NO116002B - - Google Patents
Info
- Publication number
- NO116002B NO116002B NO1441/68A NO144168A NO116002B NO 116002 B NO116002 B NO 116002B NO 1441/68 A NO1441/68 A NO 1441/68A NO 144168 A NO144168 A NO 144168A NO 116002 B NO116002 B NO 116002B
- Authority
- NO
- Norway
- Prior art keywords
- alkali metal
- added
- rotary kiln
- weight
- mixture
- Prior art date
Links
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 25
- 229910019142 PO4 Inorganic materials 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 24
- 235000021317 phosphate Nutrition 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 22
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 20
- 239000010452 phosphate Substances 0.000 claims description 19
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 13
- 239000003513 alkali Substances 0.000 claims description 12
- 238000001354 calcination Methods 0.000 claims description 11
- 239000004576 sand Substances 0.000 claims description 11
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 claims description 11
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 9
- 230000029087 digestion Effects 0.000 claims description 9
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 7
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 6
- 239000000377 silicon dioxide Substances 0.000 claims description 6
- 235000012239 silicon dioxide Nutrition 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 5
- 239000002994 raw material Substances 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 150000003112 potassium compounds Chemical class 0.000 claims description 4
- 229910052681 coesite Inorganic materials 0.000 claims description 3
- 229910052906 cristobalite Inorganic materials 0.000 claims description 3
- 229910052682 stishovite Inorganic materials 0.000 claims description 3
- 229910052905 tridymite Inorganic materials 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 2
- 150000003388 sodium compounds Chemical class 0.000 claims 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 13
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000003337 fertilizer Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 2
- 150000001339 alkali metal compounds Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- VSIIXMUUUJUKCM-UHFFFAOYSA-D pentacalcium;fluoride;triphosphate Chemical group [F-].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O VSIIXMUUUJUKCM-UHFFFAOYSA-D 0.000 description 2
- 235000011009 potassium phosphates Nutrition 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000010205 Cola acuminata Nutrition 0.000 description 1
- 244000228088 Cola acuminata Species 0.000 description 1
- 235000015438 Cola nitida Nutrition 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 229910052586 apatite Inorganic materials 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- -1 potassium compounds potassium hydroxide Chemical class 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YWYZEGXAUVWDED-UHFFFAOYSA-N triammonium citrate Chemical compound [NH4+].[NH4+].[NH4+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O YWYZEGXAUVWDED-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/16—Oxyacids of phosphorus; Salts thereof
- C01B25/26—Phosphates
- C01B25/45—Phosphates containing plural metal, or metal and ammonium
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B13/00—Fertilisers produced by pyrogenic processes from phosphatic materials
- C05B13/02—Fertilisers produced by pyrogenic processes from phosphatic materials from rock phosphates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK62041A DE1294977B (de) | 1967-04-18 | 1967-04-18 | Verfahren zur Herstellung von Gluehphosphatduengemitteln |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO116002B true NO116002B (cg-RX-API-DMAC7.html) | 1969-01-13 |
Family
ID=7230395
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1441/68A NO116002B (cg-RX-API-DMAC7.html) | 1967-04-18 | 1968-04-17 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3719464A (cg-RX-API-DMAC7.html) |
| BE (1) | BE713006A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1294977B (cg-RX-API-DMAC7.html) |
| DK (1) | DK116601B (cg-RX-API-DMAC7.html) |
| ES (1) | ES351751A1 (cg-RX-API-DMAC7.html) |
| FI (1) | FI49821C (cg-RX-API-DMAC7.html) |
| FR (1) | FR1559414A (cg-RX-API-DMAC7.html) |
| GB (1) | GB1159660A (cg-RX-API-DMAC7.html) |
| IL (1) | IL29695A (cg-RX-API-DMAC7.html) |
| NL (1) | NL6802725A (cg-RX-API-DMAC7.html) |
| NO (1) | NO116002B (cg-RX-API-DMAC7.html) |
| SE (1) | SE332643B (cg-RX-API-DMAC7.html) |
| SU (1) | SU375840A3 (cg-RX-API-DMAC7.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3985537A (en) * | 1971-06-05 | 1976-10-12 | Kali-Chemie Aktiengesellschaft | Process for making calcined alkali phosphates of high citrate solubility for use as fertilizers |
| DE2606883A1 (de) * | 1976-02-20 | 1977-09-01 | Kali Chemie Ag | Verfahren zur herstellung eines citratloeslichen gluehphosphatduengers |
| DE2709016C3 (de) * | 1977-03-02 | 1980-01-10 | Kali-Chemie Ag, 3000 Hannover | Verfahren zur Herstellung eines alkalihaltigen Glühphosphatdüngemittels |
| DE3068215D1 (en) * | 1979-09-07 | 1984-07-19 | Nat Res Dev | Fertilizer material from apatite |
| GB2142007B (en) * | 1983-06-24 | 1987-11-18 | Griffith Thomas | Alkaline processing of phosphates |
| AU568132B2 (en) * | 1983-06-24 | 1987-12-17 | Thomas, G. | Alkali metal phosphates |
| AU568666B2 (en) * | 1983-08-25 | 1988-01-07 | Thomas, G. | Production of phosphates from alkali-proecessed phosphate rock |
| DE112009005357A5 (de) * | 2009-11-10 | 2012-09-13 | Axel Bruckert | Mehrnährstoff-düngemittel |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1194219A (en) * | 1916-08-08 | And geoeoke b | ||
| FR480355A (cg-RX-API-DMAC7.html) * | 1900-01-01 | |||
| US1016989A (en) * | 1910-09-19 | 1912-02-13 | Columbia Chemical Company | Process of utilizing lime-mud in the manufacture of fertilizers. |
| US1823849A (en) * | 1926-02-01 | 1931-09-15 | Firm Rhenania Kunheim Ver Chem | Process for the manufacture of manures |
| US1842843A (en) * | 1926-07-30 | 1932-01-26 | Rhenaniakunheim Ver Chemischer | Method of making fertilizers |
| US1878185A (en) * | 1927-06-28 | 1932-09-20 | Firm Rhenania Kunhein Ver Chem | Process for obtaining fertilizers |
| US1880491A (en) * | 1927-11-23 | 1932-10-04 | Firm Kali Chemie Ag | Producing calcined phosphates |
| GB467075A (en) * | 1936-02-10 | 1937-06-10 | Kali Chemie Ag | Process for the production of calcined phosphates |
| DE692196C (de) * | 1938-04-10 | 1940-06-14 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von ammoncitratloeslichen Phosphatduengemitteln |
| DE698009C (de) * | 1939-06-30 | 1940-10-30 | Chem Fab Budenheim Akt Ges | Verfahren zur Herstellung von basischen, als Duengemittel geeigneten Calciumphosphaten |
| FR1016855A (fr) * | 1950-04-28 | 1952-11-25 | Procédé pour rendre l'anhydride phosphorique du phosphate minéral soluble dans l'acide citrique, et produits obtenus par ce procédé | |
| US3202477A (en) * | 1962-01-18 | 1965-08-24 | Diamond Alkali Co | Method of producing alkali metal carbonate |
-
1967
- 1967-04-18 DE DEK62041A patent/DE1294977B/de active Pending
-
1968
- 1968-02-15 SE SE02017/68A patent/SE332643B/xx unknown
- 1968-02-21 FI FI680459A patent/FI49821C/fi active
- 1968-02-27 NL NL6802725A patent/NL6802725A/xx unknown
- 1968-03-18 ES ES351751A patent/ES351751A1/es not_active Expired
- 1968-03-26 IL IL29695A patent/IL29695A/xx unknown
- 1968-03-26 FR FR1559414D patent/FR1559414A/fr not_active Expired
- 1968-03-29 BE BE713006D patent/BE713006A/xx unknown
- 1968-04-02 GB GB15911/68A patent/GB1159660A/en not_active Expired
- 1968-04-03 SU SU1230301A patent/SU375840A3/ru active
- 1968-04-17 DK DK168968AA patent/DK116601B/da unknown
- 1968-04-17 NO NO1441/68A patent/NO116002B/no unknown
- 1968-04-18 US US00722189A patent/US3719464A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| SE332643B (cg-RX-API-DMAC7.html) | 1971-02-15 |
| FR1559414A (cg-RX-API-DMAC7.html) | 1969-03-07 |
| FI49821C (fi) | 1975-10-10 |
| US3719464A (en) | 1973-03-06 |
| DK116601B (da) | 1970-01-26 |
| NL6802725A (cg-RX-API-DMAC7.html) | 1968-10-21 |
| IL29695A (en) | 1971-10-20 |
| GB1159660A (en) | 1969-07-30 |
| ES351751A1 (es) | 1969-06-01 |
| FI49821B (cg-RX-API-DMAC7.html) | 1975-06-30 |
| BE713006A (cg-RX-API-DMAC7.html) | 1968-07-31 |
| SU375840A3 (cg-RX-API-DMAC7.html) | 1973-03-23 |
| DE1294977B (de) | 1969-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3192013A (en) | Anhydrous liquid phosphoric acid | |
| NO116002B (cg-RX-API-DMAC7.html) | ||
| US2037706A (en) | Manufacture of ammoniated superphosphates | |
| US2997367A (en) | Defluorination of phosphatic material | |
| US4106922A (en) | Alkaline decomposition process for producing calcined phosphate fertilizer | |
| US4167406A (en) | High temperature decomposition process for producing an alkali-containing calcined phosphate fertilizer | |
| EA030295B1 (ru) | Фосфор-калий-азотсодержащее npk-удобрение и способ получения гранулированного фосфор-калий-азотсодержащего npk-удобрения | |
| US3723086A (en) | Process for producing ammonium phosphates and polyphosphates | |
| US1704218A (en) | Process for preparing fertilizers | |
| PL94344B1 (cg-RX-API-DMAC7.html) | ||
| US3058804A (en) | Process for production of defluorinated calcium phosphate | |
| NO141260B (no) | Fremgangsmaate for fremstilling av partikkelformet fast ammoniumfosfat | |
| US3713803A (en) | Production of phosphate fertilizers | |
| US2995437A (en) | Defluorination of phosphate rock | |
| US1799882A (en) | Process for producing fertilizer | |
| US1842843A (en) | Method of making fertilizers | |
| US1163130A (en) | Process of manufacturing fertilizers. | |
| US3457061A (en) | Utilization of phosphoric acid sludge | |
| US3301658A (en) | Fertilizer | |
| US1283677A (en) | Process of manufacturing fertilizer. | |
| US2875032A (en) | Process of preparing a phosphated product | |
| US1194219A (en) | And geoeoke b | |
| US1823849A (en) | Process for the manufacture of manures | |
| GB615476A (en) | Improvements in and relating to the production of mixed fertilizers | |
| NO133135B (cg-RX-API-DMAC7.html) |