NO123368B - - Google Patents
Download PDFInfo
- Publication number
- NO123368B NO123368B NO162166A NO16216666A NO123368B NO 123368 B NO123368 B NO 123368B NO 162166 A NO162166 A NO 162166A NO 16216666 A NO16216666 A NO 16216666A NO 123368 B NO123368 B NO 123368B
- Authority
- NO
- Norway
- Prior art keywords
- charge
- electrodes
- furnace
- melting
- charging
- Prior art date
Links
- 238000002844 melting Methods 0.000 claims description 40
- 230000008018 melting Effects 0.000 claims description 40
- 238000000034 method Methods 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 13
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- 229910052719 titanium Inorganic materials 0.000 claims description 8
- 238000010891 electric arc Methods 0.000 claims description 6
- 239000003575 carbonaceous material Substances 0.000 claims description 4
- 230000002093 peripheral effect Effects 0.000 claims description 3
- 230000005855 radiation Effects 0.000 claims 1
- 239000002893 slag Substances 0.000 description 18
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 11
- YDZQQRWRVYGNER-UHFFFAOYSA-N iron;titanium;trihydrate Chemical compound O.O.O.[Ti].[Fe] YDZQQRWRVYGNER-UHFFFAOYSA-N 0.000 description 8
- 229910052742 iron Inorganic materials 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003245 coal Substances 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 3
- 238000003723 Smelting Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 230000001066 destructive effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 241000220317 Rosa Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- RHZUVFJBSILHOK-UHFFFAOYSA-N anthracen-1-ylmethanolate Chemical compound C1=CC=C2C=C3C(C[O-])=CC=CC3=CC2=C1 RHZUVFJBSILHOK-UHFFFAOYSA-N 0.000 description 1
- 239000003830 anthracite Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/26—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3
- C07D311/34—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 3 only
- C07D311/38—2,3-Dihydro derivatives, e.g. isoflavanones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G17/00—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process
- G03G17/04—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process using photoelectrophoresis
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/12—Recording members for multicolour processes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Physics & Mathematics (AREA)
- Physics & Mathematics (AREA)
- Molecular Biology (AREA)
- Electrochemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Optical Filters (AREA)
- Vertical, Hearth, Or Arc Furnaces (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44110665A | 1965-03-19 | 1965-03-19 | |
| US41110665A | 1965-03-19 | 1965-03-19 | |
| US45265165A | 1965-05-03 | 1965-05-03 | |
| US45496265A | 1965-05-11 | 1965-05-11 | |
| US504122A US3419560A (en) | 1965-03-19 | 1965-10-23 | 1-aminoalkyl 2-aryl indanes and tetrahydronaphthalenes |
| US59066666A | 1966-10-31 | 1966-10-31 | |
| US79882868A | 1968-11-01 | 1968-11-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO123368B true NO123368B (enFirst) | 1971-11-01 |
Family
ID=27569758
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO162166A NO123368B (enFirst) | 1965-03-19 | 1966-03-18 | |
| NO162689A NO120030B (enFirst) | 1965-03-19 | 1966-04-21 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO162689A NO120030B (enFirst) | 1965-03-19 | 1966-04-21 |
Country Status (11)
| Country | Link |
|---|---|
| US (5) | US3553093A (enFirst) |
| AT (3) | AT285326B (enFirst) |
| BE (1) | BE680863A (enFirst) |
| CH (3) | CH479100A (enFirst) |
| DE (1) | DE1522742A1 (enFirst) |
| FR (2) | FR1568731A (enFirst) |
| GB (4) | GB1157671A (enFirst) |
| IL (1) | IL25304A (enFirst) |
| NL (1) | NL6606339A (enFirst) |
| NO (2) | NO123368B (enFirst) |
| SE (2) | SE341330B (enFirst) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE371190B (enFirst) * | 1972-03-24 | 1974-11-11 | Kabi Ab | |
| US3804508A (en) * | 1965-05-28 | 1974-04-16 | V Mihajlov | Photoelectrophoretic apparatus for heat fixing an image |
| US3504031A (en) * | 1966-05-24 | 1970-03-31 | Mead Johnson & Co | 1-aminoalkyl-1-phenylindene process and intermediate therefor |
| US3477934A (en) * | 1966-06-29 | 1969-11-11 | Xerox Corp | Imaging process |
| US3680955A (en) * | 1968-07-16 | 1972-08-01 | Minolta Camera Kk | Apparatus for forming an electrostatic image in a camera |
| US3743404A (en) * | 1968-10-03 | 1973-07-03 | Xerox Corp | Photoelectrophoretic imaging apparatus including means to simultaneously apply a compressive stress and shear stress to the imaging suspension |
| US3657091A (en) * | 1968-10-03 | 1972-04-18 | Xerox Corp | Electrophoretic imaging method employing a periodic electric field |
| US3620950A (en) * | 1968-10-03 | 1971-11-16 | Xerox Corp | Electrophoretic imaging employing periodic electromagnetic radiation |
| US3811764A (en) * | 1968-10-03 | 1974-05-21 | Xerox Corp | Apparatus for photoelectrophoretic imaging using a periodic electric field |
| US3784302A (en) * | 1968-10-03 | 1974-01-08 | Xerox Corp | Electrophoretic imaging apparatus including application of dynamic stress on the particle suspension |
| US3853556A (en) * | 1969-05-02 | 1974-12-10 | Xerox Corp | Method for eliminating electrical arcing during photoelectrophoretic imaging |
| BE756481A (fr) * | 1969-09-23 | 1971-03-22 | Xerox Corp | Procede de formation d'image photoelectrophoretique par reflexion |
| USRE28360E (en) * | 1969-10-03 | 1975-03-04 | Electrophoretic color display device | |
| US3761174A (en) * | 1969-10-31 | 1973-09-25 | Xerox Corp | Manifold web handling |
| US3690754A (en) * | 1969-11-14 | 1972-09-12 | Xerox Corp | Control system for an optical imaging system |
| JPS527348B1 (enFirst) * | 1970-01-09 | 1977-03-01 | ||
| US3909262A (en) * | 1970-12-14 | 1975-09-30 | Xerox Corp | Imaging migration member employing a gelatin overcoating |
| US3719484A (en) * | 1971-01-06 | 1973-03-06 | Xerox Corp | Photoelectrophoretic imaging method |
| US3751420A (en) * | 1971-04-01 | 1973-08-07 | Squibb & Sons Inc | Monoolmonoene amines |
| US3859438A (en) * | 1971-07-08 | 1975-01-07 | Boehringer Sohn Ingelheim | Pharmaceutical compositions containing an n-(1-bicyclic aryl-propyl-2)-n-bicyclic aryl-piperazine and method of use |
| US3984464A (en) * | 1972-10-06 | 1976-10-05 | A. Christiaens Societe Anonyme | Derivatives of 2-amino-(1,2,3,4-tetrahydronaphthalene), the preparation and use thereof |
| US3859576A (en) * | 1973-02-15 | 1975-01-07 | Xerox Corp | High performance blocking electrode for electrophotophoresis |
| US3905812A (en) * | 1973-04-23 | 1975-09-16 | Xerox Corp | Imaging process |
| US3917880A (en) * | 1973-06-27 | 1975-11-04 | Xerox Corp | Electrophoretic imaging system |
| US3945724A (en) * | 1974-06-04 | 1976-03-23 | Xerox Corporation | Velocity compensation for bead bypass |
| US4078928A (en) * | 1975-03-03 | 1978-03-14 | Xerox Corporation | Photoelectrophoretic imaging method |
| US4084896A (en) * | 1975-04-24 | 1978-04-18 | Xerox Corporation | Photoelectrophoretic web imaging apparatus |
| CH619701A5 (enFirst) * | 1975-08-07 | 1980-10-15 | Bayer Ag | |
| US4013673A (en) * | 1976-04-13 | 1977-03-22 | Warner-Lambert Company | 2,3-dihydro-3-(2-pyridinyl)-4h-1-benzopyran-4-one n-oxides |
| US4130359A (en) * | 1976-07-23 | 1978-12-19 | Eastman Kodak Company | Electrophoretic migration imaging apparatus and method utilizing enlarged migration environment |
| DE2814983A1 (de) * | 1978-04-07 | 1979-10-18 | Bayer Ag | Neue chromanon-derivate |
| CH641147A5 (de) * | 1979-01-17 | 1984-02-15 | Sandoz Ag | 3-amino-2-hydroxypropoxyaryl-derivat, seine herstellung und dieses enthaltende heilmittel. |
| NL8003141A (nl) * | 1980-05-30 | 1982-01-04 | Akzo Nv | Biologisch aktieve tricyclische aminen. |
| CH648030A5 (de) * | 1980-12-15 | 1985-02-28 | Sandoz Ag | Benzopyran-allylaminderivate, verfahren zu ihrer herstellung und ihre verwendung. |
| US4321270A (en) * | 1981-01-29 | 1982-03-23 | E. R. Squibb & Sons, Inc. | Substituted chromans |
| US4452801A (en) * | 1981-09-24 | 1984-06-05 | E. R. Squibb & Sons, Inc. | Chromans including heterocyclic substituent |
| US4505932A (en) * | 1983-05-13 | 1985-03-19 | Abbott Laboratories | Method of producing α2 -adrenergic receptor agonist activity |
| GB8704572D0 (en) * | 1987-02-26 | 1987-04-01 | Lundbeck & Co As H | Organic compounds |
| WO1989006645A1 (en) * | 1988-01-15 | 1989-07-27 | Abbott Laboratories | 1-aminomethyl-1,2,3,4-tetrahydronaphthalenes |
| US5086074A (en) * | 1988-01-15 | 1992-02-04 | Abbott Laboratories | 1-aminomethyl-1,2,3,4-tetrahydronaphthalenes |
| US5128362A (en) * | 1988-01-15 | 1992-07-07 | Abbott Laboratories | 1-aminomethyl-1,2,3,4-tetrahydronaphthalenes |
| US5298512A (en) * | 1989-04-07 | 1994-03-29 | Pfizer Inc. | Substituted chromans and their use in the treatment of asthma, arthritis and related diseases |
| US5500444A (en) * | 1989-11-14 | 1996-03-19 | Hoechst Marion Roussel, Inc. | Cardioprotective tocopherol analogs |
| US5063397A (en) * | 1990-05-25 | 1991-11-05 | Xerox Corporation | Variable-thickness imaging members |
| EP0550292A1 (en) * | 1992-01-02 | 1993-07-07 | Merrell Dow Pharmaceuticals Inc. | Tissue protective tocopherol analogs |
| US5721233A (en) * | 1992-04-06 | 1998-02-24 | Merrell Pharmaceuticals Inc. | Derivatives of 2,3-dihydro benzofuranols |
| US5510373A (en) * | 1992-04-06 | 1996-04-23 | Merrell Pharmaceuticals Inc. | Cardioprotective agents |
| US5545660A (en) * | 1992-04-07 | 1996-08-13 | Merrell Pharmaceuticals Inc. | Hydrazide derivatives of 3,4-dihydro-2H-1-benzopyrans |
| IL143780A (en) * | 2001-06-14 | 2007-06-03 | Cerel Ceramic Technologies Ltd | Process for manufacturing electrode |
| US7339715B2 (en) * | 2003-03-25 | 2008-03-04 | E Ink Corporation | Processes for the production of electrophoretic displays |
| DE102005010000A1 (de) * | 2005-03-04 | 2006-09-07 | Merck Patent Gmbh | Indane |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2758939A (en) * | 1953-12-30 | 1956-08-14 | Rca Corp | Electrostatic printing |
| US2987660A (en) * | 1955-06-06 | 1961-06-06 | Haloid Xerox Inc | Xerographic charging |
| US2902974A (en) * | 1956-06-14 | 1959-09-08 | Ibm | Latent electrostatic image developing apparatus |
| US2884434A (en) * | 1957-03-07 | 1959-04-28 | Dow Corning | Haloorgano silcarbane siloxanes |
| US2940847A (en) * | 1957-07-03 | 1960-06-14 | None i red | |
| US3068479A (en) * | 1958-05-09 | 1962-12-11 | Burroughs Corp | Electrographic recording apparatus |
| US3251685A (en) * | 1959-10-19 | 1966-05-17 | Xerox Corp | Method of controlling contrast in a xerographic reproduction process |
| US3142682A (en) * | 1961-11-21 | 1964-07-28 | Ciba Geigy Corp | Tertiary amino derivatives of chromans and homo-chromans |
| US3271145A (en) * | 1963-12-23 | 1966-09-06 | Eastman Kodak Co | Process for producing an electrostatic charge image |
| US3301866A (en) * | 1965-08-12 | 1967-01-31 | Rexall Drug Chemical | Substituted indenopyridines |
-
1965
- 1965-03-19 US US441106A patent/US3553093A/en not_active Expired - Lifetime
- 1965-05-03 US US452651A patent/US3474019A/en not_active Expired - Lifetime
- 1965-10-23 US US504122A patent/US3419560A/en not_active Expired - Lifetime
-
1966
- 1966-03-04 IL IL25304A patent/IL25304A/en unknown
- 1966-03-17 GB GB11857/66A patent/GB1157671A/en not_active Expired
- 1966-03-17 DE DE19661522742 patent/DE1522742A1/de active Pending
- 1966-03-17 GB GB34793/68A patent/GB1149666A/en not_active Expired
- 1966-03-17 GB GB11856/66A patent/GB1149665A/en not_active Expired
- 1966-03-18 CH CH393866A patent/CH479100A/fr not_active IP Right Cessation
- 1966-03-18 AT AT262066A patent/AT285326B/de not_active IP Right Cessation
- 1966-03-18 CH CH393766A patent/CH479099A/fr not_active IP Right Cessation
- 1966-03-18 SE SE03639/66A patent/SE341330B/xx unknown
- 1966-03-18 SE SE03640/66A patent/SE334540B/xx unknown
- 1966-03-18 NO NO162166A patent/NO123368B/no unknown
- 1966-03-18 AT AT261966A patent/AT286783B/de active
- 1966-04-19 GB GB17156/66A patent/GB1149615A/en not_active Expired
- 1966-04-21 NO NO162689A patent/NO120030B/no unknown
- 1966-05-10 NL NL6606339A patent/NL6606339A/xx unknown
- 1966-05-11 FR FR1568731D patent/FR1568731A/fr not_active Expired
- 1966-05-11 CH CH682366A patent/CH466305A/fr unknown
- 1966-05-11 BE BE680863D patent/BE680863A/xx unknown
- 1966-05-11 AT AT447466A patent/AT279598B/de not_active IP Right Cessation
- 1966-08-10 FR FR72633A patent/FR5864M/fr not_active Expired
- 1966-10-31 US US590666A patent/US3448025A/en not_active Expired - Lifetime
-
1968
- 1968-11-01 US US798828*A patent/US3551320A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH466305A (fr) | 1968-12-15 |
| US3419560A (en) | 1968-12-31 |
| BE680863A (enFirst) | 1966-11-14 |
| FR1568731A (enFirst) | 1969-05-30 |
| DE1522743B2 (de) | 1972-07-27 |
| AT286783B (de) | 1970-12-28 |
| IL25304A (en) | 1969-11-30 |
| DE1522743A1 (de) | 1969-10-30 |
| DE1522742A1 (de) | 1969-10-30 |
| CH479100A (fr) | 1969-09-30 |
| FR5864M (enFirst) | 1968-03-11 |
| AT285326B (de) | 1970-10-27 |
| NL6606339A (enFirst) | 1966-11-14 |
| US3448025A (en) | 1969-06-03 |
| GB1157671A (en) | 1969-07-09 |
| GB1149615A (en) | 1969-04-23 |
| US3551320A (en) | 1970-12-29 |
| GB1149666A (en) | 1969-04-23 |
| US3553093A (en) | 1971-01-05 |
| NO120030B (enFirst) | 1970-08-17 |
| SE334540B (enFirst) | 1971-04-26 |
| SE341330B (enFirst) | 1971-12-20 |
| US3474019A (en) | 1969-10-21 |
| AT279598B (de) | 1970-03-10 |
| CH479099A (fr) | 1969-09-30 |
| GB1149665A (en) | 1969-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO123368B (enFirst) | ||
| US3472650A (en) | Electric-arc steelmaking | |
| KR20030028416A (ko) | 용융철 제조 방법 및 고정식 비경사 아크 가열형 용융로 | |
| UA60347C2 (uk) | Спосіб плавлення дрібнозернистого, отриманого прямим відновленням заліза в електродуговій печі | |
| US3715203A (en) | Melting of metals | |
| CN109266866A (zh) | 铜精矿熔池熔炼工艺 | |
| US4375449A (en) | Electric furnaces | |
| US3463629A (en) | Manufacturing steel and alloys of iron | |
| US4273576A (en) | Electric arc furnace operation | |
| NO831419L (no) | Fremgangsmaate ved fremstilling av kalsiumkarbid fra pulverisert kalk/kalkstein | |
| NO152138B (no) | Fremgangsmaate ved fremstilling av silisium og ferrosilisium | |
| NO853074L (no) | Fremgangsmaate ved fremstilling av kalsiumkarbid, samt sjaktovn til gjennomfoering av fremgangsmaaten. | |
| NO161794B (no) | Anlegg for fremstilling av kalsiumkarbid. | |
| FI70729C (fi) | Foerfarande foer kontinuerlig direkt smaeltning av metalliskt bly ur svavelhaltiga blymaterial | |
| US2808324A (en) | Method of smelting ilmenite | |
| US4307872A (en) | Apparatus for reducing ore | |
| US4490169A (en) | Method for reducing ore | |
| WO1991015727A1 (en) | Method and apparatus for controlling the raw material supply to an electrical melting furnace | |
| US1902668A (en) | Electric furnace | |
| US3690867A (en) | Electric-arc steelmaking | |
| US740360A (en) | Metallurgical furnace. | |
| RU2228962C2 (ru) | Вакуумная плавильная печь с холодным подом | |
| US4337373A (en) | Furnace for fusing vanadium pentoxide powder | |
| CN115507651B (zh) | 一种大型侧吹熔炼炉及熔炼方法 | |
| RU2567426C1 (ru) | Дуговая печь для электроплавки стали |