KR20050106447A - 내후성 다층 제품 및 그의 제조 방법 - Google Patents
내후성 다층 제품 및 그의 제조 방법 Download PDFInfo
- Publication number
- KR20050106447A KR20050106447A KR1020057015514A KR20057015514A KR20050106447A KR 20050106447 A KR20050106447 A KR 20050106447A KR 1020057015514 A KR1020057015514 A KR 1020057015514A KR 20057015514 A KR20057015514 A KR 20057015514A KR 20050106447 A KR20050106447 A KR 20050106447A
- Authority
- KR
- South Korea
- Prior art keywords
- layer
- structural units
- poly
- polystyrene
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 99
- 238000002360 preparation method Methods 0.000 title description 3
- 239000010410 layer Substances 0.000 claims abstract description 247
- 239000000758 substrate Substances 0.000 claims abstract description 80
- -1 alkenyl aromatic compound Chemical class 0.000 claims abstract description 62
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims abstract description 58
- 229920001577 copolymer Polymers 0.000 claims abstract description 56
- 239000011247 coating layer Substances 0.000 claims abstract description 55
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 53
- 238000004026 adhesive bonding Methods 0.000 claims abstract description 44
- 229920000642 polymer Polymers 0.000 claims abstract description 42
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 27
- 125000003118 aryl group Chemical group 0.000 claims abstract description 25
- 238000004519 manufacturing process Methods 0.000 claims abstract description 18
- 150000001993 dienes Chemical class 0.000 claims abstract description 17
- 229920001634 Copolyester Polymers 0.000 claims abstract description 13
- 239000000203 mixture Substances 0.000 claims description 57
- 239000004417 polycarbonate Substances 0.000 claims description 53
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 49
- 229920000515 polycarbonate Polymers 0.000 claims description 46
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 43
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 43
- 229920005989 resin Polymers 0.000 claims description 41
- 239000011347 resin Substances 0.000 claims description 41
- 229920001187 thermosetting polymer Polymers 0.000 claims description 40
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 39
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 38
- 239000004793 Polystyrene Substances 0.000 claims description 36
- 229920002223 polystyrene Polymers 0.000 claims description 35
- 239000000049 pigment Substances 0.000 claims description 29
- 239000000853 adhesive Substances 0.000 claims description 25
- 230000001070 adhesive effect Effects 0.000 claims description 25
- 229920001400 block copolymer Polymers 0.000 claims description 25
- 229910052751 metal Inorganic materials 0.000 claims description 24
- 239000002184 metal Substances 0.000 claims description 24
- 239000011521 glass Substances 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 21
- 239000003086 colorant Substances 0.000 claims description 17
- 239000000178 monomer Substances 0.000 claims description 17
- 229920000728 polyester Polymers 0.000 claims description 17
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 17
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 16
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 claims description 16
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 15
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 14
- 229920001955 polyphenylene ether Polymers 0.000 claims description 14
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 claims description 13
- 229920001169 thermoplastic Polymers 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 239000004743 Polypropylene Substances 0.000 claims description 10
- 238000000465 moulding Methods 0.000 claims description 10
- 229920002678 cellulose Polymers 0.000 claims description 9
- 239000001913 cellulose Substances 0.000 claims description 9
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 9
- 239000011976 maleic acid Substances 0.000 claims description 9
- 229920001155 polypropylene Polymers 0.000 claims description 9
- 229920002877 acrylic styrene acrylonitrile Polymers 0.000 claims description 8
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 8
- 239000000919 ceramic Substances 0.000 claims description 8
- 238000005253 cladding Methods 0.000 claims description 8
- 239000000975 dye Substances 0.000 claims description 8
- 239000001530 fumaric acid Substances 0.000 claims description 8
- 229920001230 polyarylate Polymers 0.000 claims description 8
- 229920005992 thermoplastic resin Polymers 0.000 claims description 8
- 229920002554 vinyl polymer Polymers 0.000 claims description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 7
- 239000000945 filler Substances 0.000 claims description 7
- 238000003475 lamination Methods 0.000 claims description 7
- 150000002739 metals Chemical class 0.000 claims description 7
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 7
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 7
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 6
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 6
- 239000004416 thermosoftening plastic Substances 0.000 claims description 6
- 238000007765 extrusion coating Methods 0.000 claims description 5
- 229920001601 polyetherimide Polymers 0.000 claims description 5
- 239000002023 wood Substances 0.000 claims description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 4
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 claims description 4
- ZTMADXFOCUXMJE-UHFFFAOYSA-N 2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=CC=C1O ZTMADXFOCUXMJE-UHFFFAOYSA-N 0.000 claims description 4
- OFNISBHGPNMTMS-UHFFFAOYSA-N 3-methylideneoxolane-2,5-dione Chemical compound C=C1CC(=O)OC1=O OFNISBHGPNMTMS-UHFFFAOYSA-N 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 4
- 239000004952 Polyamide Substances 0.000 claims description 4
- 239000004697 Polyetherimide Substances 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 claims description 4
- 229920002647 polyamide Polymers 0.000 claims description 4
- 229920000412 polyarylene Polymers 0.000 claims description 4
- 239000004734 Polyphenylene sulfide Substances 0.000 claims description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims description 3
- 230000000996 additive effect Effects 0.000 claims description 3
- 229920001519 homopolymer Polymers 0.000 claims description 3
- 229920000098 polyolefin Polymers 0.000 claims description 3
- 229920000069 polyphenylene sulfide Polymers 0.000 claims description 3
- 238000012545 processing Methods 0.000 claims description 3
- 230000001681 protective effect Effects 0.000 claims description 3
- 229920002397 thermoplastic olefin Polymers 0.000 claims description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 claims description 2
- WSQZNZLOZXSBHA-UHFFFAOYSA-N 3,8-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-2,9-dione Chemical compound O=C1OCCCCOC(=O)C2=CC=C1C=C2 WSQZNZLOZXSBHA-UHFFFAOYSA-N 0.000 claims description 2
- 239000004696 Poly ether ether ketone Substances 0.000 claims description 2
- 239000004962 Polyamide-imide Substances 0.000 claims description 2
- 239000004698 Polyethylene Substances 0.000 claims description 2
- 239000004642 Polyimide Substances 0.000 claims description 2
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 2
- 229920010524 Syndiotactic polystyrene Polymers 0.000 claims description 2
- IUVFQZSVTQCSFE-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol;terephthalic acid Chemical compound OCC1(CO)CCCCC1.OC(=O)C1=CC=C(C(O)=O)C=C1 IUVFQZSVTQCSFE-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 238000010276 construction Methods 0.000 claims description 2
- UHPJWJRERDJHOJ-UHFFFAOYSA-N ethene;naphthalene-1-carboxylic acid Chemical compound C=C.C1=CC=C2C(C(=O)O)=CC=CC2=C1 UHPJWJRERDJHOJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000004744 fabric Substances 0.000 claims description 2
- 239000006260 foam Substances 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- 229920001652 poly(etherketoneketone) Polymers 0.000 claims description 2
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 claims description 2
- 229920000058 polyacrylate Polymers 0.000 claims description 2
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 2
- 229920002312 polyamide-imide Polymers 0.000 claims description 2
- 229920006260 polyaryletherketone Polymers 0.000 claims description 2
- 229920000570 polyether Polymers 0.000 claims description 2
- 229920002530 polyetherether ketone Polymers 0.000 claims description 2
- 229920000573 polyethylene Polymers 0.000 claims description 2
- 229920001721 polyimide Polymers 0.000 claims description 2
- 229920006324 polyoxymethylene Polymers 0.000 claims description 2
- 229920002215 polytrimethylene terephthalate Polymers 0.000 claims description 2
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 2
- 239000011118 polyvinyl acetate Substances 0.000 claims description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 2
- 239000004800 polyvinyl chloride Substances 0.000 claims description 2
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 2
- 229920002620 polyvinyl fluoride Polymers 0.000 claims description 2
- 210000003660 reticulum Anatomy 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 2
- 239000002174 Styrene-butadiene Substances 0.000 claims 6
- 239000011115 styrene butadiene Substances 0.000 claims 6
- 229920003048 styrene butadiene rubber Polymers 0.000 claims 6
- 230000001747 exhibiting effect Effects 0.000 claims 4
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 claims 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims 3
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims 3
- 239000001630 malic acid Substances 0.000 claims 3
- 235000011090 malic acid Nutrition 0.000 claims 3
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 claims 3
- 229930182556 Polyacetal Natural products 0.000 claims 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims 1
- 150000003926 acrylamides Chemical class 0.000 claims 1
- 210000003195 fascia Anatomy 0.000 claims 1
- 229920001643 poly(ether ketone) Polymers 0.000 claims 1
- 229920006149 polyester-amide block copolymer Polymers 0.000 claims 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 claims 1
- QMRNDFMLWNAFQR-UHFFFAOYSA-N prop-2-enenitrile;prop-2-enoic acid;styrene Chemical compound C=CC#N.OC(=O)C=C.C=CC1=CC=CC=C1 QMRNDFMLWNAFQR-UHFFFAOYSA-N 0.000 claims 1
- 238000012360 testing method Methods 0.000 description 23
- 229920006289 polycarbonate film Polymers 0.000 description 19
- 150000003254 radicals Chemical class 0.000 description 19
- 125000000217 alkyl group Chemical group 0.000 description 14
- 229920002633 Kraton (polymer) Polymers 0.000 description 13
- 229920003023 plastic Polymers 0.000 description 12
- 239000004033 plastic Substances 0.000 description 12
- 239000003677 Sheet moulding compound Substances 0.000 description 11
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000001746 injection moulding Methods 0.000 description 8
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 8
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 8
- 229920001207 Noryl Polymers 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 239000007924 injection Substances 0.000 description 7
- 238000002347 injection Methods 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 239000004727 Noryl Substances 0.000 description 6
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 6
- 229940106691 bisphenol a Drugs 0.000 description 6
- 239000011248 coating agent Substances 0.000 description 6
- 238000005034 decoration Methods 0.000 description 6
- 150000005677 organic carbonates Chemical group 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 5
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 5
- 150000005840 aryl radicals Chemical class 0.000 description 5
- 229910000019 calcium carbonate Inorganic materials 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 229920000049 Carbon (fiber) Polymers 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 4
- 230000000712 assembly Effects 0.000 description 4
- 238000000429 assembly Methods 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 239000004917 carbon fiber Substances 0.000 description 4
- 238000000748 compression moulding Methods 0.000 description 4
- 125000000524 functional group Chemical group 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 239000004926 polymethyl methacrylate Substances 0.000 description 4
- 239000012763 reinforcing filler Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 3
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 3
- 229930185605 Bisphenol Natural products 0.000 description 3
- YAAQEISEHDUIFO-UHFFFAOYSA-N C=CC#N.OC(=O)C=CC=CC1=CC=CC=C1 Chemical compound C=CC#N.OC(=O)C=CC=CC1=CC=CC=C1 YAAQEISEHDUIFO-UHFFFAOYSA-N 0.000 description 3
- 229920000265 Polyparaphenylene Polymers 0.000 description 3
- 239000006096 absorbing agent Substances 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 239000011324 bead Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 239000003063 flame retardant Substances 0.000 description 3
- 239000003365 glass fiber Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 239000012760 heat stabilizer Substances 0.000 description 3
- 239000004611 light stabiliser Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 125000002524 organometallic group Chemical group 0.000 description 3
- 239000012994 photoredox catalyst Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920001707 polybutylene terephthalate Polymers 0.000 description 3
- 229920001195 polyisoprene Polymers 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- 235000010215 titanium dioxide Nutrition 0.000 description 3
- SYJPAKDNFZLSMV-HYXAFXHYSA-N (Z)-2-methylpropanal oxime Chemical compound CC(C)\C=N/O SYJPAKDNFZLSMV-HYXAFXHYSA-N 0.000 description 2
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 2
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- FDTLQXNAPKJJAM-UHFFFAOYSA-N 2-(3-hydroxyquinolin-2-yl)indene-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C1C1=NC2=CC=CC=C2C=C1O FDTLQXNAPKJJAM-UHFFFAOYSA-N 0.000 description 2
- LVLNPXCISNPHLE-UHFFFAOYSA-N 2-[(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1CC1=CC=CC=C1O LVLNPXCISNPHLE-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- URFNSYWAGGETFK-UHFFFAOYSA-N 4,4'-Dihydroxybibenzyl Chemical class C1=CC(O)=CC=C1CCC1=CC=C(O)C=C1 URFNSYWAGGETFK-UHFFFAOYSA-N 0.000 description 2
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical class C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000002216 antistatic agent Substances 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 229920005601 base polymer Polymers 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 125000005587 carbonate group Chemical group 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000011111 cardboard Substances 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical class OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229910000423 chromium oxide Inorganic materials 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000007739 conversion coating Methods 0.000 description 2
- 239000007799 cork Substances 0.000 description 2
- 230000001351 cycling effect Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000032798 delamination Effects 0.000 description 2
- 239000000539 dimer Substances 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical group C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 125000005647 linker group Chemical group 0.000 description 2
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000005641 methacryl group Chemical group 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000010445 mica Substances 0.000 description 2
- 229910052618 mica group Inorganic materials 0.000 description 2
- 239000006082 mold release agent Substances 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 description 2
- 229920002492 poly(sulfone) Polymers 0.000 description 2
- 239000004431 polycarbonate resin Substances 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 229920000307 polymer substrate Polymers 0.000 description 2
- 239000002952 polymeric resin Substances 0.000 description 2
- 229920005996 polystyrene-poly(ethylene-butylene)-polystyrene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 229920005604 random copolymer Polymers 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000004758 synthetic textile Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000008646 thermal stress Effects 0.000 description 2
- 238000003856 thermoforming Methods 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- 229910001928 zirconium oxide Inorganic materials 0.000 description 2
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 2
- SMKKEOQDQNCTGL-ZETCQYMHSA-N (2s)-2-[(2-nitrophenoxy)methyl]oxirane Chemical compound [O-][N+](=O)C1=CC=CC=C1OC[C@H]1OC1 SMKKEOQDQNCTGL-ZETCQYMHSA-N 0.000 description 1
- DRZPXZMMDBMTHL-UHFFFAOYSA-N (3-hydroxyphenyl) prop-2-enoate Chemical compound OC1=CC=CC(OC(=O)C=C)=C1 DRZPXZMMDBMTHL-UHFFFAOYSA-N 0.000 description 1
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 1
- HCNHNBLSNVSJTJ-UHFFFAOYSA-N 1,1-Bis(4-hydroxyphenyl)ethane Chemical compound C=1C=C(O)C=CC=1C(C)C1=CC=C(O)C=C1 HCNHNBLSNVSJTJ-UHFFFAOYSA-N 0.000 description 1
- DMDRBXCDTZRMHZ-UHFFFAOYSA-N 1,4-bis(2,4,6-trimethylanilino)anthracene-9,10-dione Chemical compound CC1=CC(C)=CC(C)=C1NC(C=1C(=O)C2=CC=CC=C2C(=O)C=11)=CC=C1NC1=C(C)C=C(C)C=C1C DMDRBXCDTZRMHZ-UHFFFAOYSA-N 0.000 description 1
- IBABXJRXGSAJLQ-UHFFFAOYSA-N 1,4-bis(2,6-diethyl-4-methylanilino)anthracene-9,10-dione Chemical compound CCC1=CC(C)=CC(CC)=C1NC(C=1C(=O)C2=CC=CC=C2C(=O)C=11)=CC=C1NC1=C(CC)C=C(C)C=C1CC IBABXJRXGSAJLQ-UHFFFAOYSA-N 0.000 description 1
- OLJXWJUQRAOAMD-UHFFFAOYSA-N 1,4-bis(2-methylanilino)anthracene-9,10-dione Chemical compound CC1=CC=CC=C1NC(C=1C(=O)C2=CC=CC=C2C(=O)C=11)=CC=C1NC1=CC=CC=C1C OLJXWJUQRAOAMD-UHFFFAOYSA-N 0.000 description 1
- CNRPDCKHCGUKDK-UHFFFAOYSA-N 1,8-bis(phenylsulfanyl)anthracene-9,10-dione Chemical compound C=12C(=O)C3=C(SC=4C=CC=CC=4)C=CC=C3C(=O)C2=CC=CC=1SC1=CC=CC=C1 CNRPDCKHCGUKDK-UHFFFAOYSA-N 0.000 description 1
- MHXFWEJMQVIWDH-UHFFFAOYSA-N 1-amino-4-hydroxy-2-phenoxyanthracene-9,10-dione Chemical compound C1=C(O)C=2C(=O)C3=CC=CC=C3C(=O)C=2C(N)=C1OC1=CC=CC=C1 MHXFWEJMQVIWDH-UHFFFAOYSA-N 0.000 description 1
- NVZWEEGUWXZOKI-UHFFFAOYSA-N 1-ethenyl-2-methylbenzene Chemical compound CC1=CC=CC=C1C=C NVZWEEGUWXZOKI-UHFFFAOYSA-N 0.000 description 1
- JZHGRUMIRATHIU-UHFFFAOYSA-N 1-ethenyl-3-methylbenzene Chemical compound CC1=CC=CC(C=C)=C1 JZHGRUMIRATHIU-UHFFFAOYSA-N 0.000 description 1
- LUECERFWADIZPD-UHFFFAOYSA-N 1-tert-butyl-2-ethenylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1C=C LUECERFWADIZPD-UHFFFAOYSA-N 0.000 description 1
- SMSKIVCCLIQXFD-UHFFFAOYSA-N 1-tert-butyl-3-ethenylbenzene Chemical compound CC(C)(C)C1=CC=CC(C=C)=C1 SMSKIVCCLIQXFD-UHFFFAOYSA-N 0.000 description 1
- QEDJMOONZLUIMC-UHFFFAOYSA-N 1-tert-butyl-4-ethenylbenzene Chemical compound CC(C)(C)C1=CC=C(C=C)C=C1 QEDJMOONZLUIMC-UHFFFAOYSA-N 0.000 description 1
- NIDFGXDXQKPZMA-UHFFFAOYSA-N 14h-benz[4,5]isoquino[2,1-a]perimidin-14-one Chemical compound C1=CC(N2C(=O)C=3C4=C(C2=N2)C=CC=C4C=CC=3)=C3C2=CC=CC3=C1 NIDFGXDXQKPZMA-UHFFFAOYSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- ZPSZXWVBMOMXED-UHFFFAOYSA-N 2-(2-bromo-5-chlorophenyl)acetic acid Chemical compound OC(=O)CC1=CC(Cl)=CC=C1Br ZPSZXWVBMOMXED-UHFFFAOYSA-N 0.000 description 1
- XKZQKPRCPNGNFR-UHFFFAOYSA-N 2-(3-hydroxyphenyl)phenol Chemical group OC1=CC=CC(C=2C(=CC=CC=2)O)=C1 XKZQKPRCPNGNFR-UHFFFAOYSA-N 0.000 description 1
- NQAJBKZEQYYFGK-UHFFFAOYSA-N 2-[[4-[2-(4-cyclohexylphenoxy)ethyl-ethylamino]-2-methylphenyl]methylidene]propanedinitrile Chemical compound C=1C=C(C=C(C#N)C#N)C(C)=CC=1N(CC)CCOC(C=C1)=CC=C1C1CCCCC1 NQAJBKZEQYYFGK-UHFFFAOYSA-N 0.000 description 1
- XQOAPEATHLRJMI-UHFFFAOYSA-N 2-ethyl-4-[2-(3-ethyl-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C1=C(O)C(CC)=CC(C(C)(C)C=2C=C(CC)C(O)=CC=2)=C1 XQOAPEATHLRJMI-UHFFFAOYSA-N 0.000 description 1
- UBZVRROHBDDCQY-UHFFFAOYSA-N 20749-68-2 Chemical compound C1=CC(N2C(=O)C3=C(C(=C(Cl)C(Cl)=C3C2=N2)Cl)Cl)=C3C2=CC=CC3=C1 UBZVRROHBDDCQY-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- ALCTVJCRSVWGSC-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-4-[1-[2-(3,5-dimethylphenyl)-4-hydroxyphenyl]cyclohexyl]phenol Chemical compound CC1=CC(C)=CC(C=2C(=CC=C(O)C=2)C2(CCCCC2)C=2C(=CC(O)=CC=2)C=2C=C(C)C=C(C)C=2)=C1 ALCTVJCRSVWGSC-UHFFFAOYSA-N 0.000 description 1
- UFTWLTBVFOVONY-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-4-[1-[2-(3,5-dimethylphenyl)-4-hydroxyphenyl]cyclopentyl]phenol Chemical compound CC1=CC(C)=CC(C=2C(=CC=C(O)C=2)C2(CCCC2)C=2C(=CC(O)=CC=2)C=2C=C(C)C=C(C)C=2)=C1 UFTWLTBVFOVONY-UHFFFAOYSA-N 0.000 description 1
- SVQKHBGNKRDACZ-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-4-[2-(3,5-dimethylphenyl)-4-hydroxyphenyl]sulfanylphenol Chemical compound CC1=CC(C)=CC(C=2C(=CC=C(O)C=2)SC=2C(=CC(O)=CC=2)C=2C=C(C)C=C(C)C=2)=C1 SVQKHBGNKRDACZ-UHFFFAOYSA-N 0.000 description 1
- BTOCFCBIDGKQQI-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-4-[2-[2-(3,5-dimethylphenyl)-4-hydroxyphenyl]propan-2-yl]phenol Chemical compound CC1=CC(C)=CC(C=2C(=CC=C(O)C=2)C(C)(C)C=2C(=CC(O)=CC=2)C=2C=C(C)C=C(C)C=2)=C1 BTOCFCBIDGKQQI-UHFFFAOYSA-N 0.000 description 1
- RQPMMUXQMRGDOA-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-4-[3-[2-(3,5-dimethylphenyl)-4-hydroxyphenyl]-3-methylbutyl]phenol Chemical compound CC1=CC(C)=CC(C=2C(=CC=C(O)C=2)CCC(C)(C)C=2C(=CC(O)=CC=2)C=2C=C(C)C=C(C)C=2)=C1 RQPMMUXQMRGDOA-UHFFFAOYSA-N 0.000 description 1
- QDIPKJFQOLUFHZ-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-4-[3-[2-(3,5-dimethylphenyl)-4-hydroxyphenyl]pentan-3-yl]phenol Chemical compound C=1C=C(O)C=C(C=2C=C(C)C=C(C)C=2)C=1C(CC)(CC)C1=CC=C(O)C=C1C1=CC(C)=CC(C)=C1 QDIPKJFQOLUFHZ-UHFFFAOYSA-N 0.000 description 1
- TUJHKTMBIVIOOV-UHFFFAOYSA-N 3-(4-hydroxyphenyl)-1,1,3-trimethyl-2h-inden-5-ol Chemical compound C12=CC(O)=CC=C2C(C)(C)CC1(C)C1=CC=C(O)C=C1 TUJHKTMBIVIOOV-UHFFFAOYSA-N 0.000 description 1
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- CGFCKPWPXHKFPU-UHFFFAOYSA-N 3-chloro-4-[1-(2-chloro-4-hydroxyphenyl)ethyl]phenol Chemical compound C=1C=C(O)C=C(Cl)C=1C(C)C1=CC=C(O)C=C1Cl CGFCKPWPXHKFPU-UHFFFAOYSA-N 0.000 description 1
- HSSYVKMJJLDTKZ-UHFFFAOYSA-N 3-phenylphthalic acid Chemical group OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1C(O)=O HSSYVKMJJLDTKZ-UHFFFAOYSA-N 0.000 description 1
- VWGKEVWFBOUAND-UHFFFAOYSA-N 4,4'-thiodiphenol Chemical class C1=CC(O)=CC=C1SC1=CC=C(O)C=C1 VWGKEVWFBOUAND-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- WNLHHAAYHRAAKQ-UHFFFAOYSA-N 4-(2-methylbutyl)phenol Chemical compound CCC(C)CC1=CC=C(O)C=C1 WNLHHAAYHRAAKQ-UHFFFAOYSA-N 0.000 description 1
- RQCACQIALULDSK-UHFFFAOYSA-N 4-(4-hydroxyphenyl)sulfinylphenol Chemical class C1=CC(O)=CC=C1S(=O)C1=CC=C(O)C=C1 RQCACQIALULDSK-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- ACEMPBSQAVZNEJ-UHFFFAOYSA-N 4-[(4-hydroxy-3-methoxy-2,6-dimethylphenyl)methyl]-2-methoxy-3,5-dimethylphenol Chemical compound C1=C(O)C(OC)=C(C)C(CC=2C(=C(OC)C(O)=CC=2C)C)=C1C ACEMPBSQAVZNEJ-UHFFFAOYSA-N 0.000 description 1
- DTOMAXGIWFLDMR-UHFFFAOYSA-N 4-[(4-hydroxy-3-nitrophenyl)methyl]-2-nitrophenol Chemical compound C1=C([N+]([O-])=O)C(O)=CC=C1CC1=CC=C(O)C([N+]([O-])=O)=C1 DTOMAXGIWFLDMR-UHFFFAOYSA-N 0.000 description 1
- SVOBELCYOCEECO-UHFFFAOYSA-N 4-[1-(4-hydroxy-3-methylphenyl)cyclohexyl]-2-methylphenol Chemical compound C1=C(O)C(C)=CC(C2(CCCCC2)C=2C=C(C)C(O)=CC=2)=C1 SVOBELCYOCEECO-UHFFFAOYSA-N 0.000 description 1
- UMPGNGRIGSEMTC-UHFFFAOYSA-N 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol Chemical compound C1C(C)CC(C)(C)CC1(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 UMPGNGRIGSEMTC-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- DFVAFJJABIQSBK-UHFFFAOYSA-N 4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 DFVAFJJABIQSBK-UHFFFAOYSA-N 0.000 description 1
- BKTRENAPTCBBFA-UHFFFAOYSA-N 4-[2-(4-hydroxy-3-phenylphenyl)propan-2-yl]-2-phenylphenol Chemical compound C=1C=C(O)C(C=2C=CC=CC=2)=CC=1C(C)(C)C(C=1)=CC=C(O)C=1C1=CC=CC=C1 BKTRENAPTCBBFA-UHFFFAOYSA-N 0.000 description 1
- IJWIRZQYWANBMP-UHFFFAOYSA-N 4-[2-(4-hydroxy-3-propan-2-ylphenyl)propan-2-yl]-2-propan-2-ylphenol Chemical compound C1=C(O)C(C(C)C)=CC(C(C)(C)C=2C=C(C(O)=CC=2)C(C)C)=C1 IJWIRZQYWANBMP-UHFFFAOYSA-N 0.000 description 1
- DUKMWXLEZOCRSO-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)-1-phenylpropan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C=1C=CC(O)=CC=1)(C)CC1=CC=CC=C1 DUKMWXLEZOCRSO-UHFFFAOYSA-N 0.000 description 1
- RPJFWRZEEKJTGN-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=CC(O)=CC=2)=C1 RPJFWRZEEKJTGN-UHFFFAOYSA-N 0.000 description 1
- USRCZRQPBBTHCT-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propyl]-2-methylphenol Chemical compound C=1C=C(O)C=CC=1C(C)CC1=CC=C(O)C(C)=C1 USRCZRQPBBTHCT-UHFFFAOYSA-N 0.000 description 1
- YZYGDZRBLOLVDY-UHFFFAOYSA-N 4-[cyclohexyl-(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)C1CCCCC1 YZYGDZRBLOLVDY-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- HTVITOHKHWFJKO-UHFFFAOYSA-N Bisphenol B Chemical class C=1C=C(O)C=CC=1C(C)(CC)C1=CC=C(O)C=C1 HTVITOHKHWFJKO-UHFFFAOYSA-N 0.000 description 1
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UHHHLWYPXKDYTH-UHFFFAOYSA-N CC=1C=C(C=C(C1)C)C1=C(C=CC(=C1)O)C(C)C1=C(C=C(C=C1)O)C1=CC(=CC(=C1)C)C.CC=1C=C(C=C(C1)C)C1=C(C=CC(=C1)O)CC1=C(C=C(C=C1)O)C1=CC(=CC(=C1)C)C Chemical compound CC=1C=C(C=C(C1)C)C1=C(C=CC(=C1)O)C(C)C1=C(C=C(C=C1)O)C1=CC(=CC(=C1)C)C.CC=1C=C(C=C(C1)C)C1=C(C=CC(=C1)O)CC1=C(C=C(C=C1)O)C1=CC(=CC(=C1)C)C UHHHLWYPXKDYTH-UHFFFAOYSA-N 0.000 description 1
- 229920006051 Capron® Polymers 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000004609 Impact Modifier Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002614 Polyether block amide Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- YJVBLROMQZEFPA-UHFFFAOYSA-L acid red 26 Chemical compound [Na+].[Na+].CC1=CC(C)=CC=C1N=NC1=C(O)C(S([O-])(=O)=O)=CC2=CC(S([O-])(=O)=O)=CC=C12 YJVBLROMQZEFPA-UHFFFAOYSA-L 0.000 description 1
- 229920006397 acrylic thermoplastic Polymers 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- DCBMHXCACVDWJZ-UHFFFAOYSA-N adamantylidene Chemical group C1C(C2)CC3[C]C1CC2C3 DCBMHXCACVDWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002313 adhesive film Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- UMIVXZPTRXBADB-UHFFFAOYSA-N benzocyclobutene Chemical compound C1=CC=C2CCC2=C1 UMIVXZPTRXBADB-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 150000001602 bicycloalkyls Chemical group 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- ZFVMWEVVKGLCIJ-UHFFFAOYSA-N bisphenol AF Chemical class C1=CC(O)=CC=C1C(C(F)(F)F)(C(F)(F)F)C1=CC=C(O)C=C1 ZFVMWEVVKGLCIJ-UHFFFAOYSA-N 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- MMXSKTNPRXHINM-UHFFFAOYSA-N cerium(3+);trisulfide Chemical compound [S-2].[S-2].[S-2].[Ce+3].[Ce+3] MMXSKTNPRXHINM-UHFFFAOYSA-N 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- PGWFQHBXMJMAPN-UHFFFAOYSA-N ctk4b5078 Chemical compound [Cd].OS(=O)(=O)[Se]S(O)(=O)=O PGWFQHBXMJMAPN-UHFFFAOYSA-N 0.000 description 1
- 239000004643 cyanate ester Substances 0.000 description 1
- 150000001913 cyanates Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- ARUKYTASOALXFG-UHFFFAOYSA-N cycloheptylcycloheptane Chemical group C1CCCCCC1C1CCCCCC1 ARUKYTASOALXFG-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 229920000359 diblock copolymer Polymers 0.000 description 1
- 125000001142 dicarboxylic acid group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- XJUNRGGMKUAPAP-UHFFFAOYSA-N dioxido(dioxo)molybdenum;lead(2+) Chemical compound [Pb+2].[O-][Mo]([O-])(=O)=O XJUNRGGMKUAPAP-UHFFFAOYSA-N 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- VPWFPZBFBFHIIL-UHFFFAOYSA-L disodium 4-[(4-methyl-2-sulfophenyl)diazenyl]-3-oxidonaphthalene-2-carboxylate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC(C)=CC=C1N=NC1=C(O)C(C([O-])=O)=CC2=CC=CC=C12 VPWFPZBFBFHIIL-UHFFFAOYSA-L 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004070 electrodeposition Methods 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical class O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 239000002655 kraft paper Substances 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- MOUPNEIJQCETIW-UHFFFAOYSA-N lead chromate Chemical compound [Pb+2].[O-][Cr]([O-])(=O)=O MOUPNEIJQCETIW-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- DCUFMVPCXCSVNP-UHFFFAOYSA-N methacrylic anhydride Chemical class CC(=C)C(=O)OC(=O)C(C)=C DCUFMVPCXCSVNP-UHFFFAOYSA-N 0.000 description 1
- SRTQDAZYCNOJON-UHFFFAOYSA-N methyl 4-cyano-5-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methylpyridin-3-yl]diazenyl]-3-methylthiophene-2-carboxylate Chemical compound COCCCNC1=NC(NCCCOC)=C(C#N)C(C)=C1N=NC1=C(C#N)C(C)=C(C(=O)OC)S1 SRTQDAZYCNOJON-UHFFFAOYSA-N 0.000 description 1
- ASHGTJPOSUFTGB-UHFFFAOYSA-N methyl resorcinol Chemical class COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical compound C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-L naphthalene-2,6-dicarboxylate Chemical group C1=C(C([O-])=O)C=CC2=CC(C(=O)[O-])=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-L 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229940067265 pigment yellow 138 Drugs 0.000 description 1
- 239000000088 plastic resin Substances 0.000 description 1
- 229920003192 poly(bis maleimide) Polymers 0.000 description 1
- 229920003055 poly(ester-imide) Polymers 0.000 description 1
- 229920005559 polyacrylic rubber Polymers 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 125000005592 polycycloalkyl group Polymers 0.000 description 1
- 229920013636 polyphenyl ether polymer Polymers 0.000 description 1
- 229920005629 polypropylene homopolymer Polymers 0.000 description 1
- 229920002742 polystyrene-block-poly(ethylene/propylene) -block-polystyrene Polymers 0.000 description 1
- 229920002743 polystyrene-poly(ethylene-ethylene/propylene) block-polystyrene Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- TVRGPOFMYCMNRB-UHFFFAOYSA-N quinizarine green ss Chemical compound C1=CC(C)=CC=C1NC(C=1C(=O)C2=CC=CC=C2C(=O)C=11)=CC=C1NC1=CC=C(C)C=C1 TVRGPOFMYCMNRB-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- LJFWQNJLLOFIJK-UHFFFAOYSA-N solvent violet 13 Chemical compound C1=CC(C)=CC=C1NC1=CC=C(O)C2=C1C(=O)C1=CC=CC=C1C2=O LJFWQNJLLOFIJK-UHFFFAOYSA-N 0.000 description 1
- 238000013112 stability test Methods 0.000 description 1
- 229920006301 statistical copolymer Polymers 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229920001935 styrene-ethylene-butadiene-styrene Polymers 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 238000005987 sulfurization reaction Methods 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 239000004634 thermosetting polymer Substances 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical class CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- 229920006337 unsaturated polyester resin Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B27/00—Layered products comprising a layer of synthetic resin
- B32B27/28—Layered products comprising a layer of synthetic resin comprising synthetic resins not wholly covered by any one of the sub-groups B32B27/30 - B32B27/42
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B27/00—Layered products comprising a layer of synthetic resin
- B32B27/36—Layered products comprising a layer of synthetic resin comprising polyesters
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B27/00—Layered products comprising a layer of synthetic resin
- B32B27/36—Layered products comprising a layer of synthetic resin comprising polyesters
- B32B27/365—Layered products comprising a layer of synthetic resin comprising polyesters comprising polycarbonates
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B7/00—Layered products characterised by the relation between layers; Layered products characterised by the relative orientation of features between layers, or by the relative values of a measurable parameter between layers, i.e. products comprising layers having different physical, chemical or physicochemical properties; Layered products characterised by the interconnection of layers
- B32B7/04—Interconnection of layers
- B32B7/12—Interconnection of layers using interposed adhesives or interposed materials with bonding properties
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B2307/00—Properties of the layers or laminate
- B32B2307/70—Other properties
- B32B2307/712—Weather resistant
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/31504—Composite [nonstructural laminate]
- Y10T428/31507—Of polycarbonate
Landscapes
- Laminated Bodies (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37175503A | 2003-02-21 | 2003-02-21 | |
| US10/371,755 | 2003-02-21 | ||
| US10/737,944 US7270882B2 (en) | 2003-02-21 | 2003-12-16 | Weatherable multilayer articles and method for their preparation |
| US10/737,944 | 2003-12-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20050106447A true KR20050106447A (ko) | 2005-11-09 |
Family
ID=33100922
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020057015514A Ceased KR20050106447A (ko) | 2003-02-21 | 2004-02-12 | 내후성 다층 제품 및 그의 제조 방법 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US20070116959A1 (enExample) |
| EP (1) | EP1597006A2 (enExample) |
| JP (1) | JP2006522696A (enExample) |
| KR (1) | KR20050106447A (enExample) |
| WO (1) | WO2004085102A2 (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2012099358A3 (en) * | 2011-01-18 | 2012-11-22 | Sk Innovation Co., Ltd. | Multilayer film |
| WO2012153973A3 (en) * | 2011-05-09 | 2013-01-24 | Sk Innovation Co., Ltd. | Multilayered film having excellent barrier and thermal adhesion properties |
| US9486950B2 (en) | 2013-06-21 | 2016-11-08 | Samsung Display Co., Ltd. | Method of manufacturing protective window and display device produced by using the same |
| KR101712419B1 (ko) * | 2016-04-22 | 2017-03-06 | 박용필 | 내후성 복합시트 |
| KR101712416B1 (ko) * | 2016-04-22 | 2017-03-06 | 박용필 | 내후성 복합시트 |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7514147B2 (en) | 2003-01-14 | 2009-04-07 | Sabic Innovative Plastics Ip B.V. | Formable thermoplastic multi-layer laminate, a formed multi-layer laminate, an article, and a method of making an article |
| US7270882B2 (en) | 2003-02-21 | 2007-09-18 | General Electric Company | Weatherable multilayer articles and method for their preparation |
| US6844071B1 (en) * | 2003-10-06 | 2005-01-18 | General Electric Company | Multilayer articles comprising polycarbonate and polypropylene and method for their preparation |
| KR100789617B1 (ko) * | 2005-09-13 | 2007-12-27 | 주식회사 엘지화학 | 네가티브 ｃ 타입의 보상 필름 및 이의 제조 방법 |
| WO2008088336A1 (en) * | 2007-01-18 | 2008-07-24 | Sabic Innovative Plastics Ip B.V. | COATED ARTICLES OF MANUFACTURE MADE OF HIGH Tg POLYMER BLENDS |
| US20100009207A1 (en) * | 2008-07-10 | 2010-01-14 | Sabic Innovative Plastics Ip B.V. | Formable thermoplastic multi-layer article, a formed multi-layer article, an article, and a method of making an article |
| RU2011108021A (ru) * | 2008-09-23 | 2012-10-27 | ЮПМ-Кюммене Вуд Ой (FI) | Материал клеевого соединения для древесной плиты и древесная плита |
| WO2010078413A1 (en) | 2008-12-31 | 2010-07-08 | Apinee, Inc. | Preservation of wood, compositions and methods thereof |
| US9878464B1 (en) | 2011-06-30 | 2018-01-30 | Apinee, Inc. | Preservation of cellulosic materials, compositions and methods thereof |
| JP5690759B2 (ja) * | 2012-02-15 | 2015-03-25 | 株式会社日立製作所 | 熱硬化性樹脂組成物、硬化物、導線、電気機器用コイル及び電気機器 |
| RU2726661C2 (ru) * | 2015-12-22 | 2020-07-15 | Нора Системз Гмбх | Самоклеящееся напольное покрытие и способ его изготовления |
| EP3397483A1 (en) * | 2015-12-30 | 2018-11-07 | SABIC Global Technologies B.V. | Thermoformed polycarbonate/glass laminates and applications thereof |
| WO2019067654A1 (en) | 2017-09-27 | 2019-04-04 | Arkema France | MULTILAYER POLYMER STRUCTURES |
Family Cites Families (93)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE532543A (enExample) * | 1953-10-16 | |||
| US3153008A (en) * | 1955-07-05 | 1964-10-13 | Gen Electric | Aromatic carbonate resins and preparation thereof |
| US2991273A (en) * | 1956-07-07 | 1961-07-04 | Bayer Ag | Process for manufacture of vacuum moulded parts of high molecular weight thermoplastic polycarbonates |
| US3148172A (en) * | 1956-07-19 | 1964-09-08 | Gen Electric | Polycarbonates of dihydroxyaryl ethers |
| IT595468A (enExample) * | 1957-08-22 | |||
| US3030331A (en) * | 1957-08-22 | 1962-04-17 | Gen Electric | Process for preparing copolyesters comprising reacting a carbonyl halide with a dicarboxylic acid and a dihydroxy compound in the presence of a tertiary amine |
| US2999835A (en) * | 1959-01-02 | 1961-09-12 | Gen Electric | Resinous mixture comprising organo-polysiloxane and polymer of a carbonate of a dihydric phenol, and products containing same |
| US3207814A (en) * | 1961-01-03 | 1965-09-21 | Gen Electric | Carbonate-polyester copolymer resinous compositions |
| NL290119A (enExample) * | 1963-03-12 | |||
| US3271368A (en) * | 1963-05-02 | 1966-09-06 | Borg Warner | Sulfonate-thiocarbonate copolymers |
| US3391054A (en) * | 1964-07-07 | 1968-07-02 | American Cyanamid Co | Polyurethane based adhesive systems and laminates prepared therewith |
| US3460961A (en) * | 1965-04-21 | 1969-08-12 | Monsanto Co | Process of coating a substrate with a polymeric ultraviolet light barrier coating and the coated substrate |
| US3444129A (en) * | 1965-07-08 | 1969-05-13 | Monsanto Co | Polymeric ultraviolet barrier coatings |
| US3492261A (en) * | 1965-07-08 | 1970-01-27 | Monsanto Co | Solutions of polymeric ultraviolet light barrier coatings |
| US3503779A (en) * | 1965-07-08 | 1970-03-31 | Monsanto Co | Substrates coated with polymeric ultraviolet light barrier coatings |
| US3505160A (en) * | 1965-10-18 | 1970-04-07 | Ppg Industries Inc | Laminated safety glass |
| US3309261A (en) * | 1966-04-21 | 1967-03-14 | American Cyanamid Co | Adhesion of urethane adhesives to metals |
| DE2113631C3 (de) * | 1971-03-20 | 1979-07-26 | Isar-Rakoll Chemie Gmbh, 8000 Muenchen | Klebstoffe auf Basis von Polyesterurethanen für die Verklebung von Kautschuk-Materialien* mit anderen Werkstoffen |
| BE792203A (fr) * | 1971-08-02 | 1973-06-01 | Ppg Industries Inc | Produits feuilletes a bonne resistance au choc |
| US3791914A (en) * | 1972-01-26 | 1974-02-12 | Ppg Industries Inc | Laminated glass articles |
| US3965057A (en) * | 1973-10-03 | 1976-06-22 | Ppg Industries, Inc. | Adhesion control for safety glass laminates via polyurethane composition |
| US4156069A (en) * | 1976-04-02 | 1979-05-22 | Allied Chemical Corporation | Bisphenol-A/terephthalate/carbonate melt processable copolymers |
| US4217438A (en) * | 1978-12-15 | 1980-08-12 | General Electric Company | Polycarbonate transesterification process |
| US4194038A (en) * | 1979-01-25 | 1980-03-18 | Allied Chemical Corporation | Poly(ester-carbonates) from dicarboxylic acid chlorides |
| US4238597A (en) * | 1979-04-26 | 1980-12-09 | General Electric Company | Process for producing copolyester-carbonates |
| US4238596A (en) * | 1979-04-26 | 1980-12-09 | General Electric Company | Process for obtaining copolyester-carbonates |
| DE2929229A1 (de) * | 1979-07-19 | 1981-02-12 | Bayer Ag | Stabilisierte thermoplastische formmassen |
| DE3277772D1 (en) * | 1981-09-09 | 1988-01-14 | Sumitomo Naugatuck | Thermoplastic composition |
| US4503121A (en) * | 1981-12-29 | 1985-03-05 | Union Carbide Corporation | Laminate compositions with polyarylate and poly(aryl ether) |
| US4444950A (en) * | 1982-03-15 | 1984-04-24 | Sumitomo Naugatuck Co., Ltd. | Thermoplastic resin composition |
| JPS5966450A (ja) * | 1982-10-07 | 1984-04-14 | Sumitomo Naugatuck Co Ltd | 熱可塑性樹脂組成物 |
| US4487896A (en) * | 1983-09-02 | 1984-12-11 | General Electric Company | Copolyester-carbonate compositions exhibiting improved processability |
| US4506065A (en) * | 1984-01-03 | 1985-03-19 | General Electric Company | Copolyestercarbonates |
| US4576842A (en) * | 1984-03-19 | 1986-03-18 | Union Carbide Corporation | Cookware formed from a laminate |
| US4608417A (en) * | 1984-07-13 | 1986-08-26 | General Electric Company | Compositions comprising olefin polymer blends |
| US4643937A (en) * | 1985-02-27 | 1987-02-17 | Union Carbide Corporation | Laminate formed from a polyarylate sheet and a polycarbonate and/or polyester sheet |
| EP0203425A1 (en) * | 1985-05-13 | 1986-12-03 | General Electric Company | Composition of a copolymer of an olefin and an acrylate monomer and a block copolymer of vinylaromatic and aliphatic diene |
| AT383991B (de) * | 1985-11-14 | 1987-09-10 | Klepsch Senoplast | Verfahren zur herstellung von verbundplatten |
| AT383309B (de) * | 1985-11-14 | 1987-06-25 | Klepsch Senoplast | Kalander zur verarbeitung von thermoplastischen kunststoffen |
| US4804566A (en) * | 1986-06-25 | 1989-02-14 | General Electric Company | Multilayer polyester structures and containers thereof |
| US5342666A (en) * | 1986-10-28 | 1994-08-30 | Rexham Industries Corp. | Injection molded plastic article with integral weatherable pigmented film surface |
| US4931364A (en) * | 1988-05-05 | 1990-06-05 | Amoco Corporation | Polyarylate-polyethylene composite laminated structures |
| US5030505A (en) * | 1988-05-05 | 1991-07-09 | Amoco Corporation | Polyarylate-polyethylene composite laminated structures |
| US4992322A (en) * | 1988-06-23 | 1991-02-12 | General Electric Company | Coextruded products with improved weatherability |
| US4895897A (en) * | 1988-08-12 | 1990-01-23 | Exxon Chemical Patents Inc. | Aromatic carbonate compositions modified with oxazoline functionalized polystyrene reacted with an ethylene elastomer containing reactive polar groups |
| US5001000A (en) * | 1988-09-26 | 1991-03-19 | E. I. Du Pont De Nemours And Company | Process for forming a composite structure of thermoplastic polymer and sheet molding compound |
| US5001193A (en) * | 1988-12-22 | 1991-03-19 | American Cyanamid | Epoxy adhesive for bonding of automotive parts made from bulk or sheet molding compound containing polymeric toughening agent and Mannich Base |
| US5188875A (en) * | 1989-08-25 | 1993-02-23 | Mitsui Petrochemical Industries, Ltd. | Information recording medium and adhesive composition therefor |
| US5308894A (en) * | 1990-04-12 | 1994-05-03 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends containing an olefinic modifier |
| US5369154A (en) * | 1990-04-12 | 1994-11-29 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends containing an olefinic modifier |
| JP3236697B2 (ja) * | 1993-04-19 | 2001-12-10 | 三井化学株式会社 | プライマー組成物および難接着プラスチック素材の加工方法 |
| US20030008164A1 (en) * | 1994-09-06 | 2003-01-09 | Wilhelm Klepsch | Composite plate |
| JPH09314767A (ja) * | 1996-05-27 | 1997-12-09 | Fukuvi Chem Ind Co Ltd | 耐候性に優れた共押出成形体 |
| CA2221266A1 (en) * | 1996-12-10 | 1998-06-10 | Achim Grefenstein | Laminated sheets or films and moldings thereof |
| JP4034857B2 (ja) * | 1997-02-12 | 2008-01-16 | 三菱化学株式会社 | 積層体の製造方法 |
| AU736947B2 (en) * | 1997-02-10 | 2001-08-09 | Mitsubishi Chemical Corporation | Adhesive resin compositions, laminates, production method thereof and oriented films |
| JP3671625B2 (ja) * | 1997-10-29 | 2005-07-13 | 三菱化学株式会社 | 接着用樹脂組成物、積層体および延伸フィルム |
| JP3671626B2 (ja) * | 1997-02-10 | 2005-07-13 | 三菱化学株式会社 | 接着用樹脂組成物、積層体および延伸フィルム |
| US5821322A (en) * | 1997-05-05 | 1998-10-13 | General Electric Company | Diaminoalkyl quaternary ammonium salts and method for their preparation and use |
| TW467940B (en) * | 1997-10-14 | 2001-12-11 | Toray Industries | Thermosetting resin composition for carbon-fiber reinforced composite material |
| JP3894256B2 (ja) * | 1997-11-14 | 2007-03-14 | 三菱化学株式会社 | 積層体およびその製造方法 |
| US6136441A (en) * | 1998-03-24 | 2000-10-24 | General Electric Company | Multilayer plastic articles |
| US6174959B1 (en) * | 1998-08-11 | 2001-01-16 | Bayer Corporation | Compatible blends of thermoplastic polyurethane with certain polyolefins |
| ATE258199T1 (de) * | 1998-10-29 | 2004-02-15 | Gen Electric | Witterungsbeständige blockcopolyestercarbonate und diese enthaltende polymerlegierungen |
| ES2251233T3 (es) * | 1998-10-29 | 2006-04-16 | General Electric Company | Copoliestercarbonatos de bloque resistentes a la interperie, procedimientos para su preparacion y mezclas que los contienen. |
| US6572956B1 (en) * | 1999-04-08 | 2003-06-03 | General Electric Company | Weatherable multilayer resinous articles and method for their preparation |
| WO2000064973A1 (en) * | 1999-04-28 | 2000-11-02 | General Electric Company | Compositions of styrenic block copolymer resin and polyphenylene ether resin |
| US6306507B1 (en) * | 1999-05-18 | 2001-10-23 | General Electric Company | Thermally stable polymers, method of preparation, and articles made therefrom |
| US6861482B2 (en) * | 1999-05-18 | 2005-03-01 | General Electric Company | Weatherable, thermostable polymers having improved flow composition |
| US6291574B1 (en) * | 1999-08-27 | 2001-09-18 | General Electric Company | Polyester molded articles |
| US20020177551A1 (en) * | 2000-05-31 | 2002-11-28 | Terman David S. | Compositions and methods for treatment of neoplastic disease |
| US6352782B2 (en) * | 1999-12-01 | 2002-03-05 | General Electric Company | Poly(phenylene ether)-polyvinyl thermosetting resin |
| ATE276311T1 (de) * | 2000-01-31 | 2004-10-15 | Advanced Elastomer Systems | Thermoplastische elastomere mit verbesserten klebeeigenschaften |
| US6649681B2 (en) * | 2000-02-03 | 2003-11-18 | Ferro Corporation | Adhesive composition primarily intended for use in medical applications |
| AU2001246480A1 (en) * | 2000-03-09 | 2001-09-17 | Bayer Aktiengesellschaft | Polycarbonate molding materials containing graft rubber |
| US6297300B1 (en) * | 2000-05-19 | 2001-10-02 | The Dow Chemical Company | Carbonate polymer compositions comprising low volatile UV absorbers |
| DE10060603A1 (de) * | 2000-12-05 | 2002-06-13 | Daimler Chrysler Ag | Karosserieteil mit integrierter Antenne |
| US6549745B2 (en) * | 2001-02-16 | 2003-04-15 | Nexpress Solutions Llc | Method and apparatus for controlling overdrive in a frictionally driven system including a conformable member |
| US6556798B2 (en) * | 2001-02-16 | 2003-04-29 | Donald S. Rimai | Method and apparatus for using a conformable member in a frictional drive |
| US7300690B2 (en) * | 2001-03-29 | 2007-11-27 | General Electric Company | Radial tilt reduced media |
| EP1390197A2 (en) * | 2001-05-23 | 2004-02-25 | Rubbermaid Incorporated | Multi-layer stain and heat resistant plastic container for storing and heating food; methods of making the same |
| US6538065B1 (en) * | 2001-07-26 | 2003-03-25 | General Electric Company | Method for preparing copolyestercarbonates and articles therefrom |
| US7318958B2 (en) * | 2001-11-30 | 2008-01-15 | General Electric Company | Weatherable multilayer articles and method for their preparation |
| EP1316419A3 (en) * | 2001-11-30 | 2004-01-28 | General Electric Company | Weatherable multilayer articles and method for their preparation |
| US8057903B2 (en) * | 2001-11-30 | 2011-11-15 | Sabic Innovative Plastics Ip B.V. | Multilayer articles comprising resorcinol arylate polyester and method for making thereof |
| US6720386B2 (en) * | 2002-02-28 | 2004-04-13 | General Electric Company | Weatherable styrenic blends with improved translucency |
| US7270882B2 (en) * | 2003-02-21 | 2007-09-18 | General Electric Company | Weatherable multilayer articles and method for their preparation |
| US20040177593A1 (en) * | 2003-03-14 | 2004-09-16 | Reilly Michael D. | Consumer product carton having MICR encoded incentive |
| US20040253428A1 (en) * | 2003-06-12 | 2004-12-16 | General Electric Company | Weatherable multilayer articles and method for their preparation |
| US20050158561A1 (en) * | 2004-01-16 | 2005-07-21 | General Electric Company | Weatherable multilayer articles and method for their preparation |
| US7153576B2 (en) * | 2004-01-20 | 2006-12-26 | General Electric Company | Weatherable multilayer article assemblies and method for their preparation |
| US20060019099A1 (en) * | 2004-07-20 | 2006-01-26 | General Electric Company | Method for making multilayer film, sheet and articles therefrom |
| US7524447B2 (en) * | 2004-07-20 | 2009-04-28 | Sabic Innovative Plastics Ip B.V. | Method for manufacturing formable thermoplastic laminates |
-
2004
- 2004-02-12 KR KR1020057015514A patent/KR20050106447A/ko not_active Ceased
- 2004-02-12 EP EP20040749325 patent/EP1597006A2/en not_active Withdrawn
- 2004-02-12 JP JP2006508723A patent/JP2006522696A/ja active Pending
- 2004-02-12 WO PCT/US2004/004178 patent/WO2004085102A2/en not_active Ceased
-
2007
- 2007-01-24 US US11/626,396 patent/US20070116959A1/en not_active Abandoned
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2012099358A3 (en) * | 2011-01-18 | 2012-11-22 | Sk Innovation Co., Ltd. | Multilayer film |
| CN103328208A (zh) * | 2011-01-18 | 2013-09-25 | Sk新技术株式会社 | 多层膜 |
| WO2012153973A3 (en) * | 2011-05-09 | 2013-01-24 | Sk Innovation Co., Ltd. | Multilayered film having excellent barrier and thermal adhesion properties |
| US9486950B2 (en) | 2013-06-21 | 2016-11-08 | Samsung Display Co., Ltd. | Method of manufacturing protective window and display device produced by using the same |
| KR101712419B1 (ko) * | 2016-04-22 | 2017-03-06 | 박용필 | 내후성 복합시트 |
| KR101712416B1 (ko) * | 2016-04-22 | 2017-03-06 | 박용필 | 내후성 복합시트 |
Also Published As
| Publication number | Publication date |
|---|---|
| JP2006522696A (ja) | 2006-10-05 |
| EP1597006A2 (en) | 2005-11-23 |
| US20070116959A1 (en) | 2007-05-24 |
| WO2004085102A3 (en) | 2005-04-07 |
| WO2004085102A2 (en) | 2004-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US7270882B2 (en) | Weatherable multilayer articles and method for their preparation | |
| US20070116959A1 (en) | Weatherable Multilayer Articles | |
| US7410700B2 (en) | Weatherable multilayer articles and method for their preparation | |
| US7318958B2 (en) | Weatherable multilayer articles and method for their preparation | |
| KR20060022688A (ko) | 내후성 다층 제품 및 그의 제조 방법 | |
| US7153576B2 (en) | Weatherable multilayer article assemblies and method for their preparation | |
| US6844071B1 (en) | Multilayer articles comprising polycarbonate and polypropylene and method for their preparation | |
| US6607814B2 (en) | Weatherable multilayer articles and method for their preparation | |
| KR20060114000A (ko) | 내후성 다층 제품 및 그의 제조 방법 | |
| US20050266232A1 (en) | Weatherable multilayer articles and process for making | |
| EP1910464B1 (en) | Multi-layer composition |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PA0105 | International application |
Patent event date: 20050822 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PG1501 | Laying open of application | ||
| N231 | Notification of change of applicant | ||
| PN2301 | Change of applicant |
Patent event date: 20080808 Comment text: Notification of Change of Applicant Patent event code: PN23011R01D |
|
| A201 | Request for examination | ||
| PA0201 | Request for examination |
Patent event code: PA02012R01D Patent event date: 20090114 Comment text: Request for Examination of Application |
|
| E902 | Notification of reason for refusal | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20110216 Patent event code: PE09021S01D |
|
| E601 | Decision to refuse application | ||
| PE0601 | Decision on rejection of patent |
Patent event date: 20110608 Comment text: Decision to Refuse Application Patent event code: PE06012S01D Patent event date: 20110216 Comment text: Notification of reason for refusal Patent event code: PE06011S01I |