JPS6314014B2 - - Google Patents
Info
- Publication number
- JPS6314014B2 JPS6314014B2 JP61216091A JP21609186A JPS6314014B2 JP S6314014 B2 JPS6314014 B2 JP S6314014B2 JP 61216091 A JP61216091 A JP 61216091A JP 21609186 A JP21609186 A JP 21609186A JP S6314014 B2 JPS6314014 B2 JP S6314014B2
- Authority
- JP
- Japan
- Prior art keywords
- phosphorus
- nitride chloride
- equilibration
- organopolysiloxane
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 33
- 229920001296 polysiloxane Polymers 0.000 claims description 33
- 239000011574 phosphorus Substances 0.000 claims description 27
- 229910052698 phosphorus Inorganic materials 0.000 claims description 27
- AOPJVJYWEDDOBI-UHFFFAOYSA-N azanylidynephosphane Chemical compound P#N AOPJVJYWEDDOBI-UHFFFAOYSA-N 0.000 claims description 22
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 19
- 238000011067 equilibration Methods 0.000 claims description 17
- -1 phosphorus compound Chemical class 0.000 claims description 17
- 238000009833 condensation Methods 0.000 claims description 16
- 230000005494 condensation Effects 0.000 claims description 16
- 239000007795 chemical reaction product Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 11
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 10
- 150000004679 hydroxides Chemical class 0.000 claims description 10
- 229910052751 metal Inorganic materials 0.000 claims description 9
- 239000002184 metal Substances 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 4
- 229910052749 magnesium Inorganic materials 0.000 claims description 4
- 239000011777 magnesium Substances 0.000 claims description 4
- 230000006641 stabilisation Effects 0.000 claims description 4
- 238000011105 stabilization Methods 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 3
- 229910000000 metal hydroxide Inorganic materials 0.000 claims description 3
- 229910044991 metal oxide Inorganic materials 0.000 claims description 3
- 150000004706 metal oxides Chemical class 0.000 claims description 3
- 229910052712 strontium Inorganic materials 0.000 claims description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- 150000004692 metal hydroxides Chemical class 0.000 claims description 2
- 150000003018 phosphorus compounds Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 230000000087 stabilizing effect Effects 0.000 claims description 2
- 150000004767 nitrides Chemical class 0.000 description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 7
- 125000001183 hydrocarbyl group Chemical group 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 150000003961 organosilicon compounds Chemical class 0.000 description 7
- 239000001301 oxygen Substances 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000004205 dimethyl polysiloxane Substances 0.000 description 3
- 239000000395 magnesium oxide Substances 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 3
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 125000005375 organosiloxane group Chemical group 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229910004283 SiO 4 Inorganic materials 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YGLJGOMFUHQSBN-UHFFFAOYSA-N 7-methyl-n,n-bis(7-methyloctyl)octan-1-amine Chemical compound CC(C)CCCCCCN(CCCCCCC(C)C)CCCCCCC(C)C YGLJGOMFUHQSBN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FDTZNKNDXMRDQS-UHFFFAOYSA-N PNPCl Chemical compound PNPCl FDTZNKNDXMRDQS-UHFFFAOYSA-N 0.000 description 1
- FMRLDPWIRHBCCC-UHFFFAOYSA-L Zinc carbonate Chemical compound [Zn+2].[O-]C([O-])=O FMRLDPWIRHBCCC-UHFFFAOYSA-L 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 239000010431 corundum Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- BDAGIHXWWSANSR-NJFSPNSNSA-N hydroxyformaldehyde Chemical compound O[14CH]=O BDAGIHXWWSANSR-NJFSPNSNSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- XTAZYLNFDRKIHJ-UHFFFAOYSA-N n,n-dioctyloctan-1-amine Chemical compound CCCCCCCCN(CCCCCCCC)CCCCCCCC XTAZYLNFDRKIHJ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229910000018 strontium carbonate Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000004876 x-ray fluorescence Methods 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 239000011667 zinc carbonate Substances 0.000 description 1
- 229910000010 zinc carbonate Inorganic materials 0.000 description 1
- 235000004416 zinc carbonate Nutrition 0.000 description 1
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/32—Post-polymerisation treatment
- C08G77/34—Purification
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/32—Post-polymerisation treatment
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853533028 DE3533028A1 (de) | 1985-09-16 | 1985-09-16 | Verfahren zum stabilisieren von organopolysiloxanen |
| DE3533028.7 | 1985-09-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6268819A JPS6268819A (ja) | 1987-03-28 |
| JPS6314014B2 true JPS6314014B2 (ref) | 1988-03-29 |
Family
ID=6281102
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP61216091A Granted JPS6268819A (ja) | 1985-09-16 | 1986-09-16 | オルガノポリシロキサンの安定化方法 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4701490A (ref) |
| EP (1) | EP0215470B1 (ref) |
| JP (1) | JPS6268819A (ref) |
| CA (1) | CA1271486A (ref) |
| DE (2) | DE3533028A1 (ref) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH025608U (ref) * | 1988-06-23 | 1990-01-16 |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3903137A1 (de) * | 1989-02-02 | 1990-08-16 | Wacker Chemie Gmbh | Phosphornitridchloride enthaltende zusammensetzungen |
| GB8902936D0 (en) * | 1989-02-09 | 1989-03-30 | Dow Corning | Process for the production of organosilicon compounds |
| US4962221A (en) * | 1990-03-12 | 1990-10-09 | Dow Corning Corporation | Chloride reduction in polysiloxanes |
| GB9115170D0 (en) * | 1991-07-12 | 1991-08-28 | Dow Corning Sa | Process and apparatus for the production of organosilicon compounds |
| DE4216271A1 (de) * | 1992-05-16 | 1993-11-18 | Siegel Rolf | Verfahren zur naßchemischen Oberflächenmodifizierung von Formkörpern aus Organopolysiloxanen sowie Verwendung der Verfahrenserzeugnisse |
| US5420221A (en) * | 1993-07-15 | 1995-05-30 | General Electric Company | Process for the production of linear organosiloxane polymers by disproportionation |
| DE4422813A1 (de) | 1994-06-29 | 1996-01-04 | Wacker Chemie Gmbh | Verfahren zum Stabilisieren von Organpolysiloxanen |
| DE4444173A1 (de) * | 1994-12-12 | 1996-06-13 | Huels Silicone Gmbh | Verfahren zur Herstellung von im wesentlichen cyclenfreien Polyorganosiloxanen |
| US5919883A (en) * | 1994-12-12 | 1999-07-06 | Huels Silicone Gmbh | Process for preparing polyorganosiloxanes which comprise substantially no cyclic components and use of the process to prepare organofunctionally modified polysiloxanes |
| US5504150A (en) * | 1995-04-05 | 1996-04-02 | Dow Corning Corporation | Method of making polysiloxane emulsions |
| US5659056A (en) * | 1996-04-10 | 1997-08-19 | Bridgestone Corporation | Stabilization of siloxane terminated polymers |
| GB0018162D0 (en) * | 2000-07-26 | 2000-09-13 | Dow Corning Sa | Polymerisation reactor and process |
| US8153724B2 (en) * | 2005-04-06 | 2012-04-10 | Dow Corning Corporation | Organosiloxane compositions |
| GB0604583D0 (en) * | 2006-03-08 | 2006-04-19 | Dow Corning | Impregnated flexible sheet material |
| CN101522758B (zh) | 2006-10-10 | 2012-07-04 | 陶氏康宁公司 | 聚硅氧烷聚合物乳液 |
| WO2009128883A1 (en) * | 2008-04-16 | 2009-10-22 | Dow Corning Corporation | Preparation of silicone microemulsions |
| KR101664816B1 (ko) | 2009-03-10 | 2016-10-11 | 다우 코닝 도레이 캄파니 리미티드 | 수중유 실리콘 에멀젼 조성물 |
| GB0905204D0 (en) | 2009-03-26 | 2009-05-13 | Dow Corning | Preparation of organosiloxane polymers |
| GB0905205D0 (en) | 2009-03-26 | 2009-05-13 | Dow Corning | Preparation of organosiloxane polymer |
| GB0905502D0 (en) | 2009-03-31 | 2009-05-13 | Dow Corning | Organopolysiloxane emulsions and their production |
| GB0905507D0 (en) | 2009-03-31 | 2009-05-13 | Dow Corning | Organopol Ysiloxane Compositions Containing An Active Material |
| EP2493984A2 (en) | 2009-10-26 | 2012-09-05 | Dow Corning Corporation | Paintable elastomer |
| CN102596970B (zh) | 2009-11-03 | 2016-02-10 | 道康宁公司 | 用于聚硅亚烷基硅氧烷的生产的方法 |
| EP2589627B1 (en) | 2010-07-02 | 2016-10-12 | Dow Corning Toray Co., Ltd. | Oil-in-water silicone emulsion composition |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2990419A (en) * | 1961-06-27 | Certificate of correction | ||
| CA809229A (en) * | 1969-03-25 | Wacker-Chemie Gmbh | Method of preparing organohalogenosilicon compounds | |
| US2830967A (en) * | 1953-01-13 | 1958-04-15 | Wacker Chemie Gmbh | Process for polymerizing polyorganosiloxanes with phosphorus-nitrogen compounds |
| US3186967A (en) * | 1961-04-12 | 1965-06-01 | Wacker Chemie Gmbh | Method of preparing high molecular weight organosiloxane polymers |
| DE1221020B (de) * | 1962-11-26 | 1966-07-14 | Wacker Chemie Ges Mit Beschrae | Verfahren zur Herstellung von Organopolysiloxanen |
| DE1262020B (de) * | 1964-05-06 | 1968-02-29 | Wacker Chemie Gmbh | Verfahren zur Konstanthaltung der Viskositaet von Diorganopolysiloxanen |
| FR2004127A1 (ref) * | 1968-03-18 | 1969-11-21 | Wacker Chemie Gmbh | |
| US3706775A (en) * | 1970-12-17 | 1972-12-19 | Wacker Chemie Gmbh | Method of preparing high molecular weight linear organopolysiloxanes |
| DE2229514C3 (de) * | 1972-06-16 | 1979-01-04 | Wacker-Chemie Gmbh, 8000 Muenchen | Verfahren zur Förderung von Kondensations- und/oder Äquilibrierungsreaktionen von Organosiliciumverbindungen |
| DE2524041C3 (de) * | 1975-05-30 | 1979-02-15 | Wacker-Chemie Gmbh, 8000 Muenchen | Stabilisieren von Organopolysiloxanen |
| DE3306295A1 (de) * | 1983-02-23 | 1984-08-23 | Wacker-Chemie GmbH, 8000 München | Verfahren zum stabilisieren von organopolysiloxanen |
| DE3428581A1 (de) * | 1984-08-02 | 1986-02-13 | Wacker-Chemie GmbH, 8000 München | Verfahren zum stabilisieren von organopolysiloxanen |
-
1985
- 1985-09-16 DE DE19853533028 patent/DE3533028A1/de not_active Withdrawn
-
1986
- 1986-05-15 US US06/863,277 patent/US4701490A/en not_active Expired - Lifetime
- 1986-05-21 CA CA000509602A patent/CA1271486A/en not_active Expired - Lifetime
- 1986-09-16 DE DE8686112770T patent/DE3673102D1/de not_active Expired - Lifetime
- 1986-09-16 EP EP86112770A patent/EP0215470B1/de not_active Expired - Lifetime
- 1986-09-16 JP JP61216091A patent/JPS6268819A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH025608U (ref) * | 1988-06-23 | 1990-01-16 |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0215470A3 (en) | 1988-07-27 |
| EP0215470A2 (de) | 1987-03-25 |
| JPS6268819A (ja) | 1987-03-28 |
| DE3673102D1 (de) | 1990-09-06 |
| CA1271486A (en) | 1990-07-10 |
| EP0215470B1 (de) | 1990-08-01 |
| US4701490A (en) | 1987-10-20 |
| DE3533028A1 (de) | 1987-03-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6314014B2 (ref) | ||
| CA1289694C (en) | Preparation and processing of mixtures containing organocyclosiloxanes | |
| JP3657633B2 (ja) | オルガノシロキサン重合体の重縮合及び再分布用の新規触媒 | |
| CA1275415C (en) | Process for preparing linear organopolysiloxanes having terminal triorganosiloxy groups | |
| US4564693A (en) | Process for stabilizing organopolysiloxanes | |
| JPH0562129B2 (ref) | ||
| JPH06172534A (ja) | 有機官能シロキサンの調製のための縮合方法 | |
| US3498945A (en) | Linear organopolysiloxanes their preparation and their use | |
| US4552942A (en) | Silanes and compositions prepared therefrom | |
| FR2673186A1 (fr) | Procede de fabrication d'organopolysiloxanes. | |
| JPH07216091A (ja) | シロキサニル・ホスフェートの製造方法 | |
| US4975510A (en) | Process for preparing diorganopolysiloxanes having terminal triorganosiloxy units | |
| EP0586240A2 (en) | Alkoxy endblocked polydiorganosiloxane and room temperature vulcanizable silicone elastomers made therefrom | |
| US5041586A (en) | Method of preparing a silyphosphate mixture, silyphosphate mixture and its use in stabilizing metal silanolates in siloxane polymers | |
| US4137249A (en) | Silicon-tin compounds | |
| US3155634A (en) | Fluoro-organic acid catalyzed condensation of siloxanols | |
| US3169942A (en) | Zeolite catalyzed condensation of hydroxyl and/or alkoxy containing silicon compositions | |
| US20070004932A1 (en) | Silicon compound and a production process for silicon compound | |
| US2881184A (en) | Pyrrole-containing organosilicon compounds and process for producing the same | |
| US5621061A (en) | Process for stabilizing organopolysiloxanes | |
| US20060106187A1 (en) | Poly (cyclosiloxane) composition and method of systhesis thereof | |
| USRE32504E (en) | Room temperature stable organopolysiloxane compositions | |
| US4460726A (en) | Method for stabilizing organopolysiloxanes | |
| JPH0471410B2 (ref) | ||
| US4902813A (en) | Process for preparing diorganopolysiloxanes having terminal Si-bonded hydroxyl groups |