NO119412B - - Google Patents
Download PDFInfo
- Publication number
- NO119412B NO119412B NO16732567A NO16732567A NO119412B NO 119412 B NO119412 B NO 119412B NO 16732567 A NO16732567 A NO 16732567A NO 16732567 A NO16732567 A NO 16732567A NO 119412 B NO119412 B NO 119412B
- Authority
- NO
- Norway
- Prior art keywords
- cyclopropyl
- alkyl
- general formula
- compound
- sulfanilamide
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 25
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 22
- 229940124530 sulfonamide Drugs 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims description 7
- 150000007529 inorganic bases Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 150000007530 organic bases Chemical class 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- -1 methoxy, ethoxy, propoxy Chemical group 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000012043 crude product Substances 0.000 description 10
- 239000000155 melt Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- CGRKCGWEOIQFRD-UHFFFAOYSA-N sodium;(4-aminophenyl)sulfonylazanide Chemical compound [Na+].NC1=CC=C(S([NH-])(=O)=O)C=C1 CGRKCGWEOIQFRD-UHFFFAOYSA-N 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- 238000003776 cleavage reaction Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000012259 ether extract Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 2
- ULPFDYQYVQCVQX-UHFFFAOYSA-N 4,5-dichloro-6-cyclopropylpyrimidine Chemical compound C1(CC1)C1=C(C(=NC=N1)Cl)Cl ULPFDYQYVQCVQX-UHFFFAOYSA-N 0.000 description 2
- 150000005007 4-aminopyrimidines Chemical class 0.000 description 2
- JMKPHIMALWSTIB-UHFFFAOYSA-N 4-chloro-6-cyclopropyl-5-methoxypyrimidine Chemical compound COC1=C(Cl)N=CN=C1C1CC1 JMKPHIMALWSTIB-UHFFFAOYSA-N 0.000 description 2
- BCAFVZMXQPSPBS-UHFFFAOYSA-N 4-cyclopropyl-5-methoxy-1H-pyrimidin-6-one Chemical compound COC=1C(=NC=NC1C1CC1)O BCAFVZMXQPSPBS-UHFFFAOYSA-N 0.000 description 2
- OZGRATZTUWTAJK-UHFFFAOYSA-N 6-cyclopropyl-5-methyl-1h-pyrimidin-4-one Chemical compound N1C=NC(=O)C(C)=C1C1CC1 OZGRATZTUWTAJK-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229960001866 silicon dioxide Drugs 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UEFGLENGHNNEBY-UHFFFAOYSA-N 1-methoxyethanol hydrate Chemical compound O.COC(C)O UEFGLENGHNNEBY-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- YYUIMZNMVAXGKZ-UHFFFAOYSA-N 2-cyclopropyl-4-hydroxy-5-methyl-1h-pyrimidin-6-one Chemical compound N1=C(O)C(C)=C(O)N=C1C1CC1 YYUIMZNMVAXGKZ-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- AEKXEKPMZIZYLD-UHFFFAOYSA-N 4,6-dichloro-2-cyclopropyl-5-methylpyrimidine Chemical compound N1=C(Cl)C(C)=C(Cl)N=C1C1CC1 AEKXEKPMZIZYLD-UHFFFAOYSA-N 0.000 description 1
- UHSNPJFTQQFRHM-UHFFFAOYSA-N 4-chloro-2-cyclopropyl-5-methyl-6-methylsulfanylpyrimidine Chemical compound ClC1=C(C)C(SC)=NC(C2CC2)=N1 UHSNPJFTQQFRHM-UHFFFAOYSA-N 0.000 description 1
- OMJQORKEDYNAQP-UHFFFAOYSA-N 4-chloro-6-cyclopropyl-2,5-dimethylpyrimidine Chemical compound CC1=NC(Cl)=C(C)C(C2CC2)=N1 OMJQORKEDYNAQP-UHFFFAOYSA-N 0.000 description 1
- AOLHBMGNCCHHAE-UHFFFAOYSA-N 4-chloro-6-cyclopropyl-5-methylpyrimidine Chemical compound CC1=C(Cl)N=CN=C1C1CC1 AOLHBMGNCCHHAE-UHFFFAOYSA-N 0.000 description 1
- CCBGCVWONHQIHN-UHFFFAOYSA-N 4-cyclopentyl-1H-pyrimidin-6-one Chemical compound N1C=NC(=O)C=C1C1CCCC1 CCBGCVWONHQIHN-UHFFFAOYSA-N 0.000 description 1
- YTEXGMWZKIEJKF-UHFFFAOYSA-N 4-cyclopropyl-2,5-dimethyl-1H-pyrimidin-6-one Chemical compound C1(CC1)C1=C(C(=NC(=N1)C)O)C YTEXGMWZKIEJKF-UHFFFAOYSA-N 0.000 description 1
- SDIGUJXNZFETMM-UHFFFAOYSA-N 5-chloro-6-cyclopropyl-1h-pyrimidin-4-one Chemical compound OC1=NC=NC(C2CC2)=C1Cl SDIGUJXNZFETMM-UHFFFAOYSA-N 0.000 description 1
- HFMLLTVIMFEQRE-UHFFFAOYSA-N 6-amino-1h-pyrimidin-4-one Chemical class NC1=CC(O)=NC=N1 HFMLLTVIMFEQRE-UHFFFAOYSA-N 0.000 description 1
- DUKKRSPKJMHASP-UHFFFAOYSA-N 6-chloropyrimidin-4-amine Chemical class NC1=CC(Cl)=NC=N1 DUKKRSPKJMHASP-UHFFFAOYSA-N 0.000 description 1
- ZCBSUUFNOFEDES-UHFFFAOYSA-N 6-cyclopropyl-1h-pyrimidin-4-one Chemical compound C1=NC(O)=CC(C2CC2)=N1 ZCBSUUFNOFEDES-UHFFFAOYSA-N 0.000 description 1
- GZIGMQWOMSKGIL-UHFFFAOYSA-N 6-cyclopropyl-2-methoxy-5-methyl-1h-pyrimidin-4-one Chemical compound COC1=NC(O)=C(C)C(C2CC2)=N1 GZIGMQWOMSKGIL-UHFFFAOYSA-N 0.000 description 1
- YWUKTCXFPCHIBZ-UHFFFAOYSA-N 6-cyclopropyl-2-methyl-1h-pyrimidin-4-one Chemical class CC1=NC(O)=CC(C2CC2)=N1 YWUKTCXFPCHIBZ-UHFFFAOYSA-N 0.000 description 1
- ATMZBFIDDBCNMF-UHFFFAOYSA-N 6-cyclopropyl-5-methyl-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound N1C(=S)NC(=O)C(C)=C1C1CC1 ATMZBFIDDBCNMF-UHFFFAOYSA-N 0.000 description 1
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 241000293871 Salmonella enterica subsp. enterica serovar Typhi Species 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- SJORUMVWJYXAMB-UHFFFAOYSA-M [Cl-].C1(CC1)C1=C(C(=NC=N1)[N+](C)(C)C)OC Chemical compound [Cl-].C1(CC1)C1=C(C(=NC=N1)[N+](C)(C)C)OC SJORUMVWJYXAMB-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-N anhydrous cyanoacetic acid Natural products OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- FXFPOKGPAPEJNE-UHFFFAOYSA-N cyclopropanecarboximidamide Chemical compound NC(=N)C1CC1 FXFPOKGPAPEJNE-UHFFFAOYSA-N 0.000 description 1
- JRYOZJIRAVZGMV-UHFFFAOYSA-N cyclopropanecarboximidamide;hydron;chloride Chemical compound Cl.NC(=N)C1CC1 JRYOZJIRAVZGMV-UHFFFAOYSA-N 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- UPQZOUHVTJNGFK-UHFFFAOYSA-N diethyl 2-methylpropanedioate Chemical compound CCOC(=O)C(C)C(=O)OCC UPQZOUHVTJNGFK-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 230000003203 everyday effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000002035 hexane extract Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- NSTYNSYJZYEURI-UHFFFAOYSA-N n-pyrimidin-4-ylnitramide Chemical class [O-][N+](=O)NC1=CC=NC=N1 NSTYNSYJZYEURI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- FKRCODPIKNYEAC-UHFFFAOYSA-N propionic acid ethyl ester Natural products CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229950000329 thiouracil Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/69—Benzenesulfonamido-pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH399066A CH472412A (de) | 1966-03-17 | 1966-03-17 | Verfahren zur Herstellung von neuen Derivaten des Sulfanilamids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119412B true NO119412B (xx) | 1970-05-19 |
Family
ID=4267733
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO16732567A NO119412B (xx) | 1966-03-17 | 1967-03-16 |
Country Status (13)
| Country | Link |
|---|---|
| AT (1) | AT268291B (xx) |
| BE (1) | BE695624A (xx) |
| CH (1) | CH472412A (xx) |
| DE (1) | DE1695012B2 (xx) |
| DK (1) | DK113290B (xx) |
| ES (1) | ES338115A1 (xx) |
| FR (2) | FR1514738A (xx) |
| GB (1) | GB1187612A (xx) |
| GR (1) | GR36362B (xx) |
| IL (1) | IL27621A (xx) |
| NL (1) | NL146494B (xx) |
| NO (1) | NO119412B (xx) |
| SE (1) | SE329854B (xx) |
-
1966
- 1966-03-17 CH CH399066A patent/CH472412A/de not_active IP Right Cessation
-
1967
- 1967-03-16 NL NL6703977A patent/NL146494B/xx unknown
- 1967-03-16 NO NO16732567A patent/NO119412B/no unknown
- 1967-03-16 GR GR670136362A patent/GR36362B/el unknown
- 1967-03-16 AT AT255567A patent/AT268291B/de active
- 1967-03-16 IL IL2762167A patent/IL27621A/en unknown
- 1967-03-16 DK DK137267A patent/DK113290B/da unknown
- 1967-03-16 BE BE695624D patent/BE695624A/xx unknown
- 1967-03-16 GB GB02358/67A patent/GB1187612A/en not_active Expired
- 1967-03-16 DE DE1967G0049594 patent/DE1695012B2/de active Granted
- 1967-03-16 SE SE366867A patent/SE329854B/xx unknown
- 1967-03-16 ES ES338115A patent/ES338115A1/es not_active Expired
- 1967-03-16 FR FR99070A patent/FR1514738A/fr not_active Expired
- 1967-06-15 FR FR110529A patent/FR6674M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH472412A (de) | 1969-05-15 |
| IL27621A (en) | 1971-10-20 |
| SE329854B (xx) | 1970-10-26 |
| ES338115A1 (es) | 1968-06-16 |
| DK113290B (da) | 1969-03-10 |
| GB1187612A (en) | 1970-04-08 |
| NL146494B (nl) | 1975-07-15 |
| BE695624A (xx) | 1967-09-18 |
| NL6703977A (xx) | 1967-09-18 |
| FR6674M (xx) | 1969-02-03 |
| DE1695012B2 (de) | 1976-04-15 |
| FR1514738A (fr) | 1968-02-23 |
| GR36362B (el) | 1969-02-04 |
| AT268291B (de) | 1969-02-10 |
| DE1695012A1 (de) | 1971-04-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Naveena et al. | Synthesis, characterization and antimicrobial activity of some disubstituted 1, 3, 4-oxadiazoles carrying 2-(aryloxymethyl) phenyl moiety | |
| KR100460828B1 (ko) | 구아니딘유도체의제조방법,이의중간체및이의제조방법 | |
| US10160770B2 (en) | Method for preparing thienopyrimidine compound and intermediates used therein | |
| DK2401253T3 (en) | Method for producing etoricoxib | |
| US2697710A (en) | Pyrido (2,3-d) pyrimidines and method of preparing same | |
| Liu et al. | Novel synthesis approach and antiplatelet activity evaluation of 6-alkylamino-2, 4-dialkyl (aryl) thiopyrimidines | |
| NO119412B (xx) | ||
| NO167325B (no) | Anordning ved ovn for fast og flytende brensel. | |
| US9365486B2 (en) | Synthesis of calebin-A and its biologically active analogs | |
| CS231979B2 (en) | Manufacturing process of 2-substituted 4-substituted5-thiazolcarboxylacides | |
| US3328395A (en) | 6-halo-2-amino substituted-4-sulfanilamido-pyrimidine compounds | |
| US2843594A (en) | Substituted isonicotinic acid amides | |
| US2453564A (en) | Ureylenethiophane carboxylic acids and esters and methods of preparing same | |
| US3505331A (en) | Process for preparing 2,4-diamino-7-chloropyrido(2,3-d)pyrimidines | |
| Shimadzu et al. | Studies on furan derivatives. XIV. Nucleophilic substitution of methyl 5‐nitro‐2‐furancarboxylate and 5‐Nitrofuran‐2‐nitrile | |
| US5523404A (en) | Process for preparing 5-chloro-4-hydroxypyrimidines | |
| CA3036936A1 (en) | Optimized production method for a 2-acyliminopyridine pest control agent | |
| US3158618A (en) | Nu-(acylamino)-ephedrines | |
| US20140005406A1 (en) | Processes for the production of n-substituted sulfoximine pyridine n-oxides | |
| NO782455L (no) | Fremgangsmaate for fremstilling av farmakologisk aktive amidino-benzylpyrimidiner | |
| SU576045A3 (ru) | Способ получени производных пиримидина | |
| CN116655601A (zh) | 一种奥希替尼的合成方法 | |
| NO122651B (xx) | ||
| KR100371590B1 (ko) | 2-클로로피리딘의 제조방법 | |
| JPS6250467B2 (xx) |