NO131406B - - Google Patents
Download PDFInfo
- Publication number
- NO131406B NO131406B NO4275/69A NO427569A NO131406B NO 131406 B NO131406 B NO 131406B NO 4275/69 A NO4275/69 A NO 4275/69A NO 427569 A NO427569 A NO 427569A NO 131406 B NO131406 B NO 131406B
- Authority
- NO
- Norway
- Prior art keywords
- toothpaste
- alumina
- trihydrate
- corrosion
- aluminum oxide
- Prior art date
Links
- 239000000606 toothpaste Substances 0.000 claims description 27
- 229940034610 toothpaste Drugs 0.000 claims description 23
- 230000007797 corrosion Effects 0.000 claims description 10
- 238000005260 corrosion Methods 0.000 claims description 10
- -1 orthophosphate ions Chemical class 0.000 claims description 10
- KZNNRLXBDAAMDZ-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane trihydrate Chemical compound O.O.O.O=[Al]O[Al]=O KZNNRLXBDAAMDZ-UHFFFAOYSA-N 0.000 claims description 10
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 9
- 229910052782 aluminium Inorganic materials 0.000 claims description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 7
- 235000011007 phosphoric acid Nutrition 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 7
- 230000006641 stabilisation Effects 0.000 description 7
- 238000011105 stabilization Methods 0.000 description 7
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 6
- 235000019799 monosodium phosphate Nutrition 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 6
- 230000000694 effects Effects 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- UOCIZHQMWNPGEN-UHFFFAOYSA-N dialuminum;oxygen(2-);trihydrate Chemical compound O.O.O.[O-2].[O-2].[O-2].[Al+3].[Al+3] UOCIZHQMWNPGEN-UHFFFAOYSA-N 0.000 description 3
- RBLGLDWTCZMLRW-UHFFFAOYSA-K dicalcium;phosphate;dihydrate Chemical compound O.O.[Ca+2].[Ca+2].[O-]P([O-])([O-])=O RBLGLDWTCZMLRW-UHFFFAOYSA-K 0.000 description 3
- 239000006072 paste Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000551 dentifrice Substances 0.000 description 2
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- KMDNVAPSULDFFO-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanol;phosphoric acid Chemical compound OP(O)(O)=O.OCCN(CCO)CCO.OCCN(CCO)CCO KMDNVAPSULDFFO-UHFFFAOYSA-N 0.000 description 1
- 238000004131 Bayer process Methods 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- MXRIRQGCELJRSN-UHFFFAOYSA-N O.O.O.[Al] Chemical compound O.O.O.[Al] MXRIRQGCELJRSN-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- VLCINIKIVYNLPT-UHFFFAOYSA-J dicalcium;hydrogen phosphate Chemical compound [Ca+2].[Ca+2].OP(O)([O-])=O.[O-]P([O-])([O-])=O VLCINIKIVYNLPT-UHFFFAOYSA-J 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000037230 mobility Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/24—Phosphorous; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/26—Aluminium; Compounds thereof
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB51285/68A GB1277586A (en) | 1968-10-29 | 1968-10-29 | Toothpastes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131406B true NO131406B (fi) | 1975-02-17 |
| NO131406C NO131406C (fi) | 1975-05-28 |
Family
ID=10459407
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO4275/69A NO131406C (fi) | 1968-10-29 | 1969-10-28 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3662060A (fi) |
| AT (1) | AT308972B (fi) |
| BE (1) | BE740987A (fi) |
| BR (2) | BR6913666D0 (fi) |
| CA (1) | CA918568A (fi) |
| CH (1) | CH539430A (fi) |
| DE (1) | DE1953944A1 (fi) |
| DK (1) | DK124012B (fi) |
| ES (1) | ES372905A1 (fi) |
| FI (1) | FI50828C (fi) |
| FR (1) | FR2040957A5 (fi) |
| GB (1) | GB1277586A (fi) |
| IE (1) | IE33630B1 (fi) |
| LU (1) | LU59722A1 (fi) |
| NL (1) | NL6916201A (fi) |
| NO (1) | NO131406C (fi) |
| SE (1) | SE356214C (fi) |
| ZA (1) | ZA697579B (fi) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792760A (fr) * | 1971-12-20 | 1973-06-14 | Unilever Nv | Dentifrices |
| NL7407759A (fi) * | 1973-06-13 | 1974-12-17 | ||
| US4075317A (en) * | 1974-04-29 | 1978-02-21 | Colgate-Palmolive Company | Dental cream composition |
| US4046872A (en) * | 1974-04-29 | 1977-09-06 | Colgate Palmolive Company | Dental cream |
| PH13727A (en) * | 1974-05-30 | 1980-09-09 | Colgate Palmolive Co | Toothpaste |
| US4098878A (en) * | 1974-10-29 | 1978-07-04 | Colgate-Palmolive Company | Toothpaste containing milled alpha-alumina trihydrate |
| GB1475252A (en) * | 1975-01-15 | 1977-06-01 | Colgate Palmolive Co | Toothpaste composition |
| GB1475251A (en) * | 1975-01-15 | 1977-06-01 | Colgate Palmolive Co | Oral preparations |
| US4122164A (en) * | 1975-10-02 | 1978-10-24 | Colgate-Palmolive Company | Dental cream composition |
| US4309409A (en) * | 1975-12-22 | 1982-01-05 | Stauffer Chemical Company | Anti-corrosion formulation for toothpastes |
| US4141969A (en) * | 1977-02-22 | 1979-02-27 | Colgate-Palmolive Company | Dentifrices containing amorphous silica |
| US4118471A (en) * | 1977-06-09 | 1978-10-03 | Colgate-Palmolive Company | Stable dentifrice |
| PH15413A (en) * | 1978-11-01 | 1983-01-07 | Unilever Nv | Improvements in and relating to dentifrices and their preparation |
| JPS5788112A (en) * | 1980-11-20 | 1982-06-01 | Lion Corp | Tooth-paste composition |
| GB2095991B (en) * | 1981-04-07 | 1985-01-03 | Colgate Palmolive Co | Dentifrice preparations containing phytic acid |
| DE3381846D1 (de) * | 1982-10-15 | 1990-10-04 | John A Inskip | Spielzeug/modell-bausystem. |
| IN166518B (fi) * | 1985-08-30 | 1990-05-19 | Colgate Palmolive Co | |
| IN168049B (fi) * | 1986-01-22 | 1991-01-26 | Colgate Palmolive Co | |
| US5041279A (en) * | 1986-02-28 | 1991-08-20 | Colgate-Palmolive Company | Dental cream package |
| GB8803328D0 (en) * | 1988-02-12 | 1988-03-09 | Alcan Int Ltd | Alumina hydrates |
| GB8803329D0 (en) * | 1988-02-12 | 1988-03-09 | Alcan Int Ltd | Alumina hydrates |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2010910A (en) * | 1932-05-04 | 1935-08-13 | Malcolm W Atkins | Dental cleaning and polishing compound |
| US2550207A (en) * | 1949-01-25 | 1951-04-24 | Sterling Drug Inc | Dentifrice compositions |
| DE1014289B (de) * | 1952-10-18 | 1957-08-22 | Colgate Palmolive Co | Mundpflegemittel |
| US2818371A (en) * | 1953-10-26 | 1957-12-31 | Sterling Drug Inc | Fluoride-containing dentifrices |
| US3095356A (en) * | 1956-02-20 | 1963-06-25 | Monsanto Chemicals | Dentifrice comprising insoluble sodium metaphosphate and a cadmium, tin, zinc, manganese or iron compound to inhibit calcium ion sequestering |
| US3060098A (en) * | 1957-11-18 | 1962-10-23 | Lever Brothers Ltd | Dentifrice |
-
1968
- 1968-10-29 GB GB51285/68A patent/GB1277586A/en not_active Expired
-
1969
- 1969-10-14 US US866397A patent/US3662060A/en not_active Expired - Lifetime
- 1969-10-22 CH CH1578169A patent/CH539430A/de not_active IP Right Cessation
- 1969-10-22 SE SE6914489A patent/SE356214C/xx unknown
- 1969-10-24 IE IE1449/69A patent/IE33630B1/xx unknown
- 1969-10-27 BR BR213666/69A patent/BR6913666D0/pt unknown
- 1969-10-27 BR BR213667/69A patent/BR6913667D0/pt unknown
- 1969-10-27 AT AT1009369A patent/AT308972B/de active
- 1969-10-27 NL NL6916201A patent/NL6916201A/xx unknown
- 1969-10-27 ES ES372905A patent/ES372905A1/es not_active Expired
- 1969-10-27 FI FI693078A patent/FI50828C/fi active
- 1969-10-27 DE DE19691953944 patent/DE1953944A1/de active Granted
- 1969-10-27 CA CA065893A patent/CA918568A/en not_active Expired
- 1969-10-27 DK DK568169AA patent/DK124012B/da unknown
- 1969-10-28 NO NO4275/69A patent/NO131406C/no unknown
- 1969-10-28 ZA ZA697579*A patent/ZA697579B/xx unknown
- 1969-10-28 FR FR6937006A patent/FR2040957A5/fr not_active Expired
- 1969-10-29 BE BE740987D patent/BE740987A/xx not_active IP Right Cessation
- 1969-10-29 LU LU59722D patent/LU59722A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| LU59722A1 (fi) | 1970-05-04 |
| FR2040957A5 (fi) | 1971-01-22 |
| NO131406C (fi) | 1975-05-28 |
| IE33630L (en) | 1970-04-29 |
| GB1277586A (en) | 1972-06-14 |
| SE356214B (fi) | 1973-05-21 |
| BR6913667D0 (pt) | 1973-03-20 |
| US3662060A (en) | 1972-05-09 |
| ZA697579B (en) | 1971-06-30 |
| FI50828C (fi) | 1976-08-10 |
| CA918568A (en) | 1973-01-09 |
| ES372905A1 (es) | 1972-08-01 |
| SE356214C (sv) | 1980-10-13 |
| BR6913666D0 (pt) | 1973-03-20 |
| BE740987A (fi) | 1970-04-29 |
| IE33630B1 (en) | 1974-09-04 |
| NL6916201A (fi) | 1970-05-04 |
| FI50828B (fi) | 1976-04-30 |
| DK124012B (da) | 1972-09-04 |
| DE1953944C2 (fi) | 1987-08-06 |
| CH539430A (de) | 1973-07-31 |
| AT308972B (de) | 1973-07-25 |
| DE1953944A1 (de) | 1970-05-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO131406B (fi) | ||
| NO131407B (fi) | ||
| US7294285B2 (en) | Deicer and pre-wetting agent | |
| CA1102702A (en) | Fluoride toothpaste with alkaline earth metal contained in an unlined aluminum tube | |
| US3960576A (en) | Silicate-based corrosion inhibitor | |
| US3656889A (en) | Stable aqueous sodium aluminate solutions | |
| US4280822A (en) | Method for production of abrasive composition for use in toothpaste | |
| US4034076A (en) | Process for making toothpaste | |
| US2668771A (en) | Stable curing salt composition and manufacture thereof | |
| US3338829A (en) | Corrosion-inhibited ammonium orthophosphate solutions and compositions useful for manufacturing them | |
| US3364149A (en) | Corrosion-inhibited phosphate solutions and compositions useful for manufacturing them | |
| US3058917A (en) | Liquid dishwashing detergent | |
| US3792152A (en) | Stabilized phosphate and dentifrice compositions and process for producing same | |
| JP2848672B2 (ja) | 高温水系腐食抑制剤 | |
| US4248860A (en) | Dentifrices and their preparation | |
| NO136279B (fi) | ||
| JPH0481594B2 (fi) | ||
| US3981988A (en) | Dentifrice including a lustre imparting agent | |
| JPH03151319A (ja) | 新規歯磨組成物 | |
| DK145842B (da) | Tandpasta indeholdende slibende partikler af formalet alfa-aluminiumoxidtrihydrat og alkalimetalmonofluorphosphat | |
| GB1353748A (en) | Composition for addition to a central heating system or other closed circuit water system | |
| US2104528A (en) | Method of protecting steam boilers against caustic embrittlement | |
| GB1347140A (en) | Sodium tripolyphosphate | |
| JPS5850963B2 (ja) | 練歯磨組成物 | |
| US1400395A (en) | Composition of matter |