NO119840B - - Google Patents
Download PDFInfo
- Publication number
- NO119840B NO119840B NO0818/68A NO81868A NO119840B NO 119840 B NO119840 B NO 119840B NO 0818/68 A NO0818/68 A NO 0818/68A NO 81868 A NO81868 A NO 81868A NO 119840 B NO119840 B NO 119840B
- Authority
- NO
- Norway
- Prior art keywords
- general formula
- halogen
- denotes hydrogen
- tetrahydro
- derivatives
- Prior art date
Links
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- -1 halogen acetyl halide Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 238000010992 reflux Methods 0.000 claims description 4
- 229960000583 acetic acid Drugs 0.000 claims description 3
- 239000012362 glacial acetic acid Substances 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- WYSWZKVHKDMDAI-UHFFFAOYSA-N NC1=C(C(C2=CC=CC=C2)C2=C3C(C(=O)NC3=O)=CC=C2)C=CC=C1 Chemical class NC1=C(C(C2=CC=CC=C2)C2=C3C(C(=O)NC3=O)=CC=C2)C=CC=C1 WYSWZKVHKDMDAI-UHFFFAOYSA-N 0.000 claims description 2
- 238000003436 Schotten-Baumann reaction Methods 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid group Chemical group C(C=1C(C(=O)O)=CC=CC1)(=O)O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000013078 crystal Substances 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- UDLAUVFRZXIQJS-UHFFFAOYSA-N 1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound N1C(=O)CN=CC2=CC=CC=C21 UDLAUVFRZXIQJS-UHFFFAOYSA-N 0.000 description 1
- MLXBHOCKBUILHN-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-1,4-benzodiazepine Chemical class C1NCCNC2=CC=CC=C21 MLXBHOCKBUILHN-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- ZYOLWAPZVQXTTM-UHFFFAOYSA-N 7-chloro-1-methyl-5-phenyl-4,5-dihydro-3h-1,4-benzodiazepin-2-one Chemical compound N1CC(=O)N(C)C2=CC=C(Cl)C=C2C1C1=CC=CC=C1 ZYOLWAPZVQXTTM-UHFFFAOYSA-N 0.000 description 1
- MPJBZKDAPNKHGH-UHFFFAOYSA-N CNC1=C(C(C2=CC=CC=C2)C2=C3C(C(=O)NC3=O)=CC=C2)C=C(C=C1)Cl Chemical compound CNC1=C(C(C2=CC=CC=C2)C2=C3C(C(=O)NC3=O)=CC=C2)C=C(C=C1)Cl MPJBZKDAPNKHGH-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK118367AA DK112527B (da) | 1967-03-07 | 1967-03-07 | Fremgangsmåde til fremstilling af 1,3,4,5-tetrahydro-1,4-benzodiazepinderivater. |
| US591170A | 1970-01-26 | 1970-01-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119840B true NO119840B (sv) | 1970-07-13 |
Family
ID=26065339
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO0818/68A NO119840B (sv) | 1967-03-07 | 1968-03-04 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3574191A (sv) |
| AT (1) | AT283371B (sv) |
| CH (1) | CH496714A (sv) |
| DE (1) | DE1670035A1 (sv) |
| DK (1) | DK112527B (sv) |
| ES (1) | ES351285A1 (sv) |
| FI (1) | FI48087C (sv) |
| FR (1) | FR1554546A (sv) |
| NL (1) | NL143229B (sv) |
| NO (1) | NO119840B (sv) |
| SE (1) | SE341856B (sv) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU171033B (hu) * | 1974-05-29 | 1977-10-28 | Richter Gedeon Vegyeszet | Sposob poluchenija proizvodnykh benzodiazepina |
| US8431655B2 (en) * | 2007-04-09 | 2013-04-30 | Designer Molecules, Inc. | Curatives for epoxy compositions |
| WO2008124797A1 (en) * | 2007-04-09 | 2008-10-16 | Designer Molecules, Inc. | Curatives for epoxy compositions |
| WO2008128209A1 (en) * | 2007-04-12 | 2008-10-23 | Designer Molecules, Inc. | Polyfunctional epoxy oligomers |
-
1967
- 1967-03-07 DK DK118367AA patent/DK112527B/da unknown
-
1968
- 1968-03-04 NL NL686803024A patent/NL143229B/xx not_active IP Right Cessation
- 1968-03-04 NO NO0818/68A patent/NO119840B/no unknown
- 1968-03-06 AT AT220468A patent/AT283371B/de not_active IP Right Cessation
- 1968-03-06 DE DE19681670035 patent/DE1670035A1/de active Pending
- 1968-03-06 FR FR1554546D patent/FR1554546A/fr not_active Expired
- 1968-03-06 ES ES351285A patent/ES351285A1/es not_active Expired
- 1968-03-06 SE SE2918/68A patent/SE341856B/xx unknown
- 1968-03-07 CH CH338568A patent/CH496714A/de not_active IP Right Cessation
- 1968-03-07 FI FI680622A patent/FI48087C/sv active
-
1970
- 1970-01-26 US US5911A patent/US3574191A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL143229B (nl) | 1974-09-16 |
| FI48087B (sv) | 1974-02-28 |
| FR1554546A (sv) | 1969-01-17 |
| CH496714A (de) | 1970-09-30 |
| ES351285A1 (es) | 1969-06-01 |
| AT283371B (de) | 1970-08-10 |
| SE341856B (sv) | 1972-01-17 |
| DE1670035A1 (de) | 1971-02-25 |
| DK112527B (da) | 1968-12-23 |
| NL6803024A (sv) | 1968-09-09 |
| US3574191A (en) | 1971-04-06 |
| FI48087C (sv) | 1974-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK174104B1 (da) | 1-Tetrazol-5-yl-1H-indol-carboxamidderivater, fremgangsmåde til fremstilling deraf samt lægemidde indeholdende forbindelserne | |
| NO156328B (no) | Konstruksjon med keramisk overflatebelegg samt fremgangsmaate til fremstilling av samme. | |
| HU198905B (en) | Process for production of derivatives of 4-/alkyl-sulphonil/-3-hydroxi-2-chlor bensoic acid | |
| SU568366A3 (ru) | Способ получени производных бензодиазепина или их 5-окисей или солей | |
| DK149230B (da) | Analogifremgangsmaade til fremstilling af 5-benzoyl-6-hydroxy-indan-1-carboxylsyrederivater eller farmaceutisk acceptable salte deraf | |
| NO119840B (sv) | ||
| IL40861A (en) | History of theapine and oxapine and their preparation | |
| US2624730A (en) | 6-haloaryl-3-pyridazones | |
| US2305748A (en) | Process of making dialkyl stilboestrols | |
| SU1126208A3 (ru) | Способ получени алкилтиобензимидазолов | |
| US3772305A (en) | 3-amino-3-carbalkoxy-4-hydroxy-2-oxo-4-phenyl-1,2,3,4-tetrahydroquinolines | |
| US1822982A (en) | Halogenated naphthalene | |
| NO119797B (sv) | ||
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| PL81422B1 (en) | 2-chloro-7-hydroxy-11-(1-piperazinyl)dibenz(b f)(1 4)oxazepines[us3660406a] | |
| SU558914A1 (ru) | 3-(5-Арилоксазолил-2)фталевые кислоты или их ангидриды или соли в качестве люминофоров | |
| IL29423A (en) | Furazan derivatives,their preparation and use | |
| DK148082B (da) | Analogifremgangsmaade til fremstilling af 1-ethyl-1,4-dihydro-6-(2-naphthyl)-4-oxo-nicotinsyrederivater | |
| JPS58203962A (ja) | 選択的スルホン化方法 | |
| NO853732L (no) | Fremgangsm¨te til fremstilling av pyrazolonderivater. | |
| SU465791A3 (ru) | Способ получени 5-арил-(или гетероарил)-3-окси-1н-1,5-бензодиазепин-2,4(3н,5н)-дионов | |
| US3931168A (en) | Cinnamamidohydantoins | |
| Hey et al. | 666. Internuclear cyclisation. Part II. The application of the Pschorr reaction to some substituted derivatives of o-amino-α-phenylcinnamic acid | |
| US4421756A (en) | Quinolinoneimine carboxylic acid anti-inflammatory and analgesic composition containing the compound | |
| SU437284A1 (ru) | Способ получени производных индено-пиридина |