NO133276B - - Google Patents
Download PDFInfo
- Publication number
- NO133276B NO133276B NO1348/73A NO134873A NO133276B NO 133276 B NO133276 B NO 133276B NO 1348/73 A NO1348/73 A NO 1348/73A NO 134873 A NO134873 A NO 134873A NO 133276 B NO133276 B NO 133276B
- Authority
- NO
- Norway
- Prior art keywords
- pigment
- zirconium
- compounds
- addition
- suspension
- Prior art date
Links
- 239000000049 pigment Substances 0.000 claims description 56
- 150000001875 compounds Chemical class 0.000 claims description 42
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 21
- 239000000725 suspension Substances 0.000 claims description 18
- 238000011282 treatment Methods 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 17
- 239000004408 titanium dioxide Substances 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000003754 zirconium Chemical class 0.000 claims description 11
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical class [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 10
- 229910052726 zirconium Chemical class 0.000 claims description 10
- 229910052782 aluminium Inorganic materials 0.000 claims description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical class [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 9
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- GGROONUBGIWGGS-UHFFFAOYSA-N oxygen(2-);zirconium(4+);hydrate Chemical compound O.[O-2].[O-2].[Zr+4] GGROONUBGIWGGS-UHFFFAOYSA-N 0.000 claims description 8
- 150000004677 hydrates Chemical class 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 230000007935 neutral effect Effects 0.000 claims description 6
- 238000006386 neutralization reaction Methods 0.000 claims description 5
- 238000001556 precipitation Methods 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 239000002002 slurry Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000003608 titanium Chemical class 0.000 claims description 2
- 150000003751 zinc Chemical class 0.000 claims description 2
- 238000007792 addition Methods 0.000 description 28
- 239000000243 solution Substances 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 230000014759 maintenance of location Effects 0.000 description 10
- IPCAPQRVQMIMAN-UHFFFAOYSA-L zirconyl chloride Chemical compound Cl[Zr](Cl)=O IPCAPQRVQMIMAN-UHFFFAOYSA-L 0.000 description 10
- 239000003513 alkali Substances 0.000 description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical class [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 5
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 239000010936 titanium Chemical class 0.000 description 5
- 229910052719 titanium Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 229910000349 titanium oxysulfate Inorganic materials 0.000 description 4
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 230000003472 neutralizing effect Effects 0.000 description 3
- 235000019353 potassium silicate Nutrition 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 229910052684 Cerium Chemical class 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 150000004645 aluminates Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical class [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 2
- -1 e.g. acids Chemical class 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 239000002966 varnish Substances 0.000 description 2
- 229960001763 zinc sulfate Drugs 0.000 description 2
- 229910000368 zinc sulfate Inorganic materials 0.000 description 2
- 235000009529 zinc sulphate Nutrition 0.000 description 2
- 239000011686 zinc sulphate Substances 0.000 description 2
- ZXAUZSQITFJWPS-UHFFFAOYSA-J zirconium(4+);disulfate Chemical compound [Zr+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZXAUZSQITFJWPS-UHFFFAOYSA-J 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical class [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09C—TREATMENT OF INORGANIC MATERIALS, OTHER THAN FIBROUS FILLERS, TO ENHANCE THEIR PIGMENTING OR FILLING PROPERTIES ; PREPARATION OF CARBON BLACK ; PREPARATION OF INORGANIC MATERIALS WHICH ARE NO SINGLE CHEMICAL COMPOUNDS AND WHICH ARE MAINLY USED AS PIGMENTS OR FILLERS
- C09C1/00—Treatment of specific inorganic materials other than fibrous fillers; Preparation of carbon black
- C09C1/36—Compounds of titanium
- C09C1/3607—Titanium dioxide
- C09C1/3653—Treatment with inorganic compounds
- C09C1/3661—Coating
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
- Paints Or Removers (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2223524A DE2223524C2 (de) | 1972-05-13 | 1972-05-13 | Verfahren zur Herstellung eines beschichteten Titandioxid-Pigmentes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO133276B true NO133276B (pm) | 1975-12-29 |
| NO133276C NO133276C (pm) | 1976-04-07 |
Family
ID=5844873
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1348/73A NO133276C (pm) | 1972-05-13 | 1973-04-03 |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS565270B2 (pm) |
| BE (1) | BE799446A (pm) |
| BR (1) | BR7303426D0 (pm) |
| DE (1) | DE2223524C2 (pm) |
| ES (1) | ES414668A1 (pm) |
| FI (1) | FI58506C (pm) |
| FR (1) | FR2184694B1 (pm) |
| GB (1) | GB1435718A (pm) |
| IT (1) | IT987274B (pm) |
| NL (1) | NL175637C (pm) |
| NO (1) | NO133276C (pm) |
| ZA (1) | ZA733085B (pm) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1479988A (en) * | 1975-07-17 | 1977-07-13 | Tioxide Group Ltd | Treatment of pigment |
| GB1481151A (en) * | 1975-08-14 | 1977-07-27 | Tioxide Group Ltd | Treatment of pigment |
| DE2738805A1 (de) * | 1977-08-29 | 1979-03-08 | Basf Ag | Verdunstungsarme, gut ueberlaminierbare, haertbare ungesaettigte polyesterharze |
| DE2835880A1 (de) * | 1978-08-16 | 1980-02-28 | Bayer Ag | Verfahren zur herstellung von titandioxidpigmenten mit hoher wetterbestaendigkeit |
| JPS5937305B2 (ja) * | 1980-11-18 | 1984-09-08 | 石原産業株式会社 | 二酸化チタン顔料 |
| DE3137384A1 (de) * | 1981-09-19 | 1983-04-07 | Bayer Ag, 5090 Leverkusen | Flockungsstabile mischphasenpigmente mit rutilstruktur, verfahren zu ihrer herstellung sowie ihre verwendung |
| GB2108098B (en) * | 1981-10-30 | 1985-03-20 | Tioxide Group Plc | Improved pigments and their preparation |
| GB2108097B (en) * | 1981-10-30 | 1985-01-03 | Tioxide Group Plc | Improved pigments and their preparation |
| DE10205920A1 (de) | 2002-02-12 | 2003-08-21 | Itn Nanovation Gmbh | Nanoskaliger Rutil, sowie Verfahren zu dessen Herstellung |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL298822A (pm) * | 1962-10-05 | |||
| NL300720A (pm) * | 1962-11-20 | |||
| FR1426766A (fr) * | 1964-03-20 | 1966-01-28 | American Potash & Chem Corp | Perfectionnements aux pigments de bioxyde de titane |
-
1972
- 1972-05-13 DE DE2223524A patent/DE2223524C2/de not_active Expired
- 1972-12-15 FI FI3559/72A patent/FI58506C/fi active
-
1973
- 1973-04-03 NO NO1348/73A patent/NO133276C/no unknown
- 1973-05-02 GB GB2074473A patent/GB1435718A/en not_active Expired
- 1973-05-07 ZA ZA733085A patent/ZA733085B/xx unknown
- 1973-05-10 IT IT23944/73A patent/IT987274B/it active
- 1973-05-10 FR FR7317010A patent/FR2184694B1/fr not_active Expired
- 1973-05-11 BE BE131044A patent/BE799446A/xx not_active IP Right Cessation
- 1973-05-11 NL NLAANVRAGE7306622,A patent/NL175637C/xx not_active IP Right Cessation
- 1973-05-11 BR BR3426/73A patent/BR7303426D0/pt unknown
- 1973-05-11 ES ES414668A patent/ES414668A1/es not_active Expired
- 1973-05-14 JP JP5346273A patent/JPS565270B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2223524A1 (de) | 1973-11-22 |
| FR2184694B1 (pm) | 1976-11-12 |
| NL7306622A (pm) | 1973-11-15 |
| ES414668A1 (es) | 1976-01-16 |
| FI58506B (fi) | 1980-10-31 |
| GB1435718A (en) | 1976-05-12 |
| BR7303426D0 (pt) | 1974-07-18 |
| BE799446A (fr) | 1973-08-31 |
| FR2184694A1 (pm) | 1973-12-28 |
| AU5547573A (en) | 1974-11-14 |
| IT987274B (it) | 1975-02-20 |
| NL175637B (nl) | 1984-07-02 |
| NL175637C (nl) | 1984-12-03 |
| FI58506C (fi) | 1981-02-10 |
| JPS4941424A (pm) | 1974-04-18 |
| DE2223524C2 (de) | 1987-01-02 |
| ZA733085B (en) | 1974-04-24 |
| JPS565270B2 (pm) | 1981-02-04 |
| NO133276C (pm) | 1976-04-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4328040A (en) | Process for the production of titanium dioxide pigments with high weather resistance | |
| US3513007A (en) | Mixed coating process | |
| US4867794A (en) | Process for preparing rutile-coated mica pigments | |
| NO134589B (pm) | ||
| NO133276B (pm) | ||
| JPS5937305B2 (ja) | 二酸化チタン顔料 | |
| SU688136A3 (ru) | Способ получени титанового пигмента с алюмосиликатным покрытием | |
| US3859115A (en) | Production of coated TiO{HD 2 {B pigments | |
| JPH05270834A (ja) | 単斜晶系ビスマスバナデートおよびその製造法 | |
| US3897261A (en) | Hydrous oxide coated TiO{HD 2 {L | |
| IE43110B1 (en) | Lustrous pigments | |
| US2296618A (en) | Silicate treated titanium pigment | |
| US4883539A (en) | Coated silicate particles | |
| US3859109A (en) | Pigment production | |
| JPH08302236A (ja) | 有色顔料 | |
| US2357101A (en) | Titanium pigments and process for producing the same | |
| US3409454A (en) | Alumina coated tio2 pigments | |
| US3682672A (en) | Molybdenum red and molybdenum orange pigments and process of making the same | |
| US3459575A (en) | Titanium pigment manufacture | |
| JPH0747699B2 (ja) | 耐侯堅ろう性に優れたビスマスオキシクロライド光沢顔料とその製造方法 | |
| NO127244B (pm) | ||
| US2154220A (en) | Process for producing coatings on plaster or other surfaces | |
| GB2226017A (en) | Opacifying agent | |
| CA1096107A (en) | Chrome pigments | |
| US4235639A (en) | Chrome pigment |