NO119550B - - Google Patents
Download PDFInfo
- Publication number
- NO119550B NO119550B NO1783/68A NO178368A NO119550B NO 119550 B NO119550 B NO 119550B NO 1783/68 A NO1783/68 A NO 1783/68A NO 178368 A NO178368 A NO 178368A NO 119550 B NO119550 B NO 119550B
- Authority
- NO
- Norway
- Prior art keywords
- heater
- shutter
- outlet
- air
- air flow
- Prior art date
Links
- 238000010438 heat treatment Methods 0.000 claims description 8
- 238000009423 ventilation Methods 0.000 claims description 6
- 238000013021 overheating Methods 0.000 claims description 3
- 239000003779 heat-resistant material Substances 0.000 claims description 2
- 238000010276 construction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 2
- 239000012777 electrically insulating material Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- COCAUCFPFHUGAA-MGNBDDOMSA-N n-[3-[(1s,7s)-5-amino-4-thia-6-azabicyclo[5.1.0]oct-5-en-7-yl]-4-fluorophenyl]-5-chloropyridine-2-carboxamide Chemical compound C=1C=C(F)C([C@@]23N=C(SCC[C@@H]2C3)N)=CC=1NC(=O)C1=CC=C(Cl)C=N1 COCAUCFPFHUGAA-MGNBDDOMSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45D—HAIRDRESSING OR SHAVING EQUIPMENT; EQUIPMENT FOR COSMETICS OR COSMETIC TREATMENTS, e.g. FOR MANICURING OR PEDICURING
- A45D20/00—Hair drying devices; Accessories therefor
- A45D20/18—Flexible caps with provision for hot air supply
Landscapes
- Cleaning And Drying Hair (AREA)
- Hair Curling (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB21585/67A GB1223107A (en) | 1967-05-09 | 1967-05-09 | Improved hairdryer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119550B true NO119550B (oth) | 1970-06-01 |
Family
ID=10165387
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1783/68A NO119550B (oth) | 1967-05-09 | 1968-05-08 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3674980A (oth) |
| DE (1) | DE1757436C2 (oth) |
| DK (1) | DK123742B (oth) |
| FR (1) | FR1563456A (oth) |
| GB (1) | GB1223107A (oth) |
| NO (1) | NO119550B (oth) |
| SE (1) | SE335209B (oth) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4316077A (en) * | 1975-12-31 | 1982-02-16 | Texas Instruments Incorporated | Elastic hair dryer having selectively variable air output temperature |
| JPS5445518U (oth) * | 1977-09-05 | 1979-03-29 | ||
| US4218608A (en) * | 1978-08-07 | 1980-08-19 | Maroney Michael V | Multiple duct blow dryer and hair styler |
| US4297564A (en) * | 1978-11-29 | 1981-10-27 | Bartolac Robert R | Hair dryer |
| US4644135A (en) * | 1983-08-29 | 1987-02-17 | The Marley Company | Wall mounted forced air electric heater |
| BE1001875A5 (fr) * | 1988-12-05 | 1990-04-03 | Staar Sa | Perfectionnements apportes aux appareils d'enregistrement et/ou de lecture de bandes magnetiques. |
| US6038786A (en) * | 1998-04-16 | 2000-03-21 | Excel Dryer Inc. | Hand dryer |
| US7039301B1 (en) | 1999-10-04 | 2006-05-02 | Excel Dryer, Inc. | Method and apparatus for hand drying |
| WO2001025705A1 (en) * | 1999-10-04 | 2001-04-12 | Excel Dryer, Inc. | Dryer |
| KR100446050B1 (ko) * | 2001-06-14 | 2004-08-30 | 마츠시다 덴코 가부시키가이샤 | 헤어드라이어 |
| DE10226658A1 (de) * | 2002-06-14 | 2005-06-30 | BSH Bosch und Siemens Hausgeräte GmbH | Vorrichtung zur Erzeugung eines temperierten Luftstroms |
| US20060219389A1 (en) * | 2005-04-01 | 2006-10-05 | Ingersoll-Rand Company | Air compressor aftercooler |
| US20080229480A1 (en) * | 2007-03-21 | 2008-09-25 | Rose Hardwick | Heat deflector for use with a hood-type hair dryer |
| USD600856S1 (en) | 2007-10-24 | 2009-09-22 | American Dryer, Inc. | Hand dryer |
| JP2015128466A (ja) * | 2014-01-06 | 2015-07-16 | 日本電産株式会社 | ドライヤ |
| US10835007B2 (en) | 2017-07-14 | 2020-11-17 | Spectrum Brands, Inc. | Hair dryer |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1707554A (en) * | 1928-02-13 | 1929-04-02 | Halliwell Shelton Electric Cor | Hair drier |
| US1751841A (en) * | 1929-02-23 | 1930-03-25 | Art Sly | Clothes drier |
| US2090165A (en) * | 1935-03-20 | 1937-08-17 | Eastern Lab Inc | Multiple service hair drier or the like |
| US2914648A (en) * | 1957-06-13 | 1959-11-24 | Svenska Flaektfabriken Ab | Ventilating unit provided with an electric heater |
| DE1084882B (de) * | 1958-07-14 | 1960-07-07 | Licentia Gmbh | Haartrockner |
| NL266517A (oth) * | 1960-07-01 | |||
| US3272966A (en) * | 1963-06-20 | 1966-09-13 | Dominion Electric Corp | Device for drying hair and fingernails |
| US3290112A (en) * | 1965-03-09 | 1966-12-06 | Hagen B Gillenwater | Apparatus for dispensing insecticides |
| DE1945288U (de) * | 1966-07-07 | 1966-09-01 | Siegas Metallwarenfab | Haartrockenhaube. |
| US3394755A (en) * | 1967-02-06 | 1968-07-30 | Conditionaire Australia Pty Lt | Air screen creating-air conditioning apparatus |
-
1967
- 1967-05-09 GB GB21585/67A patent/GB1223107A/en not_active Expired
-
1968
- 1968-05-08 NO NO1783/68A patent/NO119550B/no unknown
- 1968-05-08 SE SE06240/68A patent/SE335209B/xx unknown
- 1968-05-08 DK DK214668AA patent/DK123742B/da unknown
- 1968-05-09 DE DE1757436A patent/DE1757436C2/de not_active Expired
- 1968-05-09 FR FR1563456D patent/FR1563456A/fr not_active Expired
- 1968-05-09 US US727806A patent/US3674980A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1757436C2 (de) | 1976-01-08 |
| DK123742B (da) | 1972-07-31 |
| FR1563456A (oth) | 1969-04-11 |
| US3674980A (en) | 1972-07-04 |
| DK123742C (oth) | 1975-05-12 |
| DE1757436B1 (de) | 1975-05-15 |
| SE335209B (oth) | 1971-05-17 |
| GB1223107A (en) | 1971-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO119550B (oth) | ||
| CA1066342A (en) | Hair dryer variable control | |
| KR860000956B1 (ko) | 건조기 | |
| US4231166A (en) | Automatic control for a clothes dryer | |
| US5673497A (en) | Clothes dryer temperature control system | |
| US3750304A (en) | Semi-recirculatory system for a clothes dryer | |
| US2645032A (en) | Control mechanism for clothes driers | |
| US5179790A (en) | Hot air boot dryer | |
| US3239945A (en) | Heat and blower control for a dryer | |
| US2498172A (en) | Gas-heated clothes drier | |
| GB2135575A (en) | Air flow adjusting mechanism for hand-held hot-air hair driers | |
| CN108603327B (zh) | 除湿器 | |
| US3286361A (en) | Clothes dryer and control therefor | |
| US2718066A (en) | Laundry dryers | |
| US6739069B2 (en) | Cool down temperature control system for clothes dryer | |
| GB2051330A (en) | Clothes dryer | |
| GB2258126A (en) | Cooling and ventilating oven heated with micrwaves and other means | |
| US9869053B2 (en) | Heater assembly for an appliance | |
| US2820623A (en) | Clothes drier | |
| US3325908A (en) | Dual function safety thermostat for dryers | |
| KR102120218B1 (ko) | 안전장치를 포함하는 가열식 조리용 가전기기 | |
| US3220117A (en) | Dryer control system | |
| JPS589152Y2 (ja) | 温風装置 | |
| JP6403363B2 (ja) | ヒータユニットおよび衣類乾燥機 | |
| US2509747A (en) | Electric preheater for permanent waving |