (1) | AT311964B (forum.php) |
| AU (1) | AU461109B2 (forum.php) |
| BE (1) | BE772395A (forum.php) |
| CH (1) | CH572916A5 (forum.php) |
| DD (1) | DD94814A5 (forum.php) |
| DE (1) | DE2145203C2 (forum.php) |
| EG (1) | EG10421A (forum.php) |
| FI (1) | FI55196C (forum.php) |
| FR (1) | FR2106434B1 (forum.php) |
| GB (1) | GB1352723A (forum.php) |
| IE (1) | IE35599B1 (forum.php) |
| IL (1) | IL37633A (forum.php) |
| LU (1) | LU63887A1 (forum.php) |
| NL (1) | NL174043C (forum.php) |
| NO (1) | NO136712C (forum.php) |
| OA (1) | OA03911A (forum.php) |
| PH (1) | PH11935A (forum.php) |
| PL (1) | PL81813B1 (forum.php) |
| RO (1) | RO61539A (forum.php) |
| SE (1) | SE367203B (forum.php) |
| SU (1) | SU455542A3 (forum.php) |
| YU (1) | YU34689B (forum.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3816443A (en) * | 1972-02-17 | 1974-06-11 | Merck & Co Inc | 4-(benzothiazol-2-yl)fluoro phenyl-acetic acids |
| GB1435721A (en) * | 1972-05-18 | 1976-05-12 | Lilly Industries Ltd | Benzoxazole derivatives |
| GB1495488A (en) * | 1976-06-23 | 1977-12-21 | Ippco Int Pharma Patents Co Es | Optically active 2-(2-phenyl-5-benzoxazolyl)propionic acids |
| IT1099589B (it) * | 1978-08-04 | 1985-09-18 | Ravizza Spa | Processo per la preparazione di derivati dell'acido benzoxazolil propionico |
| IT1157295B (it) * | 1982-07-19 | 1987-02-11 | Ravizza Spa | Processo perfezionato per la preparazione di derivati dell'acido benzoxazolil propionico |
| DE19808261A1 (de) * | 1998-02-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| WO2008035359A2 (en) * | 2006-06-12 | 2008-03-27 | Cadila Healthcare Limited | Oximinophenoxyalkanoic acid and phenylalkanoic acid derivatives |
| JP2008232573A (ja) * | 2007-03-22 | 2008-10-02 | Osaka Gas Co Ltd | 吸収冷凍機 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD70880A (forum.php) * | ||||
| CH483276A (de) * | 1959-09-23 | 1969-12-31 | Ciba Geigy | Verwendung von 2-Phenyl-benzazolen als Schutzmittel vor ultravioletter Strahlung ausserhalb der Textilindustrie |
| US3401120A (en) * | 1965-10-23 | 1968-09-10 | Gaf Corp | Corrosion inhibitors |
| CH514616A (de) * | 1968-10-07 | 1971-10-31 | Ciba Geigy Ag | Verfahren zur Herstellung von Arylenoxazolen |
-
1971
- 1971-09-01 IL IL37633A patent/IL37633A/xx unknown
- 1971-09-02 OA OA54349A patent/OA03911A/xx unknown
- 1971-09-02 AU AU33024/71A patent/AU461109B2/en not_active Expired
- 1971-09-03 CH CH1295571A patent/CH572916A5/xx not_active IP Right Cessation
- 1971-09-06 PH PH12818A patent/PH11935A/en unknown
- 1971-09-06 GB GB4149971A patent/GB1352723A/en not_active Expired
- 1971-09-06 AT AT773871A patent/AT311964B/de not_active IP Right Cessation
- 1971-09-07 IE IE1136/71A patent/IE35599B1/xx unknown
- 1971-09-07 YU YU2279/71A patent/YU34689B/xx unknown
- 1971-09-08 PL PL1971150397A patent/PL81813B1/pl unknown
- 1971-09-08 EG EG396/71*UA patent/EG10421A/xx active
- 1971-09-09 LU LU63887D patent/LU63887A1/xx unknown
- 1971-09-09 SE SE11441/71A patent/SE367203B/xx unknown
- 1971-09-09 SU SU1696052A patent/SU455542A3/ru active
- 1971-09-09 DD DD157648A patent/DD94814A5/xx unknown
- 1971-09-09 DE DE2145203A patent/DE2145203C2/de not_active Expired
- 1971-09-09 NL NLAANVRAGE7112437,A patent/NL174043C/xx not_active IP Right Cessation
- 1971-09-09 NO NO3355/71A patent/NO136712C/no unknown
- 1971-09-09 BE BE772395A patent/BE772395A/xx not_active IP Right Cessation
- 1971-09-09 FI FI2524/71A patent/FI55196C/fi active
- 1971-09-10 JP JP6981371A patent/JPS544953B1/ja active Pending
- 1971-09-10 RO RO68180A patent/RO61539A/ro unknown
- 1971-09-10 FR FR7132748A patent/FR2106434B1/fr not_active Expired
-
1977
- 1977-11-02 JP JP52130931A patent/JPS6044304B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL174043B (nl) | 1983-11-16 |
| FI55196C (fi) | 1979-06-11 |
| YU227971A (en) | 1979-07-10 |
| JPS5390258A (en) | 1978-08-08 |
| DE2145203A1 (de) | 1972-03-16 |
| RO61539A (forum.php) | 1976-12-15 |
| IL37633A (en) | 1975-08-31 |
| NO136712C (no) | 1977-10-26 |
| NL7112437A (forum.php) | 1972-03-14 |
| DD94814A5 (forum.php) | 1973-01-05 |
| FR2106434B1 (forum.php) | 1974-10-18 |
| LU63887A1 (forum.php) | 1972-03-01 |
| BE772395A (fr) | 1972-03-09 |
| OA03911A (fr) | 1975-08-14 |
| JPS544953B1 (forum.php) | 1979-03-12 |
| SU455542A3 (ru) | 1974-12-30 |
| AT311964B (de) | 1973-12-10 |
| IE35599B1 (en) | 1976-03-31 |
| YU34689B (en) | 1979-12-31 |
| AU461109B2 (en) | 1975-05-15 |
| IL37633A0 (en) | 1971-11-29 |
| NL174043C (nl) | 1984-04-16 |
| JPS6044304B2 (ja) | 1985-10-02 |
| PL81813B1 (en) | 1975-08-30 |
| GB1352723A (en) | 1974-05-08 |
| IE35599L (en) | 1972-03-10 |
| FI55196B (fi) | 1979-02-28 |
| CH572916A5 (forum.php) | 1976-02-27 |
| PH11935A (en) | 1978-09-15 |
| FR2106434A1 (forum.php) | 1972-05-05 |
| SE367203B (forum.php) | 1974-05-20 |
| EG10421A (en) | 1976-02-29 |
| DE2145203C2 (de) | 1984-07-12 |
| AU3302471A (en) | 1973-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6096770A (en) | Anthranilic acid analogs | |
| NZ200639A (en) | Chiral 2-(2-benzyl-3-mercaptopropionyl amino)-1-alkanols and 2-(2-benzyl-3-mercaptopropionylamino)-4-methyl thiobutyric acids | |
| NO136712B (forum.php) | ||
| CA1230127A (en) | Phenylalkanoic acid derivatives, their preparation and use | |
| CA1195985A (en) | Oxazole derivatives, production and use thereof | |
| CA2107150C (fr) | Nouveaux derives chromeniques a chaine laterale trienique, leur procede de preparation et les compositions pharmaceutiques les renfermant | |
| DK160760B (da) | Analogifremgangsmaade til fremstilling af n-naphthoylglycinderivater | |
| US3816443A (en) | 4-(benzothiazol-2-yl)fluoro phenyl-acetic acids | |
| EP0005559B1 (de) | Phenylaminothiophenessigsäuren, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| SE422209B (sv) | Mellanprodukt till anvendning for framstellning av nya 1,3-o x 20l- och 1,3-tiazolderivat | |
| US3899506A (en) | 4-(Benzoxazol-2-yl)-phenylacetic acids and derivatives thereof | |
| US3565943A (en) | 1-indancarboxylic acids and derivatives | |
| Wasserman et al. | Studies on the Mucohalic Acids. II. The Synthesis of Fused α-Lactam-thiazolidines Related to Penicillin1 | |
| US3947582A (en) | Phenylacetic acid compounds in treating abnormal platelet aggregation | |
| CA2045257A1 (fr) | Acyl benzoxazolinones, leur procede de preparation et les compositions pharmaceutiques qui les contiennent | |
| US3663627A (en) | 1-indanmethanols | |
| US4046905A (en) | Anti-inflammatory, analgesic and antipyretic phenylacetic acids | |
| CA2056008A1 (fr) | Derives de la benzoselenazolinone, leur procede de preparation et les compositions pharmaceutiques qui les contiennent | |
| US3565904A (en) | 1,2,3,4-tetrahydro-1-naphthoic acids | |
| US4116972A (en) | Anti-inflammatory 1-oxo-isoindoline derivatives and processes for their preparation | |
| JPS6019317B2 (ja) | チエノチアジン誘導体及びその製造方法 | |
| FR2567125A1 (fr) | Acides dihydro-5,6-4h-cyclopenta (b) thiophenecarboxylique-6, procedes de preparation et medicaments les contenant | |
| JPS6270351A (ja) | 置換ジ−t−ブチルフエノ−ル類 | |
| STEFANOVIć et al. | Reactions of Bisamides. VI. Synthesis of β-Aryl-α, β-Diaminopropionic Acids | |
| US3898269A (en) | Tetrahydronaphthylglyoxylic acids and esters |