NL8002020A - N-gesubstitueerde tetrahydrofthalimiden en op de toepassing hiervan als herbicidale verbinding. - Google Patents
N-gesubstitueerde tetrahydrofthalimiden en op de toepassing hiervan als herbicidale verbinding. Download PDFInfo
- Publication number
- NL8002020A NL8002020A NL8002020A NL8002020A NL8002020A NL 8002020 A NL8002020 A NL 8002020A NL 8002020 A NL8002020 A NL 8002020A NL 8002020 A NL8002020 A NL 8002020A NL 8002020 A NL8002020 A NL 8002020A
- Authority
- NL
- Netherlands
- Prior art keywords
- substituted
- group
- formula
- carbon atoms
- tetrahydrophthalimides
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 97
- 230000002363 herbicidal effect Effects 0.000 title claims description 52
- 239000000460 chlorine Substances 0.000 claims description 64
- -1 alkynyl aralkyl Chemical group 0.000 claims description 38
- 239000000203 mixture Substances 0.000 claims description 36
- 241000196324 Embryophyta Species 0.000 claims description 25
- 239000000126 substance Substances 0.000 claims description 23
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 16
- 239000002689 soil Substances 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 239000013543 active substance Substances 0.000 claims description 13
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000004009 herbicide Substances 0.000 claims description 9
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 229910052794 bromium Chemical group 0.000 claims description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000005394 methallyl group Chemical group 0.000 claims description 5
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 2
- 230000008569 process Effects 0.000 claims description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- 230000000052 comparative effect Effects 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 231100000674 Phytotoxicity Toxicity 0.000 description 15
- 239000013078 crystal Substances 0.000 description 15
- 238000003756 stirring Methods 0.000 description 13
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 240000007594 Oryza sativa Species 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 235000010469 Glycine max Nutrition 0.000 description 8
- 244000068988 Glycine max Species 0.000 description 8
- 235000013339 cereals Nutrition 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000004563 wettable powder Substances 0.000 description 7
- 244000058871 Echinochloa crus-galli Species 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000003337 fertilizer Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 230000000704 physical effect Effects 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 235000017896 Digitaria Nutrition 0.000 description 5
- 241001303487 Digitaria <clam> Species 0.000 description 5
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 5
- 244000214240 Galinsoga parviflora Species 0.000 description 5
- 235000011999 Panicum crusgalli Nutrition 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 241000209140 Triticum Species 0.000 description 5
- 235000021307 Triticum Nutrition 0.000 description 5
- 239000000428 dust Substances 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- NNJPGOLRFBJNIW-HNNXBMFYSA-N (-)-demecolcine Chemical compound C1=C(OC)C(=O)C=C2[C@@H](NC)CCC3=CC(OC)=C(OC)C(OC)=C3C2=C1 NNJPGOLRFBJNIW-HNNXBMFYSA-N 0.000 description 3
- SPAMRUYRVYMHPV-UHFFFAOYSA-N 3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical class C1=CCCC2C(=O)NC(=O)C21 SPAMRUYRVYMHPV-UHFFFAOYSA-N 0.000 description 3
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000007164 Oryza sativa Nutrition 0.000 description 3
- 235000001855 Portulaca oleracea Nutrition 0.000 description 3
- 244000234609 Portulaca oleracea Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 244000136421 Scirpus acutus Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 240000006694 Stellaria media Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 230000000885 phytotoxic effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 235000009566 rice Nutrition 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- KPMHBSITSXZPAX-UHFFFAOYSA-N 1-chloro-4-nitro-2-propoxybenzene Chemical compound CCCOC1=CC([N+]([O-])=O)=CC=C1Cl KPMHBSITSXZPAX-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- BBPUXIUPXMZNJP-UHFFFAOYSA-N 2-(4-chloro-3-propoxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1=C(Cl)C(OCCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1 BBPUXIUPXMZNJP-UHFFFAOYSA-N 0.000 description 2
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 2
- QZJPSGHYWQMHDD-UHFFFAOYSA-N 4-chloro-3-propoxyaniline Chemical compound CCCOC1=CC(N)=CC=C1Cl QZJPSGHYWQMHDD-UHFFFAOYSA-N 0.000 description 2
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 2
- 241001457980 Alisma gramineum Species 0.000 description 2
- 235000013478 Amaranthus oleraceus Nutrition 0.000 description 2
- 244000237960 Amaranthus oleraceus Species 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 240000001140 Mimosa pudica Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 235000004442 Polygonum persicaria Nutrition 0.000 description 2
- 244000110797 Polygonum persicaria Species 0.000 description 2
- 244000088415 Raphanus sativus Species 0.000 description 2
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 2
- 241000341978 Rotala Species 0.000 description 2
- 235000004401 Scirpus acutus Nutrition 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 240000000359 Triticum dicoccon Species 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 229940125773 compound 10 Drugs 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 238000003898 horticulture Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 2
- 150000005181 nitrobenzenes Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000007480 spreading Effects 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- LSXKDWGTSHCFPP-UHFFFAOYSA-N 1-bromoheptane Chemical compound CCCCCCCBr LSXKDWGTSHCFPP-UHFFFAOYSA-N 0.000 description 1
- UGAQUOXMTXMWEH-UHFFFAOYSA-N 2-(2,4-dichloro-3-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound CC(C)OC1=C(Cl)C=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1Cl UGAQUOXMTXMWEH-UHFFFAOYSA-N 0.000 description 1
- KGOOQDCEVLTPOB-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound ClC1=CC(Cl)=CC=C1N1C(=O)C(CCCC2)=C2C1=O KGOOQDCEVLTPOB-UHFFFAOYSA-N 0.000 description 1
- GGDOHVWUUGQELZ-UHFFFAOYSA-N 2-(4-bromo-3-butoxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1=C(Br)C(OCCCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1 GGDOHVWUUGQELZ-UHFFFAOYSA-N 0.000 description 1
- SEWDWVGOVVJYIY-UHFFFAOYSA-N 2-(4-bromo-3-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1=C(Br)C(OC(C)C)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1 SEWDWVGOVVJYIY-UHFFFAOYSA-N 0.000 description 1
- OLPACFOJNCFFGY-UHFFFAOYSA-N 2-(4-chloro-3-propan-2-yloxyphenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1 OLPACFOJNCFFGY-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- BUMGQSCPTLELLS-UHFFFAOYSA-N 2-chloro-5-nitrophenol Chemical compound OC1=CC([N+]([O-])=O)=CC=C1Cl BUMGQSCPTLELLS-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- XENORHLEQQVHAP-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1,1-diethylurea Chemical compound CCN(CC)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XENORHLEQQVHAP-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- NMYVUWQZPPDNPV-UHFFFAOYSA-N 3-amino-2,6-dichlorophenol Chemical compound NC1=CC=C(Cl)C(O)=C1Cl NMYVUWQZPPDNPV-UHFFFAOYSA-N 0.000 description 1
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 1
- HMMBJOWWRLZEMI-UHFFFAOYSA-N 4,5,6,7-tetrahydro-2-benzofuran-1,3-dione Chemical compound C1CCCC2=C1C(=O)OC2=O HMMBJOWWRLZEMI-UHFFFAOYSA-N 0.000 description 1
- DHCZZVVRBZUONT-UHFFFAOYSA-N 4-chloro-3-phenylmethoxyaniline Chemical compound NC1=CC=C(Cl)C(OCC=2C=CC=CC=2)=C1 DHCZZVVRBZUONT-UHFFFAOYSA-N 0.000 description 1
- JSCNCRWPXOTDDZ-UHFFFAOYSA-N 5-amino-2-chlorophenol Chemical compound NC1=CC=C(Cl)C(O)=C1 JSCNCRWPXOTDDZ-UHFFFAOYSA-N 0.000 description 1
- 241000748223 Alisma Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000237956 Amaranthus retroflexus Species 0.000 description 1
- 208000031968 Cadaver Diseases 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 240000006122 Chenopodium album Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 244000250952 Dentaria laciniata Species 0.000 description 1
- 235000001248 Dentaria laciniata Nutrition 0.000 description 1
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 1
- 240000003176 Digitaria ciliaris Species 0.000 description 1
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 1
- 235000005476 Digitaria cruciata Nutrition 0.000 description 1
- 235000006830 Digitaria didactyla Nutrition 0.000 description 1
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- 241000759118 Eleocharis kuroguwai Species 0.000 description 1
- 244000103152 Eleocharis tuberosa Species 0.000 description 1
- 235000014309 Eleocharis tuberosa Nutrition 0.000 description 1
- 235000014716 Eleusine indica Nutrition 0.000 description 1
- 102100029987 Erbin Human genes 0.000 description 1
- 101700035123 Erbin Proteins 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- STECJAGHUSJQJN-USLFZFAMSA-N LSM-4015 Chemical compound C1([C@@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-USLFZFAMSA-N 0.000 description 1
- 101100128278 Mus musculus Lins1 gene Proteins 0.000 description 1
- 235000003283 Pachira macrocarpa Nutrition 0.000 description 1
- 244000236458 Panicum colonum Species 0.000 description 1
- 235000015225 Panicum colonum Nutrition 0.000 description 1
- 244000170788 Persicaria vulgaris Species 0.000 description 1
- 235000014030 Podocarpus spicatus Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 244000155437 Raphanus sativus var. niger Species 0.000 description 1
- 235000015909 Sagittaria sinensis Nutrition 0.000 description 1
- 244000018694 Sagittaria sinensis Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000014364 Trapa natans Nutrition 0.000 description 1
- 240000001085 Trapa natans Species 0.000 description 1
- 235000016296 Tule bulrush Nutrition 0.000 description 1
- OMOVVBIIQSXZSZ-UHFFFAOYSA-N [6-(4-acetyloxy-5,9a-dimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3h-pyrano[3,4-b]oxepin-5-yl)-5-formyloxy-3-(furan-3-yl)-3a-methyl-7-methylidene-1a,2,3,4,5,6-hexahydroindeno[1,7a-b]oxiren-4-yl] 2-hydroxy-3-methylpentanoate Chemical compound CC12C(OC(=O)C(O)C(C)CC)C(OC=O)C(C3(C)C(CC(=O)OC4(C)COC(=O)CC43)OC(C)=O)C(=C)C32OC3CC1C=1C=COC=1 OMOVVBIIQSXZSZ-UHFFFAOYSA-N 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- IMNRJGSQCGFPHL-UHFFFAOYSA-N benzene;oxolane Chemical compound C1CCOC1.C1=CC=CC=C1 IMNRJGSQCGFPHL-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- XQNAUQUKWRBODG-UHFFFAOYSA-N chlornitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=C(Cl)C=C(Cl)C=C1Cl XQNAUQUKWRBODG-UHFFFAOYSA-N 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- CCAFPWNGIUBUSD-UHFFFAOYSA-N diethyl sulfoxide Chemical compound CCS(=O)CC CCAFPWNGIUBUSD-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002194 fatty esters Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 235000009165 saligot Nutrition 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 125000005031 thiocyano group Chemical group S(C#N)* 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/18—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing the group —CO—N<, e.g. carboxylic acid amides or imides; Thio analogues thereof
- A01N37/32—Cyclic imides of polybasic carboxylic acids or thio analogues thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N39/00—Biocides, pest repellants or attractants, or plant growth regulators containing aryloxy- or arylthio-aliphatic or cycloaliphatic compounds, containing the group or, e.g. phenoxyethylamine, phenylthio-acetonitrile, phenoxyacetone
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Dentistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Plant Pathology (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4495179A JPS55139305A (en) | 1979-04-13 | 1979-04-13 | Herbicide |
| JP4494879 | 1979-04-13 | ||
| JP4495179 | 1979-04-13 | ||
| JP4494879A JPS55139359A (en) | 1979-04-13 | 1979-04-13 | Tetrahydrophthalimides, and herbicide containing compound as effective component |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8002020A true NL8002020A (nl) | 1980-10-15 |
Family
ID=26384912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8002020A NL8002020A (nl) | 1979-04-13 | 1980-04-04 | N-gesubstitueerde tetrahydrofthalimiden en op de toepassing hiervan als herbicidale verbinding. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4292070A (enExample) |
| BR (1) | BR8002295A (enExample) |
| CA (1) | CA1109881A (enExample) |
| CH (1) | CH646424A5 (enExample) |
| DE (1) | DE3013162A1 (enExample) |
| FR (1) | FR2453852A1 (enExample) |
| GB (1) | GB2046754B (enExample) |
| IT (1) | IT1149914B (enExample) |
| NL (1) | NL8002020A (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU542544B2 (en) * | 1980-03-12 | 1985-02-28 | Nippon Kayaku Kabushiki Kaisha | Tetrahydrophthalimide derivatives |
| CA1163635A (en) * | 1980-10-07 | 1984-03-13 | Hisao Watanabe | N-(3-substituted oxyphenyl)-tetrahydrophthalimides and herbicidal composition |
| EP0049511A1 (en) * | 1980-10-07 | 1982-04-14 | Mitsubishi Kasei Corporation | Tetrahydrophthalimides and herbicidal composition |
| US4431822A (en) * | 1981-03-30 | 1984-02-14 | Sumitomo Chemical Company, Limited | Tetrahydrophthalimides, and their production and use |
| AU550845B2 (en) * | 1981-03-30 | 1986-04-10 | Sumitomo Chemical Company, Limited | Tetrahydrophthalimides and their starting compounds |
| US4484941A (en) * | 1981-09-01 | 1984-11-27 | Sumitomo Chemical Company, Limited | Tetrahydrophthalimides, and their production and use as herbicides |
| US4484940A (en) * | 1981-09-01 | 1984-11-27 | Sumitomo Chemical Company, Limited | Tetrahydrophthalimides, and their production and use as herbicides |
| US5191105A (en) * | 1981-09-01 | 1993-03-02 | Sumitomo Chemical Company, Ltd. | Tetrahydrophthalimides, and their production and use as herbicides |
| AU557324B2 (en) * | 1981-12-25 | 1986-12-18 | Sumitomo Chemical Company, Limited | Tetrahydro phthalimide compounds |
| EP0095192B1 (en) * | 1982-05-26 | 1988-08-10 | Sumitomo Chemical Company, Limited | Tetrahydrophthalimides, and their production and use |
| JPS59212472A (ja) * | 1983-05-16 | 1984-12-01 | Sumitomo Chem Co Ltd | ４，５，６，７−テトラヒドロ−２ｈ−イソインド−ル−１，３−ジオン誘導体、その製造法およびそれを有効成分とする除草剤 |
| US4902832A (en) * | 1983-08-31 | 1990-02-20 | Sumitomo Chemical Company, Limited | 2-Substituted phenyl-4,5,6,7-tetrahydro-2H-isoindole-1,3-diones, and their production and use |
| JPS6054362A (ja) * | 1983-08-31 | 1985-03-28 | Sumitomo Chem Co Ltd | テトラヒドロフタルイミド誘導体，その製造法およびそれを有効成分とする除草剤 |
| US4563535A (en) * | 1983-09-19 | 1986-01-07 | Sumitomo Chemical Co., Ltd. | Process for producing tetrahydrophthalimides |
| DE3533442A1 (de) * | 1985-09-19 | 1987-03-26 | Hoechst Ag | Neue 2-aryl-4,5,6,7-tetrahydroisoindolinone, verfahren zu ihrer herstellung sowie ihre verwendung im pflanzenschutz |
| IT1201113B (it) * | 1986-01-10 | 1989-01-27 | Fmc Corp | Composti erbicidi |
| US4846882A (en) * | 1986-01-10 | 1989-07-11 | Fmc Corporation | Herbicidal aryl tetrahydrophthalimides |
| EP0259264A1 (de) * | 1986-09-03 | 1988-03-09 | Ciba-Geigy Ag | Neue 4-Methylphthalimide |
| ATE67186T1 (de) * | 1986-09-03 | 1991-09-15 | Ciba Geigy Ag | 3-methylphthalimide. |
| JPS63225306A (ja) * | 1986-10-09 | 1988-09-20 | Sumitomo Chem Co Ltd | 除草組成物 |
| US4816065A (en) * | 1986-12-23 | 1989-03-28 | Fmc Corporation | Herbicides |
| US4885025A (en) * | 1986-12-23 | 1989-12-05 | Fmc Corporation | Herbicidal tetrazolinones and use thereof |
| DE3712987A1 (de) * | 1987-04-16 | 1988-11-10 | Bayer Ag | N-arylpyrrolin-2,5-dione |
| DE3724399A1 (de) * | 1987-07-23 | 1989-02-02 | Basf Ag | Phenylalkenylcarbonsaeuren und deren ester |
| US4919704A (en) * | 1987-08-14 | 1990-04-24 | Ciba-Geigy Corporation | 4,5,6,7-Tetrahydroisoindole-1,3-diones |
| DE3736297A1 (de) * | 1987-10-27 | 1989-05-11 | Basf Ag | N-phenyltetrahydrophthalimidverbindungen |
| US5169428A (en) * | 1987-12-30 | 1992-12-08 | Tosoh Corporation | Tetrahydrophthalimide derivative and herbicide composition containing same |
| EP0323271A1 (en) * | 1987-12-30 | 1989-07-05 | Tosoh Corporation | Tetrahydrophthalimide derivative and herbicide composition containing the same |
| US5221318A (en) * | 1988-10-15 | 1993-06-22 | Bayer Aktiengesellschaft | Herbicidal N-aryl-substituted nitrogen-containing heterocycles |
| DE3835168A1 (de) * | 1988-10-15 | 1990-04-19 | Bayer Ag | N-aryl-stickstoffheterocyclen, mehrere verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| DE3905916A1 (de) * | 1989-02-25 | 1990-08-30 | Basf Ag | Verwendung von derivaten des n-phenyl-3,4,5,6-tetrahydrophthalimids zur desikkation und abszission von pflanzenorganen |
| USRE37664E1 (en) * | 1989-02-25 | 2002-04-16 | Basf Aktiengessellschaft | Use of derivatives of N-phenl-3,4,5,6-tetrahydrophthalimide for the desiccation and abscission of plant organs |
| JP2860367B2 (ja) * | 1989-03-02 | 1999-02-24 | アグロ カネショウ株式会社 | 複素環化合物、その製造法及びそれを有効成分として含有する除草剤 |
| ATE197041T1 (de) * | 1990-07-17 | 2000-11-15 | Sagami Chem Res | Heterocyclisch substituiertes benzolderivat, dessen darstellung und herbizid, welches dieses als wirkstoff enthält |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3745170A (en) * | 1969-03-19 | 1973-07-10 | Sumitomo Chemical Co | Novel n-(3,5-dihalophenyl)-imide compounds |
| US3654302A (en) * | 1970-01-30 | 1972-04-04 | Herbert Schwartz | Tetrahydrophthalanils |
| US3984435A (en) * | 1970-12-23 | 1976-10-05 | Mitsubishi Chemical Industries Ltd. | Herbicidal N-substituted-Δ1 -tetrahydrophthalimide |
| US3878224A (en) * | 1970-12-23 | 1975-04-15 | Mitsubishi Chem Ind | N-substituted-{66 {40 -tetrahydrophthalimides |
| DE2165651C2 (de) * | 1971-10-14 | 1982-07-08 | Mitsubishi Chemical Industries, Ltd., Tokyo | N-Substituierte Δ↑1↑-Tetrahydrophthalimide, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Herbizide |
| US4001272A (en) * | 1974-09-03 | 1977-01-04 | E. I. Du Pont De Nemours And Company | Herbicidal 2-fluoro-4-halo-phenyl-4,5,6,7-tetrahydro-2h-isoindole-1,3-diones |
| US4032326A (en) * | 1974-12-24 | 1977-06-28 | E. I. Du Pont De Nemours And Company | Herbicidal 2-substituted aryl-4,5,6,7-tetrahydro-2h-isoindole-1,3-diones |
-
1980
- 1980-03-24 US US06/133,270 patent/US4292070A/en not_active Expired - Lifetime
- 1980-04-03 DE DE19803013162 patent/DE3013162A1/de not_active Withdrawn
- 1980-04-04 NL NL8002020A patent/NL8002020A/nl not_active Application Discontinuation
- 1980-04-11 CH CH282280A patent/CH646424A5/de not_active IP Right Cessation
- 1980-04-11 CA CA349,621A patent/CA1109881A/en not_active Expired
- 1980-04-11 IT IT21339/80A patent/IT1149914B/it active
- 1980-04-14 FR FR8008326A patent/FR2453852A1/fr active Granted
- 1980-04-14 GB GB8012274A patent/GB2046754B/en not_active Expired
- 1980-04-14 BR BR8002295A patent/BR8002295A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1149914B (it) | 1986-12-10 |
| CA1109881A (en) | 1981-09-29 |
| FR2453852A1 (fr) | 1980-11-07 |
| GB2046754B (en) | 1983-03-16 |
| CH646424A5 (de) | 1984-11-30 |
| IT8021339A0 (it) | 1980-04-11 |
| DE3013162A1 (de) | 1980-10-30 |
| US4292070A (en) | 1981-09-29 |
| FR2453852B1 (enExample) | 1983-07-08 |
| GB2046754A (en) | 1980-11-19 |
| BR8002295A (pt) | 1980-12-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8002020A (nl) | N-gesubstitueerde tetrahydrofthalimiden en op de toepassing hiervan als herbicidale verbinding. | |
| US4929273A (en) | N-benzyl-2-(4-fluoro-3-trifluoromethylphenoxy)butanoic amide and herbicidal composition containing the same | |
| CZ279697B6 (cs) | Tetrahydroftalimidové sloučeniny, způsob jejich výroby a herbicidní prostředek na jejich bázi | |
| NL8000888A (nl) | Heterocyclische etherachtige fenoxy-vetzure derivaten, de toepassing als herbicide en een werkwijze voor de bereiding van de fenoxy-vetzure derivaten. | |
| US4684397A (en) | 2-Substituted phenyl-4,5,6,7-tetrahydro-2H-iso-indole-1,3-diones, and their production and use | |
| US4001272A (en) | Herbicidal 2-fluoro-4-halo-phenyl-4,5,6,7-tetrahydro-2h-isoindole-1,3-diones | |
| US4032326A (en) | Herbicidal 2-substituted aryl-4,5,6,7-tetrahydro-2h-isoindole-1,3-diones | |
| US4752325A (en) | 2-substituted phenyl-3-chlorotetrahydro-2H-indazoles composition containing them, and herbicidal method of using them | |
| US5252536A (en) | Substituted indolinones useful as herbicidal agents | |
| EP0046467A1 (en) | Quinoxaline derivatives and herbicidal composition | |
| US4695312A (en) | 4,5,6,7-tetrahydro-2H-indazole derivatives and herbicides containing them | |
| CN1043642C (zh) | 除草的吡咯并吡啶化合物,包含它们的除草组合物及用途 | |
| US4670042A (en) | Tetrahydrophthalimides, and their production and use as herbicides | |
| EP0493606B1 (en) | Heterocycle-substituted benzene derivative, production thereof, and herbicide containing the same as active ingredient | |
| US5076835A (en) | Aryloxyspiroalkylindolinone herbicides | |
| US4608080A (en) | Herbicidal 2-phenyl-4,5,6,7-tetrahydro-2H-indazoles | |
| KR900001185B1 (ko) | 치환 이미다졸리닐 벤조산, 에스테르 및 염의 제조 방법 | |
| US5182397A (en) | Aryloxyspiroalkylindolinone herbicides | |
| EP0095192A2 (en) | Tetrahydrophthalimides, and their production and use | |
| US6197728B1 (en) | Quinoxaline derivatives and herbicidal composition | |
| USH531H (en) | Anilide herbicide derivatives | |
| US5484762A (en) | Aryloxy-n-(substituted phenyl) benzotriazole herbicidal agents | |
| US4902832A (en) | 2-Substituted phenyl-4,5,6,7-tetrahydro-2H-isoindole-1,3-diones, and their production and use | |
| EP0122130B1 (en) | Herbicidal tetrahydrobenzothiazole derivatives | |
| CA1250843A (en) | Quinoxaline and their production |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A85 | Still pending on 85-01-01 | ||
| BV | The patent application has lapsed |