NO123539B - - Google Patents
Download PDFInfo
- Publication number
- NO123539B NO123539B NO3749/68A NO374968A NO123539B NO 123539 B NO123539 B NO 123539B NO 3749/68 A NO3749/68 A NO 3749/68A NO 374968 A NO374968 A NO 374968A NO 123539 B NO123539 B NO 123539B
- Authority
- NO
- Norway
- Prior art keywords
- alkyl
- alkylated
- alkyl group
- monocarboxylic acid
- acid
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical group NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 150000001555 benzenes Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000012948 isocyanate Substances 0.000 claims description 3
- 150000002513 isocyanates Chemical class 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 230000029936 alkylation Effects 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- -1 5-ethylpiperidine-2-carboxylic acid chloride-hydrochloride Chemical compound 0.000 description 4
- 239000002585 base Substances 0.000 description 3
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 3
- 229940008406 diethyl sulfate Drugs 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical group CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 description 2
- JYWQLXDCNQQXGO-UHFFFAOYSA-N 5-methylpiperidine-2-carboxylic acid Chemical compound CC1CCC(C(O)=O)NC1 JYWQLXDCNQQXGO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- AXAOTHQUPORHQV-UHFFFAOYSA-N 1,5-diethylpiperidine-2-carboxylic acid Chemical compound C(C)N1C(CCC(C1)CC)C(=O)O AXAOTHQUPORHQV-UHFFFAOYSA-N 0.000 description 1
- ULHFFAFDSSHFDA-UHFFFAOYSA-N 1-amino-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1N ULHFFAFDSSHFDA-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- CCXSOWFCDHIWRN-UHFFFAOYSA-N 1-ethyl-5-methylpiperidine-2-carboxylic acid Chemical compound C(C)N1C(CCC(C1)C)C(=O)O CCXSOWFCDHIWRN-UHFFFAOYSA-N 0.000 description 1
- VNSFRNQGPLODIO-UHFFFAOYSA-N 1-ethyl-5-methylpyrrolidine-2-carboxylic acid Chemical compound CCN1C(C)CCC1C(O)=O VNSFRNQGPLODIO-UHFFFAOYSA-N 0.000 description 1
- NEVOZQVGAWLVNT-UHFFFAOYSA-N 1-ethyl-6-methylpiperidine-3-carboxylic acid Chemical compound C(C)N1CC(CCC1C)C(=O)O NEVOZQVGAWLVNT-UHFFFAOYSA-N 0.000 description 1
- CDULGHZNHURECF-UHFFFAOYSA-N 2,3-dimethylaniline 2,4-dimethylaniline 2,5-dimethylaniline 2,6-dimethylaniline 3,4-dimethylaniline 3,5-dimethylaniline Chemical group CC1=CC=C(N)C(C)=C1.CC1=CC=C(C)C(N)=C1.CC1=CC(C)=CC(N)=C1.CC1=CC=C(N)C=C1C.CC1=CC=CC(N)=C1C.CC1=CC=CC(C)=C1N CDULGHZNHURECF-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YQLRKXVEALTVCZ-UHFFFAOYSA-N 2-isocyanato-1,3-dimethylbenzene Chemical compound CC1=CC=CC(C)=C1N=C=O YQLRKXVEALTVCZ-UHFFFAOYSA-N 0.000 description 1
- DZFFQSFNUBWNSF-UHFFFAOYSA-N 3-ethylpyrrolidine Chemical compound CCC1CCNC1 DZFFQSFNUBWNSF-UHFFFAOYSA-N 0.000 description 1
- GBMMTXISGBKPJB-UHFFFAOYSA-N Cl.C(C)C1CCC(NC1)C(=O)O Chemical compound Cl.C(C)C1CCC(NC1)C(=O)O GBMMTXISGBKPJB-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- QSACPWSIIRFHHR-UHFFFAOYSA-N dimethylphenyl isocyanide Natural products CC1=CC=CC(C)=C1C#N QSACPWSIIRFHHR-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/30—Transforming light or analogous information into electric information
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/30—Transforming light or analogous information into electric information
- H04N5/33—Transforming infrared radiation
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Transforming Light Signals Into Electric Signals (AREA)
- Analysing Materials By The Use Of Radiation (AREA)
- Picture Signal Circuits (AREA)
- Measurement Of Radiation (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR122249A FR1545782A (fr) | 1967-09-26 | 1967-09-26 | Dispositif pour tracer les isothermes dans un appareil d'exploration optique au moyen de rayons infrarouges |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO123539B true NO123539B (xx) | 1971-12-06 |
Family
ID=8638973
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO3749/68A NO123539B (xx) | 1967-09-26 | 1968-09-23 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3711642A (xx) |
| AT (1) | AT290165B (xx) |
| BE (1) | BE721336A (xx) |
| DE (1) | DE1762927C3 (xx) |
| DK (1) | DK137259B (xx) |
| ES (1) | ES358462A1 (xx) |
| FR (1) | FR1545782A (xx) |
| GB (1) | GB1224670A (xx) |
| NL (1) | NL6813539A (xx) |
| NO (1) | NO123539B (xx) |
| SE (1) | SE339338B (xx) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4669466A (en) * | 1985-01-16 | 1987-06-02 | Lri L.P. | Method and apparatus for analysis and correction of abnormal refractive errors of the eye |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3005045A (en) * | 1956-02-10 | 1961-10-17 | William J Shanahan | Video quantizing and contour level apparatus |
| DE1039842B (de) * | 1957-08-14 | 1958-09-25 | Rudol Hell Dr Ing | Verfahren zur kuenstlichen Kontraststeigerung an Tonwertspruengen und Konturen in mittels elektronischer Klischier-maschinen herzustellenden Klischees |
| US3354266A (en) * | 1964-05-25 | 1967-11-21 | North American Aviation Inc | Isophote converter |
-
1967
- 1967-09-26 FR FR122249A patent/FR1545782A/fr not_active Expired
-
1968
- 1968-09-21 NL NL6813539A patent/NL6813539A/xx unknown
- 1968-09-23 AT AT923268A patent/AT290165B/de not_active IP Right Cessation
- 1968-09-23 SE SE12795/68A patent/SE339338B/xx unknown
- 1968-09-23 NO NO3749/68A patent/NO123539B/no unknown
- 1968-09-24 BE BE721336D patent/BE721336A/xx unknown
- 1968-09-24 DK DK458868AA patent/DK137259B/da unknown
- 1968-09-24 GB GB45357/68A patent/GB1224670A/en not_active Expired
- 1968-09-24 ES ES358462A patent/ES358462A1/es not_active Expired
- 1968-09-24 DE DE1762927A patent/DE1762927C3/de not_active Expired
- 1968-09-25 US US00762480A patent/US3711642A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1762927B2 (de) | 1976-03-25 |
| SE339338B (xx) | 1971-10-04 |
| GB1224670A (en) | 1971-03-10 |
| DK137259B (da) | 1978-02-06 |
| FR1545782A (fr) | 1968-11-15 |
| DE1762927C3 (de) | 1979-06-07 |
| DE1762927A1 (de) | 1970-12-23 |
| DK137259C (xx) | 1978-07-10 |
| BE721336A (xx) | 1969-03-24 |
| US3711642A (en) | 1973-01-16 |
| AT290165B (de) | 1971-05-25 |
| ES358462A1 (es) | 1970-05-16 |
| NL6813539A (xx) | 1969-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO123148B (xx) | ||
| NO120938B (xx) | ||
| NO117374B (xx) | ||
| NO123539B (xx) | ||
| NO764039L (xx) | ||
| NO139920B (no) | Fremgangsmaate ved fremstilling av 2,5-disubstituerte benzamider | |
| US2837568A (en) | Bis(halophenylimino)cyclohexanes | |
| Crowther et al. | 21. The mechanism of indole formation from phenacylarylamines. Part I | |
| US2946815A (en) | 2-sulfamoylbenzoic acid esters | |
| US2670373A (en) | Halogenated n-aryl-n-dialkylaminoalkyl-arylcarboxamides | |
| US3378592A (en) | Process for the production of 3, 4-dihydroxybenzyloxyaminehydrobromide | |
| US2078387A (en) | Diazo amino compounds | |
| US3418345A (en) | Halonitroanilides | |
| US2203506A (en) | Nitrogen-containing organinc compound | |
| Fuson et al. | Heterocycles Containing p-Phenylene Units. II. Amines | |
| DK145377B (da) | Analogifremgangsmaade til fremstilling af n-(2'-pyrrolidinylmethyl)benzamider eller syreadditionssalte eller kvaternaere ammoniumsalte eller optisk aktive isomere deraf | |
| NO135092B (xx) | ||
| US2681911A (en) | 1, 2, 3, 4-tetrahydroisoquinolinalkanol esters of aromatically substituted aliphaticacids and their derivatives | |
| SU470957A3 (ru) | Способ получени производных 4-аминопирролин-3-она-2 или их солей | |
| US2350900A (en) | Amino diphenyl sulphides and process of making them | |
| NO123538B (xx) | ||
| US3065225A (en) | N', n4-di-isoxazolylcarbonyl-sulfanilamide derivatives | |
| US2731469A (en) | N-dialkylaminoalkyl derivatives of diarylisonicotinamides | |
| US2775595A (en) | Chzohz | |
| US2776978A (en) | X-diamevotmazoles containing a halo- |