JPS6245863B2 - - Google Patents
Info
- Publication number
- JPS6245863B2 JPS6245863B2 JP53087533A JP8753378A JPS6245863B2 JP S6245863 B2 JPS6245863 B2 JP S6245863B2 JP 53087533 A JP53087533 A JP 53087533A JP 8753378 A JP8753378 A JP 8753378A JP S6245863 B2 JPS6245863 B2 JP S6245863B2
- Authority
- JP
- Japan
- Prior art keywords
- cyano
- elemental analysis
- methyl ester
- calculated value
- acid methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 lactam compound Chemical class 0.000 claims description 76
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000002252 acyl group Chemical group 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 5
- 238000000921 elemental analysis Methods 0.000 description 69
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- 238000006243 chemical reaction Methods 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- 238000002844 melting Methods 0.000 description 41
- 230000008018 melting Effects 0.000 description 41
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 150000001875 compounds Chemical class 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 32
- 238000009835 boiling Methods 0.000 description 30
- 239000000243 solution Substances 0.000 description 29
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 239000003054 catalyst Substances 0.000 description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 239000002904 solvent Substances 0.000 description 24
- 239000012046 mixed solvent Substances 0.000 description 22
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 239000002253 acid Substances 0.000 description 20
- 239000007868 Raney catalyst Substances 0.000 description 18
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 18
- 229910000564 Raney nickel Inorganic materials 0.000 description 18
- 238000000034 method Methods 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 125000003118 aryl group Chemical group 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 13
- 238000003756 stirring Methods 0.000 description 13
- 238000002329 infrared spectrum Methods 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 238000004440 column chromatography Methods 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- 239000002585 base Substances 0.000 description 10
- 238000010828 elution Methods 0.000 description 10
- 239000005457 ice water Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- 229910000033 sodium borohydride Inorganic materials 0.000 description 9
- 239000012279 sodium borohydride Substances 0.000 description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 238000006114 decarboxylation reaction Methods 0.000 description 8
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 7
- 150000004702 methyl esters Chemical class 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 230000000949 anxiolytic effect Effects 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 125000004494 ethyl ester group Chemical group 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- UUIQMZJEGPQKFD-UHFFFAOYSA-N Methyl butyrate Chemical compound CCCC(=O)OC UUIQMZJEGPQKFD-UHFFFAOYSA-N 0.000 description 5
- 238000010531 catalytic reduction reaction Methods 0.000 description 5
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 5
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- OBNCKNCVKJNDBV-UHFFFAOYSA-N ethyl butyrate Chemical compound CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- ZRNZFZGNDFKJQE-UHFFFAOYSA-N 4-[(4-chlorophenyl)methyl]pyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1CC1CC(=O)NC1 ZRNZFZGNDFKJQE-UHFFFAOYSA-N 0.000 description 3
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000002249 anxiolytic agent Substances 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- YPZJQKMZORCHGM-UHFFFAOYSA-N diethyl 2-[(4-chlorophenyl)methyl]-2-cyanobutanedioate Chemical compound CCOC(=O)CC(C(=O)OCC)(C#N)CC1=CC=C(Cl)C=C1 YPZJQKMZORCHGM-UHFFFAOYSA-N 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- ONBHFLMLADSRAP-UHFFFAOYSA-N C1(C(C2=CC=CC=C2)C(C(=O)OC)C#N)=CC=CC=C1 Chemical compound C1(C(C2=CC=CC=C2)C(C(=O)OC)C#N)=CC=CC=C1 ONBHFLMLADSRAP-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- YJKHWSILAPKSED-UHFFFAOYSA-N dimethyl 2-cyano-2-[(2,4-dichlorophenyl)methyl]butanedioate Chemical compound COC(=O)CC(C(=O)OC)(C#N)CC1=CC=C(Cl)C=C1Cl YJKHWSILAPKSED-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- FHHMWJMUMOYGQW-UHFFFAOYSA-N ethyl 2-oxopyrrolidine-3-carboxylate Chemical compound CCOC(=O)C1CCNC1=O FHHMWJMUMOYGQW-UHFFFAOYSA-N 0.000 description 2
- CLLUFLLBRNCOLB-UHFFFAOYSA-N ethyl 2-phenylbutanoate Chemical compound CCOC(=O)C(CC)C1=CC=CC=C1 CLLUFLLBRNCOLB-UHFFFAOYSA-N 0.000 description 2
- GNRRBSSSYWKZLP-UHFFFAOYSA-N ethyl 3-(4-chlorophenyl)-2-cyanopropanoate Chemical compound CCOC(=O)C(C#N)CC1=CC=C(Cl)C=C1 GNRRBSSSYWKZLP-UHFFFAOYSA-N 0.000 description 2
- MPEUOPWWEODARH-UHFFFAOYSA-N ethyl pyrrolidine-3-carboxylate Chemical compound CCOC(=O)C1CCNC1 MPEUOPWWEODARH-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- KDJRXKZBSUJYJD-UHFFFAOYSA-N methyl 4-(2-chlorophenyl)-3-cyanobutanoate Chemical compound COC(=O)CC(C#N)CC1=CC=CC=C1Cl KDJRXKZBSUJYJD-UHFFFAOYSA-N 0.000 description 2
- QPFJJESIVZVCHQ-UHFFFAOYSA-N methyl 4-(3-chlorophenyl)-3-cyanobutanoate Chemical compound COC(=O)CC(C#N)CC1=CC=CC(Cl)=C1 QPFJJESIVZVCHQ-UHFFFAOYSA-N 0.000 description 2
- YKFLJYAKACCWMH-UHFFFAOYSA-N methyl piperidine-1-carboxylate Chemical compound COC(=O)N1CCCCC1 YKFLJYAKACCWMH-UHFFFAOYSA-N 0.000 description 2
- 231100000668 minimum lethal dose Toxicity 0.000 description 2
- 230000001272 neurogenic effect Effects 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000005425 toluyl group Chemical group 0.000 description 2
- 150000003673 urethanes Chemical class 0.000 description 2
- SIFCHNIAAPMMKG-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) acetate Chemical compound CC(=O)ON1C(=O)CCC1=O SIFCHNIAAPMMKG-UHFFFAOYSA-N 0.000 description 1
- YBADLXQNJCMBKR-UHFFFAOYSA-M (4-nitrophenyl)acetate Chemical compound [O-]C(=O)CC1=CC=C([N+]([O-])=O)C=C1 YBADLXQNJCMBKR-UHFFFAOYSA-M 0.000 description 1
- QWZONZYNHJSSDY-UHFFFAOYSA-N 1-bromo-n,n-dimethylmethanamine Chemical compound CN(C)CBr QWZONZYNHJSSDY-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-chloropentane Chemical compound CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 1
- VWCCXXIHYWIBTD-UHFFFAOYSA-N 1-iodo-n,n-dimethylmethanamine Chemical compound CN(C)CI VWCCXXIHYWIBTD-UHFFFAOYSA-N 0.000 description 1
- CWYRBOMWOQXYFZ-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-phenylethanone Chemical compound C1=CC(F)=CC=C1CC(=O)C1=CC=CC=C1 CWYRBOMWOQXYFZ-UHFFFAOYSA-N 0.000 description 1
- FICQFRCPSFCFBY-UHFFFAOYSA-N 2-[bis(methylsulfanyl)methylidene]propanedinitrile Chemical compound CSC(SC)=C(C#N)C#N FICQFRCPSFCFBY-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- UPSXAPQYNGXVBF-UHFFFAOYSA-N 2-bromobutane Chemical compound CCC(C)Br UPSXAPQYNGXVBF-UHFFFAOYSA-N 0.000 description 1
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 description 1
- ZRWYNFMELXNSCF-UHFFFAOYSA-N 2-cyano-3,3-diphenylpropanoic acid Chemical compound C=1C=CC=CC=1C(C(C#N)C(=O)O)C1=CC=CC=C1 ZRWYNFMELXNSCF-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- BZQGAPWJKAYCHR-UHFFFAOYSA-N 3,3-diphenylpropanoic acid Chemical compound C=1C=CC=CC=1C(CC(=O)O)C1=CC=CC=C1 BZQGAPWJKAYCHR-UHFFFAOYSA-N 0.000 description 1
- KSLANAUEYUSFCF-UHFFFAOYSA-N 3-(2-chlorophenyl)-2-cyanopropanoic acid Chemical compound OC(=O)C(C#N)CC1=CC=CC=C1Cl KSLANAUEYUSFCF-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- FAERJKNGNOGLAA-UHFFFAOYSA-N 4-[(2,4-dichlorophenyl)methyl]pyrrolidin-2-one Chemical compound ClC1=CC(Cl)=CC=C1CC1CC(=O)NC1 FAERJKNGNOGLAA-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 206010003840 Autonomic nervous system imbalance Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- YFVYYDDQGHARAJ-UHFFFAOYSA-N COC(C(C)C1=CC(=C(C(=C1)OC)OC)OC)=O Chemical compound COC(C(C)C1=CC(=C(C(=C1)OC)OC)OC)=O YFVYYDDQGHARAJ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 208000000059 Dyspnea Diseases 0.000 description 1
- 206010013975 Dyspnoeas Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 201000009053 Neurodermatitis Diseases 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 208000012545 Psychophysiologic disease Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- 206010047700 Vomiting Diseases 0.000 description 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 1
- CZCSLHYZEQSUNV-UHFFFAOYSA-N [Na].OB(O)O Chemical compound [Na].OB(O)O CZCSLHYZEQSUNV-UHFFFAOYSA-N 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000000397 acetylating effect Effects 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 208000004631 alopecia areata Diseases 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000001253 anti-conflict Effects 0.000 description 1
- 229940005530 anxiolytics Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 229940049706 benzodiazepine Drugs 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- AQNQQHJNRPDOQV-UHFFFAOYSA-N bromocyclohexane Chemical compound BrC1CCCCC1 AQNQQHJNRPDOQV-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- NDTCXABJQNJPCF-UHFFFAOYSA-N chlorocyclopentane Chemical compound ClC1CCCC1 NDTCXABJQNJPCF-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005261 decarburization Methods 0.000 description 1
- HKHAVDZWQZQLKZ-UHFFFAOYSA-N diethyl 2-[(4-chlorophenyl)methyl]-2-cyanopentanedioate Chemical compound CCOC(=O)CCC(C(=O)OCC)(C#N)CC1=CC=C(Cl)C=C1 HKHAVDZWQZQLKZ-UHFFFAOYSA-N 0.000 description 1
- LSEQZDQVPACRSO-UHFFFAOYSA-N diethyl 2-benzyl-3-cyanobutanedioate Chemical compound C(C1=CC=CC=C1)C(C(=O)OCC)C(C(=O)OCC)C#N LSEQZDQVPACRSO-UHFFFAOYSA-N 0.000 description 1
- VQAZCUCWHIIFGE-UHFFFAOYSA-N diethyl 2-ethylpropanedioate Chemical compound CCOC(=O)C(CC)C(=O)OCC VQAZCUCWHIIFGE-UHFFFAOYSA-N 0.000 description 1
- GRRSDGHTSMJICM-UHFFFAOYSA-N diethyl 2-propylpropanedioate Chemical compound CCOC(=O)C(CCC)C(=O)OCC GRRSDGHTSMJICM-UHFFFAOYSA-N 0.000 description 1
- 125000006264 diethylaminomethyl group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- XQVVYKKDZMLQJY-UHFFFAOYSA-N dimethyl 2-[(2-chlorophenyl)methyl]-2-cyanobutanedioate Chemical compound COC(=O)CC(C(=O)OC)(C#N)CC1=CC=CC=C1Cl XQVVYKKDZMLQJY-UHFFFAOYSA-N 0.000 description 1
- HXCPSWUDBVSUBQ-UHFFFAOYSA-N dimethyl 2-[(3-chlorophenyl)methyl]-2-cyanobutanedioate Chemical compound COC(=O)CC(C(=O)OC)(C#N)CC1=CC=CC(Cl)=C1 HXCPSWUDBVSUBQ-UHFFFAOYSA-N 0.000 description 1
- XGRMVENQJLQMLT-UHFFFAOYSA-N dimethyl 2-ethylpropanedioate Chemical compound COC(=O)C(CC)C(=O)OC XGRMVENQJLQMLT-UHFFFAOYSA-N 0.000 description 1
- GQTSAGKZHIWKMR-UHFFFAOYSA-N dimethyl 2-propylpropanedioate Chemical compound CCCC(C(=O)OC)C(=O)OC GQTSAGKZHIWKMR-UHFFFAOYSA-N 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 206010015037 epilepsy Diseases 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- YZOIWGNICQUCDP-UHFFFAOYSA-N ethyl 2,2-diphenylbutanoate Chemical compound C=1C=CC=CC=1C(CC)(C(=O)OCC)C1=CC=CC=C1 YZOIWGNICQUCDP-UHFFFAOYSA-N 0.000 description 1
- SHNGGERFLIACMS-UHFFFAOYSA-N ethyl 2-cyano-3,3-diphenylpropanoate Chemical compound C=1C=CC=CC=1C(C(C#N)C(=O)OCC)C1=CC=CC=C1 SHNGGERFLIACMS-UHFFFAOYSA-N 0.000 description 1
- KJKGDEVERRGVFA-UHFFFAOYSA-N ethyl 2-cyano-3-(4-methoxyphenyl)prop-2-enoate Chemical compound CCOC(=O)C(C#N)=CC1=CC=C(OC)C=C1 KJKGDEVERRGVFA-UHFFFAOYSA-N 0.000 description 1
- KKIZDEFOEGGSKX-UHFFFAOYSA-N ethyl 2-cyano-3-(4-methylphenyl)prop-2-enoate Chemical compound CCOC(=O)C(C#N)=CC1=CC=C(C)C=C1 KKIZDEFOEGGSKX-UHFFFAOYSA-N 0.000 description 1
- UTUVIKZNQWNGIM-UHFFFAOYSA-N ethyl 2-phenylpropanoate Chemical compound CCOC(=O)C(C)C1=CC=CC=C1 UTUVIKZNQWNGIM-UHFFFAOYSA-N 0.000 description 1
- ILTRCHMHGZQVGO-UHFFFAOYSA-N ethyl 3-(2-chlorophenyl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CC=CC=C1Cl ILTRCHMHGZQVGO-UHFFFAOYSA-N 0.000 description 1
- ROEZPXRDTJGAAN-UHFFFAOYSA-N ethyl 3-(3-chlorophenyl)prop-2-enoate Chemical compound CCOC(=O)C=CC1=CC=CC(Cl)=C1 ROEZPXRDTJGAAN-UHFFFAOYSA-N 0.000 description 1
- FQTIYMRSUOADDK-UHFFFAOYSA-N ethyl 3-bromopropanoate Chemical compound CCOC(=O)CCBr FQTIYMRSUOADDK-UHFFFAOYSA-N 0.000 description 1
- GJRHDKLNYOFTLF-UHFFFAOYSA-N ethyl 4,4-diphenylbutanoate Chemical compound CCOC(=O)CCC(C1=CC=CC=C1)C1=CC=CC=C1 GJRHDKLNYOFTLF-UHFFFAOYSA-N 0.000 description 1
- ASDRWNXVONVWHF-UHFFFAOYSA-N ethyl 5-(4-chlorophenyl)-4-cyanopentanoate Chemical compound CCOC(=O)CCC(C#N)CC1=CC=C(Cl)C=C1 ASDRWNXVONVWHF-UHFFFAOYSA-N 0.000 description 1
- WGTHNNRORWFTFA-UHFFFAOYSA-N ethyl pyrrolidine-1-carboxylate Chemical compound CCOC(=O)N1CCCC1 WGTHNNRORWFTFA-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- DUMQFLGJMUWUPV-UHFFFAOYSA-N methyl 2-(3,4-dimethoxyphenyl)propanoate Chemical compound COC(=O)C(C)C1=CC=C(OC)C(OC)=C1 DUMQFLGJMUWUPV-UHFFFAOYSA-N 0.000 description 1
- HXAWDXPVCGWKBG-UHFFFAOYSA-N methyl 2-cyano-2-(2,4-dichlorophenyl)propanoate Chemical compound COC(=O)C(C)(C#N)C1=CC=C(Cl)C=C1Cl HXAWDXPVCGWKBG-UHFFFAOYSA-N 0.000 description 1
- BFDDWABERUPPIN-UHFFFAOYSA-N methyl 2-oxopyrrolidine-3-carboxylate Chemical compound COC(=O)C1CCNC1=O BFDDWABERUPPIN-UHFFFAOYSA-N 0.000 description 1
- XXPZOLSJXFGKEL-UHFFFAOYSA-N methyl 3-(3-chlorophenyl)-2-cyanopropanoate Chemical compound COC(=O)C(C#N)CC1=CC=CC(Cl)=C1 XXPZOLSJXFGKEL-UHFFFAOYSA-N 0.000 description 1
- KLYMNPBSAKBGGR-UHFFFAOYSA-N methyl 3-cyano-4-(2,4-dichlorophenyl)butanoate Chemical compound COC(=O)CC(C#N)CC1=CC=C(Cl)C=C1Cl KLYMNPBSAKBGGR-UHFFFAOYSA-N 0.000 description 1
- RWYCVUAUOUCQAN-UHFFFAOYSA-N methyl 4-(4-methylphenyl)butanoate Chemical compound COC(=O)CCCC1=CC=C(C)C=C1 RWYCVUAUOUCQAN-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- VVWWZOKQKXPVIV-UHFFFAOYSA-N methyl pyrrolidine-3-carboxylate Chemical compound COC(=O)C1CCNC1 VVWWZOKQKXPVIV-UHFFFAOYSA-N 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- BEPINZGLNNOOIJ-UHFFFAOYSA-N n-(bromomethyl)-n-ethylethanamine Chemical compound CCN(CC)CBr BEPINZGLNNOOIJ-UHFFFAOYSA-N 0.000 description 1
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N ortho-diethylbenzene Natural products CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- JOGJKIHLHQDIOG-UHFFFAOYSA-N phenyl acetate hydrobromide Chemical compound CC(=O)OC1=CC=CC=C1.Br JOGJKIHLHQDIOG-UHFFFAOYSA-N 0.000 description 1
- IFXDDAVRUDKPBW-UHFFFAOYSA-N phenyl acetate;hydrochloride Chemical compound Cl.CC(=O)OC1=CC=CC=C1 IFXDDAVRUDKPBW-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- RIBFXMJCUYXJDZ-UHFFFAOYSA-N propanoyl bromide Chemical compound CCC(Br)=O RIBFXMJCUYXJDZ-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229940090181 propyl acetate Drugs 0.000 description 1
- QQKDTTWZXHEGAQ-UHFFFAOYSA-N propyl carbonochloridate Chemical compound CCCOC(Cl)=O QQKDTTWZXHEGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- YCCNXDYQSTZKFU-UHFFFAOYSA-N tert-butyl 3,3-diphenylpropanoate Chemical compound C=1C=CC=CC=1C(CC(=O)OC(C)(C)C)C1=CC=CC=C1 YCCNXDYQSTZKFU-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000000472 traumatic effect Effects 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (9)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP8753378A JPS5515432A (en) | 1978-07-17 | 1978-07-17 | Lactam compound |
AU40242/78A AU518986B2 (en) | 1977-10-11 | 1978-09-27 | Lactams |
DK439878A DK439878A (da) | 1977-10-11 | 1978-10-04 | Fremgangsmaade til fremstilling af laktamforbindelser |
CA312,844A CA1102338A (en) | 1977-10-11 | 1978-10-06 | Lactam compounds |
DE7878101094T DE2861210D1 (en) | 1977-10-11 | 1978-10-07 | Lactam compounds and methods for their preparation |
EP78101094A EP0001601B1 (en) | 1977-10-11 | 1978-10-07 | Lactam compounds and methods for their preparation |
IT28617/78A IT1099358B (it) | 1977-10-11 | 1978-10-10 | Composti lattamici ad azione ansiolitica |
NO783420A NO150041C (no) | 1977-10-11 | 1978-10-10 | Analogifremgangsmaate ved fremstilling av nye, terapeutisk aktive lactamforbindelser |
US05/950,524 US4198514A (en) | 1977-10-11 | 1978-10-11 | Lactam compounds |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP8753378A JPS5515432A (en) | 1978-07-17 | 1978-07-17 | Lactam compound |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS5515432A JPS5515432A (en) | 1980-02-02 |
JPS6245863B2 true JPS6245863B2 (cs) | 1987-09-29 |
Family
ID=13917619
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP8753378A Granted JPS5515432A (en) | 1977-10-11 | 1978-07-17 | Lactam compound |
Country Status (1)
Country | Link |
---|---|
JP (1) | JPS5515432A (cs) |
-
1978
- 1978-07-17 JP JP8753378A patent/JPS5515432A/ja active Granted
Also Published As
Publication number | Publication date |
---|---|
JPS5515432A (en) | 1980-02-02 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE69319235T2 (de) | Perhydroisoindole derivate als substanz p antagonisten | |
DE69323768T2 (de) | Pyrrolopyrimidine als crf antagonisten | |
FI93007C (fi) | Menetelmä terapeuttisesti käyttökelpoisten substituoitujen pyridiinien valmistamiseksi sekä menetelmässä käyttökelpoiset välituotteet | |
DE69534164T2 (de) | Tri-substituierte phenyl-derivate verwendbar als pde iv hemmer | |
CA1077947A (en) | Process for the preparation of pyrrolidine derivatives | |
JP2558086B2 (ja) | 縮合ピリジン化合物類の製造方法 | |
DE69021823T2 (de) | 3-Aryl-Oxazolidinone, Verfahren zu ihrer Herstellung und ihre Anwendung in der Therapie. | |
EP0267111A1 (fr) | Imidazopyridines, leur préparation et leur application en thérapeutique | |
JPS5989679A (ja) | ピラゾロ〔3,4−b〕ピリジン誘導体類およびそれらの製造法 | |
DE3855017T2 (de) | Verfahren zur Herstellung von kondensierten Pyridinverbindungen | |
JP2007513120A (ja) | ピロール化合物 | |
JPS59130863A (ja) | 5―ビニル―2―ピロリジノンの製法 | |
JPH021478A (ja) | 二置換ピリジン類 | |
KR102790605B1 (ko) | 항염증 화합물 및 이의 제조와 응용 | |
US5728709A (en) | Alkyl and aralkyl-substituted pyrrolocarbazole derivatives that stimulate platelet production | |
JP3111321B2 (ja) | 縮合チアゾール化合物 | |
DE3739882A1 (de) | Substituierte hydroxylamine | |
WO1997025312A1 (de) | NEUE ROLIPRAM DERIVATE ALS cAMP-PDE IV-INHIBITOREN | |
EP0068386B1 (de) | Substituierte Imidazo(1,5-a)pyridine, Verfahren zu ihrer Herstellung und pharmazeutische Präparate die diese Verbindungen enthalten | |
EP0114572A1 (de) | Substituierte Imidazo(1,5-a)pyridine | |
JPS6245863B2 (cs) | ||
WO2002072567A2 (en) | Heterocyclic compounds, process for their preparation and pharmaceutical compositions containing them | |
KR20100117142A (ko) | Hdl-콜레스테롤 상승제로서 2-트라이플루오로메틸니코틴아미드 유도체 | |
JPH04244083A (ja) | 三環状ピリドン誘導体 | |
US4294969A (en) | Process for producing 2-bromo-3,5-disubstituted pyridines |