NO131734B - - Google Patents
Download PDFInfo
- Publication number
- NO131734B NO131734B NO2305/71A NO230571A NO131734B NO 131734 B NO131734 B NO 131734B NO 2305/71 A NO2305/71 A NO 2305/71A NO 230571 A NO230571 A NO 230571A NO 131734 B NO131734 B NO 131734B
- Authority
- NO
- Norway
- Prior art keywords
- cooking
- liquid
- oxygen
- wood
- absorption
- Prior art date
Links
- 238000010411 cooking Methods 0.000 claims description 80
- 239000007788 liquid Substances 0.000 claims description 72
- 238000000034 method Methods 0.000 claims description 52
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 31
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 28
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 27
- 239000001301 oxygen Substances 0.000 claims description 27
- 229910052760 oxygen Inorganic materials 0.000 claims description 27
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 26
- 239000002023 wood Substances 0.000 claims description 26
- 238000010521 absorption reaction Methods 0.000 claims description 22
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 15
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 15
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 14
- 239000001569 carbon dioxide Substances 0.000 claims description 13
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 13
- 239000007789 gas Substances 0.000 claims description 12
- 238000004061 bleaching Methods 0.000 claims description 9
- 229920002678 cellulose Polymers 0.000 claims description 9
- 239000001913 cellulose Substances 0.000 claims description 9
- 230000029087 digestion Effects 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 4
- 238000005406 washing Methods 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 238000007670 refining Methods 0.000 claims description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 12
- 239000000243 solution Substances 0.000 description 10
- 238000009835 boiling Methods 0.000 description 9
- 238000002485 combustion reaction Methods 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 239000003513 alkali Substances 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 6
- 150000002681 magnesium compounds Chemical class 0.000 description 5
- 239000002699 waste material Substances 0.000 description 5
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 229920005610 lignin Polymers 0.000 description 4
- 229910001425 magnesium ion Inorganic materials 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000004155 Chlorine dioxide Substances 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 229920001131 Pulp (paper) Polymers 0.000 description 3
- 235000019398 chlorine dioxide Nutrition 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 235000018185 Betula X alpestris Nutrition 0.000 description 2
- 235000018212 Betula X uliginosa Nutrition 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229910001882 dioxygen Inorganic materials 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical class [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- DLVZBSZXZDGKQY-UHFFFAOYSA-N 2,2-dihydroxybutanoic acid Chemical compound CCC(O)(O)C(O)=O DLVZBSZXZDGKQY-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- -1 magnesium sulfate Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C11/00—Regeneration of pulp liquors or effluent waste waters
- D21C11/06—Treatment of pulp gases; Recovery of the heat content of the gases; Treatment of gases arising from various sources in pulp and paper mills; Regeneration of gaseous SO2, e.g. arising from liquors containing sulfur compounds
Landscapes
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8589/70A SE343092B (enrdf_load_stackoverflow) | 1970-06-22 | 1970-06-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131734B true NO131734B (enrdf_load_stackoverflow) | 1975-04-07 |
| NO131734C NO131734C (enrdf_load_stackoverflow) | 1975-07-16 |
Family
ID=20274493
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO2305/71A NO131734C (enrdf_load_stackoverflow) | 1970-06-22 | 1971-06-18 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3764464A (enrdf_load_stackoverflow) |
| JP (1) | JPS4938921B1 (enrdf_load_stackoverflow) |
| AT (1) | AT303509B (enrdf_load_stackoverflow) |
| CA (1) | CA935958A (enrdf_load_stackoverflow) |
| DE (1) | DE2130164B2 (enrdf_load_stackoverflow) |
| FI (1) | FI54345C (enrdf_load_stackoverflow) |
| FR (1) | FR2099805A5 (enrdf_load_stackoverflow) |
| NO (1) | NO131734C (enrdf_load_stackoverflow) |
| SE (1) | SE343092B (enrdf_load_stackoverflow) |
| ZA (1) | ZA714055B (enrdf_load_stackoverflow) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE373896B (enrdf_load_stackoverflow) * | 1972-07-05 | 1975-02-17 | Mo Och Domsjoe Ab | |
| SE373395B (sv) * | 1972-12-19 | 1975-02-03 | Mo Och Domsjoe Ab | Forfarande for framstellning av cellulosamassa med hog ljushet genom uppslutning av ved med syrgas under tryck i nervaro av en kokvetska forsatt med basiska neutralisationsmedel |
| SE381692B (sv) * | 1973-10-17 | 1975-12-15 | Mo Och Domsjoe Ab | Forfarande for forbettring av vermeekonomin vid kokning av lignocellulosamaterial i diskontinuerliga kokare |
| US4089737A (en) * | 1974-02-18 | 1978-05-16 | Toyo Pulp Company, Ltd. | Delignification of cellulosic material with an alkaline aqueous medium containing oxygen dissolved therein |
| SE393138B (sv) * | 1974-03-14 | 1977-05-02 | Mo Och Domsjoe Ab | Forfarande for blekning av cellulosa med en syre innehallande gas i nervaro av natriumbikarbonat |
| GB1505529A (en) * | 1974-06-14 | 1978-03-30 | Mo Och Domsjoe Ab | Method for the oxygen-gas delignification of lignocellulosic material and apparatus for carrying out the method |
| US4338158A (en) * | 1976-04-09 | 1982-07-06 | Weyerhaeuser Company | Pulping in the presence of a protector |
| US4080248A (en) * | 1976-06-28 | 1978-03-21 | Crown Zellerbach Corporation | Two-stage oxygen pulping |
| US4172006A (en) * | 1976-08-26 | 1979-10-23 | Weyerhaeuser Company | Method of delignifying wood chips with oxygen by adding cooking liquor under pressure |
| JPS5383012A (en) * | 1976-12-28 | 1978-07-22 | Fujitec Kk | Device for controlling induction motor |
| US4664832A (en) * | 1984-09-28 | 1987-05-12 | State Of South Dakota As Represented By The Department Of Transportation | Deicing chemicals and their preparation from polysaccharide sources |
| US6126781A (en) * | 1991-08-01 | 2000-10-03 | Union Camp Patent Holding, Inc. | Process for conditioning ozone gas recycle stream in ozone pulp bleaching |
| CA2107764A1 (en) * | 1992-03-02 | 1993-09-16 | Lawrence A. Hinkey | Combined ozone destruction and fiber scrubbing in paper pulp mills |
| US5571378A (en) * | 1993-11-23 | 1996-11-05 | Hampshire Chemical Ltd. | Process for high-pH metal ion chelation in pulps |
| US6210527B1 (en) * | 1994-03-14 | 2001-04-03 | The Boc Group, Inc. | Pulp bleaching method wherein an ozone bleaching waste stream is scrubbed to form an oxygen containing stream |
| SE516030C2 (sv) * | 1994-11-14 | 2001-11-12 | Aga Ab | Regenerering av en gasblandning från ett ozonbleksteg |
| US6475338B1 (en) * | 1996-06-05 | 2002-11-05 | Andritz Inc. | Method of minimizing transition metal ions during chemical pulping in a digester by adding chelating agent to the digester |
| EP1337315B1 (de) * | 2000-12-01 | 2004-09-29 | Linde Aktiengesellschaft | Verfahren zur reinigung von abgas aus einer zellstoffabrik |
| FI122815B (fi) * | 2005-04-18 | 2012-07-13 | Cerefi Oy | Menetelmä lignoselluloosamateriaalien ja niistä saatujen jakeiden fraktioimiseksi |
-
1970
- 1970-06-22 SE SE8589/70A patent/SE343092B/xx unknown
-
1971
- 1971-06-18 NO NO2305/71A patent/NO131734C/no unknown
- 1971-06-18 FI FI1740/71A patent/FI54345C/fi active
- 1971-06-18 US US00154486A patent/US3764464A/en not_active Expired - Lifetime
- 1971-06-18 DE DE19712130164 patent/DE2130164B2/de active Granted
- 1971-06-21 CA CA116186A patent/CA935958A/en not_active Expired
- 1971-06-21 ZA ZA714055A patent/ZA714055B/xx unknown
- 1971-06-22 FR FR7122712A patent/FR2099805A5/fr not_active Expired
- 1971-06-22 JP JP46044554A patent/JPS4938921B1/ja active Pending
- 1971-06-22 AT AT542871A patent/AT303509B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI54345B (fi) | 1978-07-31 |
| DE2130164C3 (enrdf_load_stackoverflow) | 1974-04-11 |
| FR2099805A5 (enrdf_load_stackoverflow) | 1972-03-17 |
| DE2130164A1 (de) | 1971-12-30 |
| SE343092B (enrdf_load_stackoverflow) | 1972-02-28 |
| JPS4938921B1 (enrdf_load_stackoverflow) | 1974-10-22 |
| FI54345C (fi) | 1978-11-10 |
| DE2130164B2 (de) | 1973-08-23 |
| AT303509B (de) | 1972-11-27 |
| ZA714055B (en) | 1973-02-28 |
| NO131734C (enrdf_load_stackoverflow) | 1975-07-16 |
| CA935958A (en) | 1973-10-30 |
| US3764464A (en) | 1973-10-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO131734B (enrdf_load_stackoverflow) | ||
| US4053352A (en) | Method for producing oxidized white liquor | |
| US4244778A (en) | Process for the chemical refining of cellulose pulp | |
| NO128372B (enrdf_load_stackoverflow) | ||
| SE421938B (sv) | Forfarande for behandling av cellulosamassa med kveveoxider fore syrgasblekning | |
| JPS6012477B2 (ja) | リグノセルロ−ス物質の連続アルカリ脱リグニン化法 | |
| JPH03130482A (ja) | セルロースの連続蒸解方法及び装置 | |
| US1843466A (en) | Paper manufacture | |
| NO178406B (no) | Fremgangsmåte for delignifisering av plantefibermateriale | |
| NO162733B (no) | Fremgangsmaate for fremstilling av kokevaeske for kraftmassekoking samt kokevaeske for dette. | |
| NO792783L (no) | Fremgangsmaate og apparatur for minskning av mengden av ineffektive kjemikalier i kokevaeske | |
| NO140535B (no) | Fremgangsmaate for fremstilling av cellulosemasse ved oppslutning med oksygen | |
| US3384534A (en) | Bleaching of wood pulps with thiourea dioxide | |
| NO160325B (no) | Demonterbar stolfot. | |
| RU2649268C2 (ru) | Способ каустификации зеленого щелока | |
| US2642399A (en) | Process for dissolving ash containing sodium sulfide and sodium carbonate | |
| RU2084574C1 (ru) | Способ получения целлюлозной массы | |
| GB813072A (en) | Sulphite pulping process | |
| NO176726B (no) | Fremgangsmåte for fremstilling av kjemotermomekanisk blekede masser | |
| NO147685B (no) | Vibrerende peldriver og -uttrekker. | |
| US1606501A (en) | Treatment of residual liquor | |
| SU358859A1 (ru) | ЗОЮЭНАЯ ]: ;s*iTiiO-TEX^Ili'^ra«AIIв^'^ьп^-'Отек'* I | |
| US2802791A (en) | Treatment of spent sulfite liquor | |
| US150111A (en) | Improvement in processes of reducing wood to paper-pulp | |
| US1849334A (en) | Process for the production of chemical wood pulp |