MY108085A - Process for the preparation of terephthalic acid - Google Patents
Process for the preparation of terephthalic acidInfo
- Publication number
- MY108085A MY108085A MY1080/85A MY8501080A MY108085A MY 108085 A MY108085 A MY 108085A MY 1080/85 A MY1080/85 A MY 1080/85A MY 8501080 A MY8501080 A MY 8501080A MY 108085 A MY108085 A MY 108085A
- Authority
- MY
- Malaysia
- Prior art keywords
- preparation
- terephthalic acid
- terephthalic
- acid
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/54—Preparation of carboxylic acid anhydrides
- C07C51/56—Preparation of carboxylic acid anhydrides from organic acids, their salts, their esters or their halides, e.g. by carboxylation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7922989 | 1979-07-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MY108085A true MY108085A (en) | 1985-12-31 |
Family
ID=10506249
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MY1080/85A MY108085A (en) | 1979-07-02 | 1985-12-30 | Process for the preparation of terephthalic acid |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4314073A (member.php) |
| EP (1) | EP0021747B1 (member.php) |
| JP (1) | JPS5610138A (member.php) |
| KR (1) | KR830001304B1 (member.php) |
| BR (1) | BR8004027A (member.php) |
| DE (1) | DE3063298D1 (member.php) |
| GB (1) | GB2051804B (member.php) |
| IN (1) | IN155006B (member.php) |
| MY (1) | MY108085A (member.php) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3128147C2 (de) * | 1981-07-16 | 1986-03-06 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von aromatischen Monocarbonsäuren |
| DE3151383C1 (de) * | 1981-12-24 | 1983-06-09 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Rueckgewinnung und Wiederverwendung von Kobalt- und/oder Mangankatalysatorbestandteilen |
| DE3203658C2 (de) * | 1982-02-03 | 1984-09-13 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von Kobalt- und/oder Manganoxalat |
| DE3204510C2 (de) * | 1982-02-10 | 1986-10-02 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von Kobalt und/oder Mangan als Oxalate |
| US4447646A (en) * | 1983-01-28 | 1984-05-08 | Eastman Kodak Company | Process for the purification of terephthalic acid |
| DE3464595D1 (en) * | 1983-10-24 | 1987-08-13 | Teijin Petrochem Ind | Process for producing 2,6-naphthalenedicarboxylic acid |
| US4605763A (en) * | 1984-08-31 | 1986-08-12 | Eastman Kodak Company | Process for the purification of terephthalic acid |
| US4835307A (en) * | 1984-12-13 | 1989-05-30 | Amoco Corporation | Method and apparatus for controlling the manufacture of terephthalic acid to control the level and variability of the contaminant content and the optical density |
| JPS61252002A (ja) * | 1985-04-30 | 1986-11-10 | Mazda Motor Corp | 球面加工装置 |
| US4754062A (en) * | 1985-05-24 | 1988-06-28 | Amoco Corporation | Iron-enhanced selectivity of heavy metal-bromine catalysis in the oxidation of polyalkylaromatics |
| US4873361A (en) * | 1987-02-19 | 1989-10-10 | Amoco Corporation | Process for production of p-acetoxybenzoic acid from p-acetoxyacetophenone |
| US4952721A (en) * | 1988-02-17 | 1990-08-28 | Amoco Corporation | Process for oxidizing esters of methyl-substituted phenol compounds to aromatic carboxylic acids |
| US4845274A (en) * | 1988-09-26 | 1989-07-04 | Amoco Corporation | Oxidation of polyalkylaromatics |
| US4845275A (en) * | 1988-09-26 | 1989-07-04 | Amoco Corporation | Trimellitic acid process |
| US4996353A (en) * | 1989-05-16 | 1991-02-26 | The Dow Chemical Company | Process for the preparation of para,para'-polyphenyldicarboxylic acid |
| US5028737A (en) * | 1990-02-22 | 1991-07-02 | Amoco Corporation | Preparation of isopropylidene bis(phthalic acid) |
| EP0465100B1 (en) * | 1990-06-25 | 1994-09-28 | Mitsubishi Gas Chemical Company, Inc. | Process for producing high purity isophthalic acid |
| US5200557A (en) * | 1991-04-12 | 1993-04-06 | Amoco Corporation | Process for preparation of crude terephthalic acid suitable for reduction to prepare purified terephthalic acid |
| KR970000136B1 (ko) * | 1993-09-28 | 1997-01-04 | 브이.피. 유리예프 | 고순도 벤젠디카르복실산 이성질체의 제조방법 |
| US5767311A (en) * | 1995-06-07 | 1998-06-16 | Glitsch International, Inc. | Method and apparatus for preparing purified terephtalic acid |
| US6054610A (en) * | 1995-06-07 | 2000-04-25 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid and isophthalic acid from mixed xylenes |
| US5929274A (en) * | 1995-06-07 | 1999-07-27 | Hfm International, Inc. | Method to reduce carboxybenzaldehyde isomers in terephthalic acid or isophthalic acid |
| US6013835A (en) * | 1995-06-07 | 2000-01-11 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| WO1996041790A1 (en) * | 1995-06-08 | 1996-12-27 | Mogilev Order Of Lenin Proizvodstvennoe Obiedinenie 'khimvolokno' Named After V.I. Lenin | Method of obtaining isophthalic acid of monomeric purity |
| US6657068B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Liquid phase oxidation of halogenated ortho-xylenes |
| US6649773B2 (en) | 2002-03-22 | 2003-11-18 | General Electric Company | Method for the manufacture of halophthalic acids and anhydrides |
| US6657067B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Method for the manufacture of chlorophthalic anhydride |
| KR100881166B1 (ko) * | 2002-09-16 | 2009-02-03 | 에스케이케미칼주식회사 | 테레프탈산의 제조 방법 |
| US7161027B2 (en) * | 2002-12-09 | 2007-01-09 | Eastman Chemical Company | Process for the oxidative purification of terephthalic acid |
| BR0316462A (pt) * | 2002-12-09 | 2005-10-11 | Eastman Chem Co | Processos para reduzir uma suspensão de ácido carboxìlico purificado, para purificar um produto de oxidação em estágios, para produzir um produto de ácido carboxìlico purificado, e, suspensão de ácido carboxìlico purificado |
| US7074954B2 (en) * | 2002-12-09 | 2006-07-11 | Eastman Chemical Company | Process for the oxidative purification of terephthalic acid |
| US7132566B2 (en) * | 2003-09-22 | 2006-11-07 | Eastman Chemical Company | Process for the purification of a crude carboxylic acid slurry |
| US7546747B2 (en) * | 2004-01-15 | 2009-06-16 | Eastman Chemical Company | Process for production of a dried carboxylic acid cake suitable for use in polyester production |
| US7541489B2 (en) * | 2004-06-30 | 2009-06-02 | Sabic Innovative Plastics Ip B.V. | Method of making halophthalic acids and halophthalic anhydrides |
| US20060004223A1 (en) * | 2004-06-30 | 2006-01-05 | General Electric Company | Method of making halophthalic acids and halophthalic anhydrides |
| US7550627B2 (en) | 2005-03-08 | 2009-06-23 | Eastman Chemical Company | Processes for producing aromatic dicarboxylic acids |
| US20060205974A1 (en) * | 2005-03-08 | 2006-09-14 | Lavoie Gino G | Processes for producing aromatic dicarboxylic acids |
| US20070179312A1 (en) * | 2006-02-02 | 2007-08-02 | O'meadhra Ruairi Seosamh | Process for the purification of a crude carboxylic axid slurry |
| US7714094B2 (en) * | 2007-11-15 | 2010-05-11 | Eastman Chemical Company | Simplified isophthalic acid process for modifying PET |
| US8614350B2 (en) | 2008-01-15 | 2013-12-24 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| US8455680B2 (en) | 2008-01-15 | 2013-06-04 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| EP2522426B1 (en) | 2011-05-12 | 2014-02-12 | King Saud University | Method for preparing carboxylic acids |
| US9199906B2 (en) | 2013-09-24 | 2015-12-01 | Eastman Chemical Company | Processes for producing isophthalic acid |
| US9212121B2 (en) | 2013-09-24 | 2015-12-15 | Eastman Chemical Company | Processes for producing terephthalic acid |
| CN105218358B (zh) * | 2015-09-29 | 2017-09-12 | 江西科苑生物药业有限公司 | 一种粗均苯三甲酸的精制方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1270030C2 (de) * | 1962-04-27 | 1973-07-19 | Verfahren zur reinigung von terephthalsaeure | |
| GB983677A (en) * | 1962-04-27 | 1965-02-17 | Mitsui Petrochemical Ind | A process for the preparation of terephthalic acid having extremely high purity |
| NL128444C (member.php) * | 1963-10-10 | |||
| US3507913A (en) | 1966-02-14 | 1970-04-21 | Mitsui Petrochemical Ind | Method of manufacture of terephthalic acid |
| CA849014A (en) * | 1968-10-25 | 1970-08-11 | Ichikawa Yataro | Apparatus for continuous gas-liquid contact and process for refining crude terephthalic acid |
| JPS5518698B1 (member.php) * | 1971-04-03 | 1980-05-21 | ||
| JPS49126641A (member.php) * | 1973-04-14 | 1974-12-04 | ||
| JPS5614101B2 (member.php) * | 1974-07-31 | 1981-04-02 | ||
| JPS5291835A (en) * | 1976-01-29 | 1977-08-02 | Mitsubishi Chem Ind Ltd | Prepation of terephtalic acid for direct polymerization |
| JPS5931491B2 (ja) | 1977-08-12 | 1984-08-02 | 三井化学株式会社 | テレフタル酸懸濁液中の母液を置換分離する方法 |
-
1980
- 1980-06-13 EP EP80301996A patent/EP0021747B1/en not_active Expired
- 1980-06-13 DE DE8080301996T patent/DE3063298D1/de not_active Expired
- 1980-06-13 GB GB8019364A patent/GB2051804B/en not_active Expired
- 1980-06-19 IN IN461/DEL/80A patent/IN155006B/en unknown
- 1980-06-20 US US06/161,560 patent/US4314073A/en not_active Expired - Lifetime
- 1980-06-27 BR BR8004027A patent/BR8004027A/pt not_active IP Right Cessation
- 1980-07-01 KR KR1019800002595A patent/KR830001304B1/ko not_active Expired
- 1980-07-02 JP JP9051280A patent/JPS5610138A/ja active Granted
-
1985
- 1985-12-30 MY MY1080/85A patent/MY108085A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IN155006B (member.php) | 1984-12-22 |
| JPS5610138A (en) | 1981-02-02 |
| US4314073A (en) | 1982-02-02 |
| JPH0240653B2 (member.php) | 1990-09-12 |
| BR8004027A (pt) | 1981-01-21 |
| EP0021747B1 (en) | 1983-05-18 |
| KR830001304B1 (ko) | 1983-07-06 |
| DE3063298D1 (en) | 1983-07-07 |
| EP0021747A1 (en) | 1981-01-07 |
| GB2051804B (en) | 1983-10-12 |
| KR830003396A (ko) | 1983-06-20 |
| GB2051804A (en) | 1981-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3063298D1 (en) | Process for the preparation of terephthalic acid | |
| ZA776292B (en) | Process for the preparation of terephthalic acid | |
| PT72079A (en) | Process for the preparation of 7-acylamino-3-vinylcephalosporanic acid derivatives | |
| GB2032920B (en) | Process for preparing terephthalic acid | |
| PT71028A (en) | Process for the preparation of azolyloxy-carboxylic acid amides with herbicidal-effect | |
| DE3060027D1 (en) | Process for the preparation of benzimidazolylbenzofurans | |
| DE3060921D1 (en) | Process for the preparation of formyl-valeric acid esters | |
| DE3060155D1 (en) | Process for the preparation of thiazolidine-2-thiones | |
| DE3061181D1 (en) | Process for the preparation of dienoic acids | |
| DE3064088D1 (en) | Process for the preparation of 4-nitrotoluene-2-sulfonic acid | |
| DE3061277D1 (en) | Process for the preparation of carboxylic acid halides | |
| DE2960129D1 (en) | Process for the preparation of arylglyoxylic acids | |
| EG12905A (en) | Process for the preparation of terephthalic acid | |
| DE3060926D1 (en) | Process for the preparation of alcanediol-bis-aminobenzoic acid esters | |
| DE2960079D1 (en) | Process for the preparation of arylglyoxylic acids | |
| DE3070185D1 (en) | Process for the preparation of 2-amino-1-naphthalene sulfonic acid | |
| DE3064309D1 (en) | Process for the preparation of l-aspartic acid n-thiocarboxyanhydride | |
| DE3061043D1 (en) | Process for the preparation of carboxylic acid halides | |
| ZA806349B (en) | Process for the preparation of y-chloroacetoacetic acid chloride | |
| EP0017882B1 (en) | Process for the preparation of 3-phenoxy-4-fluoro-benzoic acid | |
| GB2018252B (en) | Process for the purification of terephthalic acid | |
| DE3064662D1 (en) | Process for the preparation of 5-oxo-alkanoic acids | |
| GB2032432B (en) | Process for preparing terephthalic acid | |
| DE2964328D1 (en) | Process for the preparation of m-amino-phenols | |
| JPS5687534A (en) | Manufacture of isophthalic acid |