NO134563B - - Google Patents
Download PDFInfo
- Publication number
- NO134563B NO134563B NO1803/71A NO180371A NO134563B NO 134563 B NO134563 B NO 134563B NO 1803/71 A NO1803/71 A NO 1803/71A NO 180371 A NO180371 A NO 180371A NO 134563 B NO134563 B NO 134563B
- Authority
- NO
- Norway
- Prior art keywords
- alkali
- digestion
- wood
- digestion process
- treatment
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 70
- 230000029087 digestion Effects 0.000 claims description 68
- 239000002023 wood Substances 0.000 claims description 57
- 230000008569 process Effects 0.000 claims description 52
- 239000003513 alkali Substances 0.000 claims description 27
- 239000007788 liquid Substances 0.000 claims description 25
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 21
- 229910052760 oxygen Inorganic materials 0.000 claims description 21
- 239000001301 oxygen Substances 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 16
- 229920002678 cellulose Polymers 0.000 claims description 16
- 239000001913 cellulose Substances 0.000 claims description 16
- 238000002203 pretreatment Methods 0.000 claims description 14
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 13
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 9
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000002994 raw material Substances 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 3
- 150000002500 ions Chemical class 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 239000000872 buffer Substances 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- 229910052723 transition metal Inorganic materials 0.000 claims description 2
- 150000003624 transition metals Chemical class 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- 241000257303 Hymenoptera Species 0.000 claims 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims 1
- 238000011282 treatment Methods 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 26
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 24
- 229910001882 dioxygen Inorganic materials 0.000 description 23
- 238000010411 cooking Methods 0.000 description 21
- 238000007792 addition Methods 0.000 description 20
- 229920005610 lignin Polymers 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 9
- 239000007789 gas Substances 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 8
- 239000003112 inhibitor Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 238000004061 bleaching Methods 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000005470 impregnation Methods 0.000 description 6
- 239000000123 paper Substances 0.000 description 6
- 229910021653 sulphate ion Inorganic materials 0.000 description 6
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- 229920001131 Pulp (paper) Polymers 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 150000002681 magnesium compounds Chemical class 0.000 description 5
- 238000001556 precipitation Methods 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 239000011122 softwood Substances 0.000 description 5
- 235000018185 Betula X alpestris Nutrition 0.000 description 4
- 235000018212 Betula X uliginosa Nutrition 0.000 description 4
- 229920000297 Rayon Polymers 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000002964 rayon Substances 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- -1 alkylbenzene sulphonate Chemical class 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 150000001720 carbohydrates Chemical class 0.000 description 3
- 235000014633 carbohydrates Nutrition 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000008139 complexing agent Substances 0.000 description 3
- 239000012634 fragment Substances 0.000 description 3
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 3
- 239000001095 magnesium carbonate Substances 0.000 description 3
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 239000004155 Chlorine dioxide Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000218657 Picea Species 0.000 description 2
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 2
- 241000018646 Pinus brutia Species 0.000 description 2
- 235000011613 Pinus brutia Nutrition 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000019398 chlorine dioxide Nutrition 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002680 magnesium Chemical class 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- 229910021645 metal ion Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 238000004064 recycling Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- 244000089654 Betula populifolia Species 0.000 description 1
- 241000219495 Betulaceae Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000218631 Coniferophyta Species 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 244000166124 Eucalyptus globulus Species 0.000 description 1
- 240000000731 Fagus sylvatica Species 0.000 description 1
- 235000010099 Fagus sylvatica Nutrition 0.000 description 1
- 229920002488 Hemicellulose Polymers 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229920001273 Polyhydroxy acid Polymers 0.000 description 1
- 241000219000 Populus Species 0.000 description 1
- 241000183024 Populus tremula Species 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000009993 causticizing Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Inorganic materials Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L magnesium sulphate Substances [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000013074 reference sample Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000002341 toxic gas Substances 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C3/00—Pulping cellulose-containing materials
- D21C3/02—Pulping cellulose-containing materials with inorganic bases or alkaline reacting compounds, e.g. sulfate processes
- D21C3/026—Pulping cellulose-containing materials with inorganic bases or alkaline reacting compounds, e.g. sulfate processes in presence of O2, e.g. air
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C3/00—Pulping cellulose-containing materials
- D21C3/22—Other features of pulping processes
- D21C3/26—Multistage processes
- D21C3/263—Multistage processes at least one stage being in presence of oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE06569/70A SE355614B (nl) | 1970-05-13 | 1970-05-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO134563B true NO134563B (nl) | 1976-07-26 |
| NO134563C NO134563C (nl) | 1976-11-03 |
Family
ID=20269035
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1803/71A NO134563C (nl) | 1970-05-13 | 1971-05-12 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3769152A (nl) |
| JP (1) | JPS5025042B1 (nl) |
| AT (1) | AT304251B (nl) |
| BR (1) | BR7102728D0 (nl) |
| CA (1) | CA935957A (nl) |
| DE (1) | DE2123542C3 (nl) |
| FI (1) | FI54343C (nl) |
| FR (1) | FR2091515A5 (nl) |
| NO (1) | NO134563C (nl) |
| SE (1) | SE355614B (nl) |
| SU (1) | SU574164A3 (nl) |
| ZA (1) | ZA712744B (nl) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI52877B (nl) * | 1972-11-16 | 1977-08-31 | Ahlstroem Oy | |
| SE373395B (sv) * | 1972-12-19 | 1975-02-03 | Mo Och Domsjoe Ab | Forfarande for framstellning av cellulosamassa med hog ljushet genom uppslutning av ved med syrgas under tryck i nervaro av en kokvetska forsatt med basiska neutralisationsmedel |
| SE379069B (nl) * | 1973-08-27 | 1975-09-22 | Kamyr Ab | |
| FI58360C (fi) * | 1974-06-14 | 1981-01-12 | Mo Och Domsjoe Ab | Foerfarande foer delignifiering av lignocellulosahaltigt material med hjaelp av syreinnehaollande gas och apparatur foer utfoerande av detta foerfarande |
| US4152197A (en) * | 1974-09-23 | 1979-05-01 | Mo Och Domsjo Ab | Process for preparing high-yield cellulose pulps by vapor phase pulping an unpulped portion of lignocellulosic material and a partially chemically pulped portion |
| US4119486A (en) * | 1975-08-14 | 1978-10-10 | Westvaco Corporation | Process for bleaching wood pulp with ozone in the presence of a cationic surfactant |
| US4338158A (en) * | 1976-04-09 | 1982-07-06 | Weyerhaeuser Company | Pulping in the presence of a protector |
| US4172006A (en) * | 1976-08-26 | 1979-10-23 | Weyerhaeuser Company | Method of delignifying wood chips with oxygen by adding cooking liquor under pressure |
| CA1079457A (en) * | 1976-09-13 | 1980-06-17 | Robert C. Eckert | Manganic ion bleaching process |
| JPS6059357B2 (ja) * | 1977-05-18 | 1985-12-24 | 本州製紙株式会社 | パルプの製造方法 |
| US4295927A (en) * | 1979-06-15 | 1981-10-20 | Weyerhaeuser Company | Method and apparatus for treating pulp with oxygen and storing the treated pulp |
| US4295926A (en) * | 1979-06-15 | 1981-10-20 | Weyerhaeuser Company | Method and apparatus for treating pulp with oxygen |
| US4295925A (en) * | 1979-06-15 | 1981-10-20 | Weyerhaeuser Company | Treating pulp with oxygen |
| US4303470A (en) * | 1979-06-15 | 1981-12-01 | Weyerhaeuser Company | Method and apparatus for mixing gases with a wood pulp slurry |
| US4298426A (en) * | 1979-06-15 | 1981-11-03 | Weyerhaeuser Company | Method and apparatus for treating pulp with oxygen in a multi-stage bleaching sequence |
| IT1209352B (it) * | 1980-09-22 | 1989-07-16 | Nardi Franco | Processo per la produzione di cellulose chimiche e/o paste per carte, nonche'impianto e relativi componenti per l'attuazione del processo indicato |
| WO1983000816A1 (en) * | 1981-09-04 | 1983-03-17 | Weyerhaeuser Co | Method and apparatus for mixing pulp with oxygen |
| US4431480A (en) * | 1981-10-27 | 1984-02-14 | The Black Clawson Company | Method and apparatus for controlled addition of alkaline chemicals to an oxygen delignification reaction |
| US4664832A (en) * | 1984-09-28 | 1987-05-12 | State Of South Dakota As Represented By The Department Of Transportation | Deicing chemicals and their preparation from polysaccharide sources |
| US4622100A (en) * | 1984-10-01 | 1986-11-11 | International Paper Company | Process for the delignification of lignocellulosic material with oxygen, ferricyanide, and a protector |
| US4622101A (en) * | 1984-10-01 | 1986-11-11 | International Paper Company | Method of oxygen bleaching with ferricyanide lignocellulosic material |
| DE3923728A1 (de) * | 1989-07-18 | 1991-01-24 | Degussa | Verfahren zur stabilisierung der viskositaet von zellstoffen |
| US5302244A (en) * | 1992-02-18 | 1994-04-12 | Domtar Inc. | Oxygen delignification of waste cellulosic paper products |
| US5858021A (en) * | 1996-10-31 | 1999-01-12 | Kimberly-Clark Worldwide, Inc. | Treatment process for cellulosic fibers |
| DE60014045D1 (de) * | 1999-02-15 | 2004-10-28 | Kiram Ab Saltsjoebaden | Verfahren zum sauerstoff-aufschluss von liganocellulosischen materialien und rückgewinnung von aufschlusschemikalien |
| WO2001059204A1 (en) * | 2000-02-14 | 2001-08-16 | Kiram Ab | Process for oxygen pulping of lignocellulosic material and recovery of pulping chemicals |
| CN1325913C (zh) * | 2002-05-29 | 2007-07-11 | 积水化学工业株式会社 | 血液检查用有底管、血液检查用有底管的栓体和血液检查用容器 |
| SE525773C2 (sv) * | 2003-09-24 | 2005-04-26 | Kvaerner Pulping Tech | Metod och arrangemang för syrgasdelignifiering av cellulosamassa med pH-reglering i slutfasen |
| CN1544752A (zh) * | 2003-11-28 | 2004-11-10 | 清洁制浆催化剂及其应用工艺 | |
| DK2701826T3 (da) * | 2011-04-29 | 2019-05-06 | Geosyntec Consultants Inc | Fremgangsmåde til volumetrisk reduktion af organiske væsker |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA694720A (en) * | 1964-09-22 | G. Gillaspie Athey | Method of bleaching cellulosic pulps | |
| GB576510A (en) * | 1944-03-16 | 1946-04-08 | Henry Dreyfus | Improvements in or relating to the production of cellulose |
| CA553349A (en) * | 1950-10-04 | 1958-02-18 | C. Harris George | Pulping process |
| BE504423A (nl) * | 1951-02-28 | |||
| US3013933A (en) * | 1953-01-28 | 1961-12-19 | Rayonier Inc | Method for preparation of wood cellulose |
| FR72957E (nl) * | 1956-11-05 | |||
| US2926114A (en) * | 1957-08-12 | 1960-02-23 | Kimberly Clark Co | Manufacture of cellulosic products |
| NL97796C (nl) * | 1958-05-29 | |||
| GB885605A (en) * | 1958-09-11 | 1961-12-28 | Stora Kopparbergs Bergslags Ab | Improved method for the production of neutral sulfite pulp |
| FR1387853A (fr) * | 1963-09-19 | 1965-02-05 | Air Liquide | Délignification et blanchiment des pâtes cellulosiques chimiques et mi-chimiques |
| SE314581B (nl) * | 1968-10-29 | 1969-09-08 | Mo Och Domsjoe Ab | |
| SE335053B (nl) * | 1969-05-13 | 1971-05-10 | Mo Och Domsjoe Ab |
-
1970
- 1970-05-13 SE SE06569/70A patent/SE355614B/xx unknown
-
1971
- 1971-02-26 US US00119375A patent/US3769152A/en not_active Expired - Lifetime
- 1971-03-08 CA CA107130A patent/CA935957A/en not_active Expired
- 1971-04-06 FI FI971/71A patent/FI54343C/fi active
- 1971-04-28 ZA ZA712744A patent/ZA712744B/xx unknown
- 1971-05-06 BR BR2728/71A patent/BR7102728D0/pt unknown
- 1971-05-06 SU SU7101653816A patent/SU574164A3/ru active
- 1971-05-12 FR FR7117192A patent/FR2091515A5/fr not_active Expired
- 1971-05-12 DE DE2123542A patent/DE2123542C3/de not_active Expired
- 1971-05-12 NO NO1803/71A patent/NO134563C/no unknown
- 1971-05-13 JP JP46031655A patent/JPS5025042B1/ja active Pending
- 1971-05-13 AT AT418271A patent/AT304251B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT304251B (de) | 1972-12-27 |
| JPS5025042B1 (nl) | 1975-08-20 |
| FI54343B (fi) | 1978-07-31 |
| DE2123542B2 (de) | 1973-10-25 |
| ZA712744B (en) | 1972-01-26 |
| DE2123542A1 (de) | 1971-11-25 |
| CA935957A (en) | 1973-10-30 |
| BR7102728D0 (pt) | 1973-06-07 |
| SU574164A3 (ru) | 1977-09-25 |
| DE2123542C3 (de) | 1974-05-22 |
| US3769152A (en) | 1973-10-30 |
| FI54343C (fi) | 1978-11-10 |
| NO134563C (nl) | 1976-11-03 |
| FR2091515A5 (nl) | 1972-01-14 |
| SE355614B (nl) | 1973-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO134563B (nl) | ||
| CA1226705A (en) | Chemithermomechanical pulping process employing separate alkali and sulfite treatments | |
| CA2651483C (en) | Methods for carbonate pretreatment and pulping of cellulosic material | |
| US3944463A (en) | Pulping of lignocellulosic material with oxygen in two stages at increasing pH | |
| WO2016080895A1 (en) | Process for the production of a treated pulp, treated pulp, and textile fibres produced from the treated pulp | |
| US4507172A (en) | Kraft pulping process | |
| NO140535B (no) | Fremgangsmaate for fremstilling av cellulosemasse ved oppslutning med oksygen | |
| US5183535A (en) | Process for preparing kraft pulp using black liquor pretreatment reaction | |
| CA1080914A (en) | Pulping of hardwood with sodium sulfide and sodium hydroxide while generating hydrogen sulfide in situ in the initial pulping stages | |
| AU639304B2 (en) | Process for preparing kraft pulp | |
| US3567572A (en) | Polysulfide liquor impregnation of lignocellulose materials in a multistage pulping process | |
| US6569285B2 (en) | Process for gas phase pretreating of lignocellulosic containing material | |
| US4750973A (en) | Process for reducing carbohydrate losses in the sulfate pulping of wood by pretreating the wood with oxygen and nitrogen oxides | |
| US3520773A (en) | Alkaline pulping processes with chemical pretreatment | |
| AU779711B2 (en) | Pulping process | |
| NO773750L (no) | Fremgangsmaate ved koking av lignocelluloseholdig materiale | |
| NO140605B (no) | Fremgangsmaate ved fjernelse av lignin fra lignocelluloseholdige materialer | |
| FI85725B (fi) | Foerfarande foer delignifiering av cellulosamaterial. | |
| Andrew et al. | Bleaching of kraft pulps produced from green liquor prehydrolyzed South African Eucalyptus grandis wood chips | |
| NO831946L (no) | Massekokingsprosess og preparat for gjennomfoering av denne | |
| US1848662A (en) | of berlin | |
| SU779471A1 (ru) | Способ получени целлюлозы | |
| GB478943A (en) | System of obtaining and treating cellulose and product thereof | |
| CA2258443A1 (en) | Pulp bleaching process including final stage brightening step with salt of peroxymonosulfuric acid | |
| NO762919L (nl) |