NO118070B - - Google Patents
Download PDFInfo
- Publication number
- NO118070B NO118070B NO1641/68A NO164168A NO118070B NO 118070 B NO118070 B NO 118070B NO 1641/68 A NO1641/68 A NO 1641/68A NO 164168 A NO164168 A NO 164168A NO 118070 B NO118070 B NO 118070B
- Authority
- NO
- Norway
- Prior art keywords
- dolomite
- reaction
- caco
- superphosphate
- reaction mass
- Prior art date
Links
- 238000006243 chemical reaction Methods 0.000 claims description 71
- 239000010459 dolomite Substances 0.000 claims description 68
- 229910000514 dolomite Inorganic materials 0.000 claims description 68
- 239000003337 fertilizer Substances 0.000 claims description 41
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 claims description 37
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 32
- 239000011777 magnesium Substances 0.000 claims description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- 238000000034 method Methods 0.000 claims description 25
- 239000002426 superphosphate Substances 0.000 claims description 24
- 239000000395 magnesium oxide Substances 0.000 claims description 22
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 21
- 229910052749 magnesium Inorganic materials 0.000 claims description 20
- 238000004519 manufacturing process Methods 0.000 claims description 19
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 16
- 239000011575 calcium Substances 0.000 claims description 16
- 229910052698 phosphorus Inorganic materials 0.000 claims description 15
- 229910019142 PO4 Inorganic materials 0.000 claims description 11
- 238000005469 granulation Methods 0.000 claims description 11
- 230000003179 granulation Effects 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- 235000021317 phosphate Nutrition 0.000 claims description 11
- 229910052791 calcium Inorganic materials 0.000 claims description 8
- 229910052796 boron Inorganic materials 0.000 claims description 7
- 229910052802 copper Inorganic materials 0.000 claims description 6
- 229910052748 manganese Inorganic materials 0.000 claims description 6
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 claims description 6
- 229910052939 potassium sulfate Inorganic materials 0.000 claims description 6
- 239000001120 potassium sulphate Substances 0.000 claims description 6
- 235000011151 potassium sulphates Nutrition 0.000 claims description 6
- 239000002002 slurry Substances 0.000 claims description 6
- 229910052725 zinc Inorganic materials 0.000 claims description 6
- 239000011573 trace mineral Substances 0.000 claims description 5
- 235000013619 trace mineral Nutrition 0.000 claims description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 239000008187 granular material Substances 0.000 claims description 4
- 229910001862 magnesium hydroxide Inorganic materials 0.000 claims description 4
- 239000001506 calcium phosphate Substances 0.000 claims description 3
- 229910000389 calcium phosphate Inorganic materials 0.000 claims description 3
- 235000011010 calcium phosphates Nutrition 0.000 claims description 3
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 claims description 3
- 239000000347 magnesium hydroxide Substances 0.000 claims description 3
- 235000012254 magnesium hydroxide Nutrition 0.000 claims description 3
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- 239000001175 calcium sulphate Substances 0.000 claims description 2
- 235000011132 calcium sulphate Nutrition 0.000 claims description 2
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 claims description 2
- 239000004137 magnesium phosphate Substances 0.000 claims description 2
- 229910000157 magnesium phosphate Inorganic materials 0.000 claims description 2
- 229960002261 magnesium phosphate Drugs 0.000 claims description 2
- 235000010994 magnesium phosphates Nutrition 0.000 claims description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- HHSPVTKDOHQBKF-UHFFFAOYSA-J calcium;magnesium;dicarbonate Chemical compound [Mg+2].[Ca+2].[O-]C([O-])=O.[O-]C([O-])=O HHSPVTKDOHQBKF-UHFFFAOYSA-J 0.000 claims 1
- 239000000047 product Substances 0.000 description 43
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 41
- 241000209140 Triticum Species 0.000 description 31
- 235000021307 Triticum Nutrition 0.000 description 31
- 241000196324 Embryophyta Species 0.000 description 29
- 229910052700 potassium Inorganic materials 0.000 description 17
- 238000004898 kneading Methods 0.000 description 13
- 239000010802 sludge Substances 0.000 description 13
- 239000002689 soil Substances 0.000 description 13
- 235000013339 cereals Nutrition 0.000 description 11
- 238000001035 drying Methods 0.000 description 10
- 239000001103 potassium chloride Substances 0.000 description 10
- 235000011164 potassium chloride Nutrition 0.000 description 10
- 238000004458 analytical method Methods 0.000 description 9
- 239000010452 phosphate Substances 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 9
- 238000001354 calcination Methods 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000010949 copper Substances 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- 229910052717 sulfur Inorganic materials 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 239000010902 straw Substances 0.000 description 6
- 235000007319 Avena orientalis Nutrition 0.000 description 5
- 244000075850 Avena orientalis Species 0.000 description 5
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- 235000007238 Secale cereale Nutrition 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 230000004720 fertilization Effects 0.000 description 5
- 238000006386 neutralization reaction Methods 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- OLQIKGSZDTXODA-UHFFFAOYSA-N 4-[3-(4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenol Chemical compound CC1=CC(O)=CC=C1C1(C=2C(=CC(O)=CC=2)C)C2=CC=CC=C2S(=O)(=O)O1 OLQIKGSZDTXODA-UHFFFAOYSA-N 0.000 description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 3
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 244000082988 Secale cereale Species 0.000 description 3
- 235000011941 Tilia x europaea Nutrition 0.000 description 3
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 239000004571 lime Substances 0.000 description 3
- 235000009973 maize Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- CEQFOVLGLXCDCX-WUKNDPDISA-N methyl red Chemical compound C1=CC(N(C)C)=CC=C1\N=N\C1=CC=CC=C1C(O)=O CEQFOVLGLXCDCX-WUKNDPDISA-N 0.000 description 3
- 238000012216 screening Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- MKNQNPYGAQGARI-UHFFFAOYSA-N 4-(bromomethyl)phenol Chemical compound OC1=CC=C(CBr)C=C1 MKNQNPYGAQGARI-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000209056 Secale Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003518 caustics Substances 0.000 description 2
- 239000000356 contaminant Substances 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910021645 metal ion Inorganic materials 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- NIFIFKQPDTWWGU-UHFFFAOYSA-N pyrite Chemical compound [Fe+2].[S-][S-] NIFIFKQPDTWWGU-UHFFFAOYSA-N 0.000 description 2
- 229910052683 pyrite Inorganic materials 0.000 description 2
- 239000011028 pyrite Substances 0.000 description 2
- PRZSXZWFJHEZBJ-UHFFFAOYSA-N thymol blue Chemical compound C1=C(O)C(C(C)C)=CC(C2(C3=CC=CC=C3S(=O)(=O)O2)C=2C(=CC(O)=C(C(C)C)C=2)C)=C1C PRZSXZWFJHEZBJ-UHFFFAOYSA-N 0.000 description 2
- YWYZEGXAUVWDED-UHFFFAOYSA-N triammonium citrate Chemical compound [NH4+].[NH4+].[NH4+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O YWYZEGXAUVWDED-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 239000005696 Diammonium phosphate Substances 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 208000019025 Hypokalemia Diseases 0.000 description 1
- 208000008167 Magnesium Deficiency Diseases 0.000 description 1
- 241001632422 Radiola linoides Species 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- 229930002875 chlorophyll Natural products 0.000 description 1
- 235000019804 chlorophyll Nutrition 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical compound C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- XJRPTMORGOIMMI-UHFFFAOYSA-N ethyl 2-amino-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate Chemical compound CCOC(=O)C=1SC(N)=NC=1C(F)(F)F XJRPTMORGOIMMI-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 235000004764 magnesium deficiency Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 208000007645 potassium deficiency Diseases 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B3/00—Fertilisers based essentially on di-calcium phosphate
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE6124/67*A SE310370B (enExample) | 1967-04-28 | 1967-04-28 | |
| SE16925/67A SE328317B (enExample) | 1967-12-08 | 1967-12-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118070B true NO118070B (enExample) | 1969-11-03 |
Family
ID=26654687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1641/68A NO118070B (enExample) | 1967-04-28 | 1968-04-27 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3573893A (enExample) |
| AT (1) | AT281880B (enExample) |
| BE (1) | BE713622A (enExample) |
| DE (1) | DE1767329A1 (enExample) |
| DK (1) | DK120198B (enExample) |
| ES (1) | ES353512A1 (enExample) |
| FR (1) | FR1562506A (enExample) |
| GB (1) | GB1207612A (enExample) |
| IE (1) | IE32126B1 (enExample) |
| NL (1) | NL140502B (enExample) |
| NO (1) | NO118070B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2396730A1 (fr) * | 1977-07-07 | 1979-02-02 | Samm A Sarl | Engrais organo-biologique |
| EP0084196A3 (en) * | 1981-12-30 | 1983-08-03 | Engrais Rosier | Fertilisers in suspension and their preparation |
| DE4132620C2 (de) * | 1991-10-01 | 1994-07-28 | Pro Mineral Ges | Verfahren zur Herstellung eines Düngemittels |
| FI117973B (fi) * | 2001-04-17 | 2007-05-15 | Kemira Growhow Oyj | Parannettu metsälannoite |
| AU2002301717B2 (en) * | 2002-10-01 | 2011-02-10 | Calix Limited | Dolomite Based Quick Release Organic Broad Acre Fertiliser |
| EP1948565B1 (en) | 2005-10-21 | 2018-08-15 | Calix Ltd | A mg(oh)2.caco3 material compound and a method of fabricating the same |
| AU2006303830B2 (en) * | 2005-10-21 | 2010-12-09 | Calix Limited | A material compound and a method of fabricating the same |
| CN101466461B (zh) | 2006-03-31 | 2012-06-20 | Calix有限公司 | 用于矿物煅烧的系统和方法 |
-
1968
- 1968-04-04 IE IE393/68A patent/IE32126B1/xx unknown
- 1968-04-05 GB GB06503/68A patent/GB1207612A/en not_active Expired
- 1968-04-12 BE BE713622D patent/BE713622A/xx unknown
- 1968-04-15 US US721166A patent/US3573893A/en not_active Expired - Lifetime
- 1968-04-23 FR FR1562506D patent/FR1562506A/fr not_active Expired
- 1968-04-25 ES ES353512A patent/ES353512A1/es not_active Expired
- 1968-04-26 DK DK195968AA patent/DK120198B/da unknown
- 1968-04-27 DE DE19681767329 patent/DE1767329A1/de active Pending
- 1968-04-27 NO NO1641/68A patent/NO118070B/no unknown
- 1968-04-29 NL NL686806085A patent/NL140502B/xx unknown
- 1968-04-29 AT AT414568A patent/AT281880B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| US3573893A (en) | 1971-04-06 |
| FR1562506A (enExample) | 1969-04-04 |
| BE713622A (enExample) | 1968-08-16 |
| NL6806085A (enExample) | 1968-10-29 |
| GB1207612A (en) | 1970-10-07 |
| NL140502B (nl) | 1973-12-17 |
| DK120198B (da) | 1971-04-26 |
| IE32126B1 (en) | 1973-04-18 |
| DE1767329A1 (de) | 1972-04-13 |
| AT281880B (de) | 1970-06-10 |
| ES353512A1 (es) | 1969-10-01 |
| IE32126L (en) | 1968-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| WO2014122669A1 (en) | A total foliar product for agriculture / horticulture / tissue culture and hydroponic cultivation | |
| Gajghane et al. | Effect of potassium and sulphur levels on soil fertility status after harvest of mustard. | |
| Chhabra | Nutrient management in salt-affected soils | |
| US4321078A (en) | Slow release fertilizer composition | |
| Bekele et al. | The impact of secondary macro nutrients on crop production | |
| NO118070B (enExample) | ||
| CN102180728A (zh) | 抗稻瘟病水稻增产专用肥 | |
| WO2016092566A2 (en) | Novel multi mineral soil supplement and carrier material | |
| KR102206193B1 (ko) | 휴믹산이 코팅된 골분을 유효성분으로 포함하는 비료 조성물 및 이의 용도 | |
| JP4828113B2 (ja) | 硝酸態窒素低減剤 | |
| EP4642749A1 (en) | Crop nutrition and fortification composition | |
| US20060010949A1 (en) | Slow-release (GSSP) fertilizer | |
| Tennakone et al. | Non hygroscopic superphosphate fertilizer from apatite and hydrochloric acid | |
| RU2672408C1 (ru) | Гранулированное комплексное бесхлорное азотно-калийно-магниевое удобрение и способ его получения | |
| JPH06144975A (ja) | 液体肥料の製造方法 | |
| NO330354B1 (no) | Fosforholdig skogsgjodsel | |
| Kamprath | Fertility management of low activity clay soils | |
| Mehring et al. | Sulfur in fertilizers, manures, and soil amendments | |
| Dejene | Opportunities to alleviate soil acidity impact through exploitation of diverse liming materials integrated with different phosphatic fertilizer sources in Ethiopia | |
| DK171130B1 (da) | Indkapslet gødningsmiddel med neutraliserende evne | |
| WO1999022889A1 (en) | Improved plant nutrients | |
| SU1650577A1 (ru) | Двойные средние гидратированные фосфаты марганца-магни | |
| Yadav et al. | MAJOR PHOSPHATIC FERTILIZERS: CHEMISTRY OF MANUFACTURING AND FATE IN SOIL | |
| RU2704828C1 (ru) | Удобрение | |
| RU2646890C1 (ru) | Способ приготовления концентрата питательного раствора для растений |