NO119130B - - Google Patents
Download PDFInfo
- Publication number
- NO119130B NO119130B NO166058A NO16605866A NO119130B NO 119130 B NO119130 B NO 119130B NO 166058 A NO166058 A NO 166058A NO 16605866 A NO16605866 A NO 16605866A NO 119130 B NO119130 B NO 119130B
- Authority
- NO
- Norway
- Prior art keywords
- charge
- sleeve
- fire
- ignition
- propellant
- Prior art date
Links
- 239000003380 propellant Substances 0.000 claims description 21
- 239000000126 substance Substances 0.000 claims description 19
- 239000003721 gunpowder Substances 0.000 claims description 12
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 claims description 3
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 claims description 3
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 claims description 3
- 229910052939 potassium sulfate Inorganic materials 0.000 claims description 3
- 235000011151 potassium sulphates Nutrition 0.000 claims description 3
- 229910002651 NO3 Inorganic materials 0.000 claims description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 2
- 239000000843 powder Substances 0.000 description 6
- 238000007792 addition Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000010304 firing Methods 0.000 description 4
- 239000000654 additive Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- PHFQLYPOURZARY-UHFFFAOYSA-N chromium trinitrate Chemical compound [Cr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PHFQLYPOURZARY-UHFFFAOYSA-N 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000001120 potassium sulphate Substances 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- 229910001936 tantalum oxide Inorganic materials 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229910021563 chromium fluoride Inorganic materials 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- IRXRGVFLQOSHOH-UHFFFAOYSA-L dipotassium;oxalate Chemical compound [K+].[K+].[O-]C(=O)C([O-])=O IRXRGVFLQOSHOH-UHFFFAOYSA-L 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910000476 molybdenum oxide Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical compound [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 description 1
- CMOAHYOGLLEOGO-UHFFFAOYSA-N oxozirconium;dihydrochloride Chemical compound Cl.Cl.[Zr]=O CMOAHYOGLLEOGO-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- SQTLECAKIMBJGK-UHFFFAOYSA-I potassium;titanium(4+);pentafluoride Chemical compound [F-].[F-].[F-].[F-].[F-].[K+].[Ti+4] SQTLECAKIMBJGK-UHFFFAOYSA-I 0.000 description 1
- TVXXNOYZHKPKGW-UHFFFAOYSA-N sodium molybdate (anhydrous) Chemical compound [Na+].[Na+].[O-][Mo]([O-])(=O)=O TVXXNOYZHKPKGW-UHFFFAOYSA-N 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 description 1
- 150000004655 tetrazenes Chemical class 0.000 description 1
- XTXFDUABTPNTFB-UHFFFAOYSA-K trifluoroalumane;hydrate Chemical compound O.F[Al](F)F XTXFDUABTPNTFB-UHFFFAOYSA-K 0.000 description 1
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 description 1
- -1 trizinate Substances 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/0807—Primers; Detonators characterised by the particular configuration of the transmission channels from the priming energy source to the charge to be ignited, e.g. multiple channels, nozzles, diaphragms or filters
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42B—EXPLOSIVE CHARGES, e.g. FOR BLASTING, FIREWORKS, AMMUNITION
- F42B5/00—Cartridge ammunition, e.g. separately-loaded propellant charges
- F42B5/26—Cartridge cases
- F42B5/36—Cartridge cases modified for housing an integral firing-cap
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F42—AMMUNITION; BLASTING
- F42C—AMMUNITION FUZES; ARMING OR SAFETY MEANS THEREFOR
- F42C19/00—Details of fuzes
- F42C19/08—Primers; Detonators
- F42C19/0823—Primers or igniters for the initiation or the propellant charge in a cartridged ammunition
- F42C19/083—Primers or igniters for the initiation or the propellant charge in a cartridged ammunition characterised by the shape and configuration of the base element embedded in the cartridge bottom, e.g. the housing for the squib or percussion cap
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Air Bags (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Portable Nailing Machines And Staplers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0049033 | 1965-12-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119130B true NO119130B (ref) | 1970-03-23 |
Family
ID=7051611
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO166058A NO119130B (ref) | 1965-12-28 | 1966-12-19 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3446146A (ref) |
| BE (1) | BE691838A (ref) |
| DE (1) | DE1453837B2 (ref) |
| DK (1) | DK122689B (ref) |
| FR (1) | FR1506813A (ref) |
| GB (1) | GB1156367A (ref) |
| NL (1) | NL6617578A (ref) |
| NO (1) | NO119130B (ref) |
| SE (1) | SE312744B (ref) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3613588A (en) * | 1969-08-04 | 1971-10-19 | Forsvarets Fabriksverk | Replaceable ignition unit for a recoilless gun cartridge |
| US4162645A (en) * | 1970-02-20 | 1979-07-31 | Aai Corporation | Method of making a cartridge |
| DE2709247C2 (de) * | 1977-03-03 | 1984-10-11 | Rheinmetall GmbH, 4000 Düsseldorf | Verfahren zur Gewährleistung einer vorbestimmten Lebensdauer eines Waffenrohrs |
| FR2679994B1 (fr) * | 1991-07-31 | 1995-02-17 | Giat Ind Sa | Dispositif d'allumage de la charge propulsive d'une munition, notamment telescopee, et munition initiee par un tel dispositif d'allumage. |
| GB9321016D0 (en) * | 1993-10-12 | 1993-12-01 | Chetcuti Francis | Recoil reducer for cartridges or other ammunition |
| US5710391A (en) * | 1993-10-12 | 1998-01-20 | Chetcuti; Francis | Recoil reducer wad for ammunition |
| US6385887B1 (en) * | 2000-06-07 | 2002-05-14 | Kenneth E. Johnston | Muzzle loading firearm and adaptor |
| US11047664B2 (en) | 2010-11-10 | 2021-06-29 | True Velocity Ip Holdings, Llc | Lightweight polymer ammunition cartridge casings |
| US11313654B2 (en) | 2010-11-10 | 2022-04-26 | True Velocity Ip Holdings, Llc | Polymer ammunition having a projectile made by metal injection molding |
| US9885551B2 (en) | 2010-11-10 | 2018-02-06 | True Velocity, Inc. | Subsonic polymeric ammunition |
| US11231257B2 (en) | 2010-11-10 | 2022-01-25 | True Velocity Ip Holdings, Llc | Method of making a metal injection molded ammunition cartridge |
| US10480915B2 (en) | 2010-11-10 | 2019-11-19 | True Velocity Ip Holdings, Llc | Method of making a polymeric subsonic ammunition cartridge |
| US8561543B2 (en) | 2010-11-10 | 2013-10-22 | True Velocity, Inc. | Lightweight polymer ammunition cartridge casings |
| US10352670B2 (en) | 2010-11-10 | 2019-07-16 | True Velocity Ip Holdings, Llc | Lightweight polymer ammunition cartridge casings |
| US10876822B2 (en) | 2017-11-09 | 2020-12-29 | True Velocity Ip Holdings, Llc | Multi-piece polymer ammunition cartridge |
| US11340050B2 (en) | 2010-11-10 | 2022-05-24 | True Velocity Ip Holdings, Llc | Subsonic polymeric ammunition cartridge |
| US10408592B2 (en) | 2010-11-10 | 2019-09-10 | True Velocity Ip Holdings, Llc | One piece polymer ammunition cartridge having a primer insert and methods of making the same |
| US11300393B2 (en) | 2010-11-10 | 2022-04-12 | True Velocity Ip Holdings, Llc | Polymer ammunition having a MIM primer insert |
| US9557150B2 (en) * | 2013-06-20 | 2017-01-31 | Atlantis Manufacturing Management Services Proprietary Limited | Grenade round |
| RU2558533C1 (ru) * | 2014-06-04 | 2015-08-10 | Акционерное общество "Конструкторское бюро приборостроения им. академика А.Г. Шипунова" | Метательное устройство артиллерийского выстрела |
| US9835427B2 (en) * | 2016-03-09 | 2017-12-05 | True Velocity, Inc. | Two-piece primer insert for polymer ammunition |
| DE102017110871A1 (de) * | 2017-05-18 | 2018-11-22 | Rheinmetall Waffe Munition Gmbh | Antriebssystem für Patronenmunition |
| US10760882B1 (en) | 2017-08-08 | 2020-09-01 | True Velocity Ip Holdings, Llc | Metal injection molded ammunition cartridge |
| WO2020010096A1 (en) | 2018-07-06 | 2020-01-09 | True Velocity Ip Holdings, Llc | Multi-piece primer insert for polymer ammunition |
| AU2019299431B2 (en) | 2018-07-06 | 2023-06-15 | True Velocity Ip Holdings, Llc | Three-piece primer insert for polymer ammunition |
| US10495425B1 (en) * | 2018-10-04 | 2019-12-03 | United States Of America, As Represented By The Secretary Of The Navy | Thermoformed projectile cartridge |
| US10731957B1 (en) | 2019-02-14 | 2020-08-04 | True Velocity Ip Holdings, Llc | Polymer ammunition and cartridge having a convex primer insert |
| US10704879B1 (en) | 2019-02-14 | 2020-07-07 | True Velocity Ip Holdings, Llc | Polymer ammunition and cartridge having a convex primer insert |
| USD893666S1 (en) | 2019-03-11 | 2020-08-18 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| USD893668S1 (en) | 2019-03-11 | 2020-08-18 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| USD893665S1 (en) | 2019-03-11 | 2020-08-18 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| USD893667S1 (en) | 2019-03-11 | 2020-08-18 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| USD891570S1 (en) | 2019-03-12 | 2020-07-28 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose |
| USD891568S1 (en) | 2019-03-12 | 2020-07-28 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| USD892258S1 (en) | 2019-03-12 | 2020-08-04 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| USD891569S1 (en) | 2019-03-12 | 2020-07-28 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| USD891567S1 (en) | 2019-03-12 | 2020-07-28 | True Velocity Ip Holdings, Llc | Ammunition cartridge nose having an angled shoulder |
| US11512936B2 (en) | 2019-03-19 | 2022-11-29 | True Velocity Ip Holdings, Llc | Methods and devices metering and compacting explosive powders |
| USD894320S1 (en) | 2019-03-21 | 2020-08-25 | True Velocity Ip Holdings, Llc | Ammunition Cartridge |
| US10989510B2 (en) * | 2019-05-13 | 2021-04-27 | Spectre Enterprises, Inc. | Primer housing for firearms and other munitions |
| EP3999799A4 (en) | 2019-07-16 | 2023-07-26 | True Velocity IP Holdings, LLC | POLYMER AMMUNITION HAVING AN ALIGNMENT AIDS, CARTRIDGE AND METHOD OF MANUFACTURING THEREOF |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US431601A (en) * | 1890-07-08 | Wilhelm lorenz | ||
| US573897A (en) * | 1896-12-29 | Frederik mohr | ||
| US1005052A (en) * | 1908-01-24 | 1911-10-03 | Hudson Maxim | Method of minimizing erosion in ordnance and preventing flareback. |
| US2685252A (en) * | 1945-06-12 | 1954-08-03 | Remington Arms Co Inc | Primer |
| GB950607A (en) * | 1959-08-14 | 1964-02-26 | Military Training Device Co Ak | Improvements in or relating to ammunition cartridges |
-
1965
- 1965-12-28 DE DE19651453837 patent/DE1453837B2/de active Pending
-
1966
- 1966-12-14 NL NL6617578A patent/NL6617578A/xx unknown
- 1966-12-19 NO NO166058A patent/NO119130B/no unknown
- 1966-12-22 SE SE17620/66A patent/SE312744B/xx unknown
- 1966-12-23 DK DK666566AA patent/DK122689B/da unknown
- 1966-12-27 FR FR88988A patent/FR1506813A/fr not_active Expired
- 1966-12-27 US US604700A patent/US3446146A/en not_active Expired - Lifetime
- 1966-12-27 BE BE691838D patent/BE691838A/xx unknown
- 1966-12-28 GB GB58027/66A patent/GB1156367A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE312744B (ref) | 1969-07-21 |
| GB1156367A (en) | 1969-06-25 |
| DK122689B (da) | 1972-03-27 |
| BE691838A (ref) | 1967-05-29 |
| NL6617578A (ref) | 1967-06-29 |
| DE1453837B2 (de) | 1976-04-22 |
| FR1506813A (fr) | 1967-12-22 |
| DE1453837A1 (de) | 1969-05-29 |
| US3446146A (en) | 1969-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO119130B (ref) | ||
| NO20006413L (no) | Branngranat for harde mål | |
| US5400715A (en) | Two part ammunition round | |
| KR20020084292A (ko) | 대형 폭발성 표적의 파괴를 위한 발사체 | |
| US3137231A (en) | Chaff dispenser system | |
| US3351019A (en) | Primer charge | |
| US2597641A (en) | Pressure-operated starting device | |
| US4195550A (en) | Propellent charge igniter for caseless cartridges of separately loaded ammunition | |
| US5052302A (en) | Unpressurized combustible primer for cannon cartridges | |
| US10837741B2 (en) | Propellant charge container | |
| JP5236666B2 (ja) | 花火発射物の打上げ用燃焼室 | |
| NO148604B (no) | Brannbestandig lett skillevegg for rom i bygninger | |
| US11125541B2 (en) | Modular charge container | |
| US3563178A (en) | Mechanical primer | |
| NO166058B (no) | Broennalarm. | |
| GB2199122A (en) | An army mortar shell | |
| US1436248A (en) | Incendiary bomb | |
| GB330493A (en) | Improvements in rockets | |
| US3351013A (en) | Illuminating mortar shell | |
| US2318994A (en) | Bomb | |
| NO150477B (no) | Brannmasse med et metallisk brennbart materiale fra gruppen ivb i det periodiske system og anvendelse av samme | |
| US10697741B2 (en) | Ignition system for pyrotechnic articles | |
| NO136127B (no) | Fremgangsm}te for behandling av jord for fiksering av skadelige metallioner som inneholdes deri. | |
| JP2009097728A (ja) | 発射薬点火用火管体 | |
| NO135294B (ref) |