NO130513B - - Google Patents
Download PDFInfo
- Publication number
- NO130513B NO130513B NO01144/71A NO114471A NO130513B NO 130513 B NO130513 B NO 130513B NO 01144/71 A NO01144/71 A NO 01144/71A NO 114471 A NO114471 A NO 114471A NO 130513 B NO130513 B NO 130513B
- Authority
- NO
- Norway
- Prior art keywords
- bis
- fluorene
- mixture
- compound
- acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 19
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000007818 Grignard reagent Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 150000004795 grignard reagents Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 claims 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 1
- 150000002825 nitriles Chemical class 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 54
- 239000000203 mixture Substances 0.000 description 51
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 47
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 44
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- 239000000047 product Substances 0.000 description 34
- 238000006243 chemical reaction Methods 0.000 description 24
- -1 methylene, 1,2-ethylene Chemical group 0.000 description 24
- 239000007787 solid Substances 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 17
- 239000000243 solution Substances 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 13
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 241000700605 Viruses Species 0.000 description 11
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 9
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- 229910052731 fluorine Inorganic materials 0.000 description 8
- 239000011737 fluorine Substances 0.000 description 8
- AAOVCKJZAXIUSW-UHFFFAOYSA-N 5-chloro-1-[7-(5-chloropentanoyl)-9h-fluoren-2-yl]pentan-1-one Chemical compound ClCCCCC(=O)C1=CC=C2C3=CC=C(C(=O)CCCCCl)C=C3CC2=C1 AAOVCKJZAXIUSW-UHFFFAOYSA-N 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 7
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 6
- 229940125904 compound 1 Drugs 0.000 description 6
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 6
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 6
- 230000000069 prophylactic effect Effects 0.000 description 6
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000007920 subcutaneous administration Methods 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- ABGXADJDTPFFSZ-UHFFFAOYSA-N 4-benzylpiperidine Chemical compound C=1C=CC=CC=1CC1CCNCC1 ABGXADJDTPFFSZ-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- CHXBGIFCBBODIH-UHFFFAOYSA-N 2-chloro-1-[7-(2-chloroacetyl)-9h-fluoren-2-yl]ethanone Chemical compound ClCC(=O)C1=CC=C2C3=CC=C(C(=O)CCl)C=C3CC2=C1 CHXBGIFCBBODIH-UHFFFAOYSA-N 0.000 description 3
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 3
- LUVLHVJJTLGAFU-UHFFFAOYSA-N 5-(diethylamino)-1-[7-[5-(diethylamino)pentanoyl]-9h-fluoren-2-yl]pentan-1-one Chemical compound CCN(CC)CCCCC(=O)C1=CC=C2C3=CC=C(C(=O)CCCCN(CC)CC)C=C3CC2=C1 LUVLHVJJTLGAFU-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000005576 amination reaction Methods 0.000 description 3
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- WXUAQHNMJWJLTG-UHFFFAOYSA-N 2-methylbutanedioic acid Chemical compound OC(=O)C(C)CC(O)=O WXUAQHNMJWJLTG-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- UTBULQCHEUWJNV-UHFFFAOYSA-N 4-phenylpiperidine Chemical compound C1CNCCC1C1=CC=CC=C1 UTBULQCHEUWJNV-UHFFFAOYSA-N 0.000 description 2
- DZZNWQDCOZGSMJ-UHFFFAOYSA-N 5-(dimethylamino)-1-[7-[5-(dimethylamino)pentanoyl]-9h-fluoren-2-yl]pentan-1-one Chemical compound CN(C)CCCCC(=O)C1=CC=C2C3=CC=C(C(=O)CCCCN(C)C)C=C3CC2=C1 DZZNWQDCOZGSMJ-UHFFFAOYSA-N 0.000 description 2
- SVNNWKWHLOJLOK-UHFFFAOYSA-N 5-chloropentanoyl chloride Chemical compound ClCCCCC(Cl)=O SVNNWKWHLOJLOK-UHFFFAOYSA-N 0.000 description 2
- NWMUOIQADGDNAM-UHFFFAOYSA-N 5-piperidin-1-yl-1-[7-(5-piperidin-1-ylpentanoyl)-9h-fluoren-2-yl]pentan-1-one Chemical compound C=1C=C(C2=CC=C(C=C2C2)C(=O)CCCCN3CCCCC3)C2=CC=1C(=O)CCCCN1CCCCC1 NWMUOIQADGDNAM-UHFFFAOYSA-N 0.000 description 2
- DYTTXNQQICAXDN-UHFFFAOYSA-N 9h-fluorene-1,2-dicarbonitrile Chemical class C1=CC=C2C3=CC=C(C#N)C(C#N)=C3CC2=C1 DYTTXNQQICAXDN-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- YZGQDNOIGFBYKF-UHFFFAOYSA-N Ethoxyacetic acid Chemical compound CCOCC(O)=O YZGQDNOIGFBYKF-UHFFFAOYSA-N 0.000 description 2
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000709664 Picornaviridae Species 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000000840 anti-viral effect Effects 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- IYYZUPMFVPLQIF-UHFFFAOYSA-N dibenzothiophene Chemical compound C1=CC=C2C3=CC=CC=C3SC2=C1 IYYZUPMFVPLQIF-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 150000002220 fluorenes Chemical class 0.000 description 2
- 150000008376 fluorenones Chemical class 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 description 2
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000001717 pathogenic effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- KQTIIICEAUMSDG-UHFFFAOYSA-N tricarballylic acid Chemical compound OC(=O)CC(C(O)=O)CC(O)=O KQTIIICEAUMSDG-UHFFFAOYSA-N 0.000 description 2
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- HDDNBUNZJIQDBQ-UHFFFAOYSA-N 1-(3-chloropropyl)piperidine Chemical compound ClCCCN1CCCCC1 HDDNBUNZJIQDBQ-UHFFFAOYSA-N 0.000 description 1
- RIRYGERFWHUZBT-UHFFFAOYSA-N 1-(7-acetyl-9h-fluoren-2-yl)ethanone Chemical compound CC(=O)C1=CC=C2C3=CC=C(C(=O)C)C=C3CC2=C1 RIRYGERFWHUZBT-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- KLOVTNJEJHKJLJ-UHFFFAOYSA-N 2,7-bis[4-(diethylamino)butanoyl]fluoren-9-one;dihydrochloride Chemical compound Cl.Cl.C1=C(C(=O)CCCN(CC)CC)C=C2C(=O)C3=CC(C(=O)CCCN(CC)CC)=CC=C3C2=C1 KLOVTNJEJHKJLJ-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-L 2-(carboxymethyl)-2-hydroxysuccinate Chemical compound [O-]C(=O)CC(O)(C(=O)O)CC([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-L 0.000 description 1
- ZBWLEOLVPZGHOJ-UHFFFAOYSA-N 2-(diethylamino)-1-[7-[2-(diethylamino)acetyl]-9h-fluoren-2-yl]ethanone Chemical compound CCN(CC)CC(=O)C1=CC=C2C3=CC=C(C(=O)CN(CC)CC)C=C3CC2=C1 ZBWLEOLVPZGHOJ-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- AQYCMVICBNBXNA-UHFFFAOYSA-N 2-methylglutaric acid Chemical compound OC(=O)C(C)CCC(O)=O AQYCMVICBNBXNA-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- INUNLMUAPJVRME-UHFFFAOYSA-N 3-chloropropanoyl chloride Chemical compound ClCCC(Cl)=O INUNLMUAPJVRME-UHFFFAOYSA-N 0.000 description 1
- JEGMWWXJUXDNJN-UHFFFAOYSA-N 3-methylpiperidine Chemical compound CC1CCCNC1 JEGMWWXJUXDNJN-UHFFFAOYSA-N 0.000 description 1
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 1
- VDULZBPMPRKRHA-UHFFFAOYSA-N 4-chloro-1-[7-(4-chlorobutanoyl)-9h-fluoren-2-yl]butan-1-one Chemical compound ClCCCC(=O)C1=CC=C2C3=CC=C(C(=O)CCCCl)C=C3CC2=C1 VDULZBPMPRKRHA-UHFFFAOYSA-N 0.000 description 1
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 1
- OMTWXOVWWYXETQ-UHFFFAOYSA-N 4-morpholin-4-yl-1-[7-(4-morpholin-4-ylbutanoyl)-9h-fluoren-2-yl]butan-1-one Chemical compound C=1C=C(C2=CC=C(C=C2C2)C(=O)CCCN3CCOCC3)C2=CC=1C(=O)CCCN1CCOCC1 OMTWXOVWWYXETQ-UHFFFAOYSA-N 0.000 description 1
- KQKCWHPANDHXPN-UHFFFAOYSA-N 4-piperidin-1-yl-1-[7-(4-piperidin-1-ylbutanoyl)-9h-fluoren-2-yl]butan-1-one Chemical compound C=1C=C(C2=CC=C(C=C2C2)C(=O)CCCN3CCCCC3)C2=CC=1C(=O)CCCN1CCCCC1 KQKCWHPANDHXPN-UHFFFAOYSA-N 0.000 description 1
- HDBVBFCLDARZFP-UHFFFAOYSA-N 4-piperidin-1-yl-1-[7-(4-piperidin-1-ylbutanoyl)-9h-fluoren-2-yl]butan-1-one;dihydrochloride Chemical compound Cl.Cl.C=1C=C(C2=CC=C(C=C2C2)C(=O)CCCN3CCCCC3)C2=CC=1C(=O)CCCN1CCCCC1 HDBVBFCLDARZFP-UHFFFAOYSA-N 0.000 description 1
- HAKKTZOUPCDMCN-UHFFFAOYSA-N 4-tert-butylpiperidine Chemical compound CC(C)(C)C1CCNCC1 HAKKTZOUPCDMCN-UHFFFAOYSA-N 0.000 description 1
- MQGGQYFSTPHDTK-UHFFFAOYSA-N 5-(4-benzylpiperidin-1-yl)-1-[7-[5-(4-benzylpiperidin-1-yl)pentanoyl]-9h-fluoren-2-yl]pentan-1-one Chemical compound C=1C=C(C2=CC=C(C=C2C2)C(=O)CCCCN3CCC(CC=4C=CC=CC=4)CC3)C2=CC=1C(=O)CCCCN(CC1)CCC1CC1=CC=CC=C1 MQGGQYFSTPHDTK-UHFFFAOYSA-N 0.000 description 1
- ANMRXTBDWRDPOA-UHFFFAOYSA-N 5-(4-methylpiperidin-1-yl)-1-[7-[5-(4-methylpiperidin-1-yl)pentanoyl]-9h-fluoren-2-yl]pentan-1-one Chemical compound C1CC(C)CCN1CCCCC(=O)C1=CC=C2C3=CC=C(C(=O)CCCCN4CCC(C)CC4)C=C3CC2=C1 ANMRXTBDWRDPOA-UHFFFAOYSA-N 0.000 description 1
- KBOGMBQWZCIHNQ-UHFFFAOYSA-N 5-chloro-3-methylpentanoyl chloride Chemical compound ClCCC(C)CC(Cl)=O KBOGMBQWZCIHNQ-UHFFFAOYSA-N 0.000 description 1
- OFOCHMIQWVHCGE-UHFFFAOYSA-N 5-chloro-4-methylpentanoyl chloride Chemical compound ClCC(C)CCC(Cl)=O OFOCHMIQWVHCGE-UHFFFAOYSA-N 0.000 description 1
- HQADYDJEZQUGEO-UHFFFAOYSA-N 5-morpholin-4-yl-1-[7-(5-morpholin-4-ylpentanoyl)-9h-fluoren-2-yl]pentan-1-one Chemical compound C=1C=C(C2=CC=C(C=C2C2)C(=O)CCCCN3CCOCC3)C2=CC=1C(=O)CCCCN1CCOCC1 HQADYDJEZQUGEO-UHFFFAOYSA-N 0.000 description 1
- ACQBHUKTPLFEOO-UHFFFAOYSA-N 9h-fluorene-1,7-dicarboxylic acid Chemical compound C1=CC=C(C(O)=O)C2=C1C1=CC=C(C(=O)O)C=C1C2 ACQBHUKTPLFEOO-UHFFFAOYSA-N 0.000 description 1
- RRLKPKUPGAXIQP-UHFFFAOYSA-N 9h-fluorene-2,5-diamine Chemical compound C1=CC(N)=C2C3=CC=C(N)C=C3CC2=C1 RRLKPKUPGAXIQP-UHFFFAOYSA-N 0.000 description 1
- DMDQSLWRPKWVOF-UHFFFAOYSA-N 9h-fluorene-2,6-dicarbonitrile Chemical compound C1=C(C#N)C=C2C3=CC=C(C#N)C=C3CC2=C1 DMDQSLWRPKWVOF-UHFFFAOYSA-N 0.000 description 1
- PWWQYQSISHEEAQ-UHFFFAOYSA-N 9h-fluorene-2,7-dicarbonitrile Chemical compound N#CC1=CC=C2C3=CC=C(C#N)C=C3CC2=C1 PWWQYQSISHEEAQ-UHFFFAOYSA-N 0.000 description 1
- QYIJUDGYEWXMNG-UHFFFAOYSA-N 9h-fluorene-3,6-dicarbonitrile Chemical compound C1=C(C#N)C=C2C3=CC(C#N)=CC=C3CC2=C1 QYIJUDGYEWXMNG-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- TXCDCPKCNAJMEE-UHFFFAOYSA-N Dibenzofuran Natural products C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 description 1
- 241000710188 Encephalomyocarditis virus Species 0.000 description 1
- 238000005967 Finkelstein reaction Methods 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 208000009889 Herpes Simplex Diseases 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 101100463797 Rattus norvegicus Pgrmc1 gene Proteins 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010046865 Vaccinia virus infection Diseases 0.000 description 1
- 241000711975 Vesicular stomatitis virus Species 0.000 description 1
- OQCDKGPJPMOXAL-UHFFFAOYSA-M [Cl-].[Mg+]CCCN1CCCCC1 Chemical compound [Cl-].[Mg+]CCCN1CCCCC1 OQCDKGPJPMOXAL-UHFFFAOYSA-M 0.000 description 1
- FFBACHVDAUIAIO-UHFFFAOYSA-N [F].Cl.Cl Chemical compound [F].Cl.Cl FFBACHVDAUIAIO-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- AFMVESZOYKHDBJ-UHFFFAOYSA-N fluoren-9-ol Chemical compound C1=CC=C2C(O)C3=CC=CC=C3C2=C1 AFMVESZOYKHDBJ-UHFFFAOYSA-N 0.000 description 1
- 150000002221 fluorine Chemical class 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical class O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000010952 in-situ formation Methods 0.000 description 1
- 206010022000 influenza Diseases 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-N methoxyacetic acid Chemical compound COCC(O)=O RMIODHQZRUFFFF-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 208000007089 vaccinia Diseases 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/10—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms
- C07D295/104—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/108—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/813—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/06—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members
- C07C2603/10—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings
- C07C2603/12—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings only one five-membered ring
- C07C2603/18—Fluorenes; Hydrogenated fluorenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2346870A | 1970-03-27 | 1970-03-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO130513B true NO130513B (OSRAM) | 1974-09-16 |
| NO130513C NO130513C (OSRAM) | 1974-12-27 |
Family
ID=21815282
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1144/71A NO130513C (OSRAM) | 1970-03-27 | 1971-03-26 |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4064347A (OSRAM) |
| JP (1) | JPS5429488B1 (OSRAM) |
| AT (1) | AT304515B (OSRAM) |
| BE (1) | BE764870A (OSRAM) |
| CA (1) | CA959488A (OSRAM) |
| CH (2) | CH569694A5 (OSRAM) |
| CS (1) | CS179369B2 (OSRAM) |
| DE (1) | DE2114461A1 (OSRAM) |
| ES (1) | ES389604A1 (OSRAM) |
| FR (1) | FR2085747B1 (OSRAM) |
| GB (1) | GB1286775A (OSRAM) |
| HU (1) | HU162836B (OSRAM) |
| IE (1) | IE35023B1 (OSRAM) |
| IL (1) | IL36423A (OSRAM) |
| NL (1) | NL7104096A (OSRAM) |
| NO (1) | NO130513C (OSRAM) |
| PH (1) | PH9308A (OSRAM) |
| SE (1) | SE374540B (OSRAM) |
| ZA (1) | ZA711333B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3859286A (en) * | 1970-12-11 | 1975-01-07 | Richardson Merrell Inc | Bis-basic ketones of xanthene and xanthen-9-one |
| US4048230A (en) * | 1972-12-21 | 1977-09-13 | Richardson-Merrell Inc. | Aminoacetyl-acenaphthenes |
| US3983124A (en) | 1972-12-21 | 1976-09-28 | Richardson-Merrell Inc. | Fluorene compounds |
| US4108896A (en) * | 1972-12-21 | 1978-08-22 | Richardson-Merrell Inc. | Anthracene derivatives |
| US4461899A (en) * | 1982-05-24 | 1984-07-24 | Diamond Shamrock Chemicals Company | Fluorenecarboxylic acid derivatives |
| US6004959A (en) * | 1996-05-30 | 1999-12-21 | Hoechst Marion Roussel, Inc. | Alkyloxyamino substituted fluorenones and their use as protein kinase-C inhibitors |
| KR101215660B1 (ko) | 2004-04-14 | 2012-12-26 | 메르크 파텐트 게엠베하 | 다이벤조퓨란 유도체, 다이벤조티오펜 유도체 및 플루오렌유도체 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB286688A (en) | 1927-03-09 | 1929-05-16 | Schering Kahlbaum Ag | Process for the manufacture of new di-halogen-acylated diphenylethers and of highly active therapeutic substances therefrom |
| US2840558A (en) * | 1954-06-30 | 1958-06-24 | Shell Dev | Mannich bases of aromatic polyketones |
| US2783216A (en) * | 1954-06-30 | 1957-02-26 | Shell Dev | Resinous products from mannich bases of aromatic polyketones with hydrogen sulfide andor polythiols |
| NL132583C (OSRAM) * | 1960-11-09 | 1971-10-15 | ||
| US3083201A (en) * | 1961-02-13 | 1963-03-26 | Smith Kline French Lab | Glyoxal derivatives of dibenzofuran and dibenzothiophene |
| US3251733A (en) * | 1961-06-07 | 1966-05-17 | Geigy Chem Corp | Antimicrobic compositions and process for protection of organic materials therewith |
| US3576865A (en) * | 1968-10-11 | 1971-04-27 | Richardson Merrell Inc | Fluorenone-,fluorenol-,and fluorenebis-basic carboxamides |
-
1971
- 1971-03-02 ZA ZA711333A patent/ZA711333B/xx unknown
- 1971-03-12 CA CA107,591A patent/CA959488A/en not_active Expired
- 1971-03-16 IL IL36423A patent/IL36423A/xx unknown
- 1971-03-18 IE IE342/71A patent/IE35023B1/xx unknown
- 1971-03-18 HU HUME1343A patent/HU162836B/hu unknown
- 1971-03-19 PH PH12305*UA patent/PH9308A/en unknown
- 1971-03-22 AT AT245171A patent/AT304515B/de not_active IP Right Cessation
- 1971-03-23 JP JP1622271A patent/JPS5429488B1/ja active Pending
- 1971-03-24 CH CH277675A patent/CH569694A5/xx not_active IP Right Cessation
- 1971-03-24 CH CH427971A patent/CH564518A5/xx not_active IP Right Cessation
- 1971-03-24 CS CS7100002147A patent/CS179369B2/cs unknown
- 1971-03-25 SE SE7103925A patent/SE374540B/xx unknown
- 1971-03-25 DE DE19712114461 patent/DE2114461A1/de not_active Withdrawn
- 1971-03-25 FR FR7110659A patent/FR2085747B1/fr not_active Expired
- 1971-03-26 NO NO1144/71A patent/NO130513C/no unknown
- 1971-03-26 ES ES389604A patent/ES389604A1/es not_active Expired
- 1971-03-26 NL NL7104096A patent/NL7104096A/xx unknown
- 1971-03-26 BE BE764870A patent/BE764870A/xx not_active IP Right Cessation
- 1971-04-19 GB GB24584/71A patent/GB1286775A/en not_active Expired
-
1973
- 1973-02-02 US US05/328,912 patent/US4064347A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH569694A5 (OSRAM) | 1975-11-28 |
| FR2085747B1 (OSRAM) | 1975-08-01 |
| AT304515B (de) | 1973-01-10 |
| JPS5429488B1 (OSRAM) | 1979-09-25 |
| IE35023L (en) | 1971-09-27 |
| CA959488A (en) | 1974-12-17 |
| DE2114461A1 (de) | 1971-10-14 |
| SE374540B (OSRAM) | 1975-03-10 |
| ZA711333B (en) | 1971-11-24 |
| HU162836B (OSRAM) | 1973-04-28 |
| NL7104096A (OSRAM) | 1971-09-29 |
| CS179369B2 (en) | 1977-10-31 |
| CH564518A5 (OSRAM) | 1975-07-31 |
| PH9308A (en) | 1975-08-18 |
| IE35023B1 (en) | 1975-10-15 |
| GB1286775A (en) | 1972-08-23 |
| IL36423A0 (en) | 1971-05-26 |
| IL36423A (en) | 1974-05-16 |
| NO130513C (OSRAM) | 1974-12-27 |
| BE764870A (fr) | 1971-08-16 |
| ES389604A1 (es) | 1973-06-16 |
| FR2085747A1 (OSRAM) | 1971-12-31 |
| US4064347A (en) | 1977-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3014911A (en) | Derivatives of dibenzo[a, e]cycloheptatriene | |
| JPS582936B2 (ja) | 5↓−アロイルピロ−ル酢酸およびその塩類の製法 | |
| EP0300614B1 (en) | Process for the preparation of substituted indolinone derivatives | |
| US3182071A (en) | Acylated indole derivatives | |
| US2996503A (en) | Derivatives of heterocyclic compounds | |
| HK1003226B (en) | Process for the preparation of substituted indolinone derivatives | |
| NO130513B (OSRAM) | ||
| US3322766A (en) | 3-beta-(4-pyridyl) ethyl-2, 3-dihydro-4(1h)-quinazolinones | |
| CA3160699A1 (en) | Process for the preparation of lasmiditan and of a synthesis intermediate | |
| NO327913B1 (no) | Fremgangsmate for fremstilling av 5-(1-piperazinyl)-benzofuran-2-karboksamid ved hjelp av overgangsmetallkatalysert aminering, samt forbindelser som er mellomprodukter i fremgangsmaten | |
| JP2004513943A (ja) | チオキサントン類調製のためのフリーデル−クラフツ法 | |
| US6043371A (en) | Organic compound synthesis | |
| US2894947A (en) | Phenthiazine derivatives | |
| US3551435A (en) | Certain 4-(pyridylmethylene)-3,4-dihydro-1-benzothiepin-5(2h)-ones | |
| US4161599A (en) | Process for the preparation of thieno(2,3-c)- and thieno(3,2-c)pyridines | |
| NO144039B (no) | Analogifremgangsmaate ved fremstilling av nye, terapeutisk virksomme benzofuranderivater | |
| US3487085A (en) | Dihydrothieno benzothiepene | |
| JP2721695B2 (ja) | チオフエン誘導体の製造法および新規なジヒドロチオフエン1―オキシド | |
| NO130514B (OSRAM) | ||
| NO150187B (no) | Kjoeretoeydekk med profilert bane | |
| Blicke et al. | The Preparation of Substituted 3-Piperidones1 | |
| US3287459A (en) | Carbostyrils, coumarines and thiocoumarines | |
| NO131836B (OSRAM) | ||
| CN109776388B (zh) | 一种具有c2季碳中心的吲哚啉衍生物的合成方法 | |
| Jacobson et al. | STUDIES IN TETRAZOLE CHEMISTRY. 1 II. THE SYNTHESIS AND REACTIONS OF 1-PHENYL-5-ACETYLTETRAZOLE2 |