JPS6365660B2 - - Google Patents
Info
- Publication number
- JPS6365660B2 JPS6365660B2 JP55008403A JP840380A JPS6365660B2 JP S6365660 B2 JPS6365660 B2 JP S6365660B2 JP 55008403 A JP55008403 A JP 55008403A JP 840380 A JP840380 A JP 840380A JP S6365660 B2 JPS6365660 B2 JP S6365660B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- substituted
- diazo
- carbon atoms
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical class C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 claims abstract description 15
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 15
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 12
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 12
- 150000002367 halogens Chemical class 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 6
- 125000003118 aryl group Chemical group 0.000 claims abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 6
- 125000003277 amino group Chemical class 0.000 claims abstract description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 239000000463 material Substances 0.000 claims description 32
- 230000008878 coupling Effects 0.000 claims description 24
- 238000010168 coupling process Methods 0.000 claims description 24
- 238000005859 coupling reaction Methods 0.000 claims description 24
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 23
- 150000008049 diazo compounds Chemical group 0.000 claims description 14
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000565 sulfonamide group Chemical group 0.000 claims description 5
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- -1 cycloalkyl radicals Chemical class 0.000 description 27
- 230000003287 optical effect Effects 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 19
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- 239000010410 layer Substances 0.000 description 11
- 239000000987 azo dye Substances 0.000 description 10
- 239000004922 lacquer Substances 0.000 description 10
- 238000000034 method Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 235000005074 zinc chloride Nutrition 0.000 description 9
- 239000011592 zinc chloride Substances 0.000 description 9
- YCPXWRQRBFJBPZ-UHFFFAOYSA-N 5-sulfosalicylic acid Chemical compound OC(=O)C1=CC(S(O)(=O)=O)=CC=C1O YCPXWRQRBFJBPZ-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 229920002678 cellulose Polymers 0.000 description 8
- 230000005855 radiation Effects 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 239000001913 cellulose Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 239000000975 dye Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 229920000139 polyethylene terephthalate Polymers 0.000 description 5
- 239000005020 polyethylene terephthalate Substances 0.000 description 5
- 230000003595 spectral effect Effects 0.000 description 5
- DKJVSIITPZVTRO-UHFFFAOYSA-N 6,7-dihydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(O)C(O)=CC2=C1 DKJVSIITPZVTRO-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 239000012790 adhesive layer Substances 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 4
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 3
- HBEICTUAWWEORS-UHFFFAOYSA-N 6,7-dihydroxynaphthalene-2-sulfonamide Chemical compound C1=C(O)C(O)=CC2=CC(S(=O)(=O)N)=CC=C21 HBEICTUAWWEORS-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000007605 air drying Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 3
- 239000002985 plastic film Substances 0.000 description 3
- 229920006255 plastic film Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 229910052709 silver Inorganic materials 0.000 description 3
- 239000004332 silver Substances 0.000 description 3
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- YBBLOADPFWKNGS-UHFFFAOYSA-N 1,1-dimethylurea Chemical compound CN(C)C(N)=O YBBLOADPFWKNGS-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 2
- FBLAHUMENIHUGG-UHFFFAOYSA-N 3-hydroxy-n-(2-methylphenyl)naphthalene-2-carboxamide Chemical compound CC1=CC=CC=C1NC(=O)C1=CC2=CC=CC=C2C=C1O FBLAHUMENIHUGG-UHFFFAOYSA-N 0.000 description 2
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 2
- NFTNTGFZYSCPSK-UHFFFAOYSA-N 3-hydroxynaphthalene-2-carboxamide Chemical class C1=CC=C2C=C(O)C(C(=O)N)=CC2=C1 NFTNTGFZYSCPSK-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- HJKSDIAPDXBYPL-UHFFFAOYSA-N 6,7-dihydroxy-n-[3-(trifluoromethyl)phenyl]naphthalene-2-sulfonamide Chemical compound C1=C2C=C(O)C(O)=CC2=CC=C1S(=O)(=O)NC1=CC=CC(C(F)(F)F)=C1 HJKSDIAPDXBYPL-UHFFFAOYSA-N 0.000 description 2
- OCXPPRYZRHBSGZ-UHFFFAOYSA-N 6-hydroxy-7-[(2-methylphenyl)sulfamoyl]naphthalene-2-sulfonic acid Chemical compound CC1=CC=CC=C1NS(=O)(=O)C1=CC2=CC(S(O)(=O)=O)=CC=C2C=C1O OCXPPRYZRHBSGZ-UHFFFAOYSA-N 0.000 description 2
- 241000974482 Aricia saepiolus Species 0.000 description 2
- 229920002284 Cellulose triacetate Polymers 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 2
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229950011260 betanaphthol Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000004327 boric acid Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- 235000013773 glyceryl triacetate Nutrition 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- BDZFZYIJGYTQJF-UHFFFAOYSA-N n-(4-chlorophenyl)-6,7-dihydroxynaphthalene-2-sulfonamide Chemical compound C1=C2C=C(O)C(O)=CC2=CC=C1S(=O)(=O)NC1=CC=C(Cl)C=C1 BDZFZYIJGYTQJF-UHFFFAOYSA-N 0.000 description 2
- 239000000123 paper Substances 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 229960002622 triacetin Drugs 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical group NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- MSJPBYNDRJGIGX-UHFFFAOYSA-M 2,5-diethoxy-4-morpholin-4-ylbenzenediazonium;chloride Chemical compound [Cl-].C1=C([N+]#N)C(OCC)=CC(N2CCOCC2)=C1OCC MSJPBYNDRJGIGX-UHFFFAOYSA-M 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- ZTMADXFOCUXMJE-UHFFFAOYSA-N 2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=CC=C1O ZTMADXFOCUXMJE-UHFFFAOYSA-N 0.000 description 1
- OTEFEXJNJQIESQ-UHFFFAOYSA-N 3-hydroxy-n-(3-morpholin-4-ylpropyl)naphthalene-2-carboxamide Chemical compound OC1=CC2=CC=CC=C2C=C1C(=O)NCCCN1CCOCC1 OTEFEXJNJQIESQ-UHFFFAOYSA-N 0.000 description 1
- IJMIXVXSQKGSPW-UHFFFAOYSA-N 3-hydroxynaphthalene-2,6-disulfonic acid Chemical class OS(=O)(=O)C1=CC=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 IJMIXVXSQKGSPW-UHFFFAOYSA-N 0.000 description 1
- UIKUBYKUYUSRSM-UHFFFAOYSA-N 3-morpholinopropylamine Chemical compound NCCCN1CCOCC1 UIKUBYKUYUSRSM-UHFFFAOYSA-N 0.000 description 1
- WEMYXYMZQRSPIA-UHFFFAOYSA-N 4-(2,4-dihydroxyphenyl)sulfanylbenzene-1,3-diol Chemical compound OC1=CC(O)=CC=C1SC1=CC=C(O)C=C1O WEMYXYMZQRSPIA-UHFFFAOYSA-N 0.000 description 1
- JCYPECIVGRXBMO-UHFFFAOYSA-N 4-(dimethylamino)azobenzene Chemical compound C1=CC(N(C)C)=CC=C1N=NC1=CC=CC=C1 JCYPECIVGRXBMO-UHFFFAOYSA-N 0.000 description 1
- GGEFIQORZZDEJZ-UHFFFAOYSA-N 6,7-bis(benzenesulfonyloxy)naphthalene-2-sulfonic acid Chemical compound C=1C=CC=CC=1S(=O)(=O)OC1=CC2=CC(S(=O)(=O)O)=CC=C2C=C1OS(=O)(=O)C1=CC=CC=C1 GGEFIQORZZDEJZ-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical class C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- VBRXFPVMZWSFML-UHFFFAOYSA-N 7-hydroxy-6-[(2-methylphenyl)sulfamoyl]naphthalene-2-sulfonic acid Chemical compound CC1=CC=CC=C1NS(=O)(=O)C1=CC2=CC=C(S(O)(=O)=O)C=C2C=C1O VBRXFPVMZWSFML-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- UXDDRFCJKNROTO-UHFFFAOYSA-N Glycerol 1,2-diacetate Chemical compound CC(=O)OCC(CO)OC(C)=O UXDDRFCJKNROTO-UHFFFAOYSA-N 0.000 description 1
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- KVZQMLGVEQKEHF-UHFFFAOYSA-N [3-(benzenesulfonyloxy)-6-sulfamoylnaphthalen-2-yl] benzenesulfonate Chemical compound C=1C=CC=CC=1S(=O)(=O)OC1=CC2=CC(S(=O)(=O)N)=CC=C2C=C1OS(=O)(=O)C1=CC=CC=C1 KVZQMLGVEQKEHF-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 150000005840 aryl radicals Chemical group 0.000 description 1
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 235000010338 boric acid Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000001808 coupling effect Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000001739 density measurement Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- VHKFOVJCOUMBFJ-UHFFFAOYSA-N n-(2-methylphenyl)naphthalene-1-carboxamide Chemical compound CC1=CC=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 VHKFOVJCOUMBFJ-UHFFFAOYSA-N 0.000 description 1
- KPLDSULKMGIJOF-UHFFFAOYSA-N n-[4-(diethylamino)phenyl]-6,7-dihydroxynaphthalene-2-sulfonamide Chemical compound C1=CC(N(CC)CC)=CC=C1NS(=O)(=O)C1=CC=C(C=C(O)C(O)=C2)C2=C1 KPLDSULKMGIJOF-UHFFFAOYSA-N 0.000 description 1
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical class C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical class C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/26—Sulfur atoms
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/58—Coupling substances therefor
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Noodles (AREA)
- Cereal-Derived Products (AREA)
- Detergent Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792903342 DE2903342A1 (de) | 1979-01-29 | 1979-01-29 | Derivate des 2-hydroxy-naphthalins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS55102556A JPS55102556A (en) | 1980-08-05 |
| JPS6365660B2 true JPS6365660B2 (OSRAM) | 1988-12-16 |
Family
ID=6061649
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP840380A Granted JPS55102556A (en) | 1979-01-29 | 1980-01-29 | 22hydroxyynaphthalene derivative and diazo type material containing it |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4492749A (OSRAM) |
| EP (1) | EP0017699B1 (OSRAM) |
| JP (1) | JPS55102556A (OSRAM) |
| AT (1) | ATE1191T1 (OSRAM) |
| BR (1) | BR8000511A (OSRAM) |
| CA (1) | CA1146172A (OSRAM) |
| DE (2) | DE2903342A1 (OSRAM) |
| DK (1) | DK33680A (OSRAM) |
| ES (1) | ES488370A0 (OSRAM) |
| FI (1) | FI75151C (OSRAM) |
| PT (1) | PT70740B (OSRAM) |
| ZA (1) | ZA80446B (OSRAM) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2815228A (en) * | 1952-02-01 | 1957-12-03 | Press Seal Gasket Corp | Gasket and pipe end construction for bell and spigot pipe |
| US3352341A (en) * | 1965-10-20 | 1967-11-14 | Eva N Schertz | Fast-action nut assembly |
| DE3633906A1 (de) * | 1986-10-04 | 1988-04-07 | Bayer Ag | Verfahren zur herstellung von hydroxynaphthalin-sulfonsaeureamiden |
| US7179261B2 (en) | 2003-12-16 | 2007-02-20 | Depuy Spine, Inc. | Percutaneous access devices and bone anchor assemblies |
| US11419642B2 (en) | 2003-12-16 | 2022-08-23 | Medos International Sarl | Percutaneous access devices and bone anchor assemblies |
| US20050228380A1 (en) * | 2004-04-09 | 2005-10-13 | Depuy Spine Inc. | Instruments and methods for minimally invasive spine surgery |
| US7918857B2 (en) | 2006-09-26 | 2011-04-05 | Depuy Spine, Inc. | Minimally invasive bone anchor extensions |
| US8414588B2 (en) | 2007-10-04 | 2013-04-09 | Depuy Spine, Inc. | Methods and devices for minimally invasive spinal connection element delivery |
| US20100198271A1 (en) * | 2009-02-02 | 2010-08-05 | Vincent Leone | Screw Sheath for Minimally Invasive Spinal Surgery and Method Relating Thereto |
| US9486422B2 (en) | 2011-10-06 | 2016-11-08 | The Regents Of The University Of Michigan | Small molecule inhibitors of Mcl-1 and the uses of thereof |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2298444A (en) * | 1940-10-15 | 1942-10-13 | Eastman Kodak Co | Light sensitive diazotype material |
| CH223303A (de) * | 1940-12-13 | 1942-09-15 | Geigy Ag J R | Verfahren zur Darstellung einer Sulfonsäure mit höhermolekularen Gruppen. |
| DE859027C (de) * | 1942-07-23 | 1952-12-11 | Basf Ag | Verfahren zur Herstellung von Oxyarylsulfonamiden |
| US2537098A (en) * | 1946-04-12 | 1951-01-09 | Gen Aniline & Film Corp | Sulfonamide azo coupling components used in diazo types |
| US2551570A (en) * | 1946-10-24 | 1951-05-01 | Gen Aniline & Film Corp | Azo dye components of the amino naphthol series for diazotypes |
| DE1068555B (OSRAM) * | 1957-02-04 | 1959-11-05 | ||
| DE1077670B (de) * | 1958-09-18 | 1960-03-17 | Bayer Ag | Verfahren zur Herstellung von 2-Oxynaphthalin-3-sulfonsaeure bzw. deren Alkalisalzenund Amiden |
| NL277400A (OSRAM) * | 1961-05-05 | |||
| NL136527C (OSRAM) * | 1966-11-07 | |||
| GB1217294A (en) * | 1968-04-17 | 1970-12-31 | Ricoh Kk | Improvements in and relating to photosensitised materials |
| GB1278640A (en) * | 1969-01-09 | 1972-06-21 | Ricoh Kk | Improvements in and relating to photosensitive materials |
| US3875216A (en) * | 1972-10-06 | 1975-04-01 | American Cyanamid Co | Process for isolating R-salt and intermediate product |
| US4055425A (en) * | 1975-03-10 | 1977-10-25 | Gaf Corporation | Diazotype material and graphic reproduction processes employing the same |
| DE2811981A1 (de) * | 1978-03-18 | 1979-09-27 | Hoechst Ag | 2-hydroxy-3-naphthoesaeureamide |
| DE2907446A1 (de) * | 1979-02-26 | 1980-09-04 | Hoechst Ag | Zweikomponenten-diazotypiematerial |
-
1979
- 1979-01-29 DE DE19792903342 patent/DE2903342A1/de not_active Withdrawn
- 1979-12-28 CA CA000342764A patent/CA1146172A/en not_active Expired
-
1980
- 1980-01-21 AT AT80100287T patent/ATE1191T1/de active
- 1980-01-21 DE DE8080100287T patent/DE3060530D1/de not_active Expired
- 1980-01-21 EP EP80100287A patent/EP0017699B1/de not_active Expired
- 1980-01-25 FI FI800224A patent/FI75151C/fi not_active IP Right Cessation
- 1980-01-25 ZA ZA00800446A patent/ZA80446B/xx unknown
- 1980-01-28 BR BR8000511A patent/BR8000511A/pt unknown
- 1980-01-28 PT PT70740A patent/PT70740B/pt not_active IP Right Cessation
- 1980-01-28 DK DK33680A patent/DK33680A/da not_active Application Discontinuation
- 1980-01-29 JP JP840380A patent/JPS55102556A/ja active Granted
- 1980-01-29 ES ES488370A patent/ES488370A0/es active Granted
-
1983
- 1983-09-15 US US06/532,302 patent/US4492749A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES8103007A1 (es) | 1981-02-16 |
| FI75151B (fi) | 1988-01-29 |
| FI800224A7 (fi) | 1980-07-30 |
| US4492749A (en) | 1985-01-08 |
| PT70740B (pt) | 1982-06-08 |
| PT70740A (de) | 1980-02-01 |
| DK33680A (da) | 1980-07-30 |
| ATE1191T1 (de) | 1982-07-15 |
| JPS55102556A (en) | 1980-08-05 |
| DE2903342A1 (de) | 1980-07-31 |
| ZA80446B (en) | 1981-01-28 |
| EP0017699B1 (de) | 1982-06-16 |
| DE3060530D1 (en) | 1982-08-05 |
| ES488370A0 (es) | 1981-02-16 |
| CA1146172A (en) | 1983-05-10 |
| BR8000511A (pt) | 1980-10-14 |
| EP0017699A1 (de) | 1980-10-29 |
| FI75151C (fi) | 1988-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3282693A (en) | Photographic printout methods and materials utilizing organic azide compounds and coupler compounds therefor | |
| FI74825B (fi) | Tvaokomponent-diazo-ljuskopiematerial. | |
| JPS6365660B2 (OSRAM) | ||
| JPS5857733B2 (ja) | シヤシンザイリヨウノタメノ ハレ−シヨンボウシ オヨビ フイルタ−センリヨウ | |
| US3028240A (en) | Light sensitive diazotype materials | |
| US4334004A (en) | Light-sensitive diazotype material with 2-hydroxy-3-naphthoic acid amides having 6-sulfonic acid amide substitution | |
| US3615575A (en) | Two-component black-line diazo-type material | |
| US2551570A (en) | Azo dye components of the amino naphthol series for diazotypes | |
| US3462271A (en) | Diazotype material | |
| US3615578A (en) | Light-sensitive diazo compounds and light-sensitive material containing them | |
| US2672418A (en) | Light-sensitive diazotype material | |
| US2946684A (en) | Diazotype copying processes | |
| US3910794A (en) | Imidazole couplers for two component diazotype systems | |
| US4321373A (en) | 2-Hydroxy-3-naphthoic acid amides | |
| US3281246A (en) | Diazotype reproduction material | |
| US3615570A (en) | Diazo-3-trifluoromethyl-4-tertiaryaminobenzene compounds | |
| CA1066104A (en) | Diazotype material containing a diazoimino compound | |
| US4207110A (en) | Diazotype material | |
| US3343960A (en) | Coupling components for lightsensitive diazo coatings | |
| US3473928A (en) | Diazotype process and material employing an oxazoline substituted aromatic hydroxyl compound as coupler | |
| US3493378A (en) | Two-component diazotype material | |
| US4267249A (en) | Benzene diazonium salts and diazotype material utilizing same | |
| US2362519A (en) | Process of color photography utilizing immobile 2-substituted-1-naphthylamines | |
| US2523889A (en) | Diazotypes containing dialkoxy phenols | |
| US3183095A (en) | Color couplers containing a tertiary amino group |