NO119160B - - Google Patents
Download PDFInfo
- Publication number
- NO119160B NO119160B NO167614A NO16761467A NO119160B NO 119160 B NO119160 B NO 119160B NO 167614 A NO167614 A NO 167614A NO 16761467 A NO16761467 A NO 16761467A NO 119160 B NO119160 B NO 119160B
- Authority
- NO
- Norway
- Prior art keywords
- salt
- solution
- magnesium
- amine
- potassium
- Prior art date
Links
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 23
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 14
- 239000002244 precipitate Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 8
- 159000000003 magnesium salts Chemical class 0.000 claims description 6
- 238000003756 stirring Methods 0.000 claims description 6
- 239000001569 carbon dioxide Substances 0.000 claims description 5
- PALNZFJYSCMLBK-UHFFFAOYSA-K magnesium;potassium;trichloride;hexahydrate Chemical compound O.O.O.O.O.O.[Mg+2].[Cl-].[Cl-].[Cl-].[K+] PALNZFJYSCMLBK-UHFFFAOYSA-K 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000011777 magnesium Substances 0.000 description 18
- 239000000243 solution Substances 0.000 description 18
- 150000001412 amines Chemical class 0.000 description 13
- 229910052700 potassium Inorganic materials 0.000 description 12
- 229910052749 magnesium Inorganic materials 0.000 description 10
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 8
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 8
- 239000011591 potassium Substances 0.000 description 8
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 7
- 239000012452 mother liquor Substances 0.000 description 7
- 238000011084 recovery Methods 0.000 description 5
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 4
- 239000001095 magnesium carbonate Substances 0.000 description 4
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 4
- 239000001103 potassium chloride Substances 0.000 description 4
- 235000011164 potassium chloride Nutrition 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- -1 Amine bicarbonate Chemical class 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000003595 primary aliphatic amine group Chemical group 0.000 description 2
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 2
- 239000013049 sediment Substances 0.000 description 2
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 1
- 229960002327 chloral hydrate Drugs 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/707—1,2,3- or 1,2,4-triazines; Hydrogenated 1,2,3- or 1,2,4-triazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1542873A DE1542873C3 (de) | 1966-04-16 | 1966-04-16 | Herbizides Mittel auf Basis von 4-Amino-1,2,4-triazin-5-onen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119160B true NO119160B (cs) | 1970-03-31 |
Family
ID=7102599
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO167614A NO119160B (cs) | 1966-04-16 | 1967-04-07 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3671523A (cs) |
| AT (1) | AT272752B (cs) |
| BE (1) | BE697083A (cs) |
| BR (1) | BR6788360D0 (cs) |
| CA (1) | CA1135696A (cs) |
| CH (1) | CH495110A (cs) |
| DK (1) | DK122053B (cs) |
| ES (1) | ES339293A1 (cs) |
| FI (1) | FI44177C (cs) |
| FR (1) | FR1519180A (cs) |
| GB (4) | GB1182801A (cs) |
| IL (1) | IL27589A (cs) |
| MY (4) | MY7100022A (cs) |
| NL (1) | NL6705318A (cs) |
| NO (1) | NO119160B (cs) |
| SE (1) | SE326337B (cs) |
| YU (2) | YU39440B (cs) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4589913A (en) * | 1985-03-25 | 1986-05-20 | Shell Oil Company | Alkoxycarbonylthiamino-substituted triazinones |
| US3966715A (en) * | 1966-04-16 | 1976-06-29 | Bayer Aktiengesellschaft | Herbicidal agents |
| US4346220A (en) | 1966-11-28 | 1982-08-24 | E. I. Du Pont De Nemours And Company | 1,2,4-Triazin-5-ones |
| DE1815145A1 (de) * | 1968-12-17 | 1970-07-02 | Bayer Ag | Totalherbizide Mittel |
| US4032324A (en) * | 1968-12-17 | 1977-06-28 | Bayer Aktiengesellschaft | Synergistic herbicidal composition for the control of weeds |
| US3907543A (en) * | 1971-02-18 | 1975-09-23 | Bayer Ag | 4-Amino-1,2,4-triazine-5-one novel compounds, a process for their production and herbicidal compositions |
| BE786840A (fr) * | 1971-07-29 | 1973-01-29 | Bayer Ag | Procede de preparation de 1,2,4-triazine -5-ones |
| DE2238206C2 (de) * | 1972-08-03 | 1985-05-02 | Bayer Ag, 5090 Leverkusen | Azomethine von 4-Amino-5-H-1,2,4-triazin-5-onen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
| DE2346936C2 (de) * | 1973-09-18 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von neuen 3,4-Dihydro-1,2,4-triazinen sowie drei Verbindungen dieses Typs und deren Verwendung |
| US3897429A (en) * | 1973-11-19 | 1975-07-29 | Du Pont | Thiol methylation with methyl bromide |
| US3905973A (en) * | 1973-11-19 | 1975-09-16 | Du Pont | Thiol methylation with methyl chloride |
| DE2417511A1 (de) * | 1974-04-10 | 1975-10-30 | Bayer Ag | 6-sec.-butyl-1,2,4-triazin-5(4h)-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| US3890317A (en) * | 1974-06-13 | 1975-06-17 | Du Pont | Process for s-methylation of 4-amino-6-t-butyl-3-mercapto-1,2,4-triazin-5-one |
| US3986862A (en) * | 1974-07-03 | 1976-10-19 | E. I. Du Pont De Nemours And Company | Emulsifiable liquid concentrates containing 4-amino-6-t-butyl-3-(methylthio)-1,2,4-triazin-5-one and 2-chloro-n-(2,6-diethylphenyl)-n-methoxymethylacetamide |
| JPS51125747A (en) * | 1975-02-14 | 1976-11-02 | Sumitomo Chem Co Ltd | Aherbicidal and non-medical germicide |
| DE2517654A1 (de) * | 1975-04-22 | 1976-11-04 | Bayer Ag | 4-amino-5-thion-1,2,4-triazine, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| US4067724A (en) * | 1975-09-13 | 1978-01-10 | Bayer Aktiengesellschaft | N-(1,2,4-Triazin-5-on-4-yl)-glycines and herbicidal compositions |
| DE2543974A1 (de) * | 1975-10-02 | 1977-04-14 | Bayer Ag | Mittel zur selektiven unkrautbekaempfung in getreide |
| DE2647460C2 (de) * | 1976-10-21 | 1985-02-07 | Bayer Ag, 5090 Leverkusen | 4-Amino-6-(thien-2-yl)-1,2,4-triazin-5-one, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
| CA1115079A (en) * | 1978-12-22 | 1981-12-29 | Uniroyal, Inc. | Synergistic herbicidal composition |
| US4252944A (en) | 1980-03-24 | 1981-02-24 | Wiley Richard H | 4-Amino-6-(2-carboxyphenyl)-3-mercapto-1,2,4-triazin-5(4H)-one |
| FR2482421B1 (fr) * | 1980-05-19 | 1985-08-02 | Slovenska Akademia Vied | Agent permettant d'augmenter la recolte de produits agricoles |
| DE3037300A1 (de) | 1980-10-02 | 1982-05-27 | Bayer Ag, 5090 Leverkusen | Substituierte 6-halogen-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| CA1167269A (en) * | 1980-11-04 | 1984-05-15 | Ludwig Eue | Selectively herbicidal 4-amino-6-tert.-butyl-3- ethylthio-1,2,4-triazin-5(4h)-one |
| DE3106707A1 (de) * | 1981-02-23 | 1982-09-09 | Degussa Ag, 6000 Frankfurt | Herbizid wirksames 1,2,4-triazin-5-on-derivat |
| DE3135413A1 (de) * | 1981-09-07 | 1983-03-24 | Bayer Ag, 5090 Leverkusen | "azomethine von 4-amino-6-halogen-tert.-butyl-1,2,4 -triazin-5-onen, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide" |
| DE3135392A1 (de) * | 1981-09-07 | 1983-03-17 | Bayer Ag, 5090 Leverkusen | "substituierte 6-alkoxy-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide" |
| US4345075A (en) * | 1981-09-10 | 1982-08-17 | Wiley Richard H | 4-Amino-6-(2'-carboxyethyl)-3-methylthio-1,2,4-triazin-5(4H)-one |
| DE3146299A1 (de) * | 1981-11-17 | 1983-06-01 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Thiazolo- und (1,3)thiazino(2,3-c)(1,2,4)triazinone mit selektiver herbizider wirkung sowie verfahren zur herstellung dieser verbindungen |
| DE3201110A1 (de) * | 1982-01-15 | 1983-07-28 | Bayer Ag, 5090 Leverkusen | 3-alken(in)yl-mercapto(amino)-4-amino-6-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihrer verwendung als herbizide |
| DE3231061A1 (de) * | 1982-08-20 | 1984-02-23 | Bayer Ag, 5090 Leverkusen | Mittel zur selektiven unkrautbekaempfung |
| DE3463141D1 (en) * | 1983-01-12 | 1987-05-21 | Ciba Geigy Ag | Herbicidal triazine derivative, process for its preparation, products containing it, their application, and a preparation intermediate, its preparation and its application |
| DE3323933A1 (de) * | 1983-07-02 | 1985-01-03 | Bayer Ag, 5090 Leverkusen | 6-cyclobutyl-1,2,4-triazin-5-on-derivate |
| ATE40124T1 (de) * | 1984-01-11 | 1989-02-15 | Ciba Geigy Ag | Herbizide und insektizide triazinone. |
| DE3403332A1 (de) * | 1984-02-01 | 1985-08-01 | Bayer Ag, 5090 Leverkusen | Selektiv-herbizide mittel auf triazinon-basis |
| US4925483A (en) * | 1984-04-03 | 1990-05-15 | Mobay Corporation | Triazinone synergistic compositions |
| HU196892B (en) * | 1984-06-12 | 1989-02-28 | Fmc Corp | Herbicides containing as active substance derivatives of 2-phenil-1,2,4-triasine-3,5-dion and process for production of these derivatives |
| US4783531A (en) * | 1984-07-18 | 1988-11-08 | Mobay Corporation | Production of S-substituted isothioureas |
| GB2167959B (en) * | 1984-12-08 | 1988-03-02 | Bayer Ag | Combination of pyridoxyphenoxypropionate and triazinone as selective weed killer |
| US4759795A (en) * | 1984-12-13 | 1988-02-26 | E. I. Du Pont De Nemours And Company | Process for preparing herbicidal N-methylol derivatives of 4-amino-1,2,4-triazine-5-ones |
| US4632694A (en) * | 1985-05-31 | 1986-12-30 | E. I. Du Pont De Nemours And Company | Asymmetrical triazine salts |
| US4820336A (en) * | 1987-01-07 | 1989-04-11 | E. I. Du Pont De Nemours And Company | Herbicidal spray mixtures |
| DE3710255A1 (de) * | 1987-03-28 | 1988-10-13 | Bayer Ag | Neue 3,4,6-trisubstituierte 1,2,4-triazin-5 (4h)-one |
| DE3917044A1 (de) * | 1989-05-25 | 1990-12-06 | Bayer Ag | 6-(pent-3-yl)-1,2,4-triazin-5(4h)-one, verfahren zu ihrer herstellung und ihre verwendung als herbizide und pflanzenwachstumsregulatoren |
| US5440038A (en) * | 1993-12-07 | 1995-08-08 | Miles Inc. | Process for the purification of substituted 4-amino-1,2,4-triazine-5-ones |
| DE19638886B4 (de) * | 1996-09-23 | 2006-03-23 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von Metribuzin und substituierten Imidazo [1,2-a]pyridin-3-yl-sulfonylverbindungen |
| US20060141036A1 (en) * | 1997-12-12 | 2006-06-29 | Andrx Labs Llc | HMG-CoA reductase inhibitor extended release formulation |
| US20040029962A1 (en) * | 1997-12-12 | 2004-02-12 | Chih-Ming Chen | HMG-COA reductase inhibitor extended release formulation |
| EP1077954A1 (de) * | 1998-05-20 | 2001-02-28 | Basf Aktiengesellschaft | Substituierte 6-aryl-3-thioxo-5-(thi)oxo-2,3,4,5-tetrahydro-1,2,4-triazine |
| PL362894A1 (en) | 1999-11-17 | 2004-11-02 | Bayer Aktiengesellschaft | Selective herbicides based upon 2,6-disubstituted pyridine derivatives |
| AU2002354850B2 (en) | 2001-07-18 | 2008-02-28 | Merck Patent Gmbh | 4-(benzylidene-amino)-3-(methylsulfanyl)-4H-(1, 2, 4) triazin-5-one derivatives having a PDE-IV inhibiting and TNF-antagonistic effect for the treatment of cardiac diseases and allergies |
| DE10212887A1 (de) * | 2002-03-22 | 2003-10-02 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten Aminotriazinonen und substituierten Benzoylcyclohexandionen |
| US6852857B2 (en) | 2002-05-16 | 2005-02-08 | Bayer Materialscience Llc | Method of preparing substituted 4-amino-3-alkylthio-1,2,4-triazine-5-ones |
| DE10236919A1 (de) * | 2002-08-12 | 2004-02-26 | Bayer Ag | Verfahren zur Herstellung von 3,3-Dimethyl-2-oxobuttersäure |
| US8023280B2 (en) | 2003-07-28 | 2011-09-20 | Qualcomm Incorporated | Communication circuit for driving a plurality of devices |
| EP1748761A4 (en) * | 2004-05-27 | 2011-10-12 | Dexcel Pharma Technologies Ltd | REGULATED AND LOCALIZED ABSORPTION OF STATINS IN THE GASTROINTESTINAL TRACT TO OBTAIN HIGH BLOOD RATE OF STATINS |
| CA2588215A1 (en) * | 2004-11-22 | 2006-05-26 | Dexcel Pharma Technologies Ltd. | Controlled absorption of statins in the intestine |
| EP1863449A2 (en) * | 2005-03-28 | 2007-12-12 | Dexcel Pharma Technologies Ltd. | Controlled absorption of statins in the intestine |
| WO2008044236A2 (en) * | 2006-10-10 | 2008-04-17 | Dexcel Pharma Technologies Ltd. | Improved release of statins in the intestine |
| EA201891011A1 (ru) | 2015-10-22 | 2018-10-31 | Адама Аган Лтд. | Гербицидная смесь и композиция для применения на картофеле |
| WO2025016885A1 (en) | 2023-07-20 | 2025-01-23 | Syngenta Crop Protection Ag | Herbicidal compositions |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670912C3 (de) * | 1967-08-18 | 1981-06-11 | Bayer Ag, 5090 Leverkusen | Herbizide Mittel auf Basis von 1,2,4-Triazin-5-onen |
-
1967
- 1967-03-07 CH CH332067A patent/CH495110A/de not_active IP Right Cessation
- 1967-03-13 IL IL27589A patent/IL27589A/xx unknown
- 1967-03-31 DK DK191667AA patent/DK122053B/da not_active IP Right Cessation
- 1967-04-07 NO NO167614A patent/NO119160B/no unknown
- 1967-04-07 BR BR188360/67A patent/BR6788360D0/pt unknown
- 1967-04-13 FI FI671087A patent/FI44177C/fi active
- 1967-04-13 AT AT348067A patent/AT272752B/de active
- 1967-04-14 NL NL6705318A patent/NL6705318A/xx unknown
- 1967-04-14 SE SE05240/67A patent/SE326337B/xx unknown
- 1967-04-14 GB GB07266/67A patent/GB1182801A/en not_active Expired
- 1967-04-14 GB GB06485/69A patent/GB1182802A/en not_active Expired
- 1967-04-14 GB GB06486/69A patent/GB1182803A/en not_active Expired
- 1967-04-14 FR FR102806A patent/FR1519180A/fr not_active Expired
- 1967-04-14 ES ES339293A patent/ES339293A1/es not_active Expired
- 1967-04-14 BE BE697083D patent/BE697083A/xx not_active IP Right Cessation
- 1967-04-14 GB GB06487/69A patent/GB1182804A/en not_active Expired
-
1970
- 1970-01-28 US US6647A patent/US3671523A/en not_active Expired - Lifetime
- 1970-11-23 CA CA000098810A patent/CA1135696A/en not_active Expired
-
1971
- 1971-12-31 MY MY197122A patent/MY7100022A/xx unknown
- 1971-12-31 MY MY197123A patent/MY7100023A/xx unknown
- 1971-12-31 MY MY197121A patent/MY7100021A/xx unknown
- 1971-12-31 MY MY197124A patent/MY7100024A/xx unknown
-
1979
- 1979-06-11 YU YU1360/79A patent/YU39440B/xx unknown
- 1979-06-11 YU YU01361/79A patent/YU136179A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MY7100024A (en) | 1971-12-31 |
| YU39440B (en) | 1984-12-31 |
| US3671523A (en) | 1972-06-20 |
| YU136179A (en) | 1982-08-31 |
| GB1182802A (en) | 1970-03-04 |
| CA1135696A (en) | 1982-11-16 |
| FR1519180A (fr) | 1968-03-29 |
| BR6788360D0 (pt) | 1973-12-26 |
| GB1182804A (en) | 1970-03-04 |
| MY7100023A (en) | 1971-12-31 |
| FI44177C (fi) | 1971-09-10 |
| MY7100022A (en) | 1971-12-31 |
| DK122053B (da) | 1972-01-17 |
| FI44177B (cs) | 1971-06-01 |
| SE326337B (cs) | 1970-07-20 |
| AT272752B (de) | 1969-07-25 |
| IL27589A (en) | 1971-08-25 |
| NL6705318A (cs) | 1967-10-17 |
| GB1182801A (en) | 1970-03-04 |
| CH495110A (de) | 1970-08-31 |
| GB1182803A (en) | 1970-03-04 |
| MY7100021A (en) | 1971-12-31 |
| YU136079A (en) | 1982-08-31 |
| BE697083A (cs) | 1967-10-16 |
| ES339293A1 (es) | 1968-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO119160B (cs) | ||
| NO118198B (cs) | ||
| GB1474446A (en) | Process for the manufacture of chlorine and sodium carbonate | |
| KR20010034850A (ko) | 황산칼륨 제조방법 | |
| NO791794L (no) | Chelatiseringsmiddel og chelater. | |
| US4195070A (en) | Preparation of a MgCl2 solution for Nalco's MgCl2 process from MgSO4 and other MgSO4 salts | |
| US2719075A (en) | Purification of alkali metal sulfite liquors | |
| US789671A (en) | Process of making alkaline fluosilicates. | |
| US4277447A (en) | Process for reducing calcium ion concentrations in alkaline alkali metal chloride brines | |
| US2403939A (en) | Process for treatment of dolomite and high-calcic limestones | |
| CN110078097A (zh) | 一种速溶解复分解法制备硝酸钾的工艺 | |
| US1838587A (en) | Process of distilling ammoniacal liquors | |
| US4789686A (en) | Process for the preparation of an aqueous solution of the sodium salt of methionine | |
| US1475563A (en) | Purification of brines | |
| US1836427A (en) | Process of producing sodium bicarbonate and sodium sulphate dekahydrate from mixtures of sodium sulphate and sodium carbonate | |
| US2002681A (en) | Process for the production of potassium carbamate | |
| US1710636A (en) | Process for manufacturing sodium bicarbonate and ammonium chloride | |
| US2905529A (en) | Preparation of engel's salt | |
| US2710789A (en) | Method of preparing substantially pure potassium nitrate | |
| US1971754A (en) | Manufacture of sodium sulphate | |
| US1198241A (en) | Treatment of zinc solutions for the recovery of the metal therefrom. | |
| US4294813A (en) | Process for forming calcium nitrite | |
| GB402382A (en) | Improvements in method of making mono-chloramine | |
| GB176400A (en) | Improvements in the recovery of ammonia in the ammonia soda process | |
| US1606767A (en) | Process of separating hydrogen cyanide, ammonia, and carbon dioxide from gas mixtures containing them |