NO134535B - - Google Patents
Download PDFInfo
- Publication number
- NO134535B NO134535B NO872/71A NO87271A NO134535B NO 134535 B NO134535 B NO 134535B NO 872/71 A NO872/71 A NO 872/71A NO 87271 A NO87271 A NO 87271A NO 134535 B NO134535 B NO 134535B
- Authority
- NO
- Norway
- Prior art keywords
- shed
- ropes
- reinforcing
- elements
- casing
- Prior art date
Links
- 239000000463 material Substances 0.000 claims description 35
- 230000003014 reinforcing effect Effects 0.000 claims description 16
- 230000002787 reinforcement Effects 0.000 claims description 15
- 238000004873 anchoring Methods 0.000 claims description 12
- 239000000758 substrate Substances 0.000 claims description 5
- 239000004033 plastic Substances 0.000 claims description 4
- 229920003023 plastic Polymers 0.000 claims description 4
- 238000007789 sealing Methods 0.000 claims description 4
- 238000010276 construction Methods 0.000 description 14
- 239000004744 fabric Substances 0.000 description 8
- 238000009434 installation Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 230000008859 change Effects 0.000 description 4
- 238000005520 cutting process Methods 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000003344 environmental pollutant Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 231100000719 pollutant Toxicity 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000003245 working effect Effects 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- 229920002799 BoPET Polymers 0.000 description 1
- 239000005041 Mylar™ Substances 0.000 description 1
- 229920012485 Plasticized Polyvinyl chloride Polymers 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000006750 UV protection Effects 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 239000002390 adhesive tape Substances 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000002457 bidirectional effect Effects 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 230000007123 defense Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000001473 noxious effect Effects 0.000 description 1
- 235000019645 odor Nutrition 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920003225 polyurethane elastomer Polymers 0.000 description 1
- 238000009417 prefabrication Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000003911 water pollution Methods 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04H—BUILDINGS OR LIKE STRUCTURES FOR PARTICULAR PURPOSES; SWIMMING OR SPLASH BATHS OR POOLS; MASTS; FENCING; TENTS OR CANOPIES, IN GENERAL
- E04H15/00—Tents or canopies, in general
- E04H15/20—Tents or canopies, in general inflatable, e.g. shaped, strengthened or supported by fluid pressure
- E04H15/22—Tents or canopies, in general inflatable, e.g. shaped, strengthened or supported by fluid pressure supported by air pressure inside the tent
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Tents Or Canopies (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17675A US3638368A (en) | 1970-03-09 | 1970-03-09 | Inflatable shelter and method of erection |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO134535B true NO134535B (enFirst) | 1976-07-19 |
| NO134535C NO134535C (enFirst) | 1976-10-27 |
Family
ID=21783942
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO872/71A NO134535C (enFirst) | 1970-03-09 | 1971-03-08 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3638368A (enFirst) |
| JP (1) | JPS5424211B1 (enFirst) |
| BE (1) | BE764015A (enFirst) |
| BR (1) | BR7101237D0 (enFirst) |
| CH (1) | CH526692A (enFirst) |
| DE (1) | DE2108262A1 (enFirst) |
| DK (1) | DK135549B (enFirst) |
| ES (1) | ES194570Y (enFirst) |
| FR (1) | FR2081791B1 (enFirst) |
| GB (1) | GB1315474A (enFirst) |
| IL (1) | IL36194A (enFirst) |
| NL (1) | NL7103136A (enFirst) |
| NO (1) | NO134535C (enFirst) |
| RO (1) | RO62055A (enFirst) |
| ZA (1) | ZA71773B (enFirst) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2188937B1 (enFirst) * | 1972-06-21 | 1974-12-27 | Sales Jean Mich5L | |
| US4068404A (en) * | 1975-12-17 | 1978-01-17 | Sheldon Robert T | Shade-producing structure and method |
| US4271641A (en) * | 1978-03-06 | 1981-06-09 | Taiyo Kogyo Company Limited | Tension structure |
| US4167086A (en) * | 1978-06-23 | 1979-09-11 | Owens-Corning Fiberglas Corporation | Eccentricity eliminating cable-fabric connection apparatus for air supported roof structures |
| NO146116C (no) * | 1979-11-28 | 1982-08-11 | Torbjoern Arnold Snekkenes | Anordning for veksthus eller vekstrom for aa fremme vekst av planter eller spiring av froe |
| AT378560B (de) * | 1983-06-03 | 1985-08-26 | Voest Alpine Krems | Grossflaechige, horizontale abdeckung |
| US6070366A (en) * | 1999-01-04 | 2000-06-06 | Pierson; Robert M | Air supported enclosure and method of assembly |
| AT410232B (de) * | 2001-04-25 | 2003-03-25 | Lothar Bitschnau | Verfahren zur errichtung einer gebäudedecke an einem bauwerk |
| US6571815B1 (en) * | 2001-07-24 | 2003-06-03 | Jimmy Hill | Sun shield |
| US7770332B2 (en) * | 2005-11-30 | 2010-08-10 | Muhamed Semiz | Structure with space applications and methods of construction thereof |
| US20080307719A1 (en) * | 2007-06-13 | 2008-12-18 | Murray Ellen | Domed non-steel roof frame |
| US20080307718A1 (en) * | 2007-06-13 | 2008-12-18 | Murray Ellen | Domed steel roof frame |
| JP5265328B2 (ja) * | 2008-12-16 | 2013-08-14 | 大成建設株式会社 | 空気膜構造物 |
| AU2011229133A1 (en) * | 2010-03-16 | 2012-10-11 | The Square Company Pty Ltd | A domed non-steel roof structure |
| USD794835S1 (en) | 2014-12-23 | 2017-08-15 | Awi Licensing Llc | Architectual ceiling panel apparatus |
| USD796699S1 (en) | 2014-12-23 | 2017-09-05 | Awi Licensing Llc | Architectual ceiling panel apparatus |
| USD796069S1 (en) | 2014-12-23 | 2017-08-29 | Awi Licensing Llc | Architectual ceiling panel apparatus |
| USD797318S1 (en) | 2014-12-23 | 2017-09-12 | Awi Licensing Llc | Architectual ceiling panel apparatus |
| CA2979091A1 (en) * | 2015-03-10 | 2016-09-15 | Antoine Marcel PAULUS | Mobile artificial cloud |
| DE102018132872B4 (de) * | 2018-12-19 | 2021-03-25 | aem - GmbH | Netzanordnung, Strömungskanal mit der Netzanordnung und Abstandshalter |
| US20220211149A1 (en) * | 2021-01-05 | 2022-07-07 | JOHN Adams LEE | Multipurpose Floating Weather Canopy |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3123085A (en) * | 1964-03-03 | demarteau | ||
| FR655445A (fr) * | 1928-06-06 | 1929-04-18 | Cellule ou édifice pneumatique utilisable pour la construction et autres applications | |
| US2881718A (en) * | 1954-02-19 | 1959-04-14 | Stromeyer & Co Gmbh L | Undulating tensioned roof construction |
| US3116746A (en) * | 1958-06-02 | 1964-01-07 | Birdair Structures | Sectionalized air supported structures |
| US3169542A (en) * | 1962-01-17 | 1965-02-16 | Frankenstein & Sons Manchester | Inflatable buildings |
| FR1312332A (fr) * | 1962-01-25 | 1962-12-14 | Frankenstein & Sons Manchester | Perfectionnements de constructions gonflables |
| FR1315693A (fr) * | 1962-02-23 | 1963-01-18 | édifice pneumatique | |
| NL298934A (enFirst) * | 1962-10-08 | |||
| DE1434635A1 (de) * | 1964-05-16 | 1968-11-28 | Feldmuehle Ag | Von einem inneren Luftueberdruck getragene Halle |
| SE318700B (enFirst) * | 1965-06-16 | 1969-12-15 | Herman G Ab | |
| FR1450617A (fr) * | 1965-06-22 | 1966-06-24 | Structures constructives spéciales formées de voiles ou treillis tendus suivant deux directions orthogonales | |
| US3381424A (en) * | 1965-12-06 | 1968-05-07 | Byron C. Butler | Protective construction for lessening the weight of accumulated snow loads on the roofs of buildings, mobile homes, and other dwellings |
| US3390491A (en) * | 1966-07-20 | 1968-07-02 | Garrett Corp | Inflatable electromagnetically shielded enclosure |
| US3391504A (en) * | 1967-03-13 | 1968-07-09 | Terence W. Mclorg | Air supported shelter |
| US3496686A (en) * | 1967-11-30 | 1970-02-24 | Birdair Structures | Weather-tight enclosure system |
-
1970
- 1970-03-09 US US17675A patent/US3638368A/en not_active Expired - Lifetime
-
1971
- 1971-02-08 ZA ZA710773A patent/ZA71773B/xx unknown
- 1971-02-15 IL IL36194A patent/IL36194A/xx unknown
- 1971-02-18 DE DE19712108262 patent/DE2108262A1/de not_active Withdrawn
- 1971-02-18 ES ES1971194570U patent/ES194570Y/es not_active Expired
- 1971-03-01 BR BR1237/71*[A patent/BR7101237D0/pt unknown
- 1971-03-01 DK DK93971AA patent/DK135549B/da unknown
- 1971-03-08 FR FR7107922A patent/FR2081791B1/fr not_active Expired
- 1971-03-08 NO NO872/71A patent/NO134535C/no unknown
- 1971-03-08 CH CH334571A patent/CH526692A/fr not_active IP Right Cessation
- 1971-03-09 NL NL7103136A patent/NL7103136A/xx unknown
- 1971-03-09 RO RO66185A patent/RO62055A/ro unknown
- 1971-03-09 BE BE764015A patent/BE764015A/xx unknown
- 1971-03-09 JP JP1271271A patent/JPS5424211B1/ja active Pending
- 1971-04-19 GB GB2155971A patent/GB1315474A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3638368A (en) | 1972-02-01 |
| GB1315474A (en) | 1973-05-02 |
| JPS5424211B1 (enFirst) | 1979-08-20 |
| DK135549B (da) | 1977-05-16 |
| DK135549C (enFirst) | 1977-10-24 |
| NL7103136A (enFirst) | 1971-09-13 |
| IL36194A (en) | 1974-05-16 |
| DE2108262A1 (de) | 1972-01-13 |
| NO134535C (enFirst) | 1976-10-27 |
| FR2081791B1 (enFirst) | 1974-05-31 |
| CH526692A (fr) | 1972-08-15 |
| ES194570U (es) | 1974-12-16 |
| IL36194A0 (en) | 1971-04-28 |
| ES194570Y (es) | 1975-04-16 |
| ZA71773B (en) | 1971-10-27 |
| RO62055A (enFirst) | 1977-06-15 |
| FR2081791A1 (enFirst) | 1971-12-10 |
| BR7101237D0 (pt) | 1973-10-25 |
| BE764015A (fr) | 1971-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO134535B (enFirst) | ||
| US3765134A (en) | Construction of rigid tensioned frame structure | |
| US4137687A (en) | Stressed membrane space enclosure | |
| US4878322A (en) | Insulating plastic film structures and method | |
| US8505263B2 (en) | Inflatable barrier | |
| US6497074B2 (en) | Multi-layer flexible panel modules with exterior and interior stressed layers spread apart at the ends and connected intermediate the ends inducing opposing concave deflections to the layers | |
| EP0306717A1 (en) | Insulating plastic film structures and method | |
| US20190390454A1 (en) | Method of attaching a membrane to a tubular framework and an integrated system using this method to build geodesic domes | |
| US5197505A (en) | Tents | |
| US5140788A (en) | Building constructions | |
| RU2383705C1 (ru) | Большепролетное покрытие строительного сооружения (варианты) | |
| US4398376A (en) | Fabric panel unit | |
| GB941466A (en) | Improvements in flexible load-bearing structures | |
| US3007541A (en) | Temporary covering and support structure therefor | |
| US715185A (en) | Brick-drying shed. | |
| US3885360A (en) | Reinforces inflatable | |
| DE202014005954U1 (de) | Schwimmende versenkbare Schwimmbadabdeckung mit eingebauter Isolierung | |
| WO1991004382A1 (en) | Personal shade device | |
| GB2223789A (en) | Canopy of greenhouse structure | |
| US20140209258A1 (en) | System for tightening fabric panels | |
| DE7517054U (de) | Tragluftcontainer | |
| JP3737659B2 (ja) | 屋根状空気膜体 | |
| DE102019201386B4 (de) | Aufblasbare Bedachung mit einem Dach mit einer flexiblen Dachhaut und einem aufblasbaren Stützelement | |
| US92487A (en) | Improvement in tents | |
| RU2095534C1 (ru) | Мембранно-каркасное сооружение |