NO122019B - - Google Patents
Download PDFInfo
- Publication number
- NO122019B NO122019B NO3854/68A NO385468A NO122019B NO 122019 B NO122019 B NO 122019B NO 3854/68 A NO3854/68 A NO 3854/68A NO 385468 A NO385468 A NO 385468A NO 122019 B NO122019 B NO 122019B
- Authority
- NO
- Norway
- Prior art keywords
- quinoxaline
- carboxylic acid
- oxide
- mentioned
- chloromethyl
- Prior art date
Links
- 238000000034 method Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 208000015181 infectious disease Diseases 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 230000001154 acute effect Effects 0.000 description 3
- 230000000973 chemotherapeutic effect Effects 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 150000004967 organic peroxy acids Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000001567 quinoxalinyl group Chemical class N1=C(C=NC2=CC=CC=C12)* 0.000 description 3
- -1 sodium o-acetoxymethylbenzoate Chemical compound 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- 206010028470 Mycoplasma infections Diseases 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 206010037596 Pyelonephritis Diseases 0.000 description 1
- ABBQHOQBGMUPJH-UHFFFAOYSA-M Sodium salicylate Chemical compound [Na+].OC1=CC=CC=C1C([O-])=O ABBQHOQBGMUPJH-UHFFFAOYSA-M 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000001174 ascending effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- 229960004025 sodium salicylate Drugs 0.000 description 1
- RDAOPIAYYCMHLN-UHFFFAOYSA-M sodium;2-methoxybenzoate Chemical compound [Na+].COC1=CC=CC=C1C([O-])=O RDAOPIAYYCMHLN-UHFFFAOYSA-M 0.000 description 1
- RBBWNXJFTBCLKT-UHFFFAOYSA-M sodium;ethanethioate Chemical compound [Na+].CC([S-])=O RBBWNXJFTBCLKT-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 208000019206 urinary tract infection Diseases 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/50—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to ring nitrogen atoms
- C07D241/52—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1670936A DE1670936C3 (de) | 1967-10-04 | 1967-10-04 | 3-Carbonsäureamido-chinoxalin-di-Nojdde-0,4), ein Verfahren zu ihrer Herstellung und diese enthaltende antibakterielle Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122019B true NO122019B (enEXAMPLES) | 1971-05-10 |
Family
ID=7106502
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO3854/68A NO122019B (enEXAMPLES) | 1967-10-04 | 1968-09-28 |
Country Status (14)
| Country | Link |
|---|---|
| AT (1) | AT281837B (enEXAMPLES) |
| BE (1) | BE721725A (enEXAMPLES) |
| CH (1) | CH513185A (enEXAMPLES) |
| DE (1) | DE1670936C3 (enEXAMPLES) |
| DK (1) | DK128679B (enEXAMPLES) |
| ES (1) | ES358795A1 (enEXAMPLES) |
| FI (1) | FI49722C (enEXAMPLES) |
| FR (2) | FR1597550A (enEXAMPLES) |
| GB (1) | GB1231594A (enEXAMPLES) |
| IL (1) | IL30714A (enEXAMPLES) |
| NL (1) | NL160555C (enEXAMPLES) |
| NO (1) | NO122019B (enEXAMPLES) |
| SE (1) | SE344463B (enEXAMPLES) |
| YU (1) | YU32939B (enEXAMPLES) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH538488A (de) * | 1969-12-12 | 1973-06-30 | Hoffmann La Roche | Verfahren zur Herstellung von heterocyclischen Verbindungen |
-
1967
- 1967-10-04 DE DE1670936A patent/DE1670936C3/de not_active Expired
-
1968
- 1968-09-16 IL IL30714A patent/IL30714A/xx unknown
- 1968-09-16 CH CH1387868A patent/CH513185A/de not_active IP Right Cessation
- 1968-09-28 NO NO3854/68A patent/NO122019B/no unknown
- 1968-10-02 YU YU2299/68A patent/YU32939B/xx unknown
- 1968-10-02 SE SE13326/68A patent/SE344463B/xx unknown
- 1968-10-02 BE BE721725D patent/BE721725A/xx unknown
- 1968-10-03 DK DK478368AA patent/DK128679B/da unknown
- 1968-10-03 GB GB1231594D patent/GB1231594A/en not_active Expired
- 1968-10-03 AT AT964468A patent/AT281837B/de not_active IP Right Cessation
- 1968-10-04 ES ES358795A patent/ES358795A1/es not_active Expired
- 1968-10-04 FR FR1597550D patent/FR1597550A/fr not_active Expired
- 1968-10-04 NL NL6814260.A patent/NL160555C/xx active
- 1968-10-04 FI FI682817A patent/FI49722C/fi active
- 1968-12-30 FR FR181598A patent/FR8124M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1670936B2 (de) | 1978-06-08 |
| CH513185A (de) | 1971-09-30 |
| FR8124M (enEXAMPLES) | 1970-08-03 |
| DE1670936A1 (de) | 1971-02-25 |
| YU229968A (en) | 1975-06-30 |
| IL30714A (en) | 1972-05-30 |
| DK128679B (da) | 1974-06-17 |
| FI49722C (fi) | 1975-09-10 |
| DE1670936C3 (de) | 1979-03-22 |
| IL30714A0 (en) | 1968-12-26 |
| YU32939B (en) | 1975-12-31 |
| NL160555C (nl) | 1979-11-15 |
| NL6814260A (enEXAMPLES) | 1969-04-09 |
| AT281837B (de) | 1970-06-10 |
| SE344463B (enEXAMPLES) | 1972-04-17 |
| BE721725A (enEXAMPLES) | 1969-04-02 |
| FI49722B (enEXAMPLES) | 1975-06-02 |
| FR1597550A (enEXAMPLES) | 1970-06-29 |
| ES358795A1 (es) | 1970-05-01 |
| GB1231594A (enEXAMPLES) | 1971-05-12 |
| NL160555B (nl) | 1979-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR870000921B1 (ko) | 7-아미노-1-시클로프로필-6,8-디플루오로-1,4-디히드로-4-옥소퀴놀린-3-카르복실산의 제조방법 | |
| SU1582986A3 (ru) | Способ получени производного хинолина или его фармацевтически приемлемого сложного эфира или фармацевтически приемлемых солей указанного производного или его сложного эфира | |
| PT93639A (pt) | Processo para a preparacao de acidos 5-alquilquinolonocarboxilicos | |
| SU812182A3 (ru) | Способ получени 7-метокси-1- ОКСАдЕТиАцЕфАлОСпОРиНОВ или иХСОлЕй | |
| CS208472B2 (en) | Therapeutic agents | |
| US4668784A (en) | Derivatives of pyrido-benzothiazine with high anti-microbial activity | |
| FR2555584A1 (fr) | Derives de l'acide fluoro-6-dihydro-1,4-oxo-4-piperazinyl substitue-7-quinoline-carboxylique-3 et procede pour leur preparation et compositions pharmaceutiques a action anti-bacteriennes a base desdits derives | |
| NO177934C (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive kinolinkarboksylsyrederivater | |
| PL79604B1 (enEXAMPLES) | ||
| KR880002355B1 (ko) | 카복실산 유도체의 제조방법 | |
| NO122019B (enEXAMPLES) | ||
| NO122020B (enEXAMPLES) | ||
| US4044130A (en) | Compositions for the control of microorganisms | |
| US3557109A (en) | 2-halomethyl-3-carboxylic acid amido-quinoxaline-1,4-di-n-oxides and their production | |
| US3558624A (en) | 3-carboxylic acid amido-quinoxaline-1,4-di-n-oxides | |
| DE2134451C3 (de) | 1,4-Dihydro-1methoxy-6,7-methylendioxy-4-oxo-3-chinolincarbonsäure und Verfahren zu deren Herstellung | |
| US4548934A (en) | 4H-1,4-Benzothiazine derivatives | |
| KR850001066B1 (ko) | 2β-클로로메틸-2α-메틸페남-3α-카르복실산술폰, 2염 또는 그의 에스테르의 제조방법 | |
| US3639400A (en) | 3-carboxylic acid-amido-quinoxaline-di-n-oxides-(1 4) and their production | |
| US4060527A (en) | Pyrido[2,3-c]-acridine-1-hydroxy-2-carboxylic acid derivatives | |
| KR870001017B1 (ko) | 7-아미노-1-시클로프로필-6,8-디플루오로-1,4-디히드로-4-옥소퀴놀린-3-카르복실산의 제조 방법 | |
| US3660384A (en) | 5-(2-(5-nitro-2-furyl)vinyl)picolinohydroxamic acid | |
| US4086236A (en) | 6,7-Methylenedioxy-1-(2,2,2-trifluoroethyl)-4(1H)-quinolone-3-carboxylic acid | |
| US3471507A (en) | New isothiazole synthesis | |
| KR800001266B1 (ko) | 6-(d-2-아실 아미도-2-페닐-아세트 아미도) 페니실란산의 제조방법 |