MY7400292A - 9, 10-dihydrolysergic acid derivative - Google Patents
9, 10-dihydrolysergic acid derivativeInfo
- Publication number
- MY7400292A MY7400292A MY292/74A MY7400292A MY7400292A MY 7400292 A MY7400292 A MY 7400292A MY 292/74 A MY292/74 A MY 292/74A MY 7400292 A MY7400292 A MY 7400292A MY 7400292 A MY7400292 A MY 7400292A
- Authority
- MY
- Malaysia
- Prior art keywords
- acid derivative
- dihydrolysergic acid
- dihydrolysergic
- derivative
- acid
- Prior art date
Links
- ORBSYPFBZQJNJE-MPKXVKKWSA-N (6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical class C1=CC([C@H]2C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ORBSYPFBZQJNJE-MPKXVKKWSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
- C07D519/02—Ergot alkaloids of the cyclic peptide type
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1090067A CH520679A (de) | 1967-08-02 | 1967-08-02 | Verfahren zur Herstellung neuer Mutterkornpeptidalkaloide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MY7400292A true MY7400292A (en) | 1974-12-31 |
Family
ID=4368003
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MY292/74A MY7400292A (en) | 1967-08-02 | 1974-12-30 | 9, 10-dihydrolysergic acid derivative |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3652569A (Direct) |
| AT (1) | AT297008B (Direct) |
| BE (1) | BE718859A (Direct) |
| CA (1) | CA952107A (Direct) |
| CH (4) | CH520680A (Direct) |
| CY (1) | CY769A (Direct) |
| DE (1) | DE1795022C3 (Direct) |
| DK (1) | DK123482B (Direct) |
| ES (5) | ES356676A1 (Direct) |
| FI (1) | FI48274C (Direct) |
| FR (2) | FR1604602A (Direct) |
| GB (2) | GB1238348A (Direct) |
| MY (1) | MY7400292A (Direct) |
| NL (1) | NL157906B (Direct) |
| PL (2) | PL72567B1 (Direct) |
| SE (2) | SE351643B (Direct) |
| SU (1) | SU392624A3 (Direct) |
| YU (1) | YU34084B (Direct) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3846433A (en) * | 1969-05-06 | 1974-11-05 | Sandoz Ltd | Process for preparing ergot alkaloids |
| US4195086A (en) * | 1974-06-21 | 1980-03-25 | Sandoz Ltd. | 6-Branched chain alkyl sustituted ergot alkaloids |
| CH601321A5 (Direct) * | 1975-01-06 | 1978-07-14 | Sandoz Ag | |
| US4138565A (en) * | 1975-05-31 | 1979-02-06 | Sandoz Ltd. | Stable solutions and processes for their preparation |
| IT1157365B (it) * | 1977-10-24 | 1987-02-11 | Sandoz Ag | Medicamenti per trattare l'obesita' o ridurre il peso del corpo |
| YU41110B (en) * | 1978-07-19 | 1986-12-31 | Lek Tovarna Farmacevtskih | Process for preparing dextrorotatory ergot alcaloids acid addition salts |
| DE3303616A1 (de) * | 1982-02-12 | 1983-08-25 | Sandoz-Patent-GmbH, 7850 Lörrach | Mutterkornalkaloide, verfahren zu deren herstellung sowie diese verbindungen enthaltende pharmazeutische zubereitungen |
| DE19525137C2 (de) * | 1995-07-11 | 2003-02-27 | Gruenenthal Gmbh | 6-Dimethylaminomethyl-1-phenyl-cyclohexanverbin -dungen als Zwischenprodukte zur Herstellung pharmazeutischer Wirkstoffe |
| WO2011079313A1 (en) * | 2009-12-23 | 2011-06-30 | Map Pharmaceuticals, Inc. | Novel ergoline analogs |
| CN103827113A (zh) | 2011-06-23 | 2014-05-28 | Map药物公司 | 新型氟麦角碱类似物 |
| SG10201509139QA (en) | 2011-12-19 | 2015-12-30 | Map Pharmaceuticals Inc | Novel iso-ergoline derivatives |
| WO2013095708A1 (en) | 2011-12-21 | 2013-06-27 | Map Pharmaceuticals, Inc. | Novel neuromodulatory compounds |
| US9012640B2 (en) | 2012-06-22 | 2015-04-21 | Map Pharmaceuticals, Inc. | Cabergoline derivatives |
-
1967
- 1967-08-02 CH CH1936170A patent/CH520680A/de not_active IP Right Cessation
- 1967-08-02 CH CH1090067A patent/CH520679A/de not_active IP Right Cessation
- 1967-08-02 CH CH1090067A patent/CH563393A5/xx not_active IP Right Cessation
- 1967-08-02 CH CH1936270A patent/CH520681A/de not_active IP Right Cessation
-
1968
- 1968-07-17 GB GB1238348D patent/GB1238348A/en not_active Expired
- 1968-07-17 GB GB56746/70A patent/GB1240420A/en not_active Expired
- 1968-07-23 NL NL6810435.A patent/NL157906B/xx not_active IP Right Cessation
- 1968-07-26 FI FI682123A patent/FI48274C/fi active
- 1968-07-26 DK DK362968AA patent/DK123482B/da unknown
- 1968-07-29 SE SE10291/68A patent/SE351643B/xx unknown
- 1968-07-29 SE SE7112754A patent/SE392903B/xx unknown
- 1968-07-30 DE DE1795022A patent/DE1795022C3/de not_active Expired
- 1968-07-31 CA CA026,340A patent/CA952107A/en not_active Expired
- 1968-07-31 BE BE718859D patent/BE718859A/xx unknown
- 1968-07-31 PL PL1968128394A patent/PL72567B1/pl unknown
- 1968-07-31 AT AT745768A patent/AT297008B/de not_active IP Right Cessation
- 1968-07-31 ES ES356676A patent/ES356676A1/es not_active Expired
- 1968-07-31 PL PL1968158941A patent/PL78658B1/pl unknown
- 1968-08-01 SU SU1370603A patent/SU392624A3/ru active
- 1968-08-01 YU YU1839/68A patent/YU34084B/xx unknown
- 1968-08-01 FR FR1604602D patent/FR1604602A/fr not_active Expired
- 1968-10-29 FR FR171753A patent/FR8150M/fr not_active Expired
-
1969
- 1969-09-12 ES ES371455A patent/ES371455A1/es not_active Expired
- 1969-09-12 ES ES371452A patent/ES371452A1/es not_active Expired
- 1969-09-12 ES ES371453A patent/ES371453A1/es not_active Expired
- 1969-09-12 ES ES371454A patent/ES371454A1/es not_active Expired
-
1971
- 1971-01-21 US US108641A patent/US3652569A/en not_active Expired - Lifetime
-
1974
- 1974-11-08 CY CY76974A patent/CY769A/xx unknown
- 1974-12-30 MY MY292/74A patent/MY7400292A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA952107A (en) | 1974-07-30 |
| FI48274B (Direct) | 1974-04-30 |
| ES371454A1 (es) | 1972-03-16 |
| ES371452A1 (es) | 1972-03-16 |
| GB1240420A (en) | 1971-07-21 |
| ES356676A1 (es) | 1970-05-01 |
| DE1795022A1 (de) | 1971-12-30 |
| CH520680A (de) | 1972-03-31 |
| DK123482B (da) | 1972-06-26 |
| YU183968A (en) | 1978-06-30 |
| SE351643B (Direct) | 1972-12-04 |
| CH520681A (de) | 1972-03-31 |
| CY769A (en) | 1974-11-08 |
| ES371453A1 (es) | 1972-03-16 |
| GB1238348A (Direct) | 1971-07-07 |
| NL157906B (nl) | 1978-09-15 |
| AT297008B (de) | 1972-03-10 |
| US3652569A (en) | 1972-03-28 |
| DE1795022B2 (Direct) | 1980-08-07 |
| ES371455A1 (es) | 1972-04-01 |
| NL6810435A (Direct) | 1969-02-04 |
| SE392903B (sv) | 1977-04-25 |
| FR8150M (Direct) | 1970-08-17 |
| BE718859A (Direct) | 1969-01-31 |
| SU392624A3 (Direct) | 1973-07-27 |
| FR1604602A (Direct) | 1972-01-03 |
| CH563393A5 (en) | 1975-06-30 |
| YU34084B (en) | 1978-12-31 |
| DE1795022C3 (de) | 1981-06-19 |
| PL78658B1 (Direct) | 1975-06-30 |
| CH520679A (de) | 1972-03-31 |
| FI48274C (fi) | 1974-08-12 |
| PL72567B1 (Direct) | 1974-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY7100160A (en) | 1,2,4- triazine-5-ones | |
| CA918665A (en) | 1,4-dihydro-1-substituted-6,7-methylene-dioxy-4-oxo-3-quinoline carboxylic acid derivatives | |
| YU32926B (en) | Postopek za pripravo 1,4-dihidropiridinov | |
| IL29899A0 (en) | 2,2-dichloro-vinylphosphoric acid ester amides | |
| MY7400292A (en) | 9, 10-dihydrolysergic acid derivative | |
| YU216968A (en) | Postopek za pripravo 1,2,4-tiadiazolil-secnin | |
| IE32535L (en) | 4-aryl-3-hydroxybutyric acid derivatives | |
| YU127768A (en) | Postupak za dobijanje novih 1, 3, 4-tiadiazola | |
| IL30706A0 (en) | 2-halomethyl-3-carbamyl quinoxaline-1,4,-di-n-oxides | |
| YU32464B (en) | Postopek za pripravo derivatov 1,4-dihidropiridina | |
| YU32078B (en) | Postupak za dobijanje 3,6-disupstituisanog piridazina | |
| IL30466A0 (en) | 1,3-benzoxazin derivatives | |
| YU32380B (en) | Postupak za proizvodnju novih derivata 1, 2, 3, 4-tetrahidrokovinazolina | |
| IE31079L (en) | Substituted 6, 7-benzomorphans | |
| IE31078L (en) | Substituted 6, 7-benzomorphans | |
| PH9601A (en) | Derivatives of 2,6-dodecadienoic acid | |
| IE31536L (en) | 3, 1-benzothiazines | |
| IE32101L (en) | 4, 6-dichlorosteroids | |
| IE31643L (en) | 11, 13ß-DIALKYLSTEROIDS | |
| IE31143L (en) | 1, 2-dihydrobenzodiazepines | |
| IE31026L (en) | 3, 5-seco-a-nor-steroids | |
| IE31937B1 (en) | Benzdiaz (1,4)epinone-(2) derivatives | |
| CA752853A (en) | 3,19-disubstituted 5-androstenes | |
| CA752400A (en) | 2,1-benzisothiazoles | |
| CA773572A (en) | Aziridinyl-halocyclotriphosphaza-1,3,5-trienes |