MY108085A - Process for the preparation of terephthalic acid - Google Patents
Process for the preparation of terephthalic acidInfo
- Publication number
- MY108085A MY108085A MY1080/85A MY8501080A MY108085A MY 108085 A MY108085 A MY 108085A MY 1080/85 A MY1080/85 A MY 1080/85A MY 8501080 A MY8501080 A MY 8501080A MY 108085 A MY108085 A MY 108085A
- Authority
- MY
- Malaysia
- Prior art keywords
- preparation
- terephthalic acid
- terephthalic
- acid
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/54—Preparation of carboxylic acid anhydrides
- C07C51/56—Preparation of carboxylic acid anhydrides from organic acids, their salts, their esters or their halides, e.g. by carboxylation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7922989 | 1979-07-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MY108085A true MY108085A (en) | 1985-12-31 |
Family
ID=10506249
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MY1080/85A MY108085A (en) | 1979-07-02 | 1985-12-30 | Process for the preparation of terephthalic acid |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4314073A (enExample) |
| EP (1) | EP0021747B1 (enExample) |
| JP (1) | JPS5610138A (enExample) |
| KR (1) | KR830001304B1 (enExample) |
| BR (1) | BR8004027A (enExample) |
| DE (1) | DE3063298D1 (enExample) |
| GB (1) | GB2051804B (enExample) |
| IN (1) | IN155006B (enExample) |
| MY (1) | MY108085A (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3128147C2 (de) * | 1981-07-16 | 1986-03-06 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von aromatischen Monocarbonsäuren |
| DE3151383C1 (de) * | 1981-12-24 | 1983-06-09 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Rueckgewinnung und Wiederverwendung von Kobalt- und/oder Mangankatalysatorbestandteilen |
| DE3203658C2 (de) * | 1982-02-03 | 1984-09-13 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von Kobalt- und/oder Manganoxalat |
| DE3204510C2 (de) * | 1982-02-10 | 1986-10-02 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Gewinnung von Kobalt und/oder Mangan als Oxalate |
| US4447646A (en) * | 1983-01-28 | 1984-05-08 | Eastman Kodak Company | Process for the purification of terephthalic acid |
| DE3464595D1 (en) * | 1983-10-24 | 1987-08-13 | Teijin Petrochem Ind | Process for producing 2,6-naphthalenedicarboxylic acid |
| US4605763A (en) * | 1984-08-31 | 1986-08-12 | Eastman Kodak Company | Process for the purification of terephthalic acid |
| US4835307A (en) * | 1984-12-13 | 1989-05-30 | Amoco Corporation | Method and apparatus for controlling the manufacture of terephthalic acid to control the level and variability of the contaminant content and the optical density |
| JPS61252002A (ja) * | 1985-04-30 | 1986-11-10 | Mazda Motor Corp | 球面加工装置 |
| US4754062A (en) * | 1985-05-24 | 1988-06-28 | Amoco Corporation | Iron-enhanced selectivity of heavy metal-bromine catalysis in the oxidation of polyalkylaromatics |
| US4873361A (en) * | 1987-02-19 | 1989-10-10 | Amoco Corporation | Process for production of p-acetoxybenzoic acid from p-acetoxyacetophenone |
| US4952721A (en) * | 1988-02-17 | 1990-08-28 | Amoco Corporation | Process for oxidizing esters of methyl-substituted phenol compounds to aromatic carboxylic acids |
| US4845275A (en) * | 1988-09-26 | 1989-07-04 | Amoco Corporation | Trimellitic acid process |
| US4845274A (en) * | 1988-09-26 | 1989-07-04 | Amoco Corporation | Oxidation of polyalkylaromatics |
| US4996353A (en) * | 1989-05-16 | 1991-02-26 | The Dow Chemical Company | Process for the preparation of para,para'-polyphenyldicarboxylic acid |
| US5028737A (en) * | 1990-02-22 | 1991-07-02 | Amoco Corporation | Preparation of isopropylidene bis(phthalic acid) |
| US5132450A (en) * | 1990-06-25 | 1992-07-21 | Mitsubishi Gas Chemical Company, Inc. | Process for producing high purity isophthalic acid |
| US5200557A (en) * | 1991-04-12 | 1993-04-06 | Amoco Corporation | Process for preparation of crude terephthalic acid suitable for reduction to prepare purified terephthalic acid |
| KR970000136B1 (ko) * | 1993-09-28 | 1997-01-04 | 브이.피. 유리예프 | 고순도 벤젠디카르복실산 이성질체의 제조방법 |
| US5929274A (en) * | 1995-06-07 | 1999-07-27 | Hfm International, Inc. | Method to reduce carboxybenzaldehyde isomers in terephthalic acid or isophthalic acid |
| US5767311A (en) * | 1995-06-07 | 1998-06-16 | Glitsch International, Inc. | Method and apparatus for preparing purified terephtalic acid |
| US6054610A (en) * | 1995-06-07 | 2000-04-25 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid and isophthalic acid from mixed xylenes |
| US6013835A (en) * | 1995-06-07 | 2000-01-11 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| WO1996041791A1 (en) * | 1995-06-08 | 1996-12-27 | Mogilev Order Of Lenin Proizvodstvennoe Obiedinenie | Method of obtaining terephthalic acid of monomeric purity |
| US6657068B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Liquid phase oxidation of halogenated ortho-xylenes |
| US6657067B2 (en) | 2002-03-22 | 2003-12-02 | General Electric Company | Method for the manufacture of chlorophthalic anhydride |
| US6649773B2 (en) | 2002-03-22 | 2003-11-18 | General Electric Company | Method for the manufacture of halophthalic acids and anhydrides |
| KR100881166B1 (ko) * | 2002-09-16 | 2009-02-03 | 에스케이케미칼주식회사 | 테레프탈산의 제조 방법 |
| US7161027B2 (en) * | 2002-12-09 | 2007-01-09 | Eastman Chemical Company | Process for the oxidative purification of terephthalic acid |
| RU2005121568A (ru) * | 2002-12-09 | 2006-01-20 | Истман Кемикал Компани (US) | Способ окислительной очистки терефталевой кислоты |
| US7074954B2 (en) * | 2002-12-09 | 2006-07-11 | Eastman Chemical Company | Process for the oxidative purification of terephthalic acid |
| US7132566B2 (en) * | 2003-09-22 | 2006-11-07 | Eastman Chemical Company | Process for the purification of a crude carboxylic acid slurry |
| US7546747B2 (en) * | 2004-01-15 | 2009-06-16 | Eastman Chemical Company | Process for production of a dried carboxylic acid cake suitable for use in polyester production |
| US20060004223A1 (en) * | 2004-06-30 | 2006-01-05 | General Electric Company | Method of making halophthalic acids and halophthalic anhydrides |
| US7541489B2 (en) * | 2004-06-30 | 2009-06-02 | Sabic Innovative Plastics Ip B.V. | Method of making halophthalic acids and halophthalic anhydrides |
| US7550627B2 (en) | 2005-03-08 | 2009-06-23 | Eastman Chemical Company | Processes for producing aromatic dicarboxylic acids |
| US20060205974A1 (en) * | 2005-03-08 | 2006-09-14 | Lavoie Gino G | Processes for producing aromatic dicarboxylic acids |
| US20070179312A1 (en) * | 2006-02-02 | 2007-08-02 | O'meadhra Ruairi Seosamh | Process for the purification of a crude carboxylic axid slurry |
| US7714094B2 (en) * | 2007-11-15 | 2010-05-11 | Eastman Chemical Company | Simplified isophthalic acid process for modifying PET |
| US8614350B2 (en) | 2008-01-15 | 2013-12-24 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| US8455680B2 (en) | 2008-01-15 | 2013-06-04 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| EP2522426B1 (en) | 2011-05-12 | 2014-02-12 | King Saud University | Method for preparing carboxylic acids |
| US9199906B2 (en) | 2013-09-24 | 2015-12-01 | Eastman Chemical Company | Processes for producing isophthalic acid |
| US9212121B2 (en) | 2013-09-24 | 2015-12-15 | Eastman Chemical Company | Processes for producing terephthalic acid |
| CN105218358B (zh) * | 2015-09-29 | 2017-09-12 | 江西科苑生物药业有限公司 | 一种粗均苯三甲酸的精制方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1270030C2 (de) * | 1962-04-27 | 1973-07-19 | Verfahren zur reinigung von terephthalsaeure | |
| GB983677A (en) * | 1962-04-27 | 1965-02-17 | Mitsui Petrochemical Ind | A process for the preparation of terephthalic acid having extremely high purity |
| NL128444C (enExample) * | 1963-10-10 | |||
| US3507913A (en) | 1966-02-14 | 1970-04-21 | Mitsui Petrochemical Ind | Method of manufacture of terephthalic acid |
| CA849014A (en) * | 1968-10-25 | 1970-08-11 | Ichikawa Yataro | Apparatus for continuous gas-liquid contact and process for refining crude terephthalic acid |
| JPS5518698B1 (enExample) * | 1971-04-03 | 1980-05-21 | ||
| JPS49126641A (enExample) * | 1973-04-14 | 1974-12-04 | ||
| JPS5614101B2 (enExample) * | 1974-07-31 | 1981-04-02 | ||
| JPS5291835A (en) * | 1976-01-29 | 1977-08-02 | Mitsubishi Chem Ind Ltd | Prepation of terephtalic acid for direct polymerization |
| JPS5931491B2 (ja) | 1977-08-12 | 1984-08-02 | 三井化学株式会社 | テレフタル酸懸濁液中の母液を置換分離する方法 |
-
1980
- 1980-06-13 DE DE8080301996T patent/DE3063298D1/de not_active Expired
- 1980-06-13 GB GB8019364A patent/GB2051804B/en not_active Expired
- 1980-06-13 EP EP80301996A patent/EP0021747B1/en not_active Expired
- 1980-06-19 IN IN461/DEL/80A patent/IN155006B/en unknown
- 1980-06-20 US US06/161,560 patent/US4314073A/en not_active Expired - Lifetime
- 1980-06-27 BR BR8004027A patent/BR8004027A/pt not_active IP Right Cessation
- 1980-07-01 KR KR1019800002595A patent/KR830001304B1/ko not_active Expired
- 1980-07-02 JP JP9051280A patent/JPS5610138A/ja active Granted
-
1985
- 1985-12-30 MY MY1080/85A patent/MY108085A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB2051804A (en) | 1981-01-21 |
| GB2051804B (en) | 1983-10-12 |
| IN155006B (enExample) | 1984-12-22 |
| KR830003396A (ko) | 1983-06-20 |
| JPS5610138A (en) | 1981-02-02 |
| JPH0240653B2 (enExample) | 1990-09-12 |
| BR8004027A (pt) | 1981-01-21 |
| EP0021747A1 (en) | 1981-01-07 |
| US4314073A (en) | 1982-02-02 |
| KR830001304B1 (ko) | 1983-07-06 |
| EP0021747B1 (en) | 1983-05-18 |
| DE3063298D1 (en) | 1983-07-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3063298D1 (en) | Process for the preparation of terephthalic acid | |
| ZA776292B (en) | Process for the preparation of terephthalic acid | |
| PT72079B (en) | Process for the preparation of 7-acylamino-3-vinylcephalosporanic acid derivatives | |
| GB2032920B (en) | Process for preparing terephthalic acid | |
| PT71028A (en) | Process for the preparation of azolyloxy-carboxylic acid amides with herbicidal-effect | |
| DE3060027D1 (en) | Process for the preparation of benzimidazolylbenzofurans | |
| DE3060921D1 (en) | Process for the preparation of formyl-valeric acid esters | |
| DE3060155D1 (en) | Process for the preparation of thiazolidine-2-thiones | |
| DE3061181D1 (en) | Process for the preparation of dienoic acids | |
| DE3064088D1 (en) | Process for the preparation of 4-nitrotoluene-2-sulfonic acid | |
| DE3061277D1 (en) | Process for the preparation of carboxylic acid halides | |
| DE2960129D1 (en) | Process for the preparation of arylglyoxylic acids | |
| EG12905A (en) | Process for the preparation of terephthalic acid | |
| DE3060926D1 (en) | Process for the preparation of alcanediol-bis-aminobenzoic acid esters | |
| DE2960079D1 (en) | Process for the preparation of arylglyoxylic acids | |
| DE3070185D1 (en) | Process for the preparation of 2-amino-1-naphthalene sulfonic acid | |
| DE3064309D1 (en) | Process for the preparation of l-aspartic acid n-thiocarboxyanhydride | |
| DE3061043D1 (en) | Process for the preparation of carboxylic acid halides | |
| ZA806349B (en) | Process for the preparation of y-chloroacetoacetic acid chloride | |
| DE3060188D1 (en) | Process for the preparation of 3-phenoxy-4-fluoro-benzoic acid | |
| GB2018252B (en) | Process for the purification of terephthalic acid | |
| DE3064662D1 (en) | Process for the preparation of 5-oxo-alkanoic acids | |
| GB2032432B (en) | Process for preparing terephthalic acid | |
| DE2964328D1 (en) | Process for the preparation of m-amino-phenols | |
| JPS5687534A (en) | Manufacture of isophthalic acid |