NO117425B - - Google Patents
Download PDFInfo
- Publication number
- NO117425B NO117425B NO165500A NO16550066A NO117425B NO 117425 B NO117425 B NO 117425B NO 165500 A NO165500 A NO 165500A NO 16550066 A NO16550066 A NO 16550066A NO 117425 B NO117425 B NO 117425B
- Authority
- NO
- Norway
- Prior art keywords
- dichloroisocyanuric acid
- alkali
- alkali hydroxide
- reaction
- aliphatic
- Prior art date
Links
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 14
- 229910001854 alkali hydroxide Inorganic materials 0.000 claims description 12
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 238000003756 stirring Methods 0.000 claims description 6
- 239000000375 suspending agent Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 238000001035 drying Methods 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 150000002430 hydrocarbons Chemical class 0.000 claims description 5
- 239000007788 liquid Substances 0.000 claims description 5
- 239000000725 suspension Substances 0.000 claims description 5
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 2
- 239000002002 slurry Substances 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- IFIDXBCRSWOUSB-UHFFFAOYSA-N potassium;1,3-dichloro-1,3,5-triazinane-2,4,6-trione Chemical compound [K+].ClN1C(=O)NC(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- -1 aliphatic chlorinated hydrocarbon Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/30—Only oxygen atoms
- C07D251/36—Only oxygen atoms having halogen atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED48606A DE1232969B (de) | 1965-11-09 | 1965-11-09 | Verfahren zur Herstellung von trockenen Alkalidichlorisocyanuraten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO117425B true NO117425B (Sortimente) | 1969-08-11 |
Family
ID=7051299
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO165500A NO117425B (Sortimente) | 1965-11-09 | 1966-11-08 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3452012A (Sortimente) |
| AT (1) | AT270665B (Sortimente) |
| BE (1) | BE689492A (Sortimente) |
| CH (1) | CH484923A (Sortimente) |
| DE (1) | DE1232969B (Sortimente) |
| FR (1) | FR1498917A (Sortimente) |
| GB (1) | GB1110708A (Sortimente) |
| NL (1) | NL6615762A (Sortimente) |
| NO (1) | NO117425B (Sortimente) |
| SE (1) | SE300423B (Sortimente) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3853867A (en) * | 1972-03-30 | 1974-12-10 | Fmc Corp | Method of stabilizing dichlorocyanuric acid salts |
| US3888855A (en) * | 1973-07-13 | 1975-06-10 | Fmc Corp | Preparation of low bulk density sodium dichloroisocyanurate dihydrate |
| DE3227817A1 (de) * | 1982-07-26 | 1984-01-26 | Lentia GmbH Chem. u. pharm. Erzeugnisse - Industriebedarf, 8000 München | Verfahren zur herstellung von grobkristallinem, rieselfaehigem natriumdichlorisocyanuratdihydrat |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3336228A (en) * | 1955-05-09 | 1967-08-15 | Fmc Corp | Active chlorine compositions containing dichlorocyanuric acid and salts thereof |
| DE1122535B (de) * | 1960-10-15 | 1962-01-25 | Basf Ag | Verfahren zur Trocknung feuchter chlorierter Cyanursaeuren |
-
0
- FR FR1498917D patent/FR1498917A/fr not_active Expired
-
1965
- 1965-11-09 DE DED48606A patent/DE1232969B/de active Pending
-
1966
- 1966-11-03 CH CH01595066A patent/CH484923A/de not_active IP Right Cessation
- 1966-11-08 US US593239A patent/US3452012A/en not_active Expired - Lifetime
- 1966-11-08 NO NO165500A patent/NO117425B/no unknown
- 1966-11-08 GB GB50083/66A patent/GB1110708A/en not_active Expired
- 1966-11-08 AT AT1030766A patent/AT270665B/de active
- 1966-11-08 SE SE15256/66A patent/SE300423B/xx unknown
- 1966-11-08 NL NL6615762A patent/NL6615762A/xx unknown
- 1966-11-09 BE BE689492D patent/BE689492A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1232969B (de) | 1967-01-26 |
| AT270665B (de) | 1969-05-12 |
| SE300423B (Sortimente) | 1968-04-29 |
| BE689492A (Sortimente) | 1967-04-14 |
| CH484923A (de) | 1970-01-31 |
| FR1498917A (Sortimente) | 1968-01-10 |
| GB1110708A (en) | 1968-04-24 |
| NL6615762A (Sortimente) | 1967-05-10 |
| US3452012A (en) | 1969-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3121715A (en) | Production of n-brominated organic compounds | |
| NO147575B (no) | Lysledende element for anvendelse ved optisk overfoering | |
| DK153682B (da) | Organiske nitrogenholdige forbindelser og fremgangsmaade til deres fremstilling samt anvendelse af forbindelserne i shampoo | |
| NO148748B (no) | Forstoevningstoerket vaskepulver med lav romvekt | |
| NO117425B (Sortimente) | ||
| JP2004532319A5 (Sortimente) | ||
| US4432959A (en) | Process of producing sodium cyanuarate | |
| JPH0621089B2 (ja) | 芳香族エ−テルまたはチオエ−テル化合物の製造方法 | |
| US3072654A (en) | Dichloroisocyanurate process | |
| JPH03109394A (ja) | リボフラビン―5′―リン酸もしくはそのモノナトリウム塩の製法 | |
| GB487009A (en) | Process for obtaining high standard and easily filtered calcium hypochlorite | |
| SU504477A3 (ru) | Способ получени м- и пфенилендиамина | |
| US3352860A (en) | Process for the manufacture of organinc nitrogen-halogen compounds | |
| RU2178718C2 (ru) | Способ утилизации 2-хлор-1-фенилэтанона-1 | |
| US3578393A (en) | Preparation of calcium hypochlorite from hypochlorous acid solutions | |
| US3919217A (en) | Chlorocyanuric acid manufacture | |
| JPH0143744B2 (Sortimente) | ||
| KR100721882B1 (ko) | α-(2-4-디술포페닐)-N-tert-부틸니트론 및 제약상허용되는 그의 염의 신규 제조 방법 | |
| DK150853B (da) | Fremgangsmaade til fremstilling af 6-chlor-benzoxazolon | |
| GB1083405A (en) | Method for producing stable salts of dichloroisocyanuric acid | |
| UA55480C2 (uk) | Спосіб одержання 3-ізопропіл-1н-2,1,3-бензотіадіазин-4(3н)-он-2,2-діоксиду | |
| DK159682B (da) | Fremgangsmaade til fremstilling af n,n-dimethylpiperidiniumchlorid eller n,n-dimethylmorpholiniumchlorid | |
| SU475345A1 (ru) | Способ получени хлорированного тринатрийфосфата | |
| US6252073B1 (en) | Method of producing alkali metal salts or alkaline earth metal salts of 2,4-dichloro-6-hydroxy-s-triazine | |
| SU802181A1 (ru) | Способ получени гранулированногоп ТиВОдНОгО МЕТАСилиКАТА НАТРи |