JPS6259689B2 - - Google Patents
Info
- Publication number
- JPS6259689B2 JPS6259689B2 JP55090066A JP9006680A JPS6259689B2 JP S6259689 B2 JPS6259689 B2 JP S6259689B2 JP 55090066 A JP55090066 A JP 55090066A JP 9006680 A JP9006680 A JP 9006680A JP S6259689 B2 JPS6259689 B2 JP S6259689B2
- Authority
- JP
- Japan
- Prior art keywords
- cobalt
- halide
- alkyl
- methanol
- iodide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims abstract description 117
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims abstract description 60
- 238000000034 method Methods 0.000 claims abstract description 42
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 33
- 239000010941 cobalt Substances 0.000 claims abstract description 33
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims abstract description 32
- 229910052707 ruthenium Inorganic materials 0.000 claims abstract description 23
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims abstract description 22
- 125000004429 atom Chemical group 0.000 claims abstract description 22
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 239000012429 reaction media Substances 0.000 claims abstract description 11
- 150000004820 halides Chemical class 0.000 claims abstract description 10
- 150000001350 alkyl halides Chemical class 0.000 claims abstract description 9
- -1 alkali metal cations Chemical class 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000001768 cations Chemical class 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- AVWLPUQJODERGA-UHFFFAOYSA-L cobalt(2+);diiodide Chemical compound [Co+2].[I-].[I-] AVWLPUQJODERGA-UHFFFAOYSA-L 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 229910021603 Ruthenium iodide Inorganic materials 0.000 claims description 2
- 150000001348 alkyl chlorides Chemical group 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 239000007791 liquid phase Substances 0.000 claims description 2
- LJZVDOUZSMHXJH-UHFFFAOYSA-K ruthenium(3+);triiodide Chemical compound [Ru+3].[I-].[I-].[I-] LJZVDOUZSMHXJH-UHFFFAOYSA-K 0.000 claims description 2
- 150000001347 alkyl bromides Chemical class 0.000 claims 1
- 150000001351 alkyl iodides Chemical class 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 claims 1
- WYRXRHOISWEUST-UHFFFAOYSA-K ruthenium(3+);tribromide Chemical compound [Br-].[Br-].[Br-].[Ru+3] WYRXRHOISWEUST-UHFFFAOYSA-K 0.000 claims 1
- 230000006315 carbonylation Effects 0.000 abstract description 7
- 238000005810 carbonylation reaction Methods 0.000 abstract description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 23
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- 230000035484 reaction time Effects 0.000 description 10
- 125000000217 alkyl group Chemical group 0.000 description 9
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 235000009518 sodium iodide Nutrition 0.000 description 7
- 229910002091 carbon monoxide Inorganic materials 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 5
- NQZFAUXPNWSLBI-UHFFFAOYSA-N carbon monoxide;ruthenium Chemical group [Ru].[Ru].[Ru].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] NQZFAUXPNWSLBI-UHFFFAOYSA-N 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Inorganic materials [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 2
- 125000004450 alkenylene group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 2
- GELSOTNVVKOYAW-UHFFFAOYSA-N ethyl(triphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 GELSOTNVVKOYAW-UHFFFAOYSA-N 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- LSMAIBOZUPTNBR-UHFFFAOYSA-N phosphanium;iodide Chemical group [PH4+].[I-] LSMAIBOZUPTNBR-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N phosphine group Chemical group P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- PLHHTYOBMWPGQX-UHFFFAOYSA-M 1,2-dimethylpyridin-1-ium;chloride Chemical compound [Cl-].CC1=CC=CC=[N+]1C PLHHTYOBMWPGQX-UHFFFAOYSA-M 0.000 description 1
- LLSKWVSWIZASLM-UHFFFAOYSA-N 1,3-diphenylpropan-2-yl(phenyl)phosphane Chemical compound C=1C=CC=CC=1CC(PC=1C=CC=CC=1)CC1=CC=CC=C1 LLSKWVSWIZASLM-UHFFFAOYSA-N 0.000 description 1
- OIDIRWZVUWCCCO-UHFFFAOYSA-N 1-ethylpyridin-1-ium Chemical compound CC[N+]1=CC=CC=C1 OIDIRWZVUWCCCO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UDHXJZHVNHGCEC-UHFFFAOYSA-N Chlorophacinone Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)C(=O)C1C(=O)C2=CC=CC=C2C1=O UDHXJZHVNHGCEC-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- VKEQBMCRQDSRET-UHFFFAOYSA-N Methylone Chemical compound CNC(C)C(=O)C1=CC=C2OCOC2=C1 VKEQBMCRQDSRET-UHFFFAOYSA-N 0.000 description 1
- PQBAWAQIRZIWIV-UHFFFAOYSA-N N-methylpyridinium Chemical compound C[N+]1=CC=CC=C1 PQBAWAQIRZIWIV-UHFFFAOYSA-N 0.000 description 1
- GSBKRFGXEJLVMI-UHFFFAOYSA-N Nervonyl carnitine Chemical compound CCC[N+](C)(C)C GSBKRFGXEJLVMI-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 229910001619 alkaline earth metal iodide Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical compound C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 1
- BNQRPLGZFADFGA-UHFFFAOYSA-N benzyl(triphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)CC1=CC=CC=C1 BNQRPLGZFADFGA-UHFFFAOYSA-N 0.000 description 1
- SHFLYPPECXRCFO-UHFFFAOYSA-N benzyl-dimethyl-octylazanium Chemical compound CCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SHFLYPPECXRCFO-UHFFFAOYSA-N 0.000 description 1
- GRHHVGHRQARKAM-UHFFFAOYSA-N benzyl-dimethyl-propylazanium Chemical compound CCC[N+](C)(C)CC1=CC=CC=C1 GRHHVGHRQARKAM-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- BEVHTMLFDWFAQF-UHFFFAOYSA-N butyl(triphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCC)C1=CC=CC=C1 BEVHTMLFDWFAQF-UHFFFAOYSA-N 0.000 description 1
- ARTHGSQAXVXICL-UHFFFAOYSA-N butyl(tripropyl)phosphanium Chemical compound CCCC[P+](CCC)(CCC)CCC ARTHGSQAXVXICL-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- USJRLGNYCQWLPF-UHFFFAOYSA-N chlorophosphane Chemical compound ClP USJRLGNYCQWLPF-UHFFFAOYSA-N 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- 229910021446 cobalt carbonate Inorganic materials 0.000 description 1
- ZOTKGJBKKKVBJZ-UHFFFAOYSA-L cobalt(2+);carbonate Chemical compound [Co+2].[O-]C([O-])=O ZOTKGJBKKKVBJZ-UHFFFAOYSA-L 0.000 description 1
- PFQLIVQUKOIJJD-UHFFFAOYSA-L cobalt(ii) formate Chemical compound [Co+2].[O-]C=O.[O-]C=O PFQLIVQUKOIJJD-UHFFFAOYSA-L 0.000 description 1
- WHWBTOCNUBAGRL-UHFFFAOYSA-N cobalt;formaldehyde Chemical compound [Co].O=C WHWBTOCNUBAGRL-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- ACZWLJHXYDFFOW-UHFFFAOYSA-N cyclohexyl(trimethyl)phosphanium Chemical compound C[P+](C)(C)C1CCCCC1 ACZWLJHXYDFFOW-UHFFFAOYSA-N 0.000 description 1
- RAWHIFQXLAGECW-UHFFFAOYSA-N dicyclohexyl(dimethyl)phosphanium Chemical compound C1CCCCC1[P+](C)(C)C1CCCCC1 RAWHIFQXLAGECW-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- RBECNRCKEQGFRU-UHFFFAOYSA-N diethyl(dimethyl)phosphanium Chemical compound CC[P+](C)(C)CC RBECNRCKEQGFRU-UHFFFAOYSA-N 0.000 description 1
- OUGDZFRDEZNAOS-UHFFFAOYSA-N diethyl-methyl-phenylphosphanium Chemical compound CC[P+](C)(CC)C1=CC=CC=C1 OUGDZFRDEZNAOS-UHFFFAOYSA-N 0.000 description 1
- MXTMXRYBYWOAGX-UHFFFAOYSA-N dimethyl(diphenyl)azanium Chemical compound C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 MXTMXRYBYWOAGX-UHFFFAOYSA-N 0.000 description 1
- BYGXNRZZNBOSBD-UHFFFAOYSA-N dimethyl(diphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C)(C)C1=CC=CC=C1 BYGXNRZZNBOSBD-UHFFFAOYSA-N 0.000 description 1
- HASCQPSFPAKVEK-UHFFFAOYSA-O dimethyl(phenyl)phosphanium Chemical compound C[PH+](C)C1=CC=CC=C1 HASCQPSFPAKVEK-UHFFFAOYSA-O 0.000 description 1
- MIQYOHNNWUEBSP-UHFFFAOYSA-N dodecyl(trimethyl)phosphanium Chemical compound CCCCCCCCCCCC[P+](C)(C)C MIQYOHNNWUEBSP-UHFFFAOYSA-N 0.000 description 1
- VICYBMUVWHJEFT-UHFFFAOYSA-N dodecyltrimethylammonium ion Chemical compound CCCCCCCCCCCC[N+](C)(C)C VICYBMUVWHJEFT-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- IQLVJVXTKNBZRC-UHFFFAOYSA-N ethyl(trimethyl)phosphanium Chemical compound CC[P+](C)(C)C IQLVJVXTKNBZRC-UHFFFAOYSA-N 0.000 description 1
- ATSROVAZOQKRJM-UHFFFAOYSA-N ethyl(tripropyl)phosphanium Chemical compound CCC[P+](CC)(CCC)CCC ATSROVAZOQKRJM-UHFFFAOYSA-N 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000011905 homologation Methods 0.000 description 1
- 238000007163 homologation reaction Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- PHUUEJUSWPFFOG-UHFFFAOYSA-N methyl(triphenyl)azanium Chemical compound C=1C=CC=CC=1[N+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 PHUUEJUSWPFFOG-UHFFFAOYSA-N 0.000 description 1
- PLNPRGLZZXAKGE-UHFFFAOYSA-N methyl(tripropyl)phosphanium Chemical compound CCC[P+](C)(CCC)CCC PLNPRGLZZXAKGE-UHFFFAOYSA-N 0.000 description 1
- XYEVWVBQYOGNMF-UHFFFAOYSA-N methyl-tri(propan-2-yl)phosphanium Chemical compound CC(C)[P+](C)(C(C)C)C(C)C XYEVWVBQYOGNMF-UHFFFAOYSA-N 0.000 description 1
- BIUUTLHYFPFWRB-UHFFFAOYSA-N methyl-tris(2-methylpropyl)phosphanium Chemical compound CC(C)C[P+](C)(CC(C)C)CC(C)C BIUUTLHYFPFWRB-UHFFFAOYSA-N 0.000 description 1
- STSCGYXBGNNIHH-UHFFFAOYSA-N methyl-tris(4-methylphenyl)phosphanium Chemical compound C1=CC(C)=CC=C1[P+](C)(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 STSCGYXBGNNIHH-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000012255 powdered metal Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003304 ruthenium compounds Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- SZWHXXNVLACKBV-UHFFFAOYSA-N tetraethylphosphanium Chemical compound CC[P+](CC)(CC)CC SZWHXXNVLACKBV-UHFFFAOYSA-N 0.000 description 1
- BXYHVFRRNNWPMB-UHFFFAOYSA-N tetramethylphosphanium Chemical compound C[P+](C)(C)C BXYHVFRRNNWPMB-UHFFFAOYSA-N 0.000 description 1
- USFPINLPPFWTJW-UHFFFAOYSA-N tetraphenylphosphonium Chemical compound C1=CC=CC=C1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 USFPINLPPFWTJW-UHFFFAOYSA-N 0.000 description 1
- MGNNDSHYJBPROH-UHFFFAOYSA-N tribenzyl(methyl)phosphanium Chemical compound C=1C=CC=CC=1C[P+](CC=1C=CC=CC=1)(C)CC1=CC=CC=C1 MGNNDSHYJBPROH-UHFFFAOYSA-N 0.000 description 1
- HJHUXWBTVVFLQI-UHFFFAOYSA-N tributyl(methyl)azanium Chemical compound CCCC[N+](C)(CCCC)CCCC HJHUXWBTVVFLQI-UHFFFAOYSA-N 0.000 description 1
- XKFPGUWSSPXXMF-UHFFFAOYSA-N tributyl(methyl)phosphanium Chemical compound CCCC[P+](C)(CCCC)CCCC XKFPGUWSSPXXMF-UHFFFAOYSA-N 0.000 description 1
- RLZMYANQLOCZOB-UHFFFAOYSA-M tributyl(methyl)phosphanium;iodide Chemical compound [I-].CCCC[P+](C)(CCCC)CCCC RLZMYANQLOCZOB-UHFFFAOYSA-M 0.000 description 1
- KXSJWMJRNYHFKC-UHFFFAOYSA-N tricyclohexyl(methyl)phosphanium Chemical compound C1CCCCC1[P+](C1CCCCC1)(C)C1CCCCC1 KXSJWMJRNYHFKC-UHFFFAOYSA-N 0.000 description 1
- SEACXNRNJAXIBM-UHFFFAOYSA-N triethyl(methyl)azanium Chemical compound CC[N+](C)(CC)CC SEACXNRNJAXIBM-UHFFFAOYSA-N 0.000 description 1
- TZWFFXFQARPFJN-UHFFFAOYSA-N triethyl(methyl)phosphanium Chemical compound CC[P+](C)(CC)CC TZWFFXFQARPFJN-UHFFFAOYSA-N 0.000 description 1
- RGXJWHBYXNYHML-UHFFFAOYSA-N triethyl(pentyl)phosphanium Chemical compound CCCCC[P+](CC)(CC)CC RGXJWHBYXNYHML-UHFFFAOYSA-N 0.000 description 1
- MYKCGIGJOAYNOG-UHFFFAOYSA-N trimethyl(pentyl)phosphanium Chemical compound CCCCC[P+](C)(C)C MYKCGIGJOAYNOG-UHFFFAOYSA-N 0.000 description 1
- WHAFDJWJDDPMDO-UHFFFAOYSA-N trimethyl(phenyl)phosphanium Chemical compound C[P+](C)(C)C1=CC=CC=C1 WHAFDJWJDDPMDO-UHFFFAOYSA-N 0.000 description 1
- IZYFBZDLXRHRLF-UHFFFAOYSA-N tritylphosphane;hydroiodide Chemical compound [I-].C=1C=CC=CC=1C(C=1C=CC=CC=1)([PH3+])C1=CC=CC=C1 IZYFBZDLXRHRLF-UHFFFAOYSA-N 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Saccharide Compounds (AREA)
- Medicines Containing Plant Substances (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7917927A FR2460284A1 (fr) | 1979-07-04 | 1979-07-04 | Procede de preparation de l'acetaldehyde |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5625128A JPS5625128A (en) | 1981-03-10 |
| JPS6259689B2 true JPS6259689B2 (show.php) | 1987-12-12 |
Family
ID=9227735
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP9006680A Granted JPS5625128A (en) | 1979-07-04 | 1980-07-03 | Manufacture of acetoaldehyde |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4306091A (show.php) |
| EP (1) | EP0022735B1 (show.php) |
| JP (1) | JPS5625128A (show.php) |
| AT (1) | ATE909T1 (show.php) |
| BR (1) | BR8004157A (show.php) |
| CA (1) | CA1140592A (show.php) |
| DD (1) | DD151743A5 (show.php) |
| DE (1) | DE3060340D1 (show.php) |
| ES (1) | ES8102546A1 (show.php) |
| FR (1) | FR2460284A1 (show.php) |
| SU (1) | SU1053742A3 (show.php) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4348541A (en) * | 1979-11-30 | 1982-09-07 | Exxon Research And Engineering Company | Methanol homologation using cobalt-ruthenium catalysts |
| CA1155458A (en) * | 1980-04-09 | 1983-10-18 | Union Carbide Corporation | Process for the selective hydroformylation of methanol to acetaldehyde |
| JPS579733A (en) * | 1980-06-18 | 1982-01-19 | Mitsubishi Gas Chem Co Inc | Preparation of acetaldehyde |
| DE3031558C2 (de) * | 1980-08-21 | 1984-04-26 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Verfahren zur Herstellung von Acetaldehyd und Ethanol |
| DE3045891C2 (de) * | 1980-12-05 | 1983-03-03 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Verfahren zur Herstellung von Acetaldehyd und Ethanol |
| US4433178A (en) * | 1982-02-01 | 1984-02-21 | Texaco, Inc. | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition |
| US4433176A (en) * | 1982-02-01 | 1984-02-21 | Texaco Inc. | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition |
| US4433177A (en) * | 1982-02-01 | 1984-02-21 | Texaco Inc. | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition |
| US4389532A (en) * | 1982-05-10 | 1983-06-21 | Eastman Kodak Company | Process for the preparation of acetaldehyde |
| GB8326986D0 (en) * | 1983-10-08 | 1983-11-09 | British Petroleum Co Plc | Production of ethanol |
| US4511741A (en) * | 1983-12-02 | 1985-04-16 | Union Carbide Corporation | Production of aldehydes from organic acid esters |
| US4628121A (en) * | 1985-09-27 | 1986-12-09 | The Halcon Sd Group, Inc. | Preparation of acetaldehyde |
| US4954665A (en) * | 1985-11-07 | 1990-09-04 | Union Carbide Chemicals And Plastics Company Inc. | Methanol homologation |
| US4993298A (en) * | 1989-10-04 | 1991-02-19 | Alpha Industries, Inc. | Apparatus for mounting a notching blade |
| US20050154239A1 (en) * | 2004-01-08 | 2005-07-14 | Windhorst Kenneth A. | Methods for preparing 1,3 butylene glycol |
| US9714206B2 (en) | 2014-12-30 | 2017-07-25 | Eastman Chemical Company | Methyl-iodide-free carbonylation of an alcohol to its homologous aldehyde and/or alcohol |
| US9365479B1 (en) | 2014-12-30 | 2016-06-14 | Eastman Chemical Company | Methyl-iodide-free carbonylation of an alcohol to its homologous aldehyde and/or alcohol |
| US9238606B1 (en) | 2014-12-30 | 2016-01-19 | Eastman Chemical Company | Methyl-Iodide-free carbonylation of methanol to acetaldehyde |
| US9266806B1 (en) | 2014-12-30 | 2016-02-23 | Eastman Chemical Company | Reductive carbonylation of methanol to acetaldehyde |
| US9266807B1 (en) | 2014-12-30 | 2016-02-23 | Eastman Chemical Company | Conversion of alcohols to longer chain aldehydes or alcohols |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2727902A (en) * | 1951-12-18 | 1955-12-20 | Basf Ag | Process for the production of aliphatic oxygen compounds by carbonylation of alcohols and ethers |
| US2729651A (en) * | 1952-06-11 | 1956-01-03 | Basf Ag | Process for the production of aliphatic oxygen compounds by carbonylation of alcohols, ethers, and esters |
| US3248432A (en) * | 1961-12-12 | 1966-04-26 | Commercial Solvents Corp | Process for the production of ethyl alcohol |
| US3356734A (en) * | 1963-02-28 | 1967-12-05 | Kuraishi Michio | Process for the production of acetaldehyde |
| US3285948A (en) * | 1965-01-22 | 1966-11-15 | Commercial Solvents Corp | Halides of ruthenium and osmium in conjunction with cobalt and iodine in the production of ethanol from methanol |
| JPS482525U (show.php) * | 1971-05-24 | 1973-01-12 | ||
| BE842430A (nl) | 1975-06-09 | 1976-12-01 | Werkwijze ter bereiding van ethanol uit methanol koolmonoxyde en waterstof | |
| US4190729A (en) * | 1977-09-19 | 1980-02-26 | Monsanto Company | Carbonylation process with stabilized catalyst |
| CA1094105A (en) * | 1977-11-08 | 1981-01-20 | Brian R. Gane | Process for the production of acetaldehyde by the reaction of methanol with synthesis gas |
| US4133966A (en) * | 1977-12-23 | 1979-01-09 | Gulf Research & Development Company | Selective formation of ethanol from methanol, hydrogen and carbon monoxide |
| US4151208A (en) * | 1977-12-23 | 1979-04-24 | Gulf Research & Development Company | Process for the selective preparation of acetaldehyde from methanol and synthesis gas |
| US4126752A (en) * | 1978-03-06 | 1978-11-21 | Allied Chemical Corporation | Homologation of methanol with a carbon monoxide-water mixture |
| US4171461A (en) * | 1978-09-01 | 1979-10-16 | Air Products And Chemicals, Inc. | Synthesis of ethanol by homologation of methanol |
| FR2441603A1 (fr) * | 1978-10-31 | 1980-06-13 | Rhone Poulenc Ind | Procede de preparation de l'acetaldehyde |
| US4233466A (en) * | 1979-11-15 | 1980-11-11 | Union Carbide Corporation | Homologation process for the production of ethanol from methanol |
-
1979
- 1979-07-04 FR FR7917927A patent/FR2460284A1/fr not_active Withdrawn
-
1980
- 1980-06-30 US US06/164,332 patent/US4306091A/en not_active Expired - Lifetime
- 1980-07-01 DD DD80222311A patent/DD151743A5/de unknown
- 1980-07-01 SU SU802938262A patent/SU1053742A3/ru active
- 1980-07-02 AT AT80420084T patent/ATE909T1/de not_active IP Right Cessation
- 1980-07-02 EP EP80420084A patent/EP0022735B1/fr not_active Expired
- 1980-07-02 DE DE8080420084T patent/DE3060340D1/de not_active Expired
- 1980-07-03 ES ES493058A patent/ES8102546A1/es not_active Expired
- 1980-07-03 BR BR8004157A patent/BR8004157A/pt unknown
- 1980-07-03 JP JP9006680A patent/JPS5625128A/ja active Granted
- 1980-07-03 CA CA000355392A patent/CA1140592A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DD151743A5 (de) | 1981-11-04 |
| ES493058A0 (es) | 1981-02-16 |
| BR8004157A (pt) | 1981-01-21 |
| CA1140592A (fr) | 1983-02-01 |
| EP0022735A1 (fr) | 1981-01-21 |
| ATE909T1 (de) | 1982-05-15 |
| EP0022735B1 (fr) | 1982-04-28 |
| DE3060340D1 (en) | 1982-06-09 |
| FR2460284A1 (fr) | 1981-01-23 |
| US4306091A (en) | 1981-12-15 |
| ES8102546A1 (es) | 1981-02-16 |
| SU1053742A3 (ru) | 1983-11-07 |
| JPS5625128A (en) | 1981-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6259689B2 (show.php) | ||
| US7947746B2 (en) | Process for the conversion of hydrocarbons into ethanol | |
| US4189441A (en) | Process for preparing esters from ethers or esters of lower homologous alcohols | |
| EP2186787A1 (en) | Hydrogenation of ethanoic acid to produce ethanol | |
| MXPA96002083A (es) | Proceso para la carbonilacion de alcoholes alquilicos y/o derivados reactivos de los mismos | |
| WO2009077719A1 (en) | Process for the conversion of hydrocarbons to ethanol | |
| WO2009077729A1 (en) | Process for the production of ethanol from a carbonaceous feedstock | |
| US4293718A (en) | Preparation of acetaldehyde | |
| SA94140676B1 (ar) | طريقة لتحضير احماض كربوكسيلية carboxylin acidsاو استراتها esters المناظرة في وجود حفاز مؤسس على الايريديوم iridium | |
| US4356320A (en) | Preparation of carboxylic acids | |
| US4212989A (en) | Process for producing carboxylic acids or esters thereof | |
| CA2525025C (en) | Carbonylation process using metal-tridentate ligand catalysts | |
| US4324927A (en) | Process for the homologization of methanol | |
| US4133963A (en) | Process for the production of carboxylic acids | |
| JP2001181229A (ja) | 酢酸の製造方法 | |
| JPS60142933A (ja) | 溶媒存在下にメタノ−ル、一酸化炭素および水素を、金属触媒を用いて液相反応させ、エタノ−ルおよび/またはアセトアルデヒドを製造する方法 | |
| JPS6323978B2 (show.php) | ||
| US4483804A (en) | Preparation of carboxylic acid anhydrides | |
| US4396726A (en) | Process for preparing ethylene glycol and lower monohydric alcohols from syn gas using a novel catalyst system | |
| JP2664046B2 (ja) | 炭酸ガスからのアルコール類の製造方法 | |
| JPS59164738A (ja) | エタノ−ルおよび酢酸の製造方法 | |
| JPS645587B2 (show.php) | ||
| JPS6158454B2 (show.php) | ||
| JPS58172331A (ja) | 含酸素化合物の製造方法 | |
| JPH0363536B2 (show.php) |