JPS6259689B2 - - Google Patents
Info
- Publication number
- JPS6259689B2 JPS6259689B2 JP55090066A JP9006680A JPS6259689B2 JP S6259689 B2 JPS6259689 B2 JP S6259689B2 JP 55090066 A JP55090066 A JP 55090066A JP 9006680 A JP9006680 A JP 9006680A JP S6259689 B2 JPS6259689 B2 JP S6259689B2
- Authority
- JP
- Japan
- Prior art keywords
- cobalt
- halide
- alkyl
- methanol
- iodide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims abstract description 117
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims abstract description 60
- 238000000034 method Methods 0.000 claims abstract description 42
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 33
- 239000010941 cobalt Substances 0.000 claims abstract description 33
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims abstract description 32
- 229910052707 ruthenium Inorganic materials 0.000 claims abstract description 23
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims abstract description 22
- 125000004429 atom Chemical group 0.000 claims abstract description 22
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 239000012429 reaction media Substances 0.000 claims abstract description 11
- 150000004820 halides Chemical class 0.000 claims abstract description 10
- 150000001350 alkyl halides Chemical class 0.000 claims abstract description 9
- -1 alkali metal cations Chemical class 0.000 claims description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000001768 cations Chemical class 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- AVWLPUQJODERGA-UHFFFAOYSA-L cobalt(2+);diiodide Chemical compound [Co+2].[I-].[I-] AVWLPUQJODERGA-UHFFFAOYSA-L 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 229910021603 Ruthenium iodide Inorganic materials 0.000 claims description 2
- 150000001348 alkyl chlorides Chemical group 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 239000007791 liquid phase Substances 0.000 claims description 2
- LJZVDOUZSMHXJH-UHFFFAOYSA-K ruthenium(3+);triiodide Chemical compound [Ru+3].[I-].[I-].[I-] LJZVDOUZSMHXJH-UHFFFAOYSA-K 0.000 claims description 2
- 150000001347 alkyl bromides Chemical class 0.000 claims 1
- 150000001351 alkyl iodides Chemical class 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 claims 1
- WYRXRHOISWEUST-UHFFFAOYSA-K ruthenium(3+);tribromide Chemical compound [Br-].[Br-].[Br-].[Ru+3] WYRXRHOISWEUST-UHFFFAOYSA-K 0.000 claims 1
- 230000006315 carbonylation Effects 0.000 abstract description 7
- 238000005810 carbonylation reaction Methods 0.000 abstract description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 23
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- 230000035484 reaction time Effects 0.000 description 10
- 125000000217 alkyl group Chemical group 0.000 description 9
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 235000009518 sodium iodide Nutrition 0.000 description 7
- 229910002091 carbon monoxide Inorganic materials 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 5
- NQZFAUXPNWSLBI-UHFFFAOYSA-N carbon monoxide;ruthenium Chemical group [Ru].[Ru].[Ru].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] NQZFAUXPNWSLBI-UHFFFAOYSA-N 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- MQIKJSYMMJWAMP-UHFFFAOYSA-N dicobalt octacarbonyl Chemical group [Co+2].[Co+2].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-].[O+]#[C-] MQIKJSYMMJWAMP-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Inorganic materials [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 2
- 125000004450 alkenylene group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 2
- GELSOTNVVKOYAW-UHFFFAOYSA-N ethyl(triphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 GELSOTNVVKOYAW-UHFFFAOYSA-N 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- LSMAIBOZUPTNBR-UHFFFAOYSA-N phosphanium;iodide Chemical group [PH4+].[I-] LSMAIBOZUPTNBR-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N phosphine group Chemical group P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- PLHHTYOBMWPGQX-UHFFFAOYSA-M 1,2-dimethylpyridin-1-ium;chloride Chemical compound [Cl-].CC1=CC=CC=[N+]1C PLHHTYOBMWPGQX-UHFFFAOYSA-M 0.000 description 1
- LLSKWVSWIZASLM-UHFFFAOYSA-N 1,3-diphenylpropan-2-yl(phenyl)phosphane Chemical compound C=1C=CC=CC=1CC(PC=1C=CC=CC=1)CC1=CC=CC=C1 LLSKWVSWIZASLM-UHFFFAOYSA-N 0.000 description 1
- OIDIRWZVUWCCCO-UHFFFAOYSA-N 1-ethylpyridin-1-ium Chemical compound CC[N+]1=CC=CC=C1 OIDIRWZVUWCCCO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UDHXJZHVNHGCEC-UHFFFAOYSA-N Chlorophacinone Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)C(=O)C1C(=O)C2=CC=CC=C2C1=O UDHXJZHVNHGCEC-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- VKEQBMCRQDSRET-UHFFFAOYSA-N Methylone Chemical compound CNC(C)C(=O)C1=CC=C2OCOC2=C1 VKEQBMCRQDSRET-UHFFFAOYSA-N 0.000 description 1
- PQBAWAQIRZIWIV-UHFFFAOYSA-N N-methylpyridinium Chemical compound C[N+]1=CC=CC=C1 PQBAWAQIRZIWIV-UHFFFAOYSA-N 0.000 description 1
- GSBKRFGXEJLVMI-UHFFFAOYSA-N Nervonyl carnitine Chemical compound CCC[N+](C)(C)C GSBKRFGXEJLVMI-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 229910001619 alkaline earth metal iodide Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical compound C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 1
- BNQRPLGZFADFGA-UHFFFAOYSA-N benzyl(triphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)CC1=CC=CC=C1 BNQRPLGZFADFGA-UHFFFAOYSA-N 0.000 description 1
- SHFLYPPECXRCFO-UHFFFAOYSA-N benzyl-dimethyl-octylazanium Chemical compound CCCCCCCC[N+](C)(C)CC1=CC=CC=C1 SHFLYPPECXRCFO-UHFFFAOYSA-N 0.000 description 1
- GRHHVGHRQARKAM-UHFFFAOYSA-N benzyl-dimethyl-propylazanium Chemical compound CCC[N+](C)(C)CC1=CC=CC=C1 GRHHVGHRQARKAM-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- BEVHTMLFDWFAQF-UHFFFAOYSA-N butyl(triphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCC)C1=CC=CC=C1 BEVHTMLFDWFAQF-UHFFFAOYSA-N 0.000 description 1
- ARTHGSQAXVXICL-UHFFFAOYSA-N butyl(tripropyl)phosphanium Chemical compound CCCC[P+](CCC)(CCC)CCC ARTHGSQAXVXICL-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- USJRLGNYCQWLPF-UHFFFAOYSA-N chlorophosphane Chemical compound ClP USJRLGNYCQWLPF-UHFFFAOYSA-N 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- 229910021446 cobalt carbonate Inorganic materials 0.000 description 1
- ZOTKGJBKKKVBJZ-UHFFFAOYSA-L cobalt(2+);carbonate Chemical compound [Co+2].[O-]C([O-])=O ZOTKGJBKKKVBJZ-UHFFFAOYSA-L 0.000 description 1
- PFQLIVQUKOIJJD-UHFFFAOYSA-L cobalt(ii) formate Chemical compound [Co+2].[O-]C=O.[O-]C=O PFQLIVQUKOIJJD-UHFFFAOYSA-L 0.000 description 1
- WHWBTOCNUBAGRL-UHFFFAOYSA-N cobalt;formaldehyde Chemical compound [Co].O=C WHWBTOCNUBAGRL-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- ACZWLJHXYDFFOW-UHFFFAOYSA-N cyclohexyl(trimethyl)phosphanium Chemical compound C[P+](C)(C)C1CCCCC1 ACZWLJHXYDFFOW-UHFFFAOYSA-N 0.000 description 1
- RAWHIFQXLAGECW-UHFFFAOYSA-N dicyclohexyl(dimethyl)phosphanium Chemical compound C1CCCCC1[P+](C)(C)C1CCCCC1 RAWHIFQXLAGECW-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- RBECNRCKEQGFRU-UHFFFAOYSA-N diethyl(dimethyl)phosphanium Chemical compound CC[P+](C)(C)CC RBECNRCKEQGFRU-UHFFFAOYSA-N 0.000 description 1
- OUGDZFRDEZNAOS-UHFFFAOYSA-N diethyl-methyl-phenylphosphanium Chemical compound CC[P+](C)(CC)C1=CC=CC=C1 OUGDZFRDEZNAOS-UHFFFAOYSA-N 0.000 description 1
- MXTMXRYBYWOAGX-UHFFFAOYSA-N dimethyl(diphenyl)azanium Chemical compound C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 MXTMXRYBYWOAGX-UHFFFAOYSA-N 0.000 description 1
- BYGXNRZZNBOSBD-UHFFFAOYSA-N dimethyl(diphenyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C)(C)C1=CC=CC=C1 BYGXNRZZNBOSBD-UHFFFAOYSA-N 0.000 description 1
- HASCQPSFPAKVEK-UHFFFAOYSA-O dimethyl(phenyl)phosphanium Chemical compound C[PH+](C)C1=CC=CC=C1 HASCQPSFPAKVEK-UHFFFAOYSA-O 0.000 description 1
- MIQYOHNNWUEBSP-UHFFFAOYSA-N dodecyl(trimethyl)phosphanium Chemical compound CCCCCCCCCCCC[P+](C)(C)C MIQYOHNNWUEBSP-UHFFFAOYSA-N 0.000 description 1
- VICYBMUVWHJEFT-UHFFFAOYSA-N dodecyltrimethylammonium ion Chemical compound CCCCCCCCCCCC[N+](C)(C)C VICYBMUVWHJEFT-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- IQLVJVXTKNBZRC-UHFFFAOYSA-N ethyl(trimethyl)phosphanium Chemical compound CC[P+](C)(C)C IQLVJVXTKNBZRC-UHFFFAOYSA-N 0.000 description 1
- ATSROVAZOQKRJM-UHFFFAOYSA-N ethyl(tripropyl)phosphanium Chemical compound CCC[P+](CC)(CCC)CCC ATSROVAZOQKRJM-UHFFFAOYSA-N 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 238000011905 homologation Methods 0.000 description 1
- 238000007163 homologation reaction Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- PHUUEJUSWPFFOG-UHFFFAOYSA-N methyl(triphenyl)azanium Chemical compound C=1C=CC=CC=1[N+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 PHUUEJUSWPFFOG-UHFFFAOYSA-N 0.000 description 1
- PLNPRGLZZXAKGE-UHFFFAOYSA-N methyl(tripropyl)phosphanium Chemical compound CCC[P+](C)(CCC)CCC PLNPRGLZZXAKGE-UHFFFAOYSA-N 0.000 description 1
- XYEVWVBQYOGNMF-UHFFFAOYSA-N methyl-tri(propan-2-yl)phosphanium Chemical compound CC(C)[P+](C)(C(C)C)C(C)C XYEVWVBQYOGNMF-UHFFFAOYSA-N 0.000 description 1
- BIUUTLHYFPFWRB-UHFFFAOYSA-N methyl-tris(2-methylpropyl)phosphanium Chemical compound CC(C)C[P+](C)(CC(C)C)CC(C)C BIUUTLHYFPFWRB-UHFFFAOYSA-N 0.000 description 1
- STSCGYXBGNNIHH-UHFFFAOYSA-N methyl-tris(4-methylphenyl)phosphanium Chemical compound C1=CC(C)=CC=C1[P+](C)(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 STSCGYXBGNNIHH-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000012255 powdered metal Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003304 ruthenium compounds Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical compound CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- SZWHXXNVLACKBV-UHFFFAOYSA-N tetraethylphosphanium Chemical compound CC[P+](CC)(CC)CC SZWHXXNVLACKBV-UHFFFAOYSA-N 0.000 description 1
- BXYHVFRRNNWPMB-UHFFFAOYSA-N tetramethylphosphanium Chemical compound C[P+](C)(C)C BXYHVFRRNNWPMB-UHFFFAOYSA-N 0.000 description 1
- USFPINLPPFWTJW-UHFFFAOYSA-N tetraphenylphosphonium Chemical compound C1=CC=CC=C1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 USFPINLPPFWTJW-UHFFFAOYSA-N 0.000 description 1
- MGNNDSHYJBPROH-UHFFFAOYSA-N tribenzyl(methyl)phosphanium Chemical compound C=1C=CC=CC=1C[P+](CC=1C=CC=CC=1)(C)CC1=CC=CC=C1 MGNNDSHYJBPROH-UHFFFAOYSA-N 0.000 description 1
- HJHUXWBTVVFLQI-UHFFFAOYSA-N tributyl(methyl)azanium Chemical compound CCCC[N+](C)(CCCC)CCCC HJHUXWBTVVFLQI-UHFFFAOYSA-N 0.000 description 1
- XKFPGUWSSPXXMF-UHFFFAOYSA-N tributyl(methyl)phosphanium Chemical compound CCCC[P+](C)(CCCC)CCCC XKFPGUWSSPXXMF-UHFFFAOYSA-N 0.000 description 1
- RLZMYANQLOCZOB-UHFFFAOYSA-M tributyl(methyl)phosphanium;iodide Chemical compound [I-].CCCC[P+](C)(CCCC)CCCC RLZMYANQLOCZOB-UHFFFAOYSA-M 0.000 description 1
- KXSJWMJRNYHFKC-UHFFFAOYSA-N tricyclohexyl(methyl)phosphanium Chemical compound C1CCCCC1[P+](C1CCCCC1)(C)C1CCCCC1 KXSJWMJRNYHFKC-UHFFFAOYSA-N 0.000 description 1
- SEACXNRNJAXIBM-UHFFFAOYSA-N triethyl(methyl)azanium Chemical compound CC[N+](C)(CC)CC SEACXNRNJAXIBM-UHFFFAOYSA-N 0.000 description 1
- TZWFFXFQARPFJN-UHFFFAOYSA-N triethyl(methyl)phosphanium Chemical compound CC[P+](C)(CC)CC TZWFFXFQARPFJN-UHFFFAOYSA-N 0.000 description 1
- RGXJWHBYXNYHML-UHFFFAOYSA-N triethyl(pentyl)phosphanium Chemical compound CCCCC[P+](CC)(CC)CC RGXJWHBYXNYHML-UHFFFAOYSA-N 0.000 description 1
- MYKCGIGJOAYNOG-UHFFFAOYSA-N trimethyl(pentyl)phosphanium Chemical compound CCCCC[P+](C)(C)C MYKCGIGJOAYNOG-UHFFFAOYSA-N 0.000 description 1
- WHAFDJWJDDPMDO-UHFFFAOYSA-N trimethyl(phenyl)phosphanium Chemical compound C[P+](C)(C)C1=CC=CC=C1 WHAFDJWJDDPMDO-UHFFFAOYSA-N 0.000 description 1
- IZYFBZDLXRHRLF-UHFFFAOYSA-N tritylphosphane;hydroiodide Chemical compound [I-].C=1C=CC=CC=1C(C=1C=CC=CC=1)([PH3+])C1=CC=CC=C1 IZYFBZDLXRHRLF-UHFFFAOYSA-N 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Saccharide Compounds (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Medicines Containing Plant Substances (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7917927A FR2460284A1 (fr) | 1979-07-04 | 1979-07-04 | Procede de preparation de l'acetaldehyde |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5625128A JPS5625128A (en) | 1981-03-10 |
| JPS6259689B2 true JPS6259689B2 (enExample) | 1987-12-12 |
Family
ID=9227735
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP9006680A Granted JPS5625128A (en) | 1979-07-04 | 1980-07-03 | Manufacture of acetoaldehyde |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4306091A (enExample) |
| EP (1) | EP0022735B1 (enExample) |
| JP (1) | JPS5625128A (enExample) |
| AT (1) | ATE909T1 (enExample) |
| BR (1) | BR8004157A (enExample) |
| CA (1) | CA1140592A (enExample) |
| DD (1) | DD151743A5 (enExample) |
| DE (1) | DE3060340D1 (enExample) |
| ES (1) | ES8102546A1 (enExample) |
| FR (1) | FR2460284A1 (enExample) |
| SU (1) | SU1053742A3 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4348541A (en) * | 1979-11-30 | 1982-09-07 | Exxon Research And Engineering Company | Methanol homologation using cobalt-ruthenium catalysts |
| CA1155458A (en) * | 1980-04-09 | 1983-10-18 | Union Carbide Corporation | Process for the selective hydroformylation of methanol to acetaldehyde |
| JPS579733A (en) * | 1980-06-18 | 1982-01-19 | Mitsubishi Gas Chem Co Inc | Preparation of acetaldehyde |
| DE3031558C2 (de) * | 1980-08-21 | 1984-04-26 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Verfahren zur Herstellung von Acetaldehyd und Ethanol |
| DE3045891C2 (de) * | 1980-12-05 | 1983-03-03 | Union Rheinische Braunkohlen Kraftstoff AG, 5000 Köln | Verfahren zur Herstellung von Acetaldehyd und Ethanol |
| US4433177A (en) * | 1982-02-01 | 1984-02-21 | Texaco Inc. | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition |
| US4433178A (en) * | 1982-02-01 | 1984-02-21 | Texaco, Inc. | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition |
| US4433176A (en) * | 1982-02-01 | 1984-02-21 | Texaco Inc. | Process for preparing acetaldehyde from methanol and synthesis gas using a novel catalyst composition |
| US4389532A (en) * | 1982-05-10 | 1983-06-21 | Eastman Kodak Company | Process for the preparation of acetaldehyde |
| GB8326986D0 (en) * | 1983-10-08 | 1983-11-09 | British Petroleum Co Plc | Production of ethanol |
| US4511741A (en) * | 1983-12-02 | 1985-04-16 | Union Carbide Corporation | Production of aldehydes from organic acid esters |
| US4628121A (en) * | 1985-09-27 | 1986-12-09 | The Halcon Sd Group, Inc. | Preparation of acetaldehyde |
| US4954665A (en) * | 1985-11-07 | 1990-09-04 | Union Carbide Chemicals And Plastics Company Inc. | Methanol homologation |
| US4993298A (en) * | 1989-10-04 | 1991-02-19 | Alpha Industries, Inc. | Apparatus for mounting a notching blade |
| US20050154239A1 (en) * | 2004-01-08 | 2005-07-14 | Windhorst Kenneth A. | Methods for preparing 1,3 butylene glycol |
| US9266806B1 (en) | 2014-12-30 | 2016-02-23 | Eastman Chemical Company | Reductive carbonylation of methanol to acetaldehyde |
| US9238606B1 (en) | 2014-12-30 | 2016-01-19 | Eastman Chemical Company | Methyl-Iodide-free carbonylation of methanol to acetaldehyde |
| US9714206B2 (en) | 2014-12-30 | 2017-07-25 | Eastman Chemical Company | Methyl-iodide-free carbonylation of an alcohol to its homologous aldehyde and/or alcohol |
| US9266807B1 (en) | 2014-12-30 | 2016-02-23 | Eastman Chemical Company | Conversion of alcohols to longer chain aldehydes or alcohols |
| US9365479B1 (en) * | 2014-12-30 | 2016-06-14 | Eastman Chemical Company | Methyl-iodide-free carbonylation of an alcohol to its homologous aldehyde and/or alcohol |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2727902A (en) * | 1951-12-18 | 1955-12-20 | Basf Ag | Process for the production of aliphatic oxygen compounds by carbonylation of alcohols and ethers |
| US2729651A (en) * | 1952-06-11 | 1956-01-03 | Basf Ag | Process for the production of aliphatic oxygen compounds by carbonylation of alcohols, ethers, and esters |
| US3248432A (en) * | 1961-12-12 | 1966-04-26 | Commercial Solvents Corp | Process for the production of ethyl alcohol |
| US3356734A (en) * | 1963-02-28 | 1967-12-05 | Kuraishi Michio | Process for the production of acetaldehyde |
| US3285948A (en) * | 1965-01-22 | 1966-11-15 | Commercial Solvents Corp | Halides of ruthenium and osmium in conjunction with cobalt and iodine in the production of ethanol from methanol |
| JPS482525U (enExample) * | 1971-05-24 | 1973-01-12 | ||
| BE842430A (nl) | 1975-06-09 | 1976-12-01 | Werkwijze ter bereiding van ethanol uit methanol koolmonoxyde en waterstof | |
| US4190729A (en) * | 1977-09-19 | 1980-02-26 | Monsanto Company | Carbonylation process with stabilized catalyst |
| CA1094105A (en) * | 1977-11-08 | 1981-01-20 | Brian R. Gane | Process for the production of acetaldehyde by the reaction of methanol with synthesis gas |
| US4133966A (en) * | 1977-12-23 | 1979-01-09 | Gulf Research & Development Company | Selective formation of ethanol from methanol, hydrogen and carbon monoxide |
| US4151208A (en) * | 1977-12-23 | 1979-04-24 | Gulf Research & Development Company | Process for the selective preparation of acetaldehyde from methanol and synthesis gas |
| US4126752A (en) * | 1978-03-06 | 1978-11-21 | Allied Chemical Corporation | Homologation of methanol with a carbon monoxide-water mixture |
| US4171461A (en) * | 1978-09-01 | 1979-10-16 | Air Products And Chemicals, Inc. | Synthesis of ethanol by homologation of methanol |
| FR2441603A1 (fr) * | 1978-10-31 | 1980-06-13 | Rhone Poulenc Ind | Procede de preparation de l'acetaldehyde |
| US4233466A (en) * | 1979-11-15 | 1980-11-11 | Union Carbide Corporation | Homologation process for the production of ethanol from methanol |
-
1979
- 1979-07-04 FR FR7917927A patent/FR2460284A1/fr not_active Withdrawn
-
1980
- 1980-06-30 US US06/164,332 patent/US4306091A/en not_active Expired - Lifetime
- 1980-07-01 SU SU802938262A patent/SU1053742A3/ru active
- 1980-07-01 DD DD80222311A patent/DD151743A5/de unknown
- 1980-07-02 DE DE8080420084T patent/DE3060340D1/de not_active Expired
- 1980-07-02 EP EP80420084A patent/EP0022735B1/fr not_active Expired
- 1980-07-02 AT AT80420084T patent/ATE909T1/de not_active IP Right Cessation
- 1980-07-03 JP JP9006680A patent/JPS5625128A/ja active Granted
- 1980-07-03 CA CA000355392A patent/CA1140592A/fr not_active Expired
- 1980-07-03 ES ES493058A patent/ES8102546A1/es not_active Expired
- 1980-07-03 BR BR8004157A patent/BR8004157A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU1053742A3 (ru) | 1983-11-07 |
| US4306091A (en) | 1981-12-15 |
| EP0022735A1 (fr) | 1981-01-21 |
| EP0022735B1 (fr) | 1982-04-28 |
| CA1140592A (fr) | 1983-02-01 |
| FR2460284A1 (fr) | 1981-01-23 |
| JPS5625128A (en) | 1981-03-10 |
| DD151743A5 (de) | 1981-11-04 |
| BR8004157A (pt) | 1981-01-21 |
| ATE909T1 (de) | 1982-05-15 |
| DE3060340D1 (en) | 1982-06-09 |
| ES493058A0 (es) | 1981-02-16 |
| ES8102546A1 (es) | 1981-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6259689B2 (enExample) | ||
| US7947746B2 (en) | Process for the conversion of hydrocarbons into ethanol | |
| US4189441A (en) | Process for preparing esters from ethers or esters of lower homologous alcohols | |
| MXPA96002083A (es) | Proceso para la carbonilacion de alcoholes alquilicos y/o derivados reactivos de los mismos | |
| WO2009077719A1 (en) | Process for the conversion of hydrocarbons to ethanol | |
| WO2009077729A1 (en) | Process for the production of ethanol from a carbonaceous feedstock | |
| US4293718A (en) | Preparation of acetaldehyde | |
| US4659518A (en) | Preparation of carboxylic acids | |
| SA94140676B1 (ar) | طريقة لتحضير احماض كربوكسيلية carboxylin acidsاو استراتها esters المناظرة في وجود حفاز مؤسس على الايريديوم iridium | |
| US4356320A (en) | Preparation of carboxylic acids | |
| US4212989A (en) | Process for producing carboxylic acids or esters thereof | |
| CA2525025C (en) | Carbonylation process using metal-tridentate ligand catalysts | |
| US4324927A (en) | Process for the homologization of methanol | |
| US4133963A (en) | Process for the production of carboxylic acids | |
| JP3766437B2 (ja) | イリジウム存在下のカルボニル化によるカルボン酸類又はそのエステル類の製造 | |
| US4613693A (en) | Process for the co-production of a C2 to C10 monocarboxylic acid and formic acid | |
| JPS60142933A (ja) | 溶媒存在下にメタノ−ル、一酸化炭素および水素を、金属触媒を用いて液相反応させ、エタノ−ルおよび/またはアセトアルデヒドを製造する方法 | |
| JPS6323978B2 (enExample) | ||
| US4483804A (en) | Preparation of carboxylic acid anhydrides | |
| US4396726A (en) | Process for preparing ethylene glycol and lower monohydric alcohols from syn gas using a novel catalyst system | |
| JP2664046B2 (ja) | 炭酸ガスからのアルコール類の製造方法 | |
| JPS59164738A (ja) | エタノ−ルおよび酢酸の製造方法 | |
| JPS645587B2 (enExample) | ||
| JPS6158454B2 (enExample) | ||
| JP2526410B2 (ja) | 炭酸ガスからのアルコ―ルの製造方法 |