NO125978B - - Google Patents
Download PDFInfo
- Publication number
- NO125978B NO125978B NO365268A NO365268A NO125978B NO 125978 B NO125978 B NO 125978B NO 365268 A NO365268 A NO 365268A NO 365268 A NO365268 A NO 365268A NO 125978 B NO125978 B NO 125978B
- Authority
- NO
- Norway
- Prior art keywords
- methyl mercaptan
- sulfur
- reaction
- water
- mixture
- Prior art date
Links
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 122
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 38
- 239000007788 liquid Substances 0.000 claims description 31
- 238000006243 chemical reaction Methods 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 23
- 239000011593 sulfur Substances 0.000 claims description 22
- 229910052717 sulfur Inorganic materials 0.000 claims description 22
- 239000007787 solid Substances 0.000 claims description 20
- 239000000126 substance Substances 0.000 claims description 20
- 229920005610 lignin Polymers 0.000 claims description 19
- 238000004519 manufacturing process Methods 0.000 claims description 15
- 239000000243 solution Substances 0.000 claims description 15
- 239000005864 Sulphur Substances 0.000 claims description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 10
- 238000010411 cooking Methods 0.000 claims description 7
- 239000012670 alkaline solution Substances 0.000 claims description 5
- 229920001021 polysulfide Polymers 0.000 claims description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 4
- 239000005077 polysulfide Substances 0.000 claims description 4
- 150000008117 polysulfides Polymers 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- 150000003568 thioethers Chemical class 0.000 claims description 3
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 claims description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 229920001732 Lignosulfonate Polymers 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 235000019357 lignosulphonate Nutrition 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 6
- 229910021653 sulphate ion Inorganic materials 0.000 description 6
- 239000003513 alkali Substances 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 239000002655 kraft paper Substances 0.000 description 5
- -1 methoxyl groups Chemical group 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 235000011089 carbon dioxide Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 241000609240 Ambelania acida Species 0.000 description 3
- 239000010905 bagasse Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 244000283070 Abies balsamea Species 0.000 description 2
- 235000007173 Abies balsamea Nutrition 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241001564395 Alnus rubra Species 0.000 description 2
- 235000014466 Douglas bleu Nutrition 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241000218683 Pseudotsuga Species 0.000 description 2
- 235000005386 Pseudotsuga menziesii var menziesii Nutrition 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011122 softwood Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 244000271437 Bambusa arundinacea Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZGSDJMADBJCNPN-UHFFFAOYSA-N [S-][NH3+] Chemical compound [S-][NH3+] ZGSDJMADBJCNPN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 235000021028 berry Nutrition 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000000659 freezing mixture Substances 0.000 description 1
- 239000011121 hardwood Substances 0.000 description 1
- 230000003165 hydrotropic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 150000002898 organic sulfur compounds Chemical class 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-N sodium polysulfide Chemical compound [Na+].S HYHCSLBZRBJJCH-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- QUCDWLYKDRVKMI-UHFFFAOYSA-M sodium;3,4-dimethylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1C QUCDWLYKDRVKMI-UHFFFAOYSA-M 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3114568 | 1968-05-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125978B true NO125978B (forum.php) | 1972-12-04 |
Family
ID=12323256
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO365268A NO125978B (forum.php) | 1968-05-09 | 1968-09-16 |
Country Status (8)
| Country | Link |
|---|---|
| BE (1) | BE719767A (forum.php) |
| DE (1) | DE1795150C3 (forum.php) |
| DK (1) | DK123301B (forum.php) |
| FR (1) | FR8201M (forum.php) |
| GB (1) | GB1233938A (forum.php) |
| NL (1) | NL6811750A (forum.php) |
| NO (1) | NO125978B (forum.php) |
| SE (1) | SE333145B (forum.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5114939A (en) * | 1988-01-29 | 1992-05-19 | Dowelanco | Substituted quinolines and cinnolines as fungicides |
| IL89028A0 (en) * | 1988-01-29 | 1989-08-15 | Lilly Co Eli | Quinoline,quinazoline and cinnoline derivatives |
| IL89026A (en) * | 1988-01-29 | 1993-02-21 | Lilly Co Eli | Substituted quinolines and cinnolines, process for their preparation and fungicidal, insecticidal and miticidal compositions containing them |
| IL89029A (en) * | 1988-01-29 | 1993-01-31 | Lilly Co Eli | Fungicidal quinoline and cinnoline derivatives, compositions containing them, and fungicidal methods of using them |
-
1968
- 1968-07-31 DK DK368568A patent/DK123301B/da unknown
- 1968-08-12 SE SE1083268A patent/SE333145B/xx unknown
- 1968-08-16 NL NL6811750A patent/NL6811750A/xx unknown
- 1968-08-16 DE DE19681795150 patent/DE1795150C3/de not_active Expired
- 1968-08-21 BE BE719767D patent/BE719767A/xx unknown
- 1968-08-27 GB GB1233938D patent/GB1233938A/en not_active Expired
- 1968-09-16 NO NO365268A patent/NO125978B/no unknown
- 1968-10-31 FR FR172291A patent/FR8201M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK123301B (da) | 1972-06-05 |
| GB1233938A (forum.php) | 1971-06-03 |
| FR8201M (forum.php) | 1970-09-14 |
| DE1795150A1 (de) | 1972-03-09 |
| DE1795150B2 (de) | 1973-06-07 |
| SE333145B (sv) | 1971-03-08 |
| DE1795150C3 (de) | 1974-01-24 |
| BE719767A (forum.php) | 1969-02-03 |
| NL6811750A (forum.php) | 1969-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20110165643A1 (en) | Separation of Lignin From Hydrolyzate | |
| US2057117A (en) | Process of making vanillin | |
| NO139976B (no) | Legeme sammensatt av minst to deler | |
| NO119964B (forum.php) | ||
| NO162733B (no) | Fremgangsmaate for fremstilling av kokevaeske for kraftmassekoking samt kokevaeske for dette. | |
| US2711430A (en) | Method of improving the yield of methyl sulfide obtained by heating waste liquors fro cellulose manufacture by adding inorganic sulfides | |
| NO125978B (forum.php) | ||
| US2864669A (en) | Method for recovering sulfur and alkali from waste liquors | |
| US3650888A (en) | Pollution controlled polysulfide recovery process | |
| NO772282L (no) | Fremgangsm}te til fremstilling av svovelsyre fra avfallssyre og jernsulfat | |
| US2840614A (en) | Process of making methyl mercaptan | |
| CA1050013A (en) | Polymer made of lignin, and method for making it | |
| US1852264A (en) | Method of dry distilling waste liquors from the soda pulp manufacture | |
| US4735683A (en) | Process for preparation of potassium salts from pulp of lignocellulosic materials | |
| US1838109A (en) | Production of furfural | |
| US2222885A (en) | Utilization of plant wastes | |
| US2816832A (en) | Making dimethyl sulfide from pulp mill spent liquors | |
| NO832783L (no) | Fremgangsmaate for delignifisering av ved og andre lignocelluloseholdige produkter | |
| US3008984A (en) | Manufacture of acids from ligneous materials | |
| USRE24293E (en) | Method of improving the yield of | |
| NO123946B (forum.php) | ||
| US1780842A (en) | Production of sulphite pulp | |
| NO144236B (no) | Veske, saerlig skoleveske. | |
| US2559305A (en) | Manufacture of tanning substances | |
| US2908716A (en) | Preparing organic sulfides |