JPS6243455B2 - - Google Patents
Info
- Publication number
- JPS6243455B2 JPS6243455B2 JP54133670A JP13367079A JPS6243455B2 JP S6243455 B2 JPS6243455 B2 JP S6243455B2 JP 54133670 A JP54133670 A JP 54133670A JP 13367079 A JP13367079 A JP 13367079A JP S6243455 B2 JPS6243455 B2 JP S6243455B2
- Authority
- JP
- Japan
- Prior art keywords
- general formula
- weight
- proportion
- polymer
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 66
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 44
- 150000004985 diamines Chemical class 0.000 claims description 36
- 229920000642 polymer Polymers 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 9
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- FVUKYCZRWSQGAS-UHFFFAOYSA-N 3-carbamoylbenzoic acid Chemical class NC(=O)C1=CC=CC(C(O)=O)=C1 FVUKYCZRWSQGAS-UHFFFAOYSA-N 0.000 claims 1
- 150000001555 benzenes Chemical class 0.000 claims 1
- 150000003504 terephthalic acids Chemical class 0.000 claims 1
- 150000003839 salts Chemical class 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 238000009835 boiling Methods 0.000 description 15
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 11
- 230000009477 glass transition Effects 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 239000004952 Polyamide Substances 0.000 description 5
- -1 aliphatic diamines Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000006068 polycondensation reaction Methods 0.000 description 4
- JWAGOKOJCIHYQM-UHFFFAOYSA-N 1,2-diazacyclododeca-1,5,9-triene Chemical compound C1CC=CCCN=NCCC=C1 JWAGOKOJCIHYQM-UHFFFAOYSA-N 0.000 description 3
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910001873 dinitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- SXIFNAOBIAIYJO-SXVCMZJPSA-N (1E,3E,7E)-cyclododeca-1,3,7-triene Chemical compound C/1=C\CCCC\C=C\C=C\CC\1 SXIFNAOBIAIYJO-SXVCMZJPSA-N 0.000 description 2
- BAWANJQNDLVTKB-UHFFFAOYSA-N 1,2-diazacyclododecene Chemical compound C1CCCCCN=NCCCC1 BAWANJQNDLVTKB-UHFFFAOYSA-N 0.000 description 2
- IGSBHTZEJMPDSZ-UHFFFAOYSA-N 4-[(4-amino-3-methylcyclohexyl)methyl]-2-methylcyclohexan-1-amine Chemical compound C1CC(N)C(C)CC1CC1CC(C)C(N)CC1 IGSBHTZEJMPDSZ-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- ZOLLIQAKMYWTBR-RYMQXAEESA-N cyclododecatriene Chemical compound C/1C\C=C\CC\C=C/CC\C=C\1 ZOLLIQAKMYWTBR-RYMQXAEESA-N 0.000 description 2
- FHESUNXRPBHDQM-UHFFFAOYSA-N diphenyl benzene-1,3-dicarboxylate Chemical compound C=1C=CC(C(=O)OC=2C=CC=CC=2)=CC=1C(=O)OC1=CC=CC=C1 FHESUNXRPBHDQM-UHFFFAOYSA-N 0.000 description 2
- HPGJOUYGWKFYQW-UHFFFAOYSA-N diphenyl benzene-1,4-dicarboxylate Chemical compound C=1C=C(C(=O)OC=2C=CC=CC=2)C=CC=1C(=O)OC1=CC=CC=C1 HPGJOUYGWKFYQW-UHFFFAOYSA-N 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- AZCPJRSLLFDOJD-UHFFFAOYSA-N 1,2-diazacyclododecane Chemical compound C1CCCCCNNCCCC1 AZCPJRSLLFDOJD-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- PWZDPZJKJOWSJS-UHFFFAOYSA-N 3,12-dihexyl-1,2-diazacyclododecene Chemical compound CCCCCCC1CCCCCCCCC(CCCCCC)N=N1 PWZDPZJKJOWSJS-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- HYPABJGVBDSCIT-UPHRSURJSA-N cyclododecene Chemical compound C1CCCCC\C=C/CCCC1 HYPABJGVBDSCIT-UPHRSURJSA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- UXWHXEQADOLPLB-UHFFFAOYSA-N docosane-7,16-diamine Chemical compound CCCCCCC(N)CCCCCCCCC(N)CCCCCC UXWHXEQADOLPLB-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/265—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from at least two different diamines or at least two different dicarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1077378 | 1978-10-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5556127A JPS5556127A (en) | 1980-04-24 |
| JPS6243455B2 true JPS6243455B2 (enExample) | 1987-09-14 |
Family
ID=4366719
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP13367079A Granted JPS5556127A (en) | 1978-10-18 | 1979-10-18 | Transparent copolyamide*its manufacture and molded body made thereof |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4258177A (enExample) |
| EP (1) | EP0010522B1 (enExample) |
| JP (1) | JPS5556127A (enExample) |
| CA (1) | CA1129589A (enExample) |
| DE (1) | DE2963549D1 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3789362T2 (de) * | 1986-12-09 | 1994-06-23 | Mitsubishi Chem Ind | Durchsichtiges Copolyamid. |
| US6297345B1 (en) | 1999-05-27 | 2001-10-02 | Ube Industries, Ltd. | Polyamide having excellent stretching properties |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3563959A (en) * | 1966-06-25 | 1971-02-16 | Dynamit Nobel Ag | Process for the production of transparent polyamides which are resistant to boiling |
| CH498893A (de) * | 1967-11-02 | 1970-11-15 | Dynamit Nobel Ag | Verfahren zur Herstellung transparenter, kochbeständiger Polyamide |
| GB1410007A (en) * | 1971-09-15 | 1975-10-15 | Bp Chem Int Ltd | Polyamide |
| CH624970A5 (en) * | 1975-09-22 | 1981-08-31 | Inventa Ag | Process for the preparation of glass-transparent polyamide |
| US4097469A (en) * | 1976-04-15 | 1978-06-27 | Phillips Petroleum Company | Process for preparing polyamides of PACP |
-
1979
- 1979-10-09 US US06/083,144 patent/US4258177A/en not_active Expired - Lifetime
- 1979-10-12 EP EP79810127A patent/EP0010522B1/de not_active Expired
- 1979-10-12 DE DE7979810127T patent/DE2963549D1/de not_active Expired
- 1979-10-16 CA CA337,699A patent/CA1129589A/en not_active Expired
- 1979-10-18 JP JP13367079A patent/JPS5556127A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| EP0010522A1 (de) | 1980-04-30 |
| CA1129589A (en) | 1982-08-10 |
| US4258177A (en) | 1981-03-24 |
| EP0010522B1 (de) | 1982-08-11 |
| JPS5556127A (en) | 1980-04-24 |
| DE2963549D1 (en) | 1982-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2415156C2 (ru) | Полукристаллический полуароматический полиамид | |
| EP0201434B1 (fr) | Copolyétheramides techniques souples à basse température | |
| FR2575756A1 (fr) | Procede de preparation de copolyamides transparents et leur utilisation pour la fabrication d'objets moules | |
| JPH0412293B2 (enExample) | ||
| US4072665A (en) | Polyamide from arylene diamine, isophthalic acid and alkylene dicarboxylic acid | |
| US3787371A (en) | Crystal-clear polyamides prepared by condensing bis(aminomethyl)-tricyclo-decane with aromatic dicarboxylic acids | |
| JPH04233943A (ja) | 無定形コポリアミドおよびその製造方法ならびに成形品の製造方法 | |
| EP3205687B1 (en) | Method for producing polyamide resin | |
| US4410684A (en) | Aromatic copolyamides containing ether linkages | |
| JPS6243455B2 (enExample) | ||
| US4225701A (en) | Crystalline polyamides from branched chain diamine and terephthalic acid | |
| JPS6243456B2 (enExample) | ||
| JPS582329A (ja) | 透明なポリアミド類、その製造方法およびそれからなる成型品 | |
| US4195164A (en) | Transparent polyamides | |
| US4210742A (en) | Transparent polyamides from branched chain diamine | |
| US4205159A (en) | Transparent polyamides from PACM and a mixture of dicarboxylic acids | |
| US4210743A (en) | Transparent polyamides from branched chain diamines | |
| US4062828A (en) | Flame resistant polyamide moulding compositions | |
| JPH0132850B2 (enExample) | ||
| FR2692272A1 (fr) | Nouveaux polyamides cristallins à point de fusion élevé. | |
| US4178432A (en) | Copolyoxalamide from branched chain diamine | |
| US4202961A (en) | Transparent polyamide from aromatic dicarboxylic acid and disubstituted decane diamine | |
| JPH0219846B2 (enExample) | ||
| JPS63268763A (ja) | ポリアミド樹脂組成物 | |
| CA1120191A (en) | Transparent polyamides |