NO131167B - - Google Patents
Download PDFInfo
- Publication number
- NO131167B NO131167B NO1401/70A NO140170A NO131167B NO 131167 B NO131167 B NO 131167B NO 1401/70 A NO1401/70 A NO 1401/70A NO 140170 A NO140170 A NO 140170A NO 131167 B NO131167 B NO 131167B
- Authority
- NO
- Norway
- Prior art keywords
- ammonium nitrate
- solution
- nitric acid
- ammonia
- column
- Prior art date
Links
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 claims description 46
- 239000000243 solution Substances 0.000 claims description 41
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 39
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 38
- 229960001730 nitrous oxide Drugs 0.000 claims description 23
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 20
- 229910017604 nitric acid Inorganic materials 0.000 claims description 20
- 229910021529 ammonia Inorganic materials 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 235000013842 nitrous oxide Nutrition 0.000 claims description 11
- 229910021645 metal ion Inorganic materials 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 230000015572 biosynthetic process Effects 0.000 claims description 9
- 239000007864 aqueous solution Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 4
- 229910052684 Cerium Inorganic materials 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 229910052797 bismuth Inorganic materials 0.000 claims description 2
- 239000012295 chemical reaction liquid Substances 0.000 claims description 2
- -1 chlorine ions Chemical class 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 claims 1
- 238000003776 cleavage reaction Methods 0.000 description 17
- 230000007017 scission Effects 0.000 description 16
- 239000007789 gas Substances 0.000 description 13
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 12
- 239000001272 nitrous oxide Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 238000007792 addition Methods 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000000630 rising effect Effects 0.000 description 3
- 239000004157 Nitrosyl chloride Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 2
- 235000019392 nitrosyl chloride Nutrition 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- AOFSUBOXJFKGAZ-UHFFFAOYSA-O azanium nitric acid nitrate Chemical compound [NH4+].O[N+]([O-])=O.[O-][N+]([O-])=O AOFSUBOXJFKGAZ-UHFFFAOYSA-O 0.000 description 1
- 229910001451 bismuth ion Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- UFMZWBIQTDUYBN-UHFFFAOYSA-N cobalt dinitrate Chemical compound [Co+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O UFMZWBIQTDUYBN-UHFFFAOYSA-N 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- 229910001981 cobalt nitrate Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 229910001453 nickel ion Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/20—Nitrogen oxides; Oxyacids of nitrogen; Salts thereof
- C01B21/22—Nitrous oxide (N2O)
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Inorganic Chemistry (AREA)
- Catalysts (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1921181A DE1921181C3 (de) | 1969-04-25 | 1969-04-25 | Verfahren zur Herstellung von Distickstoffmonoxid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO131167B true NO131167B (enFirst) | 1975-01-06 |
| NO131167C NO131167C (enFirst) | 1975-04-16 |
Family
ID=5732381
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1401/70A NO131167C (enFirst) | 1969-04-25 | 1970-04-14 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3656899A (enFirst) |
| AT (1) | AT298516B (enFirst) |
| BE (1) | BE749596A (enFirst) |
| CA (1) | CA917885A (enFirst) |
| CH (1) | CH532531A (enFirst) |
| DE (1) | DE1921181C3 (enFirst) |
| DK (1) | DK132698C (enFirst) |
| ES (1) | ES378984A1 (enFirst) |
| FI (1) | FI50514C (enFirst) |
| FR (1) | FR2040243A1 (enFirst) |
| GB (1) | GB1299479A (enFirst) |
| IE (1) | IE33761B1 (enFirst) |
| NL (1) | NL166238C (enFirst) |
| NO (1) | NO131167C (enFirst) |
| RO (1) | RO63610A (enFirst) |
| SE (1) | SE362235B (enFirst) |
| ZA (1) | ZA702099B (enFirst) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4102986A (en) * | 1975-01-22 | 1978-07-25 | South African Inventions Development Corporation | Process for the continuous manufacture of nitrous oxide |
| DE2617968C3 (de) * | 1976-04-24 | 1980-05-22 | Kernforschungsanlage Juelich Gmbh, 5170 Juelich | Verfahren zur Aufarbeitung von bei der Herstellung von Brenn- und/oder Brutstoffen für Kernreaktoren anfallender Ammoniumnitratlösung |
| HU173939B (hu) * | 1976-12-30 | 1979-09-28 | Eotvos Lorand Tudomanyegyetem | Sposob poluchenija zakisi azota |
| DE10133067A1 (de) * | 2001-07-07 | 2003-01-16 | Phenolchemie Gmbh & Co Kg | Verfahren zur Hydroxylierung aromatischer Kohlenwasserstoffe |
| DE10344594A1 (de) * | 2003-09-25 | 2005-05-12 | Basf Ag | Verfahren zur Herstellung von Cyclododecanon |
| DE10344595A1 (de) * | 2003-09-25 | 2005-05-12 | Basf Ag | Verfahren zur Herstellung eines Ketons |
| DE102004046171A1 (de) | 2004-09-23 | 2006-04-13 | Basf Ag | Verfahren zur Herstellung von Cyclopentanon |
| DE102004046167A1 (de) * | 2004-09-23 | 2006-04-06 | Basf Ag | Verfahren zur Reinigung und Aufkonzentrierung von Distickstoffmonoxid |
| DE102005055588A1 (de) * | 2005-11-22 | 2007-05-24 | Basf Ag | Verfahren zur Isolierung von N2O |
| KR101435232B1 (ko) * | 2006-12-11 | 2014-08-28 | 바스프 에스이 | N2o의 분리 방법 |
| UA99192C2 (ru) * | 2008-04-02 | 2012-07-25 | Басф Се | Способ очистки монооксида азота |
| KR101579997B1 (ko) * | 2008-04-02 | 2015-12-23 | 바스프 에스이 | N20의 정제 방법 |
| WO2010054988A2 (en) * | 2008-11-11 | 2010-05-20 | Basf Se | Process for preparing cyclic diamines |
| DE102009000075A1 (de) * | 2009-01-08 | 2010-07-15 | Robert Bosch Gmbh | Verfahren zur Gewinnung von Distickstoffoxid |
| ES2424002T3 (es) | 2009-08-21 | 2013-09-26 | Basf Se | Método para la producción de ácido 4-pentenoico |
| DE102010031075A1 (de) * | 2010-07-07 | 2012-01-12 | Robert Bosch Gmbh | Verfahren zur Gewinnung von Distickstoffmonooxid (N2O) |
| DE102014212602A1 (de) | 2013-07-02 | 2015-01-08 | Basf Se | Verfahren zur Herstellung eines Ketons aus einem Olefin |
| CN112138615B (zh) * | 2020-10-14 | 2024-10-25 | 北京万机汇机电工程技术有限公司 | 一种氧化亚氮的制备装置及方法 |
| WO2024033126A1 (en) | 2022-08-11 | 2024-02-15 | Basf Se | A process for the explosion-proof storage of nitrous oxide |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1315674A (en) * | 1919-09-09 | Process q f producing ammonium nictate | ||
| CA534248A (en) * | 1956-12-11 | E. Winter Eric | Decomposition of ammonium nitrate | |
| US19953A (en) * | 1858-04-13 | Improvement in seed-planters | ||
| DE506542C (de) * | 1928-04-27 | 1930-09-05 | Walter Friederich Dr | Herstellung von Stickoxydul aus Ammoniumnitrat |
-
1969
- 1969-04-25 DE DE1921181A patent/DE1921181C3/de not_active Expired
-
1970
- 1970-03-24 IE IE372/70A patent/IE33761B1/xx unknown
- 1970-03-25 FI FI700866A patent/FI50514C/fi active
- 1970-03-26 ZA ZA702099A patent/ZA702099B/xx unknown
- 1970-03-27 US US23305A patent/US3656899A/en not_active Expired - Lifetime
- 1970-04-07 RO RO7000063019A patent/RO63610A/ro unknown
- 1970-04-14 NO NO1401/70A patent/NO131167C/no unknown
- 1970-04-15 NL NL7005416.A patent/NL166238C/xx not_active IP Right Cessation
- 1970-04-21 CH CH593270A patent/CH532531A/de not_active IP Right Cessation
- 1970-04-23 DK DK209670A patent/DK132698C/da not_active IP Right Cessation
- 1970-04-23 AT AT372670A patent/AT298516B/de not_active IP Right Cessation
- 1970-04-23 ES ES378984A patent/ES378984A1/es not_active Expired
- 1970-04-24 CA CA081022A patent/CA917885A/en not_active Expired
- 1970-04-24 GB GB09834/70A patent/GB1299479A/en not_active Expired
- 1970-04-24 SE SE05743/70A patent/SE362235B/xx unknown
- 1970-04-27 BE BE749596D patent/BE749596A/xx not_active IP Right Cessation
- 1970-04-27 FR FR7015260A patent/FR2040243A1/fr active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL166238B (nl) | 1981-02-16 |
| DE1921181A1 (de) | 1970-11-19 |
| IE33761L (en) | 1970-10-25 |
| CA917885A (en) | 1973-01-02 |
| FI50514B (enFirst) | 1975-12-31 |
| DK132698B (da) | 1976-01-26 |
| NO131167C (enFirst) | 1975-04-16 |
| CH532531A (de) | 1973-01-15 |
| DE1921181C3 (de) | 1976-01-08 |
| ES378984A1 (es) | 1972-08-01 |
| NL7005416A (enFirst) | 1970-10-27 |
| SE362235B (enFirst) | 1973-12-03 |
| DK132698C (da) | 1976-06-28 |
| IE33761B1 (en) | 1974-10-16 |
| DE1921181B2 (de) | 1975-05-28 |
| GB1299479A (en) | 1972-12-13 |
| BE749596A (fr) | 1970-10-27 |
| FR2040243A1 (enFirst) | 1971-01-22 |
| AT298516B (de) | 1972-05-10 |
| ZA702099B (en) | 1971-01-27 |
| FI50514C (fi) | 1976-04-12 |
| NL166238C (nl) | 1981-07-15 |
| US3656899A (en) | 1972-04-18 |
| RO63610A (fr) | 1978-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO131167B (enFirst) | ||
| NO168635B (no) | Lastepall | |
| US3922314A (en) | Process for the preparation of ethylene glycol | |
| KR920008519B1 (ko) | 염화제1철로부터의 염화제2철의 제조방법 | |
| US3197515A (en) | Process for preparing dichlorethylene and mixtures thereof with vinylidene chloride | |
| US3489515A (en) | Production of high percentage nitric oxide | |
| US2419019A (en) | Continuous process for oxidizing carbohydrates to tartaric acid | |
| US4276277A (en) | Manufacture of concentrated nitric acid | |
| US4018873A (en) | Processes for the preparation of concentrated nitric acid | |
| US3131028A (en) | Catalytic oxidation reaction of a hydrogen halide to produce the corresponding halogen in a single stage, homogeneous, vapor phase using no as a catalyst | |
| US4081518A (en) | Gaseous product stream | |
| DE1956905C3 (de) | Kreislaufverfahren zur Herstellung von Ketoximen | |
| US2797144A (en) | Production of ammonium nitrite solutions | |
| JP4306320B2 (ja) | 炭酸ジアルキルの製造法 | |
| US4102986A (en) | Process for the continuous manufacture of nitrous oxide | |
| US1717951A (en) | Method of producing nitrosyl halide | |
| US4018872A (en) | Process for the production of concentrated nitric acid | |
| US3876752A (en) | Manufacture of strong nitric acid | |
| US3380806A (en) | Reduction of chlorates in caustic soda | |
| US2181559A (en) | Process for producing a nitrate | |
| US3857926A (en) | Production of nickel sulfate | |
| US2765215A (en) | Method of making chlorine dioxide | |
| US2827362A (en) | Preparation of hydroxylamine | |
| Hine et al. | Methylene Derivatives as Intermediates in Polar Reactions. XV. The Decomposition of Dichlorofluoroacetic Acid1 | |
| Haug et al. | Reaction of nitric acid with alkali metal chlorides in fused salt solution |